diff --git a/www/css/dashboard.css b/www/css/dashboard.css new file mode 100644 index 0000000..e92d484 --- /dev/null +++ b/www/css/dashboard.css @@ -0,0 +1,58 @@ +.portlet { margin-bottom: 20px; -moz-box-shadow: 1px 1px 2px #ccc; -webkit-box-shadow: 1px 1px 2px #ccc; box-shadow: 1px 1px 2px #ccc; } +.portlet-header { font-size: 12px; text-transform: uppercase; color: #fff; font-weight: normal; text-shadow: 1px 1px #4b6592; } +.portlet-header { -moz-border-radius: 3px 3px 0 0; -webkit-border-radius: 3px 3px 0 0; border-radius: 3px 3px 0 0; } +.portlet-header { border: 1px solid #6082ad; background: #688ab5 url(../images/titlebg.png) repeat-x top left; } +.portlet-header { display: block; padding: 10px 15px; } +.portlet-content { background: #fcfcfc; padding: 20px 15px; color: #666; overflow: hidden; border: 1px solid #ccc; border-top: 0; } +.portlet-content { -moz-border-radius: 0 0 3px 3px; -webkit-border-radius: 0 0 3px 3px; border-radius: 0 0 3px 3px; } + +.portlet-content p { margin: 5px 0; } +.portlet-content p:first-child { margin-top: 0; } +.portlet-content label { display: block; padding: 0; width: 120px; margin-right: 15px; float: left; } + +.portlet-header .ui-icon { background-repeat: no-repeat; display: block; overflow: hidden; text-indent: -99999px; } +.portlet-header .ui-icon { float: right; margin-top: -10px; width: 43px; height: 41px; } +.portlet-header .ui-icon:first-of-type { margin-right: -15px; } + +.portlet-header .ui-icon { display: none !important; } +.portlet-header .ui-icon.display {display: block !important; } + +.portlet-header .ui-icon.icon-vis { background: url(../images/toggle.png) no-repeat center center; } +.portlet-header .ui-icon.icon-close { background: url(../images/toggle.png) no-repeat center center; } + + + +.ui-sortable-placeholder { border: 1px dotted black; visibility: visible !important; height: 50px !important; } +.ui-sortable-placeholder * { visibility: hidden; } +/*.portlet-content { + max-height:400px; + _height:expression(this.scrollHeight>199?"200px":"auto"); + overflow:auto; + background-color: #F2F5F7; +}*/ + +#dash-header{margin-bottom: 5px; padding: 3px} +#dash-header div{float: left;} +#menu2{float:left;} + +.dash-sing-col-content{ + width: 920px; float: left; padding-bottom: 10px; +} + +/***MAIN CONTENT: WIDGET BOX (dashboard.html)***/ +/*.widgetbox h3 span { padding: 10px 15px; display: block; } +.widgetbox h3.arrow span { background: url(../images/toggle.png) no-repeat right center; } +.widgetbox .content p { margin: 5px auto; } +.widgetbox .content p:first-child { margin-top: 0; } + +.widgetbox2 { margin-bottom: 20px; -moz-box-shadow: 1px 1px 2px #ddd; -webkit-box-shadow: 1px 1px 2px #ddd; box-shadow: 1px 1px 2px #ddd; } +.widgetbox2 h3 { font-size: 12px; color: #333; font-weight: normal; text-shadow: 1px 1px #fff; } +.widgetbox2 h3 { -moz-border-radius: 3px 3px 0 0; -webkit-border-radius: 3px 3px 0 0; border-radius: 3px 3px 0 0; } +.widgetbox2 h3 { border: 1px solid #ddd; background: #eee url(../images/thead.png) repeat-x top left; } +.widgetbox2 h3 span { padding: 10px 15px; display: block; } +.widgetbox2 h3.arrow span { background: url(../images/toggle2.png) no-repeat right center; } +.widgetbox2 .content { background: #fcfcfc; padding: 20px 15px; color: #666; overflow: hidden; border: 1px solid #ddd; border-top: 0; } +.widgetbox2 .content { -moz-border-radius: 0 0 3px 3px; -webkit-border-radius: 0 0 3px 3px; border-radius: 0 0 3px 3px; } +.widgetbox2 .content p { margin: 5px 0; } +.widgetbox2 .content p:first-child { margin-top: 0; } +.widgetbox2 .content label { display: block; padding: 0; width: 120px; margin-right: 15px; float: left; }*/ \ No newline at end of file diff --git a/www/css/style.css b/www/css/style.css index 315d3b8..58cb0c4 100644 --- a/www/css/style.css +++ b/www/css/style.css @@ -10,6 +10,7 @@ @import url('plugins/jquery.alerts.css'); @import url('plugins/fullcalendar.css'); +@import url('dashboard.css'); @import url('custom.css'); html, body, div, span, applet, object, iframe, @@ -308,30 +309,6 @@ button.button:hover, .button:active { background-position: 0 -39px; } .button_lblue { border: 1px solid #7197bd; background: #333 url(../images/buttons/button_lblue.png) repeat-x top left; text-shadow: 1px 1px #fff; color: #2161a0; } .button_lblue:active { -moz-box-shadow: inset 2px 2px 2px #7197bd; -webkit-box-shadow: inset 2px 2px 2px #7197bd; box-shadow: inset 2px 2px 2px #7197bd; } -/***MAIN CONTENT: WIDGET BOX (dashboard.html)***/ -.widgetbox { margin-bottom: 20px; -moz-box-shadow: 1px 1px 2px #ccc; -webkit-box-shadow: 1px 1px 2px #ccc; box-shadow: 1px 1px 2px #ccc; } -.widgetbox h3 { font-size: 12px; text-transform: uppercase; color: #fff; font-weight: normal; text-shadow: 1px 1px #4b6592; } -.widgetbox h3 { -moz-border-radius: 3px 3px 0 0; -webkit-border-radius: 3px 3px 0 0; border-radius: 3px 3px 0 0; } -.widgetbox h3 { border: 1px solid #6082ad; background: #688ab5 url(../images/titlebg.png) repeat-x top left; } -.widgetbox h3 span { padding: 10px 15px; display: block; } -.widgetbox h3.arrow span { background: url(../images/toggle.png) no-repeat right center; } -.widgetbox .content { background: #fcfcfc; padding: 20px 15px; color: #666; overflow: hidden; border: 1px solid #ccc; border-top: 0; } -.widgetbox .content { -moz-border-radius: 0 0 3px 3px; -webkit-border-radius: 0 0 3px 3px; border-radius: 0 0 3px 3px; } -.widgetbox .content p { margin: 5px auto; } -.widgetbox .content p:first-child { margin-top: 0; } - -.widgetbox2 { margin-bottom: 20px; -moz-box-shadow: 1px 1px 2px #ddd; -webkit-box-shadow: 1px 1px 2px #ddd; box-shadow: 1px 1px 2px #ddd; } -.widgetbox2 h3 { font-size: 12px; color: #333; font-weight: normal; text-shadow: 1px 1px #fff; } -.widgetbox2 h3 { -moz-border-radius: 3px 3px 0 0; -webkit-border-radius: 3px 3px 0 0; border-radius: 3px 3px 0 0; } -.widgetbox2 h3 { border: 1px solid #ddd; background: #eee url(../images/thead.png) repeat-x top left; } -.widgetbox2 h3 span { padding: 10px 15px; display: block; } -.widgetbox2 h3.arrow span { background: url(../images/toggle2.png) no-repeat right center; } -.widgetbox2 .content { background: #fcfcfc; padding: 20px 15px; color: #666; overflow: hidden; border: 1px solid #ddd; border-top: 0; } -.widgetbox2 .content { -moz-border-radius: 0 0 3px 3px; -webkit-border-radius: 0 0 3px 3px; border-radius: 0 0 3px 3px; } -.widgetbox2 .content p { margin: 5px 0; } -.widgetbox2 .content p:first-child { margin-top: 0; } -.widgetbox2 .content label { display: block; padding: 0; width: 120px; margin-right: 15px; float: left; } - /***PROGRESS BAR (dashboard.html)***/ .progress { margin: 5px 0; } .progress .bar { background: #ddd; -moz-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; padding: 2px; } diff --git a/www/js/custom/dashboard.js b/www/js/custom/dashboard.js index f59fa3b..fdc2a8b 100644 --- a/www/js/custom/dashboard.js +++ b/www/js/custom/dashboard.js @@ -1,85 +1,126 @@ - jQuery(document).ready(function () { - - - //////////// CHARTS ///////////////// - var flash = [], html5 = []; - for (var i = 0; i < 14; i += 0.5) { - flash.push([i, Math.sin(i)]); - html5.push([i, Math.cos(i)]); - } - - function showTooltip(x, y, contents) { - jQuery('
' + contents + '
').css( { - position: 'absolute', - display: 'none', - top: y + 5, - left: x + 5 - }).appendTo("body").fadeIn(200); - } +jQuery(document).ready(function () { + function showTooltip(x, y, contents) { + jQuery('
' + contents + '
').css( { + position: 'absolute', + display: 'none', + top: y + 5, + left: x + 5 + }).appendTo("body").fadeIn(200); + } + //////////// TABS ///////////////// + jQuery( "#tabs" ).tabs(); - var plot = jQuery.plot(jQuery("#chartplace"), - [ { data: flash, label: "Flash(x)", color: "#069"}, { data: html5, label: "HTML5(x)", color: "#ff0000"} ], { - series: { - lines: { show: true }, - points: { show: true } - }, - grid: { hoverable: true, clickable: true }, - yaxis: { min: -1.2, max: 1.2 } - }); - - var previousPoint = null; - jQuery("#chartplace").bind("plothover", function (event, pos, item) { - jQuery("#x").text(pos.x.toFixed(2)); - jQuery("#y").text(pos.y.toFixed(2)); - - if(item) { - if (previousPoint != item.dataIndex) { - previousPoint = item.dataIndex; - - jQuery("#tooltip").remove(); - var x = item.datapoint[0].toFixed(2), - y = item.datapoint[1].toFixed(2); - - showTooltip(item.pageX, item.pageY, - item.series.label + " of " + x + " = " + y); - } - } - else { - jQuery("#tooltip").remove(); - previousPoint = null; - } - - }); - - jQuery("#chartplace").bind("plotclick", function (event, pos, item) { - if (item) { - jQuery("#clickdata").text("You clicked point " + item.dataIndex + " in " + item.series.label + "."); - plot.highlight(item.series, item.datapoint); - } - }); - - //////////// TABS ///////////////// - jQuery( "#tabs" ).tabs(); - - //////////// ACCORDION ///////////////// - jQuery( ".accordion" ).accordion(); - - //////////// FORM VALIDATION ///////////////// - jQuery("#form").validate({ - rules: { - name: "required", - email: { - required: true, - email: true, - }, - occupation: "required" - }, - messages: { - name: "Please enter your name", - email: "Please enter a valid email address", - occupation: "Please select your occupation" - } - }); - + //////////// ACCORDION ///////////////// + jQuery( ".accordion" ).accordion(); }); + +var portlets = ["feeds", "shopping", "news", "links", "images"]; + +jQuery(document).ready(function () { + jQuery('#menu2').click(function(event) { + jQuery('#window_dialog').dialog({ + autoOpen: true, + draggable: false, + modal: true, + title: 'Settings', + buttons: { + "Save": function () { + + jQuery(portlets).each(function() { + set_window_visibility(this); + }); + jQuery(".column1").width(parseInt($('#c1-width').val())); + jQuery(".column2").width(parseInt($('#c2-width').val())); + jQuery(".column3").width(parseInt($('#c3-width').val())); + jQuery(this).dialog('destroy'); + }, + "Cancel": function () { + jQuery(this).dialog('destroy'); + } + } + }); + }); + function set_window_visibility(name){ + if(jQuery('#'+name+'-visible').is(':checked')) + jQuery('#'+name+'-portlet').show(); + else + jQuery('#'+name+'-portlet').hide(); + } + function set_visible_check(name){ + if(jQuery('#'+name+'-portlet').is(":visible")) + jQuery('#'+name+'-visible').each(function(){ + this.checked = true; + }); + else + jQuery('#'+name+'-visible').attr("checked", false); + } + jQuery( "#settings_dialog" ).bind( "dialogopen", function(event, ui) { + + }); + jQuery( "#window_dialog" ).bind( "dialogopen", function(event, ui) { + jQuery(portlets).each(function() { + set_visible_check(this); + }); + jQuery('#c1-width').val(jQuery(".column1").width()); + jQuery('#c2-width').val(jQuery(".column2").width()); + jQuery('#c3-width').val(jQuery(".column3").width()); + }); +}); + +jQuery(function() { + jQuery( ".dash-column1" ).sortable({ + connectWith: ".dash-column1, .dash-column2" + }); + jQuery( ".dash-column2" ).sortable({ + connectWith: ".dash-column1, .dash-column2" + }); + + /*jQuery( ".portlet" ).addClass( "ui-widget ui-widget-content ui-helper-clearfix ui-corner-all" ) + .find( ".portlet-header" ) + .addClass( "ui-widget-header ui-corner-all" ) + .prepend( "") + .end() + .find( ".portlet-content" );*/ + + /** + * Widget Box Toggle + **/ + jQuery('.portlet-header').hover(function(){ + jQuery(this).find('.ui-icon').addClass('display'); + return false; + },function(){ + jQuery(this).find('.ui-icon').removeClass('display'); + return false; + }); + + jQuery('.portlet-header').toggle(function(){ + jQuery(this).next().slideUp('fast'); + jQuery(this).css({ + MozBorderRadius: '3px', + WebkitBorderRadius: '3px', + borderRadius: '3px' + }); + return false; + },function(){ + jQuery(this).next().slideDown('fast'); + jQuery(this).css({ + MozBorderRadius: '3px 3px 0 0', + WebkitBorderRadius: '3px 3px 0 0', + borderRadius: '3px 3px 0 0' + }); + return false; + }); + + + jQuery( ".icon-vis" ).click(function() { + jQuery( this ).toggleClass( "ui-icon-minusthick" ).toggleClass( "ui-icon-plusthick" ); + jQuery( this ).parents( ".portlet:first" ).find( ".portlet-content" ).toggle(); + }); + jQuery( ".icon-close" ).click(function() { + //$( this ).toggleClass( "ui-icon-minusthick" ).toggleClass( "ui-icon-plusthick" ); + jQuery( this ).parents( ".portlet:first" ).hide(); + }); + jQuery( ".column" ).disableSelection(); +}); + diff --git a/www/js/custom/general.js b/www/js/custom/general.js index 740aecf..9586ef4 100644 --- a/www/js/custom/general.js +++ b/www/js/custom/general.js @@ -84,31 +84,11 @@ jQuery(document).ready(function(){ }return false; }); + //////////// TABS ///////////////// + jQuery( '#tabs' ).tabs(); + - /** - * Widget Box Toggle - **/ - jQuery('.widgetbox h3, .widgetbox2 h3').hover(function(){ - jQuery(this).addClass('arrow'); - return false; - },function(){ - jQuery(this).removeClass('arrow'); - return false; - }); - - jQuery('.widgetbox h3, .widgetbox2 h3').toggle(function(){ - jQuery(this).next().slideUp('fast'); - jQuery(this).css({MozBorderRadius: '3px', - WebkitBorderRadius: '3px', - borderRadius: '3px'}); - return false; - },function(){ - jQuery(this).next().slideDown('fast'); - jQuery(this).css({MozBorderRadius: '3px 3px 0 0', - WebkitBorderRadius: '3px 3px 0 0', - borderRadius: '3px 3px 0 0'}); - return false; - }); + /** diff --git a/www/protected/controllers/CandidatoController.php b/www/protected/controllers/CandidatoController.php index 8c53665..9175ac6 100644 --- a/www/protected/controllers/CandidatoController.php +++ b/www/protected/controllers/CandidatoController.php @@ -41,6 +41,19 @@ class CandidatoController extends Controller ), );*/ } + + public function actionGetDashboardPortlets() { + $model=new Candidato('search'); + + $portlet = array( + 'id' => 'actividad_candidatos', + 'header' => 'Resumen de actividad de candidatos (últimos 7 días)', + 'content' => $this->renderPartial('portlets/actividad', $model, true) + ); + return $portlet; + } + + /** * Displays a particular model. diff --git a/www/protected/controllers/SiteController.php b/www/protected/controllers/SiteController.php index b35d962..071e494 100644 --- a/www/protected/controllers/SiteController.php +++ b/www/protected/controllers/SiteController.php @@ -4,7 +4,7 @@ class SiteController extends Controller { public $layout='//layouts/default'; public $defaultAction='index'; - + /** * @return array action filters */ @@ -70,7 +70,9 @@ class SiteController extends Controller // renders the view file 'protected/views/site/index.php' // using the default layout 'protected/views/layouts/main.php' $this->layout = 'tablero'; - $this->render('tablero'); + $model = new Tablero(); + + $this->render('tablero', array('tablero'=>$model)); } /** diff --git a/www/protected/extensions/dashboard/assests/css/dashboard.css b/www/protected/extensions/dashboard/assests/css/dashboard.css new file mode 100644 index 0000000..6b0ead3 --- /dev/null +++ b/www/protected/extensions/dashboard/assests/css/dashboard.css @@ -0,0 +1,23 @@ +.column1 { width: 170px; float: left; padding-bottom: 10px; } +.column2 {width: 500px; float: left; padding-bottom: 10px; } +.column3 { width: 240px; float: left; padding-bottom: 10px; } +.portlet { margin: 0 1em 1em 0; } +.portlet-header { margin: 0.3em; padding-bottom: 4px; padding-left: 0.2em; } +.portlet-header .ui-icon { float: right; } +.portlet-content { padding: 0.4em; } +.ui-sortable-placeholder { border: 1px dotted black; visibility: visible !important; height: 50px !important; } +.ui-sortable-placeholder * { visibility: hidden; } +.portlet-content { + max-height:400px; + _height:expression(this.scrollHeight>199?"200px":"auto"); + overflow:auto; + background-color: #F2F5F7; +} +.hidden{display: none} +#dash-header{margin-bottom: 5px; padding: 3px} +#dash-header div{float: left;} +#menu2{float:left;} + +.dash-sing-col-content{ + width: 920px; float: left; padding-bottom: 10px; +} diff --git a/www/protected/extensions/dashboard/assests/css/images/ui-bg_diagonals-thick_90_eeeeee_40x40.png b/www/protected/extensions/dashboard/assests/css/images/ui-bg_diagonals-thick_90_eeeeee_40x40.png new file mode 100644 index 0000000..6348115 Binary files /dev/null and b/www/protected/extensions/dashboard/assests/css/images/ui-bg_diagonals-thick_90_eeeeee_40x40.png differ diff --git a/www/protected/extensions/dashboard/assests/css/images/ui-bg_glass_100_e4f1fb_1x400.png b/www/protected/extensions/dashboard/assests/css/images/ui-bg_glass_100_e4f1fb_1x400.png new file mode 100644 index 0000000..705a32e Binary files /dev/null and b/www/protected/extensions/dashboard/assests/css/images/ui-bg_glass_100_e4f1fb_1x400.png differ diff --git a/www/protected/extensions/dashboard/assests/css/images/ui-bg_glass_80_d7ebf9_1x400.png b/www/protected/extensions/dashboard/assests/css/images/ui-bg_glass_80_d7ebf9_1x400.png new file mode 100644 index 0000000..d9387e9 Binary files /dev/null and b/www/protected/extensions/dashboard/assests/css/images/ui-bg_glass_80_d7ebf9_1x400.png differ diff --git a/www/protected/extensions/dashboard/assests/css/images/ui-bg_highlight-hard_100_f2f5f7_1x100.png b/www/protected/extensions/dashboard/assests/css/images/ui-bg_highlight-hard_100_f2f5f7_1x100.png new file mode 100644 index 0000000..8794b48 Binary files /dev/null and b/www/protected/extensions/dashboard/assests/css/images/ui-bg_highlight-hard_100_f2f5f7_1x100.png differ diff --git a/www/protected/extensions/dashboard/assests/css/images/ui-bg_highlight-soft_100_deedf7_1x100.png b/www/protected/extensions/dashboard/assests/css/images/ui-bg_highlight-soft_100_deedf7_1x100.png new file mode 100644 index 0000000..2289d3c Binary files /dev/null and b/www/protected/extensions/dashboard/assests/css/images/ui-bg_highlight-soft_100_deedf7_1x100.png differ diff --git a/www/protected/extensions/dashboard/assests/css/images/ui-icons_2694e8_256x240.png b/www/protected/extensions/dashboard/assests/css/images/ui-icons_2694e8_256x240.png new file mode 100644 index 0000000..e62b8f7 Binary files /dev/null and b/www/protected/extensions/dashboard/assests/css/images/ui-icons_2694e8_256x240.png differ diff --git a/www/protected/extensions/dashboard/assests/css/images/ui-icons_72a7cf_256x240.png b/www/protected/extensions/dashboard/assests/css/images/ui-icons_72a7cf_256x240.png new file mode 100644 index 0000000..0d20b73 Binary files /dev/null and b/www/protected/extensions/dashboard/assests/css/images/ui-icons_72a7cf_256x240.png differ diff --git a/www/protected/extensions/dashboard/assests/css/jquery-ui.css b/www/protected/extensions/dashboard/assests/css/jquery-ui.css new file mode 100644 index 0000000..ead4802 --- /dev/null +++ b/www/protected/extensions/dashboard/assests/css/jquery-ui.css @@ -0,0 +1,405 @@ +/* +* jQuery UI CSS Framework +* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. +*/ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute; left: -99999999px; } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + +/* +* jQuery UI CSS Framework +* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. +* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Lucida%20Grande,%20Lucida%20Sans,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=6px&bgColorHeader=deedf7&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=100&borderColorHeader=aed0ea&fcHeader=222222&iconColorHeader=72a7cf&bgColorContent=f2f5f7&bgTextureContent=04_highlight_hard.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=362b36&iconColorContent=72a7cf&bgColorDefault=d7ebf9&bgTextureDefault=02_glass.png&bgImgOpacityDefault=80&borderColorDefault=aed0ea&fcDefault=2779aa&iconColorDefault=3d80b3&bgColorHover=e4f1fb&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=74b2e2&fcHover=0070a3&iconColorHover=2694e8&bgColorActive=3baae3&bgTextureActive=02_glass.png&bgImgOpacityActive=50&borderColorActive=2694e8&fcActive=ffffff&iconColorActive=ffffff&bgColorHighlight=ffef8f&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=25&borderColorHighlight=f9dd34&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=cd0a0a&bgTextureError=01_flat.png&bgImgOpacityError=15&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffffff&bgColorOverlay=eeeeee&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=90&opacityOverlay=80&bgColorShadow=000000&bgTextureShadow=04_highlight_hard.png&bgImgOpacityShadow=70&opacityShadow=30&thicknessShadow=7px&offsetTopShadow=-7px&offsetLeftShadow=-7px&cornerRadiusShadow=8px +*/ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Lucida Grande, Lucida Sans, Arial, sans-serif; font-size: 1.1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Lucida Grande, Lucida Sans, Arial, sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #dddddd; background: #f2f5f7 url(images/ui-bg_highlight-hard_100_f2f5f7_1x100.png) 50% top repeat-x; color: #362b36; } +.ui-widget-content a { color: #362b36; } +.ui-widget-header { border: 1px solid #aed0ea; background: #deedf7 url(images/ui-bg_highlight-soft_100_deedf7_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; } +.ui-widget-header a { color: #222222; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #aed0ea; background: #d7ebf9 url(images/ui-bg_glass_80_d7ebf9_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #2779aa; outline: none; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #2779aa; text-decoration: none; outline: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #74b2e2; background: #e4f1fb url(images/ui-bg_glass_100_e4f1fb_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #0070a3; outline: none; } +.ui-state-hover a, .ui-state-hover a:hover { color: #0070a3; text-decoration: none; outline: none; } +.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #2694e8; background: #3baae3 url(images/ui-bg_glass_50_3baae3_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #ffffff; outline: none; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #ffffff; outline: none; text-decoration: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #f9dd34; background: #ffef8f url(images/ui-bg_highlight-soft_25_ffef8f_1x100.png) 50% top repeat-x; color: #363636; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a; background: #cd0a0a url(images/ui-bg_flat_15_cd0a0a_40x100.png) 50% 50% repeat-x; color: #ffffff; } +.ui-state-error a, .ui-widget-content .ui-state-error a { color: #ffffff; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #ffffff; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_72a7cf_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_72a7cf_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_72a7cf_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_3d80b3_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_2694e8_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-tl { -moz-border-radius-topleft: 6px; -webkit-border-top-left-radius: 6px; } +.ui-corner-tr { -moz-border-radius-topright: 6px; -webkit-border-top-right-radius: 6px; } +.ui-corner-bl { -moz-border-radius-bottomleft: 6px; -webkit-border-bottom-left-radius: 6px; } +.ui-corner-br { -moz-border-radius-bottomright: 6px; -webkit-border-bottom-right-radius: 6px; } +.ui-corner-top { -moz-border-radius-topleft: 6px; -webkit-border-top-left-radius: 6px; -moz-border-radius-topright: 6px; -webkit-border-top-right-radius: 6px; } +.ui-corner-bottom { -moz-border-radius-bottomleft: 6px; -webkit-border-bottom-left-radius: 6px; -moz-border-radius-bottomright: 6px; -webkit-border-bottom-right-radius: 6px; } +.ui-corner-right { -moz-border-radius-topright: 6px; -webkit-border-top-right-radius: 6px; -moz-border-radius-bottomright: 6px; -webkit-border-bottom-right-radius: 6px; } +.ui-corner-left { -moz-border-radius-topleft: 6px; -webkit-border-top-left-radius: 6px; -moz-border-radius-bottomleft: 6px; -webkit-border-bottom-left-radius: 6px; } +.ui-corner-all { -moz-border-radius: 6px; -webkit-border-radius: 6px; } + +/* Overlays */ +.ui-widget-overlay { background: #eeeeee url(images/ui-bg_diagonals-thick_90_eeeeee_40x40.png) 50% 50% repeat; opacity: .80;filter:Alpha(Opacity=80); } +.ui-widget-shadow { margin: -7px 0 0 -7px; padding: 7px; background: #000000 url(images/ui-bg_highlight-hard_70_000000_1x100.png) 50% top repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; }/* Accordion +----------------------------------*/ +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; } +.ui-accordion .ui-accordion-content-active { display: block; }/* Datepicker +----------------------------------*/ +.ui-datepicker { width: 17em; padding: .2em .2em 0; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { float:left; font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker .ui-datepicker-title select.ui-datepicker-year { float: right; } +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/* Dialog +----------------------------------*/ +.ui-dialog { position: relative; padding: .2em; width: 300px; } +.ui-dialog .ui-dialog-titlebar { padding: .5em .3em .3em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 0 .2em; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* Progressbar +----------------------------------*/ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }/* Resizable +----------------------------------*/ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;} +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0px; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0px; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0px; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0px; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* Slider +----------------------------------*/ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* Tabs +----------------------------------*/ +.ui-tabs { padding: .2em; zoom: 1; } +.ui-tabs .ui-tabs-nav { list-style: none; position: relative; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { position: relative; float: left; border-bottom-width: 0 !important; margin: 0 .2em -1px 0; padding: 0; } +.ui-tabs .ui-tabs-nav li a { float: left; text-decoration: none; padding: .5em 1em; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { padding-bottom: 1px; border-bottom-width: 0; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { padding: 1em 1.4em; display: block; border-width: 0; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } diff --git a/www/protected/extensions/dashboard/assests/js/dashboard.js b/www/protected/extensions/dashboard/assests/js/dashboard.js new file mode 100644 index 0000000..16a7b91 --- /dev/null +++ b/www/protected/extensions/dashboard/assests/js/dashboard.js @@ -0,0 +1,81 @@ + + +var portlets = ["feeds", "shopping", "news", "links", "images"]; + +$(document).ready(function () { + $('#menu2').click(function(event) { + $('#window_dialog').dialog({ + autoOpen: true, + draggable: false, + modal: true, + title: 'Settings', + buttons: { + "Save": function () { + + $(portlets).each(function() { + set_window_visibility(this); + }); + $(".column1").width(parseInt($('#c1-width').val())); + $(".column2").width(parseInt($('#c2-width').val())); + $(".column3").width(parseInt($('#c3-width').val())); + $(this).dialog('destroy'); + }, + "Cancel": function () { + $(this).dialog('destroy'); + } + } + }); + }); + function set_window_visibility(name){ + if($('#'+name+'-visible').is(':checked')) + $('#'+name+'-portlet').show(); + else + $('#'+name+'-portlet').hide(); + } + function set_visible_check(name){ + if($('#'+name+'-portlet').is(":visible")) + $('#'+name+'-visible').each(function(){ this.checked = true; }); + else + $('#'+name+'-visible').attr("checked", false); + } + $( "#settings_dialog" ).bind( "dialogopen", function(event, ui) { + + }); + $( "#window_dialog" ).bind( "dialogopen", function(event, ui) { + $(portlets).each(function() { + set_visible_check(this); + }); + $('#c1-width').val($(".column1").width()); + $('#c2-width').val($(".column2").width()); + $('#c3-width').val($(".column3").width()); + }); +}); + +$(function() { + $( ".column1" ).sortable({ + connectWith: ".column1, .column2, .column3" + }); + $( ".column2" ).sortable({ + connectWith: ".column1, .column2, .column3" + }); + $( ".column3" ).sortable({ + connectWith: ".column1, .column2, .column3" + }); + $( ".portlet" ).addClass( "ui-widget ui-widget-content ui-helper-clearfix ui-corner-all" ) + .find( ".portlet-header" ) + .addClass( "ui-widget-header ui-corner-all" ) + .prepend( "") + .end() + .find( ".portlet-content" ); + + $( ".icon-vis" ).click(function() { + $( this ).toggleClass( "ui-icon-minusthick" ).toggleClass( "ui-icon-plusthick" ); + $( this ).parents( ".portlet:first" ).find( ".portlet-content" ).toggle(); + }); + $( ".icon-close" ).click(function() { + //$( this ).toggleClass( "ui-icon-minusthick" ).toggleClass( "ui-icon-plusthick" ); + $( this ).parents( ".portlet:first" ).hide(); + }); + $( ".column" ).disableSelection(); +}); + diff --git a/www/protected/extensions/dashboard/assests/js/jquery-ui.js b/www/protected/extensions/dashboard/assests/js/jquery-ui.js new file mode 100644 index 0000000..5e64145 --- /dev/null +++ b/www/protected/extensions/dashboard/assests/js/jquery-ui.js @@ -0,0 +1,9133 @@ +/* + * jQuery UI 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI + */ +;jQuery.ui || (function($) { + +var _remove = $.fn.remove, + isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9); + +//Helper functions and ui object +$.ui = { + version: "1.7.2", + + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function(module, option, set) { + var proto = $.ui[module].prototype; + for(var i in set) { + proto.plugins[i] = proto.plugins[i] || []; + proto.plugins[i].push([option, set[i]]); + } + }, + call: function(instance, name, args) { + var set = instance.plugins[name]; + if(!set || !instance.element[0].parentNode) { return; } + + for (var i = 0; i < set.length; i++) { + if (instance.options[set[i][0]]) { + set[i][1].apply(instance.element, args); + } + } + } + }, + + contains: function(a, b) { + return document.compareDocumentPosition + ? a.compareDocumentPosition(b) & 16 + : a !== b && a.contains(b); + }, + + hasScroll: function(el, a) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ($(el).css('overflow') == 'hidden') { return false; } + + var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop', + has = false; + + if (el[scroll] > 0) { return true; } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[scroll] = 1; + has = (el[scroll] > 0); + el[scroll] = 0; + return has; + }, + + isOverAxis: function(x, reference, size) { + //Determines when x coordinate is over "b" element axis + return (x > reference) && (x < (reference + size)); + }, + + isOver: function(y, x, top, left, height, width) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width); + }, + + keyCode: { + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38 + } +}; + +// WAI-ARIA normalization +if (isFF2) { + var attr = $.attr, + removeAttr = $.fn.removeAttr, + ariaNS = "http://www.w3.org/2005/07/aaa", + ariaState = /^aria-/, + ariaRole = /^wairole:/; + + $.attr = function(elem, name, value) { + var set = value !== undefined; + + return (name == 'role' + ? (set + ? attr.call(this, elem, name, "wairole:" + value) + : (attr.apply(this, arguments) || "").replace(ariaRole, "")) + : (ariaState.test(name) + ? (set + ? elem.setAttributeNS(ariaNS, + name.replace(ariaState, "aaa:"), value) + : attr.call(this, elem, name.replace(ariaState, "aaa:"))) + : attr.apply(this, arguments))); + }; + + $.fn.removeAttr = function(name) { + return (ariaState.test(name) + ? this.each(function() { + this.removeAttributeNS(ariaNS, name.replace(ariaState, "")); + }) : removeAttr.call(this, name)); + }; +} + +//jQuery plugins +$.fn.extend({ + remove: function() { + // Safari has a native remove event which actually removes DOM elements, + // so we have to use triggerHandler instead of trigger (#3037). + $("*", this).add(this).each(function() { + $(this).triggerHandler("remove"); + }); + return _remove.apply(this, arguments ); + }, + + enableSelection: function() { + return this + .attr('unselectable', 'off') + .css('MozUserSelect', '') + .unbind('selectstart.ui'); + }, + + disableSelection: function() { + return this + .attr('unselectable', 'on') + .css('MozUserSelect', 'none') + .bind('selectstart.ui', function() { return false; }); + }, + + scrollParent: function() { + var scrollParent; + if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + } +}); + + +//Additional selectors +$.extend($.expr[':'], { + data: function(elem, i, match) { + return !!$.data(elem, match[3]); + }, + + focusable: function(element) { + var nodeName = element.nodeName.toLowerCase(), + tabIndex = $.attr(element, 'tabindex'); + return (/input|select|textarea|button|object/.test(nodeName) + ? !element.disabled + : 'a' == nodeName || 'area' == nodeName + ? element.href || !isNaN(tabIndex) + : !isNaN(tabIndex)) + // the element and all of its ancestors must be visible + // the browser may report that the area is hidden + && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length; + }, + + tabbable: function(element) { + var tabIndex = $.attr(element, 'tabindex'); + return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable'); + } +}); + + +// $.widget is a factory to create jQuery plugins +// taking some boilerplate code out of the plugin code +function getter(namespace, plugin, method, args) { + function getMethods(type) { + var methods = $[namespace][plugin][type] || []; + return (typeof methods == 'string' ? methods.split(/,?\s+/) : methods); + } + + var methods = getMethods('getter'); + if (args.length == 1 && typeof args[0] == 'string') { + methods = methods.concat(getMethods('getterSetter')); + } + return ($.inArray(method, methods) != -1); +} + +$.widget = function(name, prototype) { + var namespace = name.split(".")[0]; + name = name.split(".")[1]; + + // create plugin method + $.fn[name] = function(options) { + var isMethodCall = (typeof options == 'string'), + args = Array.prototype.slice.call(arguments, 1); + + // prevent calls to internal methods + if (isMethodCall && options.substring(0, 1) == '_') { + return this; + } + + // handle getter methods + if (isMethodCall && getter(namespace, name, options, args)) { + var instance = $.data(this[0], name); + return (instance ? instance[options].apply(instance, args) + : undefined); + } + + // handle initialization and non-getter methods + return this.each(function() { + var instance = $.data(this, name); + + // constructor + (!instance && !isMethodCall && + $.data(this, name, new $[namespace][name](this, options))._init()); + + // method call + (instance && isMethodCall && $.isFunction(instance[options]) && + instance[options].apply(instance, args)); + }); + }; + + // create widget constructor + $[namespace] = $[namespace] || {}; + $[namespace][name] = function(element, options) { + var self = this; + + this.namespace = namespace; + this.widgetName = name; + this.widgetEventPrefix = $[namespace][name].eventPrefix || name; + this.widgetBaseClass = namespace + '-' + name; + + this.options = $.extend({}, + $.widget.defaults, + $[namespace][name].defaults, + $.metadata && $.metadata.get(element)[name], + options); + + this.element = $(element) + .bind('setData.' + name, function(event, key, value) { + if (event.target == element) { + return self._setData(key, value); + } + }) + .bind('getData.' + name, function(event, key) { + if (event.target == element) { + return self._getData(key); + } + }) + .bind('remove', function() { + return self.destroy(); + }); + }; + + // add widget prototype + $[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype); + + // TODO: merge getter and getterSetter properties from widget prototype + // and plugin prototype + $[namespace][name].getterSetter = 'option'; +}; + +$.widget.prototype = { + _init: function() {}, + destroy: function() { + this.element.removeData(this.widgetName) + .removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled') + .removeAttr('aria-disabled'); + }, + + option: function(key, value) { + var options = key, + self = this; + + if (typeof key == "string") { + if (value === undefined) { + return this._getData(key); + } + options = {}; + options[key] = value; + } + + $.each(options, function(key, value) { + self._setData(key, value); + }); + }, + _getData: function(key) { + return this.options[key]; + }, + _setData: function(key, value) { + this.options[key] = value; + + if (key == 'disabled') { + this.element + [value ? 'addClass' : 'removeClass']( + this.widgetBaseClass + '-disabled' + ' ' + + this.namespace + '-state-disabled') + .attr("aria-disabled", value); + } + }, + + enable: function() { + this._setData('disabled', false); + }, + disable: function() { + this._setData('disabled', true); + }, + + _trigger: function(type, event, data) { + var callback = this.options[type], + eventName = (type == this.widgetEventPrefix + ? type : this.widgetEventPrefix + type); + + event = $.Event(event); + event.type = eventName; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if (event.originalEvent) { + for (var i = $.event.props.length, prop; i;) { + prop = $.event.props[--i]; + event[prop] = event.originalEvent[prop]; + } + } + + this.element.trigger(event, data); + + return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false + || event.isDefaultPrevented()); + } +}; + +$.widget.defaults = { + disabled: false +}; + + +/** Mouse Interaction Plugin **/ + +$.ui.mouse = { + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if(self._preventClickEvent) { + self._preventClickEvent = false; + event.stopImmediatePropagation(); + return false; + } + }); + + // Prevent text selection in IE + if ($.browser.msie) { + this._mouseUnselectable = this.element.attr('unselectable'); + this.element.attr('unselectable', 'on'); + } + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + + // Restore text selection in IE + ($.browser.msie + && this.element.attr('unselectable', this._mouseUnselectable)); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + // TODO: figure out why we have to use originalEvent + event.originalEvent = event.originalEvent || {}; + if (event.originalEvent.mouseHandled) { return; } + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + // preventDefault() is used to prevent the selection of text here - + // however, in Safari, this causes select boxes not to be selectable + // anymore, so this fix is needed + ($.browser.safari || event.preventDefault()); + + event.originalEvent.mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + this._preventClickEvent = (event.target == this._mouseDownEvent.target); + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}; + +$.ui.mouse.defaults = { + cancel: null, + distance: 1, + delay: 0 +}; + +})(jQuery); +/* + * jQuery UI Draggable 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.draggable", $.extend({}, $.ui.mouse, { + + _init: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + }, + + _mouseCapture: function(event) { + + var o = this.options; + + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + if(o.cursorAt) + this._adjustOffsetFromHelper(o.cursorAt); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Call plugins and callbacks + this._trigger("start", event); + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + this._trigger('drag', event, ui); + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + self._trigger("stop", event); + self._clear(); + }); + } else { + this._trigger("stop", event); + this._clear(); + } + + return false; + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left; + if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top; + if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var ce = $(o.containment)[0]; if(!ce) return; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + absolutePosition: this.positionAbs, //deprecated + offset: this.positionAbs + }; + } + +})); + +$.extend($.ui.draggable, { + version: "1.7.2", + eventPrefix: "drag", + defaults: { + addClasses: true, + appendTo: "parent", + axis: false, + cancel: ":input,option", + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + delay: 0, + distance: 1, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + } +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "iframeFix", { + start: function(event, ui) { + var o = $(this).data('draggable').options; + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('
') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + }, + stop: function(event, ui) { + $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack.group)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min); + }); + + $(group).each(function(i) { + this.style.zIndex = o.stack.min + i; + }); + + this[0].style.zIndex = o.stack.min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); +/* + * jQuery UI Droppable 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * ui.core.js + * ui.draggable.js + */ +(function($) { + +$.widget("ui.droppable", { + + _init: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.options.accept = this.options.accept && $.isFunction(this.options.accept) ? this.options.accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[this.options.scope] = $.ui.ddmanager.droppables[this.options.scope] || []; + $.ui.ddmanager.droppables[this.options.scope].push(this); + + (this.options.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + }, + + _setData: function(key, value) { + + if(key == 'accept') { + this.options.accept = value && $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } else { + $.widget.prototype._setData.apply(this, arguments); + } + + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if(inst.options.greedy && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)) { + childrenIntersection = true; return false; + } + }); + if(childrenIntersection) return false; + + if(this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + absolutePosition: c.positionAbs, //deprecated + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.7.2", + eventPrefix: 'drop', + defaults: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + } +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l < x1 && x2 < r + && t < y1 && y2 < b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope]; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].options.accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = this._drop.call(this, event); + + if (!this.options.disabled && this.visible && this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + + $.each($.ui.ddmanager.droppables[draggable.options.scope], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + var parent = this.element.parents(':data(droppable):eq(0)'); + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + } +}; + +})(jQuery); +/* + * jQuery UI Resizable 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.resizable", $.extend({}, $.ui.mouse, { + + _init: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Opera fix for relative positioning + if (/relative/.test(this.element.css('position')) && $.browser.opera) + this.element.css({ position: 'relative', top: 'auto', left: 'auto' }); + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('
').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('
'); + + // increase zIndex of sw, se, ne, nw axis + //TODO : this modifies original option + if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.parent().append( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).end().remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + }, + + _mouseCapture: function(event) { + + var handle = false; + for(var i in this.handles) { + if($(this.handles[i])[0] == event.target) handle = true; + } + + return this.options.disabled || !!handle; + + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + //Opera fixing relative position + if ($.browser.opera && (/relative/).test(el.css('position'))) + el.css({ position: 'relative', top: 'auto', left: 'auto' }); + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (data.height) data.width = (csize.height * this.aspectRatio); + else if (data.width) data.height = (csize.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('
'); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +})); + +$.extend($.ui.resizable, { + version: "1.7.2", + eventPrefix: "resize", + defaults: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + cancel: ":input,option", + containment: false, + delay: 0, + distance: 1, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + } +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options; + + _store = function(exp) { + $(exp).each(function() { + $(this).data("resizable-alsoresize", { + width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10), + left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10) + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function(exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left']; + + $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + //Opera fixing relative position + if (/relative/.test(el.css('position')) && $.browser.opera) { + self._revertToRelativePosition = true; + el.css({ position: 'absolute', top: 'auto', left: 'auto' }); + } + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"); + + //Opera fixing relative position + if (self._revertToRelativePosition && $.browser.opera) { + self._revertToRelativePosition = false; + el.css({ position: 'relative' }); + } + + $(this).removeData("resizable-alsoresize-start"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / o.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * o.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); +/* + * jQuery UI Selectable 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.selectable", $.extend({}, $.ui.mouse, { + + _init: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $(document.createElement('div')) + .css({border:'1px dotted black'}) + .addClass("ui-selectable-helper"); + }, + + destroy: function() { + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "z-index": 100, + "position": "absolute", + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + selectee.$element.removeClass("ui-unselecting").addClass('ui-selecting'); + selectee.unselecting = false; + selectee.selecting = true; + selectee.selected = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if (event.metaKey && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +})); + +$.extend($.ui.selectable, { + version: "1.7.2", + defaults: { + appendTo: 'body', + autoRefresh: true, + cancel: ":input,option", + delay: 0, + distance: 0, + filter: '*', + tolerance: 'touch' + } +}); + +})(jQuery); +/* + * jQuery UI Sortable 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.sortable", $.extend({}, $.ui.mouse, { + _init: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are floating + this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + }, + + destroy: function() { + this.element + .removeClass("ui-sortable ui-sortable-disabled") + .removeData("sortable") + .unbind(".sortable"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData("sortable-item"); + }, + + _mouseCapture: function(event, overrideHandle) { + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, 'sortable-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + if(o.cursorAt) + this._adjustOffsetFromHelper(o.cursorAt); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + if(itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp(); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + + return true; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper"), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper"), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(sortable-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data('sortable-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) + continue; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + for (var i = this.containers.length - 1; i >= 0; i--){ + + if(this._intersectsWith(this.containers[i].containerCache)) { + if(!this.containers[i].containerCache.over) { + + if(this.currentContainer != this.containers[i]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[i].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[i].element[0], this.items[j].item[0])) continue; + var cur = this.items[j][this.containers[i].floating ? 'left' : 'top']; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + continue; + + this.currentContainer = this.containers[i]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[i].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[i]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + } + + this.containers[i]._trigger("over", event, this._uiHash(this)); + this.containers[i].containerCache.over = 1; + } + } else { + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + }; + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left; + if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top; + if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element + if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + for (var i = this.containers.length - 1; i >= 0; i--){ + if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + }; + }; + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset cursor + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + absolutePosition: self.positionAbs, //deprecated + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +})); + +$.extend($.ui.sortable, { + getter: "serialize toArray", + version: "1.7.2", + eventPrefix: "sort", + defaults: { + appendTo: "parent", + axis: false, + cancel: ":input,option", + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + delay: 0, + distance: 1, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + } +}); + +})(jQuery); +/* + * jQuery UI Effects 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/ + */ +;jQuery.effects || (function($) { + +$.effects = { + version: "1.7.2", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + //if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) + return element.parent(); + + //Cache width,height and float properties of the element, and create a wrapper around it + var props = { width: element.outerWidth(true), height: element.outerHeight(true), 'float': element.css('float') }; + element.wrap('
'); + var wrapper = element.parent(); + + //Transfer the positioning of the element to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative'} ); + } else { + var top = element.css('top'); if(isNaN(parseInt(top,10))) top = 'auto'; + var left = element.css('left'); if(isNaN(parseInt(left,10))) left = 'auto'; + wrapper.css({ position: element.css('position'), top: top, left: left, zIndex: element.css('z-index') }).show(); + element.css({position: 'relative', top: 0, left: 0 }); + } + + wrapper.css(props); + return wrapper; + }, + + removeWrapper: function(element) { + if (element.parent().is('.ui-effects-wrapper')) + return element.parent().replaceWith(element); + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + }, + + //Base function to animate from one class to another in a seamless transition + animateClass: function(value, duration, easing, callback) { + + var cb = (typeof easing == "function" ? easing : (callback ? callback : null)); + var ea = (typeof easing == "string" ? easing : null); + + return this.each(function() { + + var offset = {}; var that = $(this); var oldStyleAttr = that.attr("style") || ''; + if(typeof oldStyleAttr == 'object') oldStyleAttr = oldStyleAttr["cssText"]; /* Stupidly in IE, style is a object.. */ + if(value.toggle) { that.hasClass(value.toggle) ? value.remove = value.toggle : value.add = value.toggle; } + + //Let's get a style offset + var oldStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle)); + if(value.add) that.addClass(value.add); if(value.remove) that.removeClass(value.remove); + var newStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle)); + if(value.add) that.removeClass(value.add); if(value.remove) that.addClass(value.remove); + + // The main function to form the object for animation + for(var n in newStyle) { + if( typeof newStyle[n] != "function" && newStyle[n] /* No functions and null properties */ + && n.indexOf("Moz") == -1 && n.indexOf("length") == -1 /* No mozilla spezific render properties. */ + && newStyle[n] != oldStyle[n] /* Only values that have changed are used for the animation */ + && (n.match(/color/i) || (!n.match(/color/i) && !isNaN(parseInt(newStyle[n],10)))) /* Only things that can be parsed to integers or colors */ + && (oldStyle.position != "static" || (oldStyle.position == "static" && !n.match(/left|top|bottom|right/))) /* No need for positions when dealing with static positions */ + ) offset[n] = newStyle[n]; + } + + that.animate(offset, duration, ea, function() { // Animate the newly constructed offset object + // Change style attribute back to original. For stupid IE, we need to clear the damn object. + if(typeof $(this).attr("style") == 'object') { $(this).attr("style")["cssText"] = ""; $(this).attr("style")["cssText"] = oldStyleAttr; } else $(this).attr("style", oldStyleAttr); + if(value.add) $(this).addClass(value.add); if(value.remove) $(this).removeClass(value.remove); + if(cb) cb.apply(this, arguments); + }); + + }); + } +}; + + +function _normalizeArguments(a, m) { + + var o = a[1] && a[1].constructor == Object ? a[1] : {}; if(m) o.mode = m; + var speed = a[1] && a[1].constructor != Object ? a[1] : (o.duration ? o.duration : a[2]); //either comes from options.duration or the secon/third argument + speed = $.fx.off ? 0 : typeof speed === "number" ? speed : $.fx.speeds[speed] || $.fx.speeds._default; + var callback = o.callback || ( $.isFunction(a[1]) && a[1] ) || ( $.isFunction(a[2]) && a[2] ) || ( $.isFunction(a[3]) && a[3] ); + + return [a[0], o, speed, callback]; + +} + +//Extend the methods of jQuery +$.fn.extend({ + + //Save old methods + _show: $.fn.show, + _hide: $.fn.hide, + __toggle: $.fn.toggle, + _addClass: $.fn.addClass, + _removeClass: $.fn.removeClass, + _toggleClass: $.fn.toggleClass, + + // New effect methods + effect: function(fx, options, speed, callback) { + return $.effects[fx] ? $.effects[fx].call(this, {method: fx, options: options || {}, duration: speed, callback: callback }) : null; + }, + + show: function() { + if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0]))) + return this._show.apply(this, arguments); + else { + return this.effect.apply(this, _normalizeArguments(arguments, 'show')); + } + }, + + hide: function() { + if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0]))) + return this._hide.apply(this, arguments); + else { + return this.effect.apply(this, _normalizeArguments(arguments, 'hide')); + } + }, + + toggle: function(){ + if(!arguments[0] || + (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])) || + ($.isFunction(arguments[0]) || typeof arguments[0] == 'boolean')) { + return this.__toggle.apply(this, arguments); + } else { + return this.effect.apply(this, _normalizeArguments(arguments, 'toggle')); + } + }, + + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + toggleClass: function(classNames,speed,easing,callback) { + return ( (typeof speed !== "boolean") && speed ) ? $.effects.animateClass.apply(this, [{ toggle: classNames },speed,easing,callback]) : this._toggleClass(classNames, speed); + }, + morph: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + }, + switchClass: function() { + return this.morph.apply(this, arguments); + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + +/* + * jQuery Color Animations + * Copyright 2007 John Resig + * Released under the MIT and GPL licenses. + */ + +// We override the animation for all of these color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'], function(i,attr){ + $.fx.step[attr] = function(fx) { + if ( fx.state == 0 ) { + fx.start = getColor( fx.elem, attr ); + fx.end = getRGB( fx.end ); + } + + fx.elem.style[attr] = "rgb(" + [ + Math.max(Math.min( parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0],10), 255), 0), + Math.max(Math.min( parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1],10), 255), 0), + Math.max(Math.min( parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2],10), 255), 0) + ].join(",") + ")"; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + color = $.curCSS(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + +/* + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * TERMS OF USE - jQuery Easing + * + * Open source under the BSD License. + * + * Copyright 2008 George McGinley Smith + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +$.easing.jswing = $.easing.swing; + +$.extend($.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert($.easing.default); + return $.easing[$.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +})(jQuery); +/* + * jQuery UI Effects Blind 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Bounce 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Clip 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Drop 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Explode 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Fold 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Highlight 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.highlight = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['backgroundImage','backgroundColor','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var color = o.options.color || "#ffff99"; // Default highlight color + var oldColor = el.css("backgroundColor"); + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + el.css({backgroundImage: 'none', backgroundColor: color}); // Shift + + // Animation + var animation = {backgroundColor: oldColor }; + if (mode == "hide") animation['opacity'] = 0; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == "hide") el.hide(); + $.effects.restore(el, props); + if (mode == "show" && $.browser.msie) this.style.removeAttribute('filter'); + if(o.callback) o.callback.apply(this, arguments); + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Pulsate 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.pulsate = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var times = o.options.times || 5; // Default # of times + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + if (mode == 'hide') times--; + if (el.is(':hidden')) { // Show fadeIn + el.css('opacity', 0); + el.show(); // Show + el.animate({opacity: 1}, duration, o.options.easing); + times = times-2; + } + + // Animate + for (var i = 0; i < times; i++) { // Pulsate + el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing); + }; + if (mode == 'hide') { // Last Pulse + el.animate({opacity: 0}, duration, o.options.easing, function(){ + el.hide(); // Hide + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing, function(){ + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Scale 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.puff = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var percent = parseInt(o.options.percent,10) || 150; // Set default puff percent + options.fade = true; // It's not a puff if it doesn't fade! :) + var original = {height: el.height(), width: el.width()}; // Save original + + // Adjust + var factor = percent / 100; + el.from = (mode == 'hide') ? original : {height: original.height * factor, width: original.width * factor}; + + // Animation + options.from = el.from; + options.percent = (mode == 'hide') ? percent : 100; + options.mode = mode; + + // Animate + el.effect('scale', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','width','height','overflow','opacity']; + var props1 = ['position','top','left','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Shake 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Slide 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); + if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Transfer 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('
') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); +/* + * jQuery UI Accordion 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.accordion", { + + _init: function() { + + var o = this.options, self = this; + this.running = 0; + + // if the user set the alwaysOpen option on init + // then we need to set the collapsible option + // if they set both on init, collapsible will take priority + if (o.collapsible == $.ui.accordion.defaults.collapsible && + o.alwaysOpen != $.ui.accordion.defaults.alwaysOpen) { + o.collapsible = !o.alwaysOpen; + } + + if ( o.navigation ) { + var current = this.element.find("a").filter(o.navigationFilter); + if ( current.length ) { + if ( current.filter(o.header).length ) { + this.active = current; + } else { + this.active = current.parent().parent().prev(); + current.addClass("ui-accordion-content-active"); + } + } + } + + this.element.addClass("ui-accordion ui-widget ui-helper-reset"); + + // in lack of child-selectors in CSS we need to mark top-LIs in a UL-accordion for some IE-fix + if (this.element[0].nodeName == "UL") { + this.element.children("li").addClass("ui-accordion-li-fix"); + } + + this.headers = this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all") + .bind("mouseenter.accordion", function(){ $(this).addClass('ui-state-hover'); }) + .bind("mouseleave.accordion", function(){ $(this).removeClass('ui-state-hover'); }) + .bind("focus.accordion", function(){ $(this).addClass('ui-state-focus'); }) + .bind("blur.accordion", function(){ $(this).removeClass('ui-state-focus'); }); + + this.headers + .next() + .addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); + + this.active = this._findActive(this.active || o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top"); + this.active.next().addClass('ui-accordion-content-active'); + + //Append icon elements + $("").addClass("ui-icon " + o.icons.header).prependTo(this.headers); + this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected); + + // IE7-/Win - Extra vertical space in lists fixed + if ($.browser.msie) { + this.element.find('a').css('zoom', '1'); + } + + this.resize(); + + //ARIA + this.element.attr('role','tablist'); + + this.headers + .attr('role','tab') + .bind('keydown', function(event) { return self._keydown(event); }) + .next() + .attr('role','tabpanel'); + + this.headers + .not(this.active || "") + .attr('aria-expanded','false') + .attr("tabIndex", "-1") + .next() + .hide(); + + // make sure at least one header is in the tab order + if (!this.active.length) { + this.headers.eq(0).attr('tabIndex','0'); + } else { + this.active + .attr('aria-expanded','true') + .attr('tabIndex', '0'); + } + + // only need links in taborder for Safari + if (!$.browser.safari) + this.headers.find('a').attr('tabIndex','-1'); + + if (o.event) { + this.headers.bind((o.event) + ".accordion", function(event) { return self._clickHandler.call(self, event, this); }); + } + + }, + + destroy: function() { + var o = this.options; + + this.element + .removeClass("ui-accordion ui-widget ui-helper-reset") + .removeAttr("role") + .unbind('.accordion') + .removeData('accordion'); + + this.headers + .unbind(".accordion") + .removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top") + .removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex"); + + this.headers.find("a").removeAttr("tabindex"); + this.headers.children(".ui-icon").remove(); + var contents = this.headers.next().css("display", "").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active"); + if (o.autoHeight || o.fillHeight) { + contents.css("height", ""); + } + }, + + _setData: function(key, value) { + if(key == 'alwaysOpen') { key = 'collapsible'; value = !value; } + $.widget.prototype._setData.apply(this, arguments); + }, + + _keydown: function(event) { + + var o = this.options, keyCode = $.ui.keyCode; + + if (o.disabled || event.altKey || event.ctrlKey) + return; + + var length = this.headers.length; + var currentIndex = this.headers.index(event.target); + var toFocus = false; + + switch(event.keyCode) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[(currentIndex + 1) % length]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[(currentIndex - 1 + length) % length]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + return this._clickHandler({ target: event.target }, event.target); + } + + if (toFocus) { + $(event.target).attr('tabIndex','-1'); + $(toFocus).attr('tabIndex','0'); + toFocus.focus(); + return false; + } + + return true; + + }, + + resize: function() { + + var o = this.options, maxHeight; + + if (o.fillSpace) { + + if($.browser.msie) { var defOverflow = this.element.parent().css('overflow'); this.element.parent().css('overflow', 'hidden'); } + maxHeight = this.element.parent().height(); + if($.browser.msie) { this.element.parent().css('overflow', defOverflow); } + + this.headers.each(function() { + maxHeight -= $(this).outerHeight(); + }); + + var maxPadding = 0; + this.headers.next().each(function() { + maxPadding = Math.max(maxPadding, $(this).innerHeight() - $(this).height()); + }).height(Math.max(0, maxHeight - maxPadding)) + .css('overflow', 'auto'); + + } else if ( o.autoHeight ) { + maxHeight = 0; + this.headers.next().each(function() { + maxHeight = Math.max(maxHeight, $(this).outerHeight()); + }).height(maxHeight); + } + + }, + + activate: function(index) { + // call clickHandler with custom event + var active = this._findActive(index)[0]; + this._clickHandler({ target: active }, active); + }, + + _findActive: function(selector) { + return selector + ? typeof selector == "number" + ? this.headers.filter(":eq(" + selector + ")") + : this.headers.not(this.headers.not(selector)) + : selector === false + ? $([]) + : this.headers.filter(":eq(0)"); + }, + + _clickHandler: function(event, target) { + + var o = this.options; + if (o.disabled) return false; + + // called only when using activate(false) to close all parts programmatically + if (!event.target && o.collapsible) { + this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all") + .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header); + this.active.next().addClass('ui-accordion-content-active'); + var toHide = this.active.next(), + data = { + options: o, + newHeader: $([]), + oldHeader: o.active, + newContent: $([]), + oldContent: toHide + }, + toShow = (this.active = $([])); + this._toggle(toShow, toHide, data); + return false; + } + + // get the click target + var clicked = $(event.currentTarget || target); + var clickedIsActive = clicked[0] == this.active[0]; + + // if animations are still active, or the active header is the target, ignore click + if (this.running || (!o.collapsible && clickedIsActive)) { + return false; + } + + // switch classes + this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all") + .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header); + this.active.next().addClass('ui-accordion-content-active'); + if (!clickedIsActive) { + clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top") + .find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected); + clicked.next().addClass('ui-accordion-content-active'); + } + + // find elements to show and hide + var toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: o, + newHeader: clickedIsActive && o.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && o.collapsible ? $([]) : toShow.find('> *'), + oldContent: toHide.find('> *') + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + this.active = clickedIsActive ? $([]) : clicked; + this._toggle(toShow, toHide, data, clickedIsActive, down); + + return false; + + }, + + _toggle: function(toShow, toHide, data, clickedIsActive, down) { + + var o = this.options, self = this; + + this.toShow = toShow; + this.toHide = toHide; + this.data = data; + + var complete = function() { if(!self) return; return self._completed.apply(self, arguments); }; + + // trigger changestart event + this._trigger("changestart", null, this.data); + + // count elements to animate + this.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if (o.animated) { + + var animOptions = {}; + + if ( o.collapsible && clickedIsActive ) { + animOptions = { + toShow: $([]), + toHide: toHide, + complete: complete, + down: down, + autoHeight: o.autoHeight || o.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: o.autoHeight || o.fillSpace + }; + } + + if (!o.proxied) { + o.proxied = o.animated; + } + + if (!o.proxiedDuration) { + o.proxiedDuration = o.duration; + } + + o.animated = $.isFunction(o.proxied) ? + o.proxied(animOptions) : o.proxied; + + o.duration = $.isFunction(o.proxiedDuration) ? + o.proxiedDuration(animOptions) : o.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = o.duration, + easing = o.animated; + + if (!animations[easing]) { + animations[easing] = function(options) { + this.slide(options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[easing](animOptions); + + } else { + + if (o.collapsible && clickedIsActive) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete(true); + + } + + toHide.prev().attr('aria-expanded','false').attr("tabIndex", "-1").blur(); + toShow.prev().attr('aria-expanded','true').attr("tabIndex", "0").focus(); + + }, + + _completed: function(cancel) { + + var o = this.options; + + this.running = cancel ? 0 : --this.running; + if (this.running) return; + + if (o.clearStyle) { + this.toShow.add(this.toHide).css({ + height: "", + overflow: "" + }); + } + + this._trigger('change', null, this.data); + } + +}); + + +$.extend($.ui.accordion, { + version: "1.7.2", + defaults: { + active: null, + alwaysOpen: true, //deprecated, use collapsible + animated: 'slide', + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() == location.href.toLowerCase(); + } + }, + animations: { + slide: function(options, additions) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions); + if ( !options.toHide.size() ) { + options.toShow.animate({height: "show"}, options); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({height: "hide"}, options); + return; + } + var overflow = options.toShow.css('overflow'), + percentDone, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( parseInt(s.parent().width(),10) - parseInt(s.css("paddingLeft"),10) - parseInt(s.css("paddingRight"),10) - (parseInt(s.css("borderLeftWidth"),10) || 0) - (parseInt(s.css("borderRightWidth"),10) || 0) ); + + $.each(fxAttrs, function(i, prop) { + hideProps[prop] = 'hide'; + + var parts = ('' + $.css(options.toShow[0], prop)).match(/^([\d+-.]+)(.*)$/); + showProps[prop] = { + value: parts[1], + unit: parts[2] || 'px' + }; + }); + options.toShow.css({ height: 0, overflow: 'hidden' }).show(); + options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{ + step: function(now, settings) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if (settings.prop == 'height') { + percentDone = (settings.now - settings.start) / (settings.end - settings.start); + } + + options.toShow[0].style[settings.prop] = + (percentDone * showProps[settings.prop].value) + showProps[settings.prop].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css("height", ""); + } + options.toShow.css("width", originalWidth); + options.toShow.css({overflow: overflow}); + options.complete(); + } + }); + }, + bounceslide: function(options) { + this.slide(options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + }, + easeslide: function(options) { + this.slide(options, { + easing: "easeinout", + duration: 700 + }); + } + } +}); + +})(jQuery); +/* + * jQuery UI Datepicker 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * ui.core.js + */ + +(function($) { // hide the namespace + +$.extend($.ui, { datepicker: { version: "1.7.2" } }); + +var PROP_NAME = 'datepicker'; + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false // True if right-to-left language, false if left-to-right + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'show', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearRange: '-10:+10', // Range of years to display in drop-down, + // either relative to current year (-nn:+nn) or absolute (nnnn:nnnn) + showOtherMonths: false, // True to show dates in other months, false to leave blank + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'normal', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false // True to show button panel, false to not show it + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = $('
'); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) + target.id = 'dp' + (++this.uuid); + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([:\[\]\.])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + $('
'))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (appendText) { + inst.append = $('' + appendText + ''); + input[isRTL ? 'before' : 'after'](inst.append); + } + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == target) + $.datepicker._hideDatepicker(); + else + $.datepicker._showDatepicker(target); + return false; + }); + } + input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst)); + this._updateDatepicker(inst); + this._updateAlternate(inst); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param dateText string - the initial date to display (in the current format) + @param onSelect function - the function(dateText) to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, dateText, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + var id = 'dp' + (++this.uuid); + this._dialogInput = $(''); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + this._dialogInput.val(dateText); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth; + var browserHeight = window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', this._pos[0] + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(null); + } + var date = this._getDateDatepicker(target); + extendRemove(inst.settings, settings); + this._setDateDatepicker(target, date); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date + @param endDate Date - the new end date for a range (optional) */ + _setDateDatepicker: function(target, date, endDate) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date, endDate); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @return Date - the current date or + Date[2] - the current dates for a range */ + _getDateDatepicker: function(target) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(null, ''); + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + + ', td.' + $.datepicker._currentClass, inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + else + $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration')); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration')); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Pop-up the date picker for a given input field. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {})); + $.datepicker._hideDatepicker(null, ''); + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + inst.rangeStart = null; + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim') || 'show'; + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._datepickerShowing = true; + if ($.browser.msie && parseInt($.browser.version,10) < 7) // fix IE < 7 select problems + $('iframe.ui-datepicker-cover').css({width: inst.dpDiv.width() + 4, + height: inst.dpDiv.height() + 4}); + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim](duration, postProcess); + if (duration == '') + postProcess(); + if (inst.input[0].type != 'hidden') + inst.input[0].focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var dims = {width: inst.dpDiv.width() + 4, + height: inst.dpDiv.height() + 4}; + var self = this; + inst.dpDiv.empty().append(this._generateHTML(inst)) + .find('iframe.ui-datepicker-cover'). + css({width: dims.width, height: dims.height}) + .end() + .find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a') + .bind('mouseout', function(){ + $(this).removeClass('ui-state-hover'); + if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover'); + if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover'); + }) + .bind('mouseover', function(){ + if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) { + $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + $(this).addClass('ui-state-hover'); + if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover'); + if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover'); + } + }) + .end() + .find('.' + this._dayOverClass + ' a') + .trigger('mouseover') + .end(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + if (cols > 1) { + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + } else { + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + } + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst.input && inst.input[0].type != 'hidden' && inst == $.datepicker._curInst) + $(inst.input[0]).focus(); + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = (window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth) + $(document).scrollLeft(); + var viewHeight = (window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight) + $(document).scrollTop(); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? Math.abs(offset.left + dpWidth - viewWidth) : 0; + offset.top -= (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? Math.abs(offset.top + dpHeight + inputHeight*2 - viewHeight) : 0; + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) { + obj = obj.nextSibling; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker + @param duration string - the duration over which to close the date picker */ + _hideDatepicker: function(input, duration) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (inst.stayOpen) + this._selectDate('#' + inst.id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + inst.stayOpen = false; + if (this._datepickerShowing) { + duration = (duration != null ? duration : this._get(inst, 'duration')); + var showAnim = this._get(inst, 'showAnim'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + }; + if (duration != '' && $.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), + duration, postProcess); + else + inst.dpDiv[(duration == '' ? 'hide' : (showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide')))](duration, postProcess); + if (duration == '') + this._tidyDialog(inst); + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback + this._datepickerShowing = false; + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + this._curInst = null; + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + var $target = $(event.target); + if (($target.parents('#' + $.datepicker._mainDivId).length == 0) && + !$target.hasClass($.datepicker.markerClassName) && + !$target.hasClass($.datepicker._triggerClass) && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI)) + $.datepicker._hideDatepicker(null, ''); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst._selectingMonthYear = false; + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Restore input focus after not changing month/year. */ + _clickMonthYear: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (inst.input && inst._selectingMonthYear && !$.browser.msie) + inst.input[0].focus(); + inst._selectingMonthYear = !inst._selectingMonthYear; + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + if (inst.stayOpen) { + inst.endDay = inst.endMonth = inst.endYear = null; + } + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + if (inst.stayOpen) { + inst.rangeStart = this._daylightSavingAdjust( + new Date(inst.currentYear, inst.currentMonth, inst.currentDay)); + this._updateDatepicker(inst); + } + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + inst.stayOpen = false; + inst.endDay = inst.endMonth = inst.endYear = inst.rangeStart = null; + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else if (!inst.stayOpen) { + this._hideDatepicker(null, this._get(inst, 'duration')); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input[0].focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getFullYear(), date.getMonth(), date.getDate()); + var firstMon = new Date(checkDate.getFullYear(), 1 - 1, 4); // First week always contains 4 Jan + var firstDay = firstMon.getDay() || 7; // Day of week: Mon = 1, ..., Sun = 7 + firstMon.setDate(firstMon.getDate() + 1 - firstDay); // Preceding Monday + if (firstDay < 4 && checkDate < firstMon) { // Adjust first three days in year if necessary + checkDate.setDate(checkDate.getDate() - 3); // Generate for previous year + return $.datepicker.iso8601Week(checkDate); + } else if (checkDate > new Date(checkDate.getFullYear(), 12 - 1, 28)) { // Check last three days in year + firstDay = new Date(checkDate.getFullYear() + 1, 1 - 1, 4).getDay() || 7; + if (firstDay > 4 && (checkDate.getDay() || 7) < firstDay - 3) { // Adjust if necessary + return 1; + } + } + return Math.floor(((checkDate - firstMon) / 86400000) / 7) + 1; // Weeks to given date + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + lookAhead(match); + var origSize = (match == '@' ? 14 : (match == 'y' ? 4 : (match == 'o' ? 3 : 2))); + var size = origSize; + var num = 0; + while (size > 0 && iValue < value.length && + value.charAt(iValue) >= '0' && value.charAt(iValue) <= '9') { + num = num * 10 + parseInt(value.charAt(iValue++),10); + size--; + } + if (size == origSize) + throw 'Missing number at position ' + iValue; + return num; + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = (lookAhead(match) ? longNames : shortNames); + var size = 0; + for (var j = 0; j < names.length; j++) + size = Math.max(size, names[j].length); + var name = ''; + var iInit = iValue; + while (size > 0 && iValue < value.length) { + name += value.charAt(iValue++); + for (var i = 0; i < names.length; i++) + if (name == names[i]) + return i + 1; + size--; + } + throw 'Unknown name at position ' + iInit; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/* + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + var doy = date.getDate(); + for (var m = date.getMonth() - 1; m >= 0; m--) + doy += this._getDaysInMonth(date.getFullYear(), m); + output += formatNumber('o', doy, 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst) { + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.input ? inst.input.val() : null; + inst.endDay = inst.endMonth = inst.endYear = null; + var date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + date = defaultDate; + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + var date = this._determineDate(this._get(inst, 'defaultDate'), new Date()); + var minDate = this._getMinMaxDate(inst, 'min', true); + var maxDate = this._getMinMaxDate(inst, 'max'); + date = (minDate && date < minDate ? minDate : date); + date = (maxDate && date > maxDate ? maxDate : date); + return date; + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset, getDaysInMonth) { + var date = new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + date = (date == null ? defaultDate : + (typeof date == 'string' ? offsetString(date, this._getDaysInMonth) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date))); + date = (date && date.toString() == 'Invalid Date' ? defaultDate : date); + if (date) { + date.setHours(0); + date.setMinutes(0); + date.setSeconds(0); + date.setMilliseconds(0); + } + return this._daylightSavingAdjust(date); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, endDate) { + var clear = !(date); + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + date = this._determineDate(date, new Date()); + inst.selectedDay = inst.currentDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear(); + if (origMonth != inst.selectedMonth || origYear != inst.selectedYear) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var stepBigMonths = this._get(inst, 'stepBigMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min', true); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - numMonths[1] + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '' + prevText + '' : + (hideIfNoPrevNext ? '' : '' + prevText + '')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '' + nextText + '' : + (hideIfNoPrevNext ? '' : '' + nextText + '')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '' : ''); + var buttonPanel = (showButtonPanel) ? '
' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '' : '') + (isRTL ? '' : controls) + '
' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var endDate = inst.endDay ? this._daylightSavingAdjust( + new Date(inst.endYear, inst.endMonth, inst.endDay)) : currentDate; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '
'; + } + calender += '
' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + selectedDate, row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '
' + + ''; + var thead = ''; + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '' + dayNamesMin[day] + ''; + } + calender += thead + ''; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += ''; + var tbody = ''; + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = otherMonth || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += ''; // display for this month + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + ''; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '
' + // actions + (otherMonth ? (showOtherMonths ? printDate.getDate() : ' ') : // display for other months + (unselectable ? '' + printDate.getDate() + '' : '' + printDate.getDate() + '')) + '
' + (isMultiMonth ? '
' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '
' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + selectedDate, secondary, monthNames, monthNamesShort) { + minDate = (inst.rangeStart && minDate && selectedDate < minDate ? selectedDate : minDate); + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '
'; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '' + monthNames[drawMonth] + ' '; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += ''; + } + if (!showMonthAfterYear) + html += monthHtml + ((secondary || changeMonth || changeYear) && (!(changeMonth && changeYear)) ? ' ' : ''); + // year selection + if (secondary || !changeYear) + html += '' + drawYear + ''; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var year = 0; + var endYear = 0; + if (years.length != 2) { + year = drawYear - 10; + endYear = drawYear + 10; + } else if (years[0].charAt(0) == '+' || years[0].charAt(0) == '-') { + year = drawYear + parseInt(years[0], 10); + endYear = drawYear + parseInt(years[1], 10); + } else { + year = parseInt(years[0], 10); + endYear = parseInt(years[1], 10); + } + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + html += ''; + } + if (showMonthAfterYear) + html += (secondary || changeMonth || changeYear ? ' ' : '') + monthHtml; + html += '
'; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._daylightSavingAdjust(new Date(year, month, day)); + // ensure it is within the bounds set + var minDate = this._getMinMaxDate(inst, 'min', true); + var maxDate = this._getMinMaxDate(inst, 'max'); + date = (minDate && date < minDate ? minDate : date); + date = (maxDate && date > maxDate ? maxDate : date); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set - may be overridden for a range. */ + _getMinMaxDate: function(inst, minMax, checkRange) { + var date = this._determineDate(this._get(inst, minMax + 'Date'), null); + return (!checkRange || !inst.rangeStart ? date : + (!date || inst.rangeStart > date ? inst.rangeStart : date)); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - new Date(year, month, 32).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date( + curYear, curMonth + (offset < 0 ? offset : numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + // during range selection, use minimum of selected date and range start + var newMinDate = (!inst.rangeStart ? null : this._daylightSavingAdjust( + new Date(inst.selectedYear, inst.selectedMonth, inst.selectedDay))); + newMinDate = (newMinDate && inst.rangeStart < newMinDate ? inst.rangeStart : newMinDate); + var minDate = newMinDate || this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date >= minDate) && (!maxDate || date <= maxDate)); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.7.2"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window.DP_jQuery = $; + +})(jQuery); +/* + * jQuery UI Dialog 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * ui.core.js + * ui.draggable.js + * ui.resizable.js + */ +(function($) { + +var setDataSwitch = { + dragStart: "start.draggable", + drag: "drag.draggable", + dragStop: "stop.draggable", + maxHeight: "maxHeight.resizable", + minHeight: "minHeight.resizable", + maxWidth: "maxWidth.resizable", + minWidth: "minWidth.resizable", + resizeStart: "start.resizable", + resize: "drag.resizable", + resizeStop: "stop.resizable" + }, + + uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all '; + +$.widget("ui.dialog", { + + _init: function() { + this.originalTitle = this.element.attr('title'); + + var self = this, + options = this.options, + + title = options.title || this.originalTitle || ' ', + titleId = $.ui.dialog.getTitleId(this.element), + + uiDialog = (this.uiDialog = $('
')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + position: 'absolute', + overflow: 'hidden', + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + (options.closeOnEscape && event.keyCode + && event.keyCode == $.ui.keyCode.ESCAPE && self.close(event)); + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = this.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (this.uiDialogTitlebar = $('
')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .mousedown(function(ev) { + ev.stopPropagation(); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + (options.draggable && $.fn.draggable && this._makeDraggable()); + (options.resizable && $.fn.resizable && this._makeResizable()); + + this._createButtons(options.buttons); + this._isOpen = false; + + (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe()); + (options.autoOpen && this.open()); + + }, + + destroy: function() { + (this.overlay && this.overlay.destroy()); + this.uiDialog.hide(); + this.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + this.uiDialog.remove(); + + (this.originalTitle && this.element.attr('title', this.originalTitle)); + }, + + close: function(event) { + var self = this; + + if (false === self._trigger('beforeclose', event)) { + return; + } + + (self.overlay && self.overlay.destroy()); + self.uiDialog.unbind('keypress.ui-dialog'); + + (self.options.hide + ? self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }) + : self.uiDialog.hide() && self._trigger('close', event)); + + $.ui.dialog.overlay.resize(); + + self._isOpen = false; + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + var maxZ = 0; + $('.ui-dialog').each(function() { + if (this != self.uiDialog[0]) { + maxZ = Math.max(maxZ, $(this).css('z-index')); + } + }); + $.ui.dialog.maxZ = maxZ; + } + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + + if ((this.options.modal && !force) + || (!this.options.stack && !this.options.modal)) { + return this._trigger('focus', event); + } + + if (this.options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = this.options.zIndex; + } + (this.overlay && this.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = ++$.ui.dialog.maxZ)); + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') }; + this.uiDialog.css('z-index', ++$.ui.dialog.maxZ); + this.element.attr(saveScroll); + this._trigger('focus', event); + }, + + open: function() { + if (this._isOpen) { return; } + + var options = this.options, + uiDialog = this.uiDialog; + + this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null; + (uiDialog.next().length && uiDialog.appendTo('body')); + this._size(); + this._position(options.position); + uiDialog.show(options.show); + this.moveToTop(true); + + // prevent tabbing out of modal dialogs + (options.modal && uiDialog.bind('keypress.ui-dialog', function(event) { + if (event.keyCode != $.ui.keyCode.TAB) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first')[0], + last = tabbables.filter(':last')[0]; + + if (event.target == last && !event.shiftKey) { + setTimeout(function() { + first.focus(); + }, 1); + } else if (event.target == first && event.shiftKey) { + setTimeout(function() { + last.focus(); + }, 1); + } + })); + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $([]) + .add(uiDialog.find('.ui-dialog-content :tabbable:first')) + .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first')) + .add(uiDialog) + .filter(':first') + .focus(); + + this._trigger('open'); + this._isOpen = true; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('
') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ); + + // if we already have a button pane, remove it + this.uiDialog.find('.ui-dialog-buttonpane').remove(); + + (typeof buttons == 'object' && buttons !== null && + $.each(buttons, function() { return !(hasButtons = true); })); + if (hasButtons) { + $.each(buttons, function(name, fn) { + $('') + .addClass( + 'ui-state-default ' + + 'ui-corner-all' + ) + .text(name) + .click(function() { fn.apply(self.element[0], arguments); }) + .hover( + function() { + $(this).addClass('ui-state-hover'); + }, + function() { + $(this).removeClass('ui-state-hover'); + } + ) + .focus(function() { + $(this).addClass('ui-state-focus'); + }) + .blur(function() { + $(this).removeClass('ui-state-focus'); + }) + .appendTo(uiDialogButtonPane); + }); + uiDialogButtonPane.appendTo(this.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = this.options, + heightBeforeDrag; + + this.uiDialog.draggable({ + cancel: '.ui-dialog-content', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function() { + heightBeforeDrag = options.height; + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + (options.dragStart && options.dragStart.apply(self.element[0], arguments)); + }, + drag: function() { + (options.drag && options.drag.apply(self.element[0], arguments)); + }, + stop: function() { + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + (options.dragStop && options.dragStop.apply(self.element[0], arguments)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = this.options, + resizeHandles = typeof handles == 'string' + ? handles + : 'n,e,s,w,se,sw,ne,nw'; + + this.uiDialog.resizable({ + cancel: '.ui-dialog-content', + alsoResize: this.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: options.minHeight, + start: function() { + $(this).addClass("ui-dialog-resizing"); + (options.resizeStart && options.resizeStart.apply(self.element[0], arguments)); + }, + resize: function() { + (options.resize && options.resize.apply(self.element[0], arguments)); + }, + handles: resizeHandles, + stop: function() { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + (options.resizeStop && options.resizeStop.apply(self.element[0], arguments)); + $.ui.dialog.overlay.resize(); + } + }) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _position: function(pos) { + var wnd = $(window), doc = $(document), + pTop = doc.scrollTop(), pLeft = doc.scrollLeft(), + minTop = pTop; + + if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) { + pos = [ + pos == 'right' || pos == 'left' ? pos : 'center', + pos == 'top' || pos == 'bottom' ? pos : 'middle' + ]; + } + if (pos.constructor != Array) { + pos = ['center', 'middle']; + } + if (pos[0].constructor == Number) { + pLeft += pos[0]; + } else { + switch (pos[0]) { + case 'left': + pLeft += 0; + break; + case 'right': + pLeft += wnd.width() - this.uiDialog.outerWidth(); + break; + default: + case 'center': + pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2; + } + } + if (pos[1].constructor == Number) { + pTop += pos[1]; + } else { + switch (pos[1]) { + case 'top': + pTop += 0; + break; + case 'bottom': + pTop += wnd.height() - this.uiDialog.outerHeight(); + break; + default: + case 'middle': + pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2; + } + } + + // prevent the dialog from being too high (make sure the titlebar + // is accessible) + pTop = Math.max(pTop, minTop); + this.uiDialog.css({top: pTop, left: pLeft}); + }, + + _setData: function(key, value){ + (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value)); + switch (key) { + case "buttons": + this._createButtons(value); + break; + case "closeText": + this.uiDialogTitlebarCloseText.text(value); + break; + case "dialogClass": + this.uiDialog + .removeClass(this.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "draggable": + (value + ? this._makeDraggable() + : this.uiDialog.draggable('destroy')); + break; + case "height": + this.uiDialog.height(value); + break; + case "position": + this._position(value); + break; + case "resizable": + var uiDialog = this.uiDialog, + isResizable = this.uiDialog.is(':data(resizable)'); + + // currently resizable, becoming non-resizable + (isResizable && !value && uiDialog.resizable('destroy')); + + // currently resizable, changing handles + (isResizable && typeof value == 'string' && + uiDialog.resizable('option', 'handles', value)); + + // currently non-resizable, becoming resizable + (isResizable || this._makeResizable(value)); + break; + case "title": + $(".ui-dialog-title", this.uiDialogTitlebar).html(value || ' '); + break; + case "width": + this.uiDialog.width(value); + break; + } + + $.widget.prototype._setData.apply(this, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options; + + // reset content sizing + this.element.css({ + height: 0, + minHeight: 0, + width: 'auto' + }); + + // reset wrapper sizing + // determine the height of all the non-content elements + var nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + + this.element + .css({ + minHeight: Math.max(options.minHeight - nonContentHeight, 0), + height: options.height == 'auto' + ? 'auto' + : Math.max(options.height - nonContentHeight, 0) + }); + } +}); + +$.extend($.ui.dialog, { + version: "1.7.2", + defaults: { + autoOpen: true, + bgiframe: false, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: 'center', + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + getter: 'isOpen', + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid); + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + var dialogZ = $(event.target).parents('.ui-dialog').css('zIndex') || 0; + return (dialogZ > $.ui.dialog.overlay.maxZ); + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + (dialog.options.closeOnEscape && event.keyCode + && event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event)); + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = $('
').appendTo(document.body) + .addClass('ui-widget-overlay').css({ + width: this.width(), + height: this.height() + }); + + (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe()); + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + this.instances.splice($.inArray(this.instances, $el), 1); + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + var scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + var offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + var scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + var offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +})(jQuery); +/* + * jQuery UI Progressbar 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.progressbar", { + + _init: function() { + + this.element + .addClass("ui-progressbar" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all") + .attr({ + role: "progressbar", + "aria-valuemin": this._valueMin(), + "aria-valuemax": this._valueMax(), + "aria-valuenow": this._value() + }); + + this.valueDiv = $('
').appendTo(this.element); + + this._refreshValue(); + + }, + + destroy: function() { + + this.element + .removeClass("ui-progressbar" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all") + .removeAttr("role") + .removeAttr("aria-valuemin") + .removeAttr("aria-valuemax") + .removeAttr("aria-valuenow") + .removeData("progressbar") + .unbind(".progressbar"); + + this.valueDiv.remove(); + + $.widget.prototype.destroy.apply(this, arguments); + + }, + + value: function(newValue) { + if (newValue === undefined) { + return this._value(); + } + + this._setData('value', newValue); + return this; + }, + + _setData: function(key, value) { + + switch (key) { + case 'value': + this.options.value = value; + this._refreshValue(); + this._trigger('change', null, {}); + break; + } + + $.widget.prototype._setData.apply(this, arguments); + + }, + + _value: function() { + + var val = this.options.value; + if (val < this._valueMin()) val = this._valueMin(); + if (val > this._valueMax()) val = this._valueMax(); + + return val; + + }, + + _valueMin: function() { + var valueMin = 0; + return valueMin; + }, + + _valueMax: function() { + var valueMax = 100; + return valueMax; + }, + + _refreshValue: function() { + var value = this.value(); + this.valueDiv[value == this._valueMax() ? 'addClass' : 'removeClass']("ui-corner-right"); + this.valueDiv.width(value + '%'); + this.element.attr("aria-valuenow", value); + } + +}); + +$.extend($.ui.progressbar, { + version: "1.7.2", + defaults: { + value: 0 + } +}); + +})(jQuery); +/* + * jQuery UI Slider 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * ui.core.js + */ + +(function($) { + +$.widget("ui.slider", $.extend({}, $.ui.mouse, { + + _init: function() { + + var self = this, o = this.options; + this._keySliding = false; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass("ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all"); + + this.range = $([]); + + if (o.range) { + + if (o.range === true) { + this.range = $('
'); + if (!o.values) o.values = [this._valueMin(), this._valueMin()]; + if (o.values.length && o.values.length != 2) { + o.values = [o.values[0], o.values[0]]; + } + } else { + this.range = $('
'); + } + + this.range + .appendTo(this.element) + .addClass("ui-slider-range"); + + if (o.range == "min" || o.range == "max") { + this.range.addClass("ui-slider-range-" + o.range); + } + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + this.range.addClass("ui-widget-header"); + + } + + if ($(".ui-slider-handle", this.element).length == 0) + $('
') + .appendTo(this.element) + .addClass("ui-slider-handle"); + + if (o.values && o.values.length) { + while ($(".ui-slider-handle", this.element).length < o.values.length) + $('') + .appendTo(this.element) + .addClass("ui-slider-handle"); + } + + this.handles = $(".ui-slider-handle", this.element) + .addClass("ui-state-default" + + " ui-corner-all"); + + this.handle = this.handles.eq(0); + + this.handles.add(this.range).filter("a") + .click(function(event) { + event.preventDefault(); + }) + .hover(function() { + if (!o.disabled) { + $(this).addClass('ui-state-hover'); + } + }, function() { + $(this).removeClass('ui-state-hover'); + }) + .focus(function() { + if (!o.disabled) { + $(".ui-slider .ui-state-focus").removeClass('ui-state-focus'); $(this).addClass('ui-state-focus'); + } else { + $(this).blur(); + } + }) + .blur(function() { + $(this).removeClass('ui-state-focus'); + }); + + this.handles.each(function(i) { + $(this).data("index.ui-slider-handle", i); + }); + + this.handles.keydown(function(event) { + + var ret = true; + + var index = $(this).data("index.ui-slider-handle"); + + if (self.options.disabled) + return; + + switch (event.keyCode) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + ret = false; + if (!self._keySliding) { + self._keySliding = true; + $(this).addClass("ui-state-active"); + self._start(event, index); + } + break; + } + + var curVal, newVal, step = self._step(); + if (self.options.values && self.options.values.length) { + curVal = newVal = self.values(index); + } else { + curVal = newVal = self.value(); + } + + switch (event.keyCode) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if(curVal == self._valueMax()) return; + newVal = curVal + step; + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if(curVal == self._valueMin()) return; + newVal = curVal - step; + break; + } + + self._slide(event, index, newVal); + + return ret; + + }).keyup(function(event) { + + var index = $(this).data("index.ui-slider-handle"); + + if (self._keySliding) { + self._stop(event, index); + self._change(event, index); + self._keySliding = false; + $(this).removeClass("ui-state-active"); + } + + }); + + this._refreshValue(); + + }, + + destroy: function() { + + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass("ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all") + .removeData("slider") + .unbind(".slider"); + + this._mouseDestroy(); + + }, + + _mouseCapture: function(event) { + + var o = this.options; + + if (o.disabled) + return false; + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + var position = { x: event.pageX, y: event.pageY }; + var normValue = this._normValueFromMouse(position); + + var distance = this._valueMax() - this._valueMin() + 1, closestHandle; + var self = this, index; + this.handles.each(function(i) { + var thisDistance = Math.abs(normValue - self.values(i)); + if (distance > thisDistance) { + distance = thisDistance; + closestHandle = $(this); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if(o.range == true && this.values(1) == o.min) { + closestHandle = $(this.handles[++index]); + } + + this._start(event, index); + + self._handleIndex = index; + + closestHandle + .addClass("ui-state-active") + .focus(); + + var offset = closestHandle.offset(); + var mouseOverHandle = !$(event.target).parents().andSelf().is('.ui-slider-handle'); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - (closestHandle.width() / 2), + top: event.pageY - offset.top + - (closestHandle.height() / 2) + - (parseInt(closestHandle.css('borderTopWidth'),10) || 0) + - (parseInt(closestHandle.css('borderBottomWidth'),10) || 0) + + (parseInt(closestHandle.css('marginTop'),10) || 0) + }; + + normValue = this._normValueFromMouse(position); + this._slide(event, index, normValue); + return true; + + }, + + _mouseStart: function(event) { + return true; + }, + + _mouseDrag: function(event) { + + var position = { x: event.pageX, y: event.pageY }; + var normValue = this._normValueFromMouse(position); + + this._slide(event, this._handleIndex, normValue); + + return false; + + }, + + _mouseStop: function(event) { + + this.handles.removeClass("ui-state-active"); + this._stop(event, this._handleIndex); + this._change(event, this._handleIndex); + this._handleIndex = null; + this._clickOffset = null; + + return false; + + }, + + _detectOrientation: function() { + this.orientation = this.options.orientation == 'vertical' ? 'vertical' : 'horizontal'; + }, + + _normValueFromMouse: function(position) { + + var pixelTotal, pixelMouse; + if ('horizontal' == this.orientation) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - (this._clickOffset ? this._clickOffset.left : 0); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - (this._clickOffset ? this._clickOffset.top : 0); + } + + var percentMouse = (pixelMouse / pixelTotal); + if (percentMouse > 1) percentMouse = 1; + if (percentMouse < 0) percentMouse = 0; + if ('vertical' == this.orientation) + percentMouse = 1 - percentMouse; + + var valueTotal = this._valueMax() - this._valueMin(), + valueMouse = percentMouse * valueTotal, + valueMouseModStep = valueMouse % this.options.step, + normValue = this._valueMin() + valueMouse - valueMouseModStep; + + if (valueMouseModStep > (this.options.step / 2)) + normValue += this.options.step; + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat(normValue.toFixed(5)); + + }, + + _start: function(event, index) { + var uiHash = { + handle: this.handles[index], + value: this.value() + }; + if (this.options.values && this.options.values.length) { + uiHash.value = this.values(index); + uiHash.values = this.values(); + } + this._trigger("start", event, uiHash); + }, + + _slide: function(event, index, newVal) { + + var handle = this.handles[index]; + + if (this.options.values && this.options.values.length) { + + var otherVal = this.values(index ? 0 : 1); + + if ((this.options.values.length == 2 && this.options.range === true) && + ((index == 0 && newVal > otherVal) || (index == 1 && newVal < otherVal))){ + newVal = otherVal; + } + + if (newVal != this.values(index)) { + var newValues = this.values(); + newValues[index] = newVal; + // A slide can be canceled by returning false from the slide callback + var allowed = this._trigger("slide", event, { + handle: this.handles[index], + value: newVal, + values: newValues + }); + var otherVal = this.values(index ? 0 : 1); + if (allowed !== false) { + this.values(index, newVal, ( event.type == 'mousedown' && this.options.animate ), true); + } + } + + } else { + + if (newVal != this.value()) { + // A slide can be canceled by returning false from the slide callback + var allowed = this._trigger("slide", event, { + handle: this.handles[index], + value: newVal + }); + if (allowed !== false) { + this._setData('value', newVal, ( event.type == 'mousedown' && this.options.animate )); + } + + } + + } + + }, + + _stop: function(event, index) { + var uiHash = { + handle: this.handles[index], + value: this.value() + }; + if (this.options.values && this.options.values.length) { + uiHash.value = this.values(index); + uiHash.values = this.values(); + } + this._trigger("stop", event, uiHash); + }, + + _change: function(event, index) { + var uiHash = { + handle: this.handles[index], + value: this.value() + }; + if (this.options.values && this.options.values.length) { + uiHash.value = this.values(index); + uiHash.values = this.values(); + } + this._trigger("change", event, uiHash); + }, + + value: function(newValue) { + + if (arguments.length) { + this._setData("value", newValue); + this._change(null, 0); + } + + return this._value(); + + }, + + values: function(index, newValue, animated, noPropagation) { + + if (arguments.length > 1) { + this.options.values[index] = newValue; + this._refreshValue(animated); + if(!noPropagation) this._change(null, index); + } + + if (arguments.length) { + if (this.options.values && this.options.values.length) { + return this._values(index); + } else { + return this.value(); + } + } else { + return this._values(); + } + + }, + + _setData: function(key, value, animated) { + + $.widget.prototype._setData.apply(this, arguments); + + switch (key) { + case 'disabled': + if (value) { + this.handles.filter(".ui-state-focus").blur(); + this.handles.removeClass("ui-state-hover"); + this.handles.attr("disabled", "disabled"); + } else { + this.handles.removeAttr("disabled"); + } + case 'orientation': + + this._detectOrientation(); + + this.element + .removeClass("ui-slider-horizontal ui-slider-vertical") + .addClass("ui-slider-" + this.orientation); + this._refreshValue(animated); + break; + case 'value': + this._refreshValue(animated); + break; + } + + }, + + _step: function() { + var step = this.options.step; + return step; + }, + + _value: function() { + + var val = this.options.value; + if (val < this._valueMin()) val = this._valueMin(); + if (val > this._valueMax()) val = this._valueMax(); + + return val; + + }, + + _values: function(index) { + + if (arguments.length) { + var val = this.options.values[index]; + if (val < this._valueMin()) val = this._valueMin(); + if (val > this._valueMax()) val = this._valueMax(); + + return val; + } else { + return this.options.values; + } + + }, + + _valueMin: function() { + var valueMin = this.options.min; + return valueMin; + }, + + _valueMax: function() { + var valueMax = this.options.max; + return valueMax; + }, + + _refreshValue: function(animate) { + + var oRange = this.options.range, o = this.options, self = this; + + if (this.options.values && this.options.values.length) { + var vp0, vp1; + this.handles.each(function(i, j) { + var valPercent = (self.values(i) - self._valueMin()) / (self._valueMax() - self._valueMin()) * 100; + var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%'; + $(this).stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate); + if (self.options.range === true) { + if (self.orientation == 'horizontal') { + (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ left: valPercent + '%' }, o.animate); + (i == 1) && self.range[animate ? 'animate' : 'css']({ width: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate }); + } else { + (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ bottom: (valPercent) + '%' }, o.animate); + (i == 1) && self.range[animate ? 'animate' : 'css']({ height: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate }); + } + } + lastValPercent = valPercent; + }); + } else { + var value = this.value(), + valueMin = this._valueMin(), + valueMax = this._valueMax(), + valPercent = valueMax != valueMin + ? (value - valueMin) / (valueMax - valueMin) * 100 + : 0; + var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%'; + this.handle.stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate); + + (oRange == "min") && (this.orientation == "horizontal") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ width: valPercent + '%' }, o.animate); + (oRange == "max") && (this.orientation == "horizontal") && this.range[animate ? 'animate' : 'css']({ width: (100 - valPercent) + '%' }, { queue: false, duration: o.animate }); + (oRange == "min") && (this.orientation == "vertical") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ height: valPercent + '%' }, o.animate); + (oRange == "max") && (this.orientation == "vertical") && this.range[animate ? 'animate' : 'css']({ height: (100 - valPercent) + '%' }, { queue: false, duration: o.animate }); + } + + } + +})); + +$.extend($.ui.slider, { + getter: "value values", + version: "1.7.2", + eventPrefix: "slide", + defaults: { + animate: false, + delay: 0, + distance: 0, + max: 100, + min: 0, + orientation: 'horizontal', + range: false, + step: 1, + value: 0, + values: null + } +}); + +})(jQuery); +/* + * jQuery UI Tabs 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.tabs", { + + _init: function() { + if (this.options.deselectable !== undefined) { + this.options.collapsible = this.options.deselectable; + } + this._tabify(true); + }, + + _setData: function(key, value) { + if (key == 'selected') { + if (this.options.collapsible && value == this.options.selected) { + return; + } + this.select(value); + } + else { + this.options[key] = value; + if (key == 'deselectable') { + this.options.collapsible = value; + } + this._tabify(); + } + }, + + _tabId: function(a) { + return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') || + this.options.idPrefix + $.data(a); + }, + + _sanitizeSelector: function(hash) { + return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":" + }, + + _cookie: function() { + var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + $.data(this.list[0])); + return $.cookie.apply(null, [cookie].concat($.makeArray(arguments))); + }, + + _ui: function(tab, panel) { + return { + tab: tab, + panel: panel, + index: this.anchors.index(tab) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter('.ui-state-processing').removeClass('ui-state-processing') + .find('span:data(label.tabs)') + .each(function() { + var el = $(this); + el.html(el.data('label.tabs')).removeData('label.tabs'); + }); + }, + + _tabify: function(init) { + + this.list = this.element.children('ul:first'); + this.lis = $('li:has(a[href])', this.list); + this.anchors = this.lis.map(function() { return $('a', this)[0]; }); + this.panels = $([]); + + var self = this, o = this.options; + + var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + this.anchors.each(function(i, a) { + var href = $(a).attr('href'); + + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split('#')[0], baseEl; + if (hrefBase && (hrefBase === location.toString().split('#')[0] || + (baseEl = $('base')[0]) && hrefBase === baseEl.href)) { + href = a.hash; + a.href = href; + } + + // inline tab + if (fragmentId.test(href)) { + self.panels = self.panels.add(self._sanitizeSelector(href)); + } + + // remote tab + else if (href != '#') { // prevent loading the page itself if href is just "#" + $.data(a, 'href.tabs', href); // required for restore on destroy + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data + + var id = self._tabId(a); + a.href = '#' + id; + var $panel = $('#' + id); + if (!$panel.length) { + $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom') + .insertAfter(self.panels[i - 1] || self.list); + $panel.data('destroy.tabs', true); + } + self.panels = self.panels.add($panel); + } + + // invalid tab href + else { + o.disabled.push(i); + } + }); + + // initialization from scratch + if (init) { + + // attach necessary classes for styling + this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all'); + this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all'); + this.lis.addClass('ui-state-default ui-corner-top'); + this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom'); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on
  • + if (o.selected === undefined) { + if (location.hash) { + this.anchors.each(function(i, a) { + if (a.hash == location.hash) { + o.selected = i; + return false; // break + } + }); + } + if (typeof o.selected != 'number' && o.cookie) { + o.selected = parseInt(self._cookie(), 10); + } + if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) { + o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected')); + } + o.selected = o.selected || 0; + } + else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique(o.disabled.concat( + $.map(this.lis.filter('.ui-state-disabled'), + function(n, i) { return self.lis.index(n); } ) + )).sort(); + + if ($.inArray(o.selected, o.disabled) != -1) { + o.disabled.splice($.inArray(o.selected, o.disabled), 1); + } + + // highlight selected tab + this.panels.addClass('ui-tabs-hide'); + this.lis.removeClass('ui-tabs-selected ui-state-active'); + if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list + this.panels.eq(o.selected).removeClass('ui-tabs-hide'); + this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active'); + + // seems to be expected behavior that the show callback is fired + self.element.queue("tabs", function() { + self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected])); + }); + + this.load(o.selected); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + $(window).bind('unload', function() { + self.lis.add(self.anchors).unbind('.tabs'); + self.lis = self.anchors = self.panels = null; + }); + + } + // update selected after add/remove + else { + o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected')); + } + + // update collapsible + this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible'); + + // set or update cookie after init and add/remove respectively + if (o.cookie) { + this._cookie(o.selected, o.cookie); + } + + // disable tabs + for (var i = 0, li; (li = this.lis[i]); i++) { + $(li)[$.inArray(i, o.disabled) != -1 && + !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled'); + } + + // reset cache if switching from cached to not cached + if (o.cache === false) { + this.anchors.removeData('cache.tabs'); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add(this.anchors).unbind('.tabs'); + + if (o.event != 'mouseover') { + var addState = function(state, el) { + if (el.is(':not(.ui-state-disabled)')) { + el.addClass('ui-state-' + state); + } + }; + var removeState = function(state, el) { + el.removeClass('ui-state-' + state); + }; + this.lis.bind('mouseover.tabs', function() { + addState('hover', $(this)); + }); + this.lis.bind('mouseout.tabs', function() { + removeState('hover', $(this)); + }); + this.anchors.bind('focus.tabs', function() { + addState('focus', $(this).closest('li')); + }); + this.anchors.bind('blur.tabs', function() { + removeState('focus', $(this).closest('li')); + }); + } + + // set up animations + var hideFx, showFx; + if (o.fx) { + if ($.isArray(o.fx)) { + hideFx = o.fx[0]; + showFx = o.fx[1]; + } + else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle($el, fx) { + $el.css({ display: '' }); + if ($.browser.msie && fx.opacity) { + $el[0].style.removeAttribute('filter'); + } + } + + // Show a tab... + var showTab = showFx ? + function(clicked, $show) { + $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active'); + $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way + .animate(showFx, showFx.duration || 'normal', function() { + resetStyle($show, showFx); + self._trigger('show', null, self._ui(clicked, $show[0])); + }); + } : + function(clicked, $show) { + $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active'); + $show.removeClass('ui-tabs-hide'); + self._trigger('show', null, self._ui(clicked, $show[0])); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx ? + function(clicked, $hide) { + $hide.animate(hideFx, hideFx.duration || 'normal', function() { + self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default'); + $hide.addClass('ui-tabs-hide'); + resetStyle($hide, hideFx); + self.element.dequeue("tabs"); + }); + } : + function(clicked, $hide, $show) { + self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default'); + $hide.addClass('ui-tabs-hide'); + self.element.dequeue("tabs"); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind(o.event + '.tabs', function() { + var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'), + $show = $(self._sanitizeSelector(this.hash)); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if (($li.hasClass('ui-tabs-selected') && !o.collapsible) || + $li.hasClass('ui-state-disabled') || + $li.hasClass('ui-state-processing') || + self._trigger('select', null, self._ui(this, $show[0])) === false) { + this.blur(); + return false; + } + + o.selected = self.anchors.index(this); + + self.abort(); + + // if tab may be closed + if (o.collapsible) { + if ($li.hasClass('ui-tabs-selected')) { + o.selected = -1; + + if (o.cookie) { + self._cookie(o.selected, o.cookie); + } + + self.element.queue("tabs", function() { + hideTab(el, $hide); + }).dequeue("tabs"); + + this.blur(); + return false; + } + else if (!$hide.length) { + if (o.cookie) { + self._cookie(o.selected, o.cookie); + } + + self.element.queue("tabs", function() { + showTab(el, $show); + }); + + self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + + this.blur(); + return false; + } + } + + if (o.cookie) { + self._cookie(o.selected, o.cookie); + } + + // show new tab + if ($show.length) { + if ($hide.length) { + self.element.queue("tabs", function() { + hideTab(el, $hide); + }); + } + self.element.queue("tabs", function() { + showTab(el, $show); + }); + + self.load(self.anchors.index(this)); + } + else { + throw 'jQuery UI Tabs: Mismatching fragment identifier.'; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ($.browser.msie) { + this.blur(); + } + + }); + + // disable click in any case + this.anchors.bind('click.tabs', function(){return false;}); + + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element.unbind('.tabs') + .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible') + .removeData('tabs'); + + this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all'); + + this.anchors.each(function() { + var href = $.data(this, 'href.tabs'); + if (href) { + this.href = href; + } + var $this = $(this).unbind('.tabs'); + $.each(['href', 'load', 'cache'], function(i, prefix) { + $this.removeData(prefix + '.tabs'); + }); + }); + + this.lis.unbind('.tabs').add(this.panels).each(function() { + if ($.data(this, 'destroy.tabs')) { + $(this).remove(); + } + else { + $(this).removeClass([ + 'ui-state-default', + 'ui-corner-top', + 'ui-tabs-selected', + 'ui-state-active', + 'ui-state-hover', + 'ui-state-focus', + 'ui-state-disabled', + 'ui-tabs-panel', + 'ui-widget-content', + 'ui-corner-bottom', + 'ui-tabs-hide' + ].join(' ')); + } + }); + + if (o.cookie) { + this._cookie(null, o.cookie); + } + }, + + add: function(url, label, index) { + if (index === undefined) { + index = this.anchors.length; // append by default + } + + var self = this, o = this.options, + $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)), + id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]); + + $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true); + + // try to find an existing element before creating a new one + var $panel = $('#' + id); + if (!$panel.length) { + $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true); + } + $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide'); + + if (index >= this.lis.length) { + $li.appendTo(this.list); + $panel.appendTo(this.list[0].parentNode); + } + else { + $li.insertBefore(this.lis[index]); + $panel.insertBefore(this.panels[index]); + } + + o.disabled = $.map(o.disabled, + function(n, i) { return n >= index ? ++n : n; }); + + this._tabify(); + + if (this.anchors.length == 1) { // after tabify + $li.addClass('ui-tabs-selected ui-state-active'); + $panel.removeClass('ui-tabs-hide'); + this.element.queue("tabs", function() { + self._trigger('show', null, self._ui(self.anchors[0], self.panels[0])); + }); + + this.load(0); + } + + // callback + this._trigger('add', null, this._ui(this.anchors[index], this.panels[index])); + }, + + remove: function(index) { + var o = this.options, $li = this.lis.eq(index).remove(), + $panel = this.panels.eq(index).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) { + this.select(index + (index + 1 < this.anchors.length ? 1 : -1)); + } + + o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }), + function(n, i) { return n >= index ? --n : n; }); + + this._tabify(); + + // callback + this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0])); + }, + + enable: function(index) { + var o = this.options; + if ($.inArray(index, o.disabled) == -1) { + return; + } + + this.lis.eq(index).removeClass('ui-state-disabled'); + o.disabled = $.grep(o.disabled, function(n, i) { return n != index; }); + + // callback + this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index])); + }, + + disable: function(index) { + var self = this, o = this.options; + if (index != o.selected) { // cannot disable already selected tab + this.lis.eq(index).addClass('ui-state-disabled'); + + o.disabled.push(index); + o.disabled.sort(); + + // callback + this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index])); + } + }, + + select: function(index) { + if (typeof index == 'string') { + index = this.anchors.index(this.anchors.filter('[href$=' + index + ']')); + } + else if (index === null) { // usage of null is deprecated, TODO remove in next release + index = -1; + } + if (index == -1 && this.options.collapsible) { + index = this.options.selected; + } + + this.anchors.eq(index).trigger(this.options.event + '.tabs'); + }, + + load: function(index) { + var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs'); + + this.abort(); + + // not remote or from cache + if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) { + this.element.dequeue("tabs"); + return; + } + + // load remote from here on + this.lis.eq(index).addClass('ui-state-processing'); + + if (o.spinner) { + var span = $('span', a); + span.data('label.tabs', span.html()).html(o.spinner); + } + + this.xhr = $.ajax($.extend({}, o.ajaxOptions, { + url: url, + success: function(r, s) { + $(self._sanitizeSelector(a.hash)).html(r); + + // take care of tab labels + self._cleanup(); + + if (o.cache) { + $.data(a, 'cache.tabs', true); // if loaded once do not load them again + } + + // callbacks + self._trigger('load', null, self._ui(self.anchors[index], self.panels[index])); + try { + o.ajaxOptions.success(r, s); + } + catch (e) {} + + // last, so that load event is fired before show... + self.element.dequeue("tabs"); + } + })); + }, + + abort: function() { + // stop possibly running animations + this.element.queue([]); + this.panels.stop(false, true); + + // terminate pending requests from other tabs + if (this.xhr) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + + }, + + url: function(index, url) { + this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url); + }, + + length: function() { + return this.anchors.length; + } + +}); + +$.extend($.ui.tabs, { + version: '1.7.2', + getter: 'length', + defaults: { + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disabled: [], + event: 'click', + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: 'ui-tabs-', + panelTemplate: '
    ', + spinner: 'Loading…', + tabTemplate: '
  • #{label}
  • ' + } +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend($.ui.tabs.prototype, { + rotation: null, + rotate: function(ms, continuing) { + + var self = this, o = this.options; + + var rotate = self._rotate || (self._rotate = function(e) { + clearTimeout(self.rotation); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms); + + if (e) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || (self._unrotate = !continuing ? + function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } : + function(e) { + t = o.selected; + rotate(); + }); + + // start rotation + if (ms) { + this.element.bind('tabsshow', rotate); + this.anchors.bind(o.event + '.tabs', stop); + rotate(); + } + // stop rotation + else { + clearTimeout(self.rotation); + this.element.unbind('tabsshow', rotate); + this.anchors.unbind(o.event + '.tabs', stop); + delete this._rotate; + delete this._unrotate; + } + } +}); + +})(jQuery); diff --git a/www/protected/extensions/dashboard/assests/js/jquery.cookie.js b/www/protected/extensions/dashboard/assests/js/jquery.cookie.js new file mode 100644 index 0000000..61d3bce --- /dev/null +++ b/www/protected/extensions/dashboard/assests/js/jquery.cookie.js @@ -0,0 +1,91 @@ +/*jslint browser: true */ /*global jQuery: true */ + +/** + * jQuery Cookie plugin + * + * Copyright (c) 2010 Klaus Hartl (stilbuero.de) + * Dual licensed under the MIT and GPL licenses: + * http://www.opensource.org/licenses/mit-license.php + * http://www.gnu.org/licenses/gpl.html + * + */ + +// TODO JsDoc + +/** + * Create a cookie with the given key and value and other optional parameters. + * + * @example $.cookie('the_cookie', 'the_value'); + * @desc Set the value of a cookie. + * @example $.cookie('the_cookie', 'the_value', { expires: 7, path: '/', domain: 'jquery.com', secure: true }); + * @desc Create a cookie with all available options. + * @example $.cookie('the_cookie', 'the_value'); + * @desc Create a session cookie. + * @example $.cookie('the_cookie', null); + * @desc Delete a cookie by passing null as value. Keep in mind that you have to use the same path and domain + * used when the cookie was set. + * + * @param String key The key of the cookie. + * @param String value The value of the cookie. + * @param Object options An object literal containing key/value pairs to provide optional cookie attributes. + * @option Number|Date expires Either an integer specifying the expiration date from now on in days or a Date object. + * If a negative value is specified (e.g. a date in the past), the cookie will be deleted. + * If set to null or omitted, the cookie will be a session cookie and will not be retained + * when the the browser exits. + * @option String path The value of the path atribute of the cookie (default: path of page that created the cookie). + * @option String domain The value of the domain attribute of the cookie (default: domain of page that created the cookie). + * @option Boolean secure If true, the secure attribute of the cookie will be set and the cookie transmission will + * require a secure protocol (like HTTPS). + * @type undefined + * + * @name $.cookie + * @cat Plugins/Cookie + * @author Klaus Hartl/klaus.hartl@stilbuero.de + */ + +/** + * Get the value of a cookie with the given key. + * + * @example $.cookie('the_cookie'); + * @desc Get the value of a cookie. + * + * @param String key The key of the cookie. + * @return The value of the cookie. + * @type String + * + * @name $.cookie + * @cat Plugins/Cookie + * @author Klaus Hartl/klaus.hartl@stilbuero.de + */ +jQuery.cookie = function (key, value, options) { + + // key and at least value given, set cookie... + if (arguments.length > 1 && String(value) !== "[object Object]") { + options = jQuery.extend({}, options); + + if (value === null || value === undefined) { + options.expires = -1; + } + + if (typeof options.expires === 'number') { + var days = options.expires, t = options.expires = new Date(); + t.setDate(t.getDate() + days); + } + + value = String(value); + + return (document.cookie = [ + encodeURIComponent(key), '=', + options.raw ? value : encodeURIComponent(value), + options.expires ? '; expires=' + options.expires.toUTCString() : '', // use expires attribute, max-age is not supported by IE + options.path ? '; path=' + options.path : '', + options.domain ? '; domain=' + options.domain : '', + options.secure ? '; secure' : '' + ].join('')); + } + + // key and possibly options given, get cookie... + options = value || {}; + var result, decode = options.raw ? function (s) { return s; } : decodeURIComponent; + return (result = new RegExp('(?:^|; )' + encodeURIComponent(key) + '=([^;]*)').exec(document.cookie)) ? decode(result[1]) : null; +}; diff --git a/www/protected/extensions/dashboard/assests/js/jquery.js b/www/protected/extensions/dashboard/assests/js/jquery.js new file mode 100644 index 0000000..423fd77 --- /dev/null +++ b/www/protected/extensions/dashboard/assests/js/jquery.js @@ -0,0 +1,4376 @@ +/*! + * jQuery JavaScript Library v1.3.2 + * http://jquery.com/ + * + * Copyright (c) 2009 John Resig + * Dual licensed under the MIT and GPL licenses. + * http://docs.jquery.com/License + * + * Date: 2009-02-19 17:34:21 -0500 (Thu, 19 Feb 2009) + * Revision: 6246 + */ +(function(){ + +var + // Will speed up references to window, and allows munging its name. + window = this, + // Will speed up references to undefined, and allows munging its name. + undefined, + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + // Map over the $ in case of overwrite + _$ = window.$, + + jQuery = window.jQuery = window.$ = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context ); + }, + + // A simple way to check for HTML strings or ID strings + // (both of which we optimize for) + quickExpr = /^[^<]*(<(.|\s)+>)[^>]*$|^#([\w-]+)$/, + // Is it a simple selector + isSimple = /^.[^:#\[\.,]*$/; + +jQuery.fn = jQuery.prototype = { + init: function( selector, context ) { + // Make sure that a selection was provided + selector = selector || document; + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this[0] = selector; + this.length = 1; + this.context = selector; + return this; + } + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + var match = quickExpr.exec( selector ); + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) + selector = jQuery.clean( [ match[1] ], context ); + + // HANDLE: $("#id") + else { + var elem = document.getElementById( match[3] ); + + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem && elem.id != match[3] ) + return jQuery().find( selector ); + + // Otherwise, we inject the element directly into the jQuery object + var ret = jQuery( elem || [] ); + ret.context = document; + ret.selector = selector; + return ret; + } + + // HANDLE: $(expr, [context]) + // (which is just equivalent to: $(content).find(expr) + } else + return jQuery( context ).find( selector ); + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) + return jQuery( document ).ready( selector ); + + // Make sure that old selector state is passed along + if ( selector.selector && selector.context ) { + this.selector = selector.selector; + this.context = selector.context; + } + + return this.setArray(jQuery.isArray( selector ) ? + selector : + jQuery.makeArray(selector)); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.3.2", + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num === undefined ? + + // Return a 'clean' array + Array.prototype.slice.call( this ) : + + // Return just the object + this[ num ]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = jQuery( elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) + ret.selector = this.selector + (this.selector ? " " : "") + selector; + else if ( name ) + ret.selector = this.selector + "." + name + "(" + selector + ")"; + + // Return the newly-formed element set + return ret; + }, + + // Force the current matched set of elements to become + // the specified array of elements (destroying the stack in the process) + // You should use pushStack() in order to do this, but maintain the stack + setArray: function( elems ) { + // Resetting the length to 0, then using the native Array push + // is a super-fast way to populate an object with array-like properties + this.length = 0; + Array.prototype.push.apply( this, elems ); + + return this; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem && elem.jquery ? elem[0] : elem + , this ); + }, + + attr: function( name, value, type ) { + var options = name; + + // Look for the case where we're accessing a style value + if ( typeof name === "string" ) + if ( value === undefined ) + return this[0] && jQuery[ type || "attr" ]( this[0], name ); + + else { + options = {}; + options[ name ] = value; + } + + // Check to see if we're setting style values + return this.each(function(i){ + // Set all the styles + for ( name in options ) + jQuery.attr( + type ? + this.style : + this, + name, jQuery.prop( this, options[ name ], type, i, name ) + ); + }); + }, + + css: function( key, value ) { + // ignore negative width and height values + if ( (key == 'width' || key == 'height') && parseFloat(value) < 0 ) + value = undefined; + return this.attr( key, value, "curCSS" ); + }, + + text: function( text ) { + if ( typeof text !== "object" && text != null ) + return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) ); + + var ret = ""; + + jQuery.each( text || this, function(){ + jQuery.each( this.childNodes, function(){ + if ( this.nodeType != 8 ) + ret += this.nodeType != 1 ? + this.nodeValue : + jQuery.fn.text( [ this ] ); + }); + }); + + return ret; + }, + + wrapAll: function( html ) { + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).clone(); + + if ( this[0].parentNode ) + wrap.insertBefore( this[0] ); + + wrap.map(function(){ + var elem = this; + + while ( elem.firstChild ) + elem = elem.firstChild; + + return elem; + }).append(this); + } + + return this; + }, + + wrapInner: function( html ) { + return this.each(function(){ + jQuery( this ).contents().wrapAll( html ); + }); + }, + + wrap: function( html ) { + return this.each(function(){ + jQuery( this ).wrapAll( html ); + }); + }, + + append: function() { + return this.domManip(arguments, true, function(elem){ + if (this.nodeType == 1) + this.appendChild( elem ); + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function(elem){ + if (this.nodeType == 1) + this.insertBefore( elem, this.firstChild ); + }); + }, + + before: function() { + return this.domManip(arguments, false, function(elem){ + this.parentNode.insertBefore( elem, this ); + }); + }, + + after: function() { + return this.domManip(arguments, false, function(elem){ + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + }, + + end: function() { + return this.prevObject || jQuery( [] ); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: [].push, + sort: [].sort, + splice: [].splice, + + find: function( selector ) { + if ( this.length === 1 ) { + var ret = this.pushStack( [], "find", selector ); + ret.length = 0; + jQuery.find( selector, this[0], ret ); + return ret; + } else { + return this.pushStack( jQuery.unique(jQuery.map(this, function(elem){ + return jQuery.find( selector, elem ); + })), "find", selector ); + } + }, + + clone: function( events ) { + // Do the clone + var ret = this.map(function(){ + if ( !jQuery.support.noCloneEvent && !jQuery.isXMLDoc(this) ) { + // IE copies events bound via attachEvent when + // using cloneNode. Calling detachEvent on the + // clone will also remove the events from the orignal + // In order to get around this, we use innerHTML. + // Unfortunately, this means some modifications to + // attributes in IE that are actually only stored + // as properties will not be copied (such as the + // the name attribute on an input). + var html = this.outerHTML; + if ( !html ) { + var div = this.ownerDocument.createElement("div"); + div.appendChild( this.cloneNode(true) ); + html = div.innerHTML; + } + + return jQuery.clean([html.replace(/ jQuery\d+="(?:\d+|null)"/g, "").replace(/^\s*/, "")])[0]; + } else + return this.cloneNode(true); + }); + + // Copy the events from the original to the clone + if ( events === true ) { + var orig = this.find("*").andSelf(), i = 0; + + ret.find("*").andSelf().each(function(){ + if ( this.nodeName !== orig[i].nodeName ) + return; + + var events = jQuery.data( orig[i], "events" ); + + for ( var type in events ) { + for ( var handler in events[ type ] ) { + jQuery.event.add( this, type, events[ type ][ handler ], events[ type ][ handler ].data ); + } + } + + i++; + }); + } + + // Return the cloned set + return ret; + }, + + filter: function( selector ) { + return this.pushStack( + jQuery.isFunction( selector ) && + jQuery.grep(this, function(elem, i){ + return selector.call( elem, i ); + }) || + + jQuery.multiFilter( selector, jQuery.grep(this, function(elem){ + return elem.nodeType === 1; + }) ), "filter", selector ); + }, + + closest: function( selector ) { + var pos = jQuery.expr.match.POS.test( selector ) ? jQuery(selector) : null, + closer = 0; + + return this.map(function(){ + var cur = this; + while ( cur && cur.ownerDocument ) { + if ( pos ? pos.index(cur) > -1 : jQuery(cur).is(selector) ) { + jQuery.data(cur, "closest", closer); + return cur; + } + cur = cur.parentNode; + closer++; + } + }); + }, + + not: function( selector ) { + if ( typeof selector === "string" ) + // test special case where just one selector is passed in + if ( isSimple.test( selector ) ) + return this.pushStack( jQuery.multiFilter( selector, this, true ), "not", selector ); + else + selector = jQuery.multiFilter( selector, this ); + + var isArrayLike = selector.length && selector[selector.length - 1] !== undefined && !selector.nodeType; + return this.filter(function() { + return isArrayLike ? jQuery.inArray( this, selector ) < 0 : this != selector; + }); + }, + + add: function( selector ) { + return this.pushStack( jQuery.unique( jQuery.merge( + this.get(), + typeof selector === "string" ? + jQuery( selector ) : + jQuery.makeArray( selector ) + ))); + }, + + is: function( selector ) { + return !!selector && jQuery.multiFilter( selector, this ).length > 0; + }, + + hasClass: function( selector ) { + return !!selector && this.is( "." + selector ); + }, + + val: function( value ) { + if ( value === undefined ) { + var elem = this[0]; + + if ( elem ) { + if( jQuery.nodeName( elem, 'option' ) ) + return (elem.attributes.value || {}).specified ? elem.value : elem.text; + + // We need to handle select boxes special + if ( jQuery.nodeName( elem, "select" ) ) { + var index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type == "select-one"; + + // Nothing was selected + if ( index < 0 ) + return null; + + // Loop through all the selected options + for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) { + var option = options[ i ]; + + if ( option.selected ) { + // Get the specifc value for the option + value = jQuery(option).val(); + + // We don't need an array for one selects + if ( one ) + return value; + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + } + + // Everything else, we just grab the value + return (elem.value || "").replace(/\r/g, ""); + + } + + return undefined; + } + + if ( typeof value === "number" ) + value += ''; + + return this.each(function(){ + if ( this.nodeType != 1 ) + return; + + if ( jQuery.isArray(value) && /radio|checkbox/.test( this.type ) ) + this.checked = (jQuery.inArray(this.value, value) >= 0 || + jQuery.inArray(this.name, value) >= 0); + + else if ( jQuery.nodeName( this, "select" ) ) { + var values = jQuery.makeArray(value); + + jQuery( "option", this ).each(function(){ + this.selected = (jQuery.inArray( this.value, values ) >= 0 || + jQuery.inArray( this.text, values ) >= 0); + }); + + if ( !values.length ) + this.selectedIndex = -1; + + } else + this.value = value; + }); + }, + + html: function( value ) { + return value === undefined ? + (this[0] ? + this[0].innerHTML.replace(/ jQuery\d+="(?:\d+|null)"/g, "") : + null) : + this.empty().append( value ); + }, + + replaceWith: function( value ) { + return this.after( value ).remove(); + }, + + eq: function( i ) { + return this.slice( i, +i + 1 ); + }, + + slice: function() { + return this.pushStack( Array.prototype.slice.apply( this, arguments ), + "slice", Array.prototype.slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function(elem, i){ + return callback.call( elem, i, elem ); + })); + }, + + andSelf: function() { + return this.add( this.prevObject ); + }, + + domManip: function( args, table, callback ) { + if ( this[0] ) { + var fragment = (this[0].ownerDocument || this[0]).createDocumentFragment(), + scripts = jQuery.clean( args, (this[0].ownerDocument || this[0]), fragment ), + first = fragment.firstChild; + + if ( first ) + for ( var i = 0, l = this.length; i < l; i++ ) + callback.call( root(this[i], first), this.length > 1 || i > 0 ? + fragment.cloneNode(true) : fragment ); + + if ( scripts ) + jQuery.each( scripts, evalScript ); + } + + return this; + + function root( elem, cur ) { + return table && jQuery.nodeName(elem, "table") && jQuery.nodeName(cur, "tr") ? + (elem.getElementsByTagName("tbody")[0] || + elem.appendChild(elem.ownerDocument.createElement("tbody"))) : + elem; + } + } +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +function evalScript( i, elem ) { + if ( elem.src ) + jQuery.ajax({ + url: elem.src, + async: false, + dataType: "script" + }); + + else + jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" ); + + if ( elem.parentNode ) + elem.parentNode.removeChild( elem ); +} + +function now(){ + return +new Date; +} + +jQuery.extend = jQuery.fn.extend = function() { + // copy reference to target object + var target = arguments[0] || {}, i = 1, length = arguments.length, deep = false, options; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) + target = {}; + + // extend jQuery itself if only one argument is passed + if ( length == i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) + // Extend the base object + for ( var name in options ) { + var src = target[ name ], copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) + continue; + + // Recurse if we're merging object values + if ( deep && copy && typeof copy === "object" && !copy.nodeType ) + target[ name ] = jQuery.extend( deep, + // Never move original objects, clone them + src || ( copy.length != null ? [ ] : { } ) + , copy ); + + // Don't bring in undefined values + else if ( copy !== undefined ) + target[ name ] = copy; + + } + + // Return the modified object + return target; +}; + +// exclude the following css properties to add px +var exclude = /z-?index|font-?weight|opacity|zoom|line-?height/i, + // cache defaultView + defaultView = document.defaultView || {}, + toString = Object.prototype.toString; + +jQuery.extend({ + noConflict: function( deep ) { + window.$ = _$; + + if ( deep ) + window.jQuery = _jQuery; + + return jQuery; + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return toString.call(obj) === "[object Function]"; + }, + + isArray: function( obj ) { + return toString.call(obj) === "[object Array]"; + }, + + // check if an element is in a (or is an) XML document + isXMLDoc: function( elem ) { + return elem.nodeType === 9 && elem.documentElement.nodeName !== "HTML" || + !!elem.ownerDocument && jQuery.isXMLDoc( elem.ownerDocument ); + }, + + // Evalulates a script in a global context + globalEval: function( data ) { + if ( data && /\S/.test(data) ) { + // Inspired by code by Andrea Giammarchi + // http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html + var head = document.getElementsByTagName("head")[0] || document.documentElement, + script = document.createElement("script"); + + script.type = "text/javascript"; + if ( jQuery.support.scriptEval ) + script.appendChild( document.createTextNode( data ) ); + else + script.text = data; + + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709). + head.insertBefore( script, head.firstChild ); + head.removeChild( script ); + } + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() == name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, length = object.length; + + if ( args ) { + if ( length === undefined ) { + for ( name in object ) + if ( callback.apply( object[ name ], args ) === false ) + break; + } else + for ( ; i < length; ) + if ( callback.apply( object[ i++ ], args ) === false ) + break; + + // A special, fast, case for the most common use of each + } else { + if ( length === undefined ) { + for ( name in object ) + if ( callback.call( object[ name ], name, object[ name ] ) === false ) + break; + } else + for ( var value = object[0]; + i < length && callback.call( value, i, value ) !== false; value = object[++i] ){} + } + + return object; + }, + + prop: function( elem, value, type, i, name ) { + // Handle executable functions + if ( jQuery.isFunction( value ) ) + value = value.call( elem, i ); + + // Handle passing in a number to a CSS property + return typeof value === "number" && type == "curCSS" && !exclude.test( name ) ? + value + "px" : + value; + }, + + className: { + // internal only, use addClass("class") + add: function( elem, classNames ) { + jQuery.each((classNames || "").split(/\s+/), function(i, className){ + if ( elem.nodeType == 1 && !jQuery.className.has( elem.className, className ) ) + elem.className += (elem.className ? " " : "") + className; + }); + }, + + // internal only, use removeClass("class") + remove: function( elem, classNames ) { + if (elem.nodeType == 1) + elem.className = classNames !== undefined ? + jQuery.grep(elem.className.split(/\s+/), function(className){ + return !jQuery.className.has( classNames, className ); + }).join(" ") : + ""; + }, + + // internal only, use hasClass("class") + has: function( elem, className ) { + return elem && jQuery.inArray( className, (elem.className || elem).toString().split(/\s+/) ) > -1; + } + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var old = {}; + // Remember the old values, and insert the new ones + for ( var name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + callback.call( elem ); + + // Revert the old values + for ( var name in options ) + elem.style[ name ] = old[ name ]; + }, + + css: function( elem, name, force, extra ) { + if ( name == "width" || name == "height" ) { + var val, props = { position: "absolute", visibility: "hidden", display:"block" }, which = name == "width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ]; + + function getWH() { + val = name == "width" ? elem.offsetWidth : elem.offsetHeight; + + if ( extra === "border" ) + return; + + jQuery.each( which, function() { + if ( !extra ) + val -= parseFloat(jQuery.curCSS( elem, "padding" + this, true)) || 0; + if ( extra === "margin" ) + val += parseFloat(jQuery.curCSS( elem, "margin" + this, true)) || 0; + else + val -= parseFloat(jQuery.curCSS( elem, "border" + this + "Width", true)) || 0; + }); + } + + if ( elem.offsetWidth !== 0 ) + getWH(); + else + jQuery.swap( elem, props, getWH ); + + return Math.max(0, Math.round(val)); + } + + return jQuery.curCSS( elem, name, force ); + }, + + curCSS: function( elem, name, force ) { + var ret, style = elem.style; + + // We need to handle opacity special in IE + if ( name == "opacity" && !jQuery.support.opacity ) { + ret = jQuery.attr( style, "opacity" ); + + return ret == "" ? + "1" : + ret; + } + + // Make sure we're using the right name for getting the float value + if ( name.match( /float/i ) ) + name = styleFloat; + + if ( !force && style && style[ name ] ) + ret = style[ name ]; + + else if ( defaultView.getComputedStyle ) { + + // Only "float" is needed here + if ( name.match( /float/i ) ) + name = "float"; + + name = name.replace( /([A-Z])/g, "-$1" ).toLowerCase(); + + var computedStyle = defaultView.getComputedStyle( elem, null ); + + if ( computedStyle ) + ret = computedStyle.getPropertyValue( name ); + + // We should always get a number back from opacity + if ( name == "opacity" && ret == "" ) + ret = "1"; + + } else if ( elem.currentStyle ) { + var camelCase = name.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + + ret = elem.currentStyle[ name ] || elem.currentStyle[ camelCase ]; + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + if ( !/^\d+(px)?$/i.test( ret ) && /^\d/.test( ret ) ) { + // Remember the original values + var left = style.left, rsLeft = elem.runtimeStyle.left; + + // Put in the new values to get a computed value out + elem.runtimeStyle.left = elem.currentStyle.left; + style.left = ret || 0; + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + elem.runtimeStyle.left = rsLeft; + } + } + + return ret; + }, + + clean: function( elems, context, fragment ) { + context = context || document; + + // !context.createElement fails in IE with an error but returns typeof 'object' + if ( typeof context.createElement === "undefined" ) + context = context.ownerDocument || context[0] && context[0].ownerDocument || document; + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + if ( !fragment && elems.length === 1 && typeof elems[0] === "string" ) { + var match = /^<(\w+)\s*\/?>$/.exec(elems[0]); + if ( match ) + return [ context.createElement( match[1] ) ]; + } + + var ret = [], scripts = [], div = context.createElement("div"); + + jQuery.each(elems, function(i, elem){ + if ( typeof elem === "number" ) + elem += ''; + + if ( !elem ) + return; + + // Convert html string into DOM nodes + if ( typeof elem === "string" ) { + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(/(<(\w+)[^>]*?)\/>/g, function(all, front, tag){ + return tag.match(/^(abbr|br|col|img|input|link|meta|param|hr|area|embed)$/i) ? + all : + front + ">"; + }); + + // Trim whitespace, otherwise indexOf won't work as expected + var tags = elem.replace(/^\s+/, "").substring(0, 10).toLowerCase(); + + var wrap = + // option or optgroup + !tags.indexOf("", "" ] || + + !tags.indexOf("", "" ] || + + tags.match(/^<(thead|tbody|tfoot|colg|cap)/) && + [ 1, "", "
    " ] || + + !tags.indexOf("", "" ] || + + // matched above + (!tags.indexOf("", "" ] || + + !tags.indexOf("", "" ] || + + // IE can't serialize and + * > + * > + * + * jqPlot can be customized by overriding the defaults of any of the objects which make + * up the plot. The general usage of jqplot is: + * + * > chart = $.jqplot('targetElemId', [dataArray,...], {optionsObject}); + * + * The options available to jqplot are detailed in in the jqPlotOptions.txt file. + * + * An actual call to $.jqplot() may look like the + * examples below: + * + * > chart = $.jqplot('chartdiv', [[[1, 2],[3,5.12],[5,13.1],[7,33.6],[9,85.9],[11,219.9]]]); + * + * or + * + * > dataArray = [34,12,43,55,77]; + * > chart = $.jqplot('targetElemId', [dataArray, ...], {title:'My Plot', axes:{yaxis:{min:20, max:100}}}); + * + * For more inforrmation, see . + * + * About: Usage + * + * See + * + * About: Available Options + * + * See for a list of options available thorugh the options object (not complete yet!) + * + * About: Options Usage + * + * See + * + * About: Changes + * + * See + * + */ + +(function($) { + // make sure undefined is undefined + var undefined; + + $.fn.emptyForce = function() { + for ( var i = 0, elem; (elem = $(this)[i]) != null; i++ ) { + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + } + + // Remove any remaining nodes + if ($.jqplot_use_excanvas) { + elem.outerHTML = ""; + } + else { + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } + } + + elem = null; + } + + return $(this); + }; + + $.fn.removeChildForce = function(parent) { + while ( parent.firstChild ) { + this.removeChildForce( parent.firstChild ); + parent.removeChild( parent.firstChild ); + } + }; + + + /** + * Namespace: $.jqplot + * jQuery function called by the user to create a plot. + * + * Parameters: + * target - ID of target element to render the plot into. + * data - an array of data series. + * options - user defined options object. See the individual classes for available options. + * + * Properties: + * config - object to hold configuration information for jqPlot plot object. + * + * attributes: + * enablePlugins - False to disable plugins by default. Plugins must then be explicitly + * enabled in the individual plot options. Default: false. + * This property sets the "show" property of certain plugins to true or false. + * Only plugins that can be immediately active upon loading are affected. This includes + * non-renderer plugins like cursor, dragable, highlighter, and trendline. + * defaultHeight - Default height for plots where no css height specification exists. This + * is a jqplot wide default. + * defaultWidth - Default height for plots where no css height specification exists. This + * is a jqplot wide default. + */ + + $.jqplot = function(target, data, options) { + var _data, _options; + + if (options == null) { + if (jQuery.isArray(data)) { + _data = data; + _options = null; + } + + else if (typeof(data) === 'object') { + _data = null; + _options = data; + } + } + else { + _data = data; + _options = options; + } + var plot = new jqPlot(); + // remove any error class that may be stuck on target. + $('#'+target).removeClass('jqplot-error'); + + if ($.jqplot.config.catchErrors) { + try { + plot.init(target, _data, _options); + plot.draw(); + plot.themeEngine.init.call(plot); + return plot; + } + catch(e) { + var msg = $.jqplot.config.errorMessage || e.message; + $('#'+target).append('
    '+msg+'
    '); + $('#'+target).addClass('jqplot-error'); + document.getElementById(target).style.background = $.jqplot.config.errorBackground; + document.getElementById(target).style.border = $.jqplot.config.errorBorder; + document.getElementById(target).style.fontFamily = $.jqplot.config.errorFontFamily; + document.getElementById(target).style.fontSize = $.jqplot.config.errorFontSize; + document.getElementById(target).style.fontStyle = $.jqplot.config.errorFontStyle; + document.getElementById(target).style.fontWeight = $.jqplot.config.errorFontWeight; + } + } + else { + plot.init(target, _data, _options); + plot.draw(); + plot.themeEngine.init.call(plot); + return plot; + } + }; + + $.jqplot.version = "1.0.0b2_r1012"; + + // canvas manager to reuse canvases on the plot. + // Should help solve problem of canvases not being freed and + // problem of waiting forever for firefox to decide to free memory. + $.jqplot.CanvasManager = function() { + // canvases are managed globally so that they can be reused + // across plots after they have been freed + if (typeof $.jqplot.CanvasManager.canvases == 'undefined') { + $.jqplot.CanvasManager.canvases = []; + $.jqplot.CanvasManager.free = []; + } + + var myCanvases = []; + + this.getCanvas = function() { + var canvas; + var makeNew = true; + + if (!$.jqplot.use_excanvas) { + for (var i = 0, l = $.jqplot.CanvasManager.canvases.length; i < l; i++) { + if ($.jqplot.CanvasManager.free[i] === true) { + makeNew = false; + canvas = $.jqplot.CanvasManager.canvases[i]; + // $(canvas).removeClass('jqplot-canvasManager-free').addClass('jqplot-canvasManager-inuse'); + $.jqplot.CanvasManager.free[i] = false; + myCanvases.push(i); + break; + } + } + } + + if (makeNew) { + canvas = document.createElement('canvas'); + myCanvases.push($.jqplot.CanvasManager.canvases.length); + $.jqplot.CanvasManager.canvases.push(canvas); + $.jqplot.CanvasManager.free.push(false); + } + + return canvas; + }; + + // this method has to be used after settings the dimesions + // on the element returned by getCanvas() + this.initCanvas = function(canvas) { + if ($.jqplot.use_excanvas) { + return window.G_vmlCanvasManager.initElement(canvas); + } + return canvas; + }; + + this.freeAllCanvases = function() { + for (var i = 0, l=myCanvases.length; i < l; i++) { + this.freeCanvas(myCanvases[i]); + } + myCanvases = []; + }; + + this.freeCanvas = function(idx) { + if ($.jqplot.use_excanvas && window.G_vmlCanvasManager.uninitElement !== undefined) { + // excanvas can't be reused, but properly unset + window.G_vmlCanvasManager.uninitElement($.jqplot.CanvasManager.canvases[idx]); + $.jqplot.CanvasManager.canvases[idx] = null; + } + else { + var canvas = $.jqplot.CanvasManager.canvases[idx]; + canvas.getContext('2d').clearRect(0, 0, canvas.width, canvas.height); + $(canvas).unbind().removeAttr('class').removeAttr('style'); + // Style attributes seemed to be still hanging around. wierd. Some ticks + // still retained a left: 0px attribute after reusing a canvas. + $(canvas).css({left: '', top: '', position: ''}); + // setting size to 0 may save memory of unused canvases? + canvas.width = 0; + canvas.height = 0; + $.jqplot.CanvasManager.free[idx] = true; + } + }; + + }; + + + // Convienence function that won't hang IE or FF without FireBug. + $.jqplot.log = function() { + if (window.console) { + window.console.log.apply(window.console, arguments); + } + }; + + $.jqplot.config = { + addDomReference: false, + enablePlugins:false, + defaultHeight:300, + defaultWidth:400, + UTCAdjust:false, + timezoneOffset: new Date(new Date().getTimezoneOffset() * 60000), + errorMessage: '', + errorBackground: '', + errorBorder: '', + errorFontFamily: '', + errorFontSize: '', + errorFontStyle: '', + errorFontWeight: '', + catchErrors: false, + defaultTickFormatString: "%.1f", + defaultColors: [ "#4bb2c5", "#EAA228", "#c5b47f", "#579575", "#839557", "#958c12", "#953579", "#4b5de4", "#d8b83f", "#ff5800", "#0085cc", "#c747a3", "#cddf54", "#FBD178", "#26B4E3", "#bd70c7"], + defaultNegativeColors: [ "#498991", "#C08840", "#9F9274", "#546D61", "#646C4A", "#6F6621", "#6E3F5F", "#4F64B0", "#A89050", "#C45923", "#187399", "#945381", "#959E5C", "#C7AF7B", "#478396", "#907294"], + dashLength: 4, + gapLength: 4, + dotGapLength: 2.5, + srcLocation: 'jqplot/src/', + pluginLocation: 'jqplot/src/plugins/' + }; + + + $.jqplot.arrayMax = function( array ){ + return Math.max.apply( Math, array ); + }; + + $.jqplot.arrayMin = function( array ){ + return Math.min.apply( Math, array ); + }; + + $.jqplot.enablePlugins = $.jqplot.config.enablePlugins; + + // canvas related tests taken from modernizer: + // Copyright (c) 2009 - 2010 Faruk Ates. + // http://www.modernizr.com + + $.jqplot.support_canvas = function() { + if (typeof $.jqplot.support_canvas.result == 'undefined') { + $.jqplot.support_canvas.result = !!document.createElement('canvas').getContext; + } + return $.jqplot.support_canvas.result; + }; + + $.jqplot.support_canvas_text = function() { + if (typeof $.jqplot.support_canvas_text.result == 'undefined') { + if (window.G_vmlCanvasManager !== undefined && window.G_vmlCanvasManager._version > 887) { + $.jqplot.support_canvas_text.result = true; + } + else { + $.jqplot.support_canvas_text.result = !!(document.createElement('canvas').getContext && typeof document.createElement('canvas').getContext('2d').fillText == 'function'); + } + + } + return $.jqplot.support_canvas_text.result; + }; + + $.jqplot.use_excanvas = ($.browser.msie && !$.jqplot.support_canvas()) ? true : false; + + /** + * + * Hooks: jqPlot Pugin Hooks + * + * $.jqplot.preInitHooks - called before initialization. + * $.jqplot.postInitHooks - called after initialization. + * $.jqplot.preParseOptionsHooks - called before user options are parsed. + * $.jqplot.postParseOptionsHooks - called after user options are parsed. + * $.jqplot.preDrawHooks - called before plot draw. + * $.jqplot.postDrawHooks - called after plot draw. + * $.jqplot.preDrawSeriesHooks - called before each series is drawn. + * $.jqplot.postDrawSeriesHooks - called after each series is drawn. + * $.jqplot.preDrawLegendHooks - called before the legend is drawn. + * $.jqplot.addLegendRowHooks - called at the end of legend draw, so plugins + * can add rows to the legend table. + * $.jqplot.preSeriesInitHooks - called before series is initialized. + * $.jqplot.postSeriesInitHooks - called after series is initialized. + * $.jqplot.preParseSeriesOptionsHooks - called before series related options + * are parsed. + * $.jqplot.postParseSeriesOptionsHooks - called after series related options + * are parsed. + * $.jqplot.eventListenerHooks - called at the end of plot drawing, binds + * listeners to the event canvas which lays on top of the grid area. + * $.jqplot.preDrawSeriesShadowHooks - called before series shadows are drawn. + * $.jqplot.postDrawSeriesShadowHooks - called after series shadows are drawn. + * + */ + + $.jqplot.preInitHooks = []; + $.jqplot.postInitHooks = []; + $.jqplot.preParseOptionsHooks = []; + $.jqplot.postParseOptionsHooks = []; + $.jqplot.preDrawHooks = []; + $.jqplot.postDrawHooks = []; + $.jqplot.preDrawSeriesHooks = []; + $.jqplot.postDrawSeriesHooks = []; + $.jqplot.preDrawLegendHooks = []; + $.jqplot.addLegendRowHooks = []; + $.jqplot.preSeriesInitHooks = []; + $.jqplot.postSeriesInitHooks = []; + $.jqplot.preParseSeriesOptionsHooks = []; + $.jqplot.postParseSeriesOptionsHooks = []; + $.jqplot.eventListenerHooks = []; + $.jqplot.preDrawSeriesShadowHooks = []; + $.jqplot.postDrawSeriesShadowHooks = []; + + // A superclass holding some common properties and methods. + $.jqplot.ElemContainer = function() { + this._elem; + this._plotWidth; + this._plotHeight; + this._plotDimensions = {height:null, width:null}; + }; + + $.jqplot.ElemContainer.prototype.createElement = function(el, offsets, clss, cssopts, attrib) { + this._offsets = offsets; + var klass = clss || 'jqplot'; + var elem = document.createElement(el); + this._elem = $(elem); + this._elem.addClass(klass); + this._elem.css(cssopts); + this._elem.attr(attrib); + // avoid memory leak; + elem = null; + return this._elem; + }; + + $.jqplot.ElemContainer.prototype.getWidth = function() { + if (this._elem) { + return this._elem.outerWidth(true); + } + else { + return null; + } + }; + + $.jqplot.ElemContainer.prototype.getHeight = function() { + if (this._elem) { + return this._elem.outerHeight(true); + } + else { + return null; + } + }; + + $.jqplot.ElemContainer.prototype.getPosition = function() { + if (this._elem) { + return this._elem.position(); + } + else { + return {top:null, left:null, bottom:null, right:null}; + } + }; + + $.jqplot.ElemContainer.prototype.getTop = function() { + return this.getPosition().top; + }; + + $.jqplot.ElemContainer.prototype.getLeft = function() { + return this.getPosition().left; + }; + + $.jqplot.ElemContainer.prototype.getBottom = function() { + return this._elem.css('bottom'); + }; + + $.jqplot.ElemContainer.prototype.getRight = function() { + return this._elem.css('right'); + }; + + + /** + * Class: Axis + * An individual axis object. Cannot be instantiated directly, but created + * by the Plot oject. Axis properties can be set or overriden by the + * options passed in from the user. + * + */ + function Axis(name) { + $.jqplot.ElemContainer.call(this); + // Group: Properties + // + // Axes options are specified within an axes object at the top level of the + // plot options like so: + // > { + // > axes: { + // > xaxis: {min: 5}, + // > yaxis: {min: 2, max: 8, numberTicks:4}, + // > x2axis: {pad: 1.5}, + // > y2axis: {ticks:[22, 44, 66, 88]} + // > } + // > } + // There are 2 x axes, 'xaxis' and 'x2axis', and + // 9 yaxes, 'yaxis', 'y2axis'. 'y3axis', ... Any or all of which may be specified. + this.name = name; + this._series = []; + // prop: show + // Wether to display the axis on the graph. + this.show = false; + // prop: tickRenderer + // A class of a rendering engine for creating the ticks labels displayed on the plot, + // See <$.jqplot.AxisTickRenderer>. + this.tickRenderer = $.jqplot.AxisTickRenderer; + // prop: tickOptions + // Options that will be passed to the tickRenderer, see <$.jqplot.AxisTickRenderer> options. + this.tickOptions = {}; + // prop: labelRenderer + // A class of a rendering engine for creating an axis label. + this.labelRenderer = $.jqplot.AxisLabelRenderer; + // prop: labelOptions + // Options passed to the label renderer. + this.labelOptions = {}; + // prop: label + // Label for the axis + this.label = null; + // prop: showLabel + // true to show the axis label. + this.showLabel = true; + // prop: min + // minimum value of the axis (in data units, not pixels). + this.min = null; + // prop: max + // maximum value of the axis (in data units, not pixels). + this.max = null; + // prop: autoscale + // DEPRECATED + // the default scaling algorithm produces superior results. + this.autoscale = false; + // prop: pad + // Padding to extend the range above and below the data bounds. + // The data range is multiplied by this factor to determine minimum and maximum axis bounds. + // A value of 0 will be interpreted to mean no padding, and pad will be set to 1.0. + this.pad = 1.2; + // prop: padMax + // Padding to extend the range above data bounds. + // The top of the data range is multiplied by this factor to determine maximum axis bounds. + // A value of 0 will be interpreted to mean no padding, and padMax will be set to 1.0. + this.padMax = null; + // prop: padMin + // Padding to extend the range below data bounds. + // The bottom of the data range is multiplied by this factor to determine minimum axis bounds. + // A value of 0 will be interpreted to mean no padding, and padMin will be set to 1.0. + this.padMin = null; + // prop: ticks + // 1D [val, val, ...] or 2D [[val, label], [val, label], ...] array of ticks for the axis. + // If no label is specified, the value is formatted into an appropriate label. + this.ticks = []; + // prop: numberTicks + // Desired number of ticks. Default is to compute automatically. + this.numberTicks; + // prop: tickInterval + // number of units between ticks. Mutually exclusive with numberTicks. + this.tickInterval; + // prop: renderer + // A class of a rendering engine that handles tick generation, + // scaling input data to pixel grid units and drawing the axis element. + this.renderer = $.jqplot.LinearAxisRenderer; + // prop: rendererOptions + // renderer specific options. See <$.jqplot.LinearAxisRenderer> for options. + this.rendererOptions = {}; + // prop: showTicks + // Wether to show the ticks (both marks and labels) or not. + // Will not override showMark and showLabel options if specified on the ticks themselves. + this.showTicks = true; + // prop: showTickMarks + // Wether to show the tick marks (line crossing grid) or not. + // Overridden by showTicks and showMark option of tick itself. + this.showTickMarks = true; + // prop: showMinorTicks + // Wether or not to show minor ticks. This is renderer dependent. + this.showMinorTicks = true; + // prop: drawMajorGridlines + // True to draw gridlines for major axis ticks. + this.drawMajorGridlines = true; + // prop: drawMinorGridlines + // True to draw gridlines for minor ticks. + this.drawMinorGridlines = false; + // prop: drawMajorTickMarks + // True to draw tick marks for major axis ticks. + this.drawMajorTickMarks = true; + // prop: drawMinorTickMarks + // True to draw tick marks for minor ticks. This is renderer dependent. + this.drawMinorTickMarks = true; + // prop: useSeriesColor + // Use the color of the first series associated with this axis for the + // tick marks and line bordering this axis. + this.useSeriesColor = false; + // prop: borderWidth + // width of line stroked at the border of the axis. Defaults + // to the width of the grid boarder. + this.borderWidth = null; + // prop: borderColor + // color of the border adjacent to the axis. Defaults to grid border color. + this.borderColor = null; + // minimum and maximum values on the axis. + this._dataBounds = {min:null, max:null}; + // statistics (min, max, mean) as well as actual data intervals for each series attached to axis. + // holds collection of {intervals:[], min:, max:, mean: } objects for each series on axis. + this._intervalStats = []; + // pixel position from the top left of the min value and max value on the axis. + this._offsets = {min:null, max:null}; + this._ticks=[]; + this._label = null; + // prop: syncTicks + // true to try and synchronize tick spacing across multiple axes so that ticks and + // grid lines line up. This has an impact on autoscaling algorithm, however. + // In general, autoscaling an individual axis will work better if it does not + // have to sync ticks. + this.syncTicks = null; + // prop: tickSpacing + // Approximate pixel spacing between ticks on graph. Used during autoscaling. + // This number will be an upper bound, actual spacing will be less. + this.tickSpacing = 75; + // Properties to hold the original values for min, max, ticks, tickInterval and numberTicks + // so they can be restored if altered by plugins. + this._min = null; + this._max = null; + this._tickInterval = null; + this._numberTicks = null; + this.__ticks = null; + // hold original user options. + this._options = {}; + } + + Axis.prototype = new $.jqplot.ElemContainer(); + Axis.prototype.constructor = Axis; + + Axis.prototype.init = function() { + this.renderer = new this.renderer(); + // set the axis name + this.tickOptions.axis = this.name; + // if showMark or showLabel tick options not specified, use value of axis option. + // showTicks overrides showTickMarks. + if (this.tickOptions.showMark == null) { + this.tickOptions.showMark = this.showTicks; + } + if (this.tickOptions.showMark == null) { + this.tickOptions.showMark = this.showTickMarks; + } + if (this.tickOptions.showLabel == null) { + this.tickOptions.showLabel = this.showTicks; + } + + if (this.label == null || this.label == '') { + this.showLabel = false; + } + else { + this.labelOptions.label = this.label; + } + if (this.showLabel == false) { + this.labelOptions.show = false; + } + // set the default padMax, padMin if not specified + // special check, if no padding desired, padding + // should be set to 1.0 + if (this.pad == 0) { + this.pad = 1.0; + } + if (this.padMax == 0) { + this.padMax = 1.0; + } + if (this.padMin == 0) { + this.padMin = 1.0; + } + if (this.padMax == null) { + this.padMax = (this.pad-1)/2 + 1; + } + if (this.padMin == null) { + this.padMin = (this.pad-1)/2 + 1; + } + // now that padMin and padMax are correctly set, reset pad in case user has supplied + // padMin and/or padMax + this.pad = this.padMax + this.padMin - 1; + if (this.min != null || this.max != null) { + this.autoscale = false; + } + // if not set, sync ticks for y axes but not x by default. + if (this.syncTicks == null && this.name.indexOf('y') > -1) { + this.syncTicks = true; + } + else if (this.syncTicks == null){ + this.syncTicks = false; + } + this.renderer.init.call(this, this.rendererOptions); + + }; + + Axis.prototype.draw = function(ctx, plot) { + // Memory Leaks patch + if (this.__ticks) { + this.__ticks = null; + } + + return this.renderer.draw.call(this, ctx, plot); + + }; + + Axis.prototype.set = function() { + this.renderer.set.call(this); + }; + + Axis.prototype.pack = function(pos, offsets) { + if (this.show) { + this.renderer.pack.call(this, pos, offsets); + } + // these properties should all be available now. + if (this._min == null) { + this._min = this.min; + this._max = this.max; + this._tickInterval = this.tickInterval; + this._numberTicks = this.numberTicks; + this.__ticks = this._ticks; + } + }; + + // reset the axis back to original values if it has been scaled, zoomed, etc. + Axis.prototype.reset = function() { + this.renderer.reset.call(this); + }; + + Axis.prototype.resetScale = function(opts) { + $.extend(true, this, {min: null, max: null, numberTicks: null, tickInterval: null, _ticks: [], ticks: []}, opts); + this.resetDataBounds(); + }; + + Axis.prototype.resetDataBounds = function() { + // Go through all the series attached to this axis and find + // the min/max bounds for this axis. + var db = this._dataBounds; + db.min = null; + db.max = null; + var l, s, d; + // check for when to force min 0 on bar series plots. + var doforce = (this.show) ? true : false; + for (var i=0; i db.max) || db.max == null) { + db.max = d[j][0]; + } + } + else { + if ((d[j][minyidx] != null && d[j][minyidx] < db.min) || db.min == null) { + db.min = d[j][minyidx]; + } + if ((d[j][maxyidx] != null && d[j][maxyidx] > db.max) || db.max == null) { + db.max = d[j][maxyidx]; + } + } + } + + // Hack to not pad out bottom of bar plots unless user has specified a padding. + // every series will have a chance to set doforce to false. once it is set to + // false, it cannot be reset to true. + // If any series attached to axis is not a bar, wont force 0. + if (doforce && s.renderer.constructor !== $.jqplot.BarRenderer) { + doforce = false; + } + + else if (doforce && this._options.hasOwnProperty('forceTickAt0') && this._options.forceTickAt0 == false) { + doforce = false; + } + + else if (doforce && s.renderer.constructor === $.jqplot.BarRenderer) { + if (s.barDirection == 'vertical' && this.name != 'xaxis' && this.name != 'x2axis') { + if (this._options.pad != null || this._options.padMin != null) { + doforce = false; + } + } + + else if (s.barDirection == 'horizontal' && (this.name == 'xaxis' || this.name == 'x2axis')) { + if (this._options.pad != null || this._options.padMin != null) { + doforce = false; + } + } + + } + } + } + + if (doforce && this.renderer.constructor === $.jqplot.LinearAxisRenderer && db.min >= 0) { + this.padMin = 1.0; + this.forceTickAt0 = true; + } + }; + + /** + * Class: Legend + * Legend object. Cannot be instantiated directly, but created + * by the Plot oject. Legend properties can be set or overriden by the + * options passed in from the user. + */ + function Legend(options) { + $.jqplot.ElemContainer.call(this); + // Group: Properties + + // prop: show + // Wether to display the legend on the graph. + this.show = false; + // prop: location + // Placement of the legend. one of the compass directions: nw, n, ne, e, se, s, sw, w + this.location = 'ne'; + // prop: labels + // Array of labels to use. By default the renderer will look for labels on the series. + // Labels specified in this array will override labels specified on the series. + this.labels = []; + // prop: showLabels + // true to show the label text on the legend. + this.showLabels = true; + // prop: showSwatch + // true to show the color swatches on the legend. + this.showSwatches = true; + // prop: placement + // "insideGrid" places legend inside the grid area of the plot. + // "outsideGrid" places the legend outside the grid but inside the plot container, + // shrinking the grid to accomodate the legend. + // "inside" synonym for "insideGrid", + // "outside" places the legend ouside the grid area, but does not shrink the grid which + // can cause the legend to overflow the plot container. + this.placement = "insideGrid"; + // prop: xoffset + // DEPRECATED. Set the margins on the legend using the marginTop, marginLeft, etc. + // properties or via CSS margin styling of the .jqplot-table-legend class. + this.xoffset = 0; + // prop: yoffset + // DEPRECATED. Set the margins on the legend using the marginTop, marginLeft, etc. + // properties or via CSS margin styling of the .jqplot-table-legend class. + this.yoffset = 0; + // prop: border + // css spec for the border around the legend box. + this.border; + // prop: background + // css spec for the background of the legend box. + this.background; + // prop: textColor + // css color spec for the legend text. + this.textColor; + // prop: fontFamily + // css font-family spec for the legend text. + this.fontFamily; + // prop: fontSize + // css font-size spec for the legend text. + this.fontSize ; + // prop: rowSpacing + // css padding-top spec for the rows in the legend. + this.rowSpacing = '0.5em'; + // renderer + // A class that will create a DOM object for the legend, + // see <$.jqplot.TableLegendRenderer>. + this.renderer = $.jqplot.TableLegendRenderer; + // prop: rendererOptions + // renderer specific options passed to the renderer. + this.rendererOptions = {}; + // prop: predraw + // Wether to draw the legend before the series or not. + // Used with series specific legend renderers for pie, donut, mekko charts, etc. + this.preDraw = false; + // prop: marginTop + // CSS margin for the legend DOM element. This will set an element + // CSS style for the margin which will override any style sheet setting. + // The default will be taken from the stylesheet. + this.marginTop = null; + // prop: marginRight + // CSS margin for the legend DOM element. This will set an element + // CSS style for the margin which will override any style sheet setting. + // The default will be taken from the stylesheet. + this.marginRight = null; + // prop: marginBottom + // CSS margin for the legend DOM element. This will set an element + // CSS style for the margin which will override any style sheet setting. + // The default will be taken from the stylesheet. + this.marginBottom = null; + // prop: marginLeft + // CSS margin for the legend DOM element. This will set an element + // CSS style for the margin which will override any style sheet setting. + // The default will be taken from the stylesheet. + this.marginLeft = null; + // prop: escapeHtml + // True to escape special characters with their html entity equivalents + // in legend text. "<" becomes < and so on, so html tags are not rendered. + this.escapeHtml = false; + this._series = []; + + $.extend(true, this, options); + } + + Legend.prototype = new $.jqplot.ElemContainer(); + Legend.prototype.constructor = Legend; + + Legend.prototype.setOptions = function(options) { + $.extend(true, this, options); + + // Try to emulate deprecated behaviour + // if user has specified xoffset or yoffset, copy these to + // the margin properties. + + if (this.placement == 'inside') { + this.placement = 'insideGrid'; + } + + if (this.xoffset >0) { + if (this.placement == 'insideGrid') { + switch (this.location) { + case 'nw': + case 'w': + case 'sw': + if (this.marginLeft == null) { + this.marginLeft = this.xoffset + 'px'; + } + this.marginRight = '0px'; + break; + case 'ne': + case 'e': + case 'se': + default: + if (this.marginRight == null) { + this.marginRight = this.xoffset + 'px'; + } + this.marginLeft = '0px'; + break; + } + } + else if (this.placement == 'outside') { + switch (this.location) { + case 'nw': + case 'w': + case 'sw': + if (this.marginRight == null) { + this.marginRight = this.xoffset + 'px'; + } + this.marginLeft = '0px'; + break; + case 'ne': + case 'e': + case 'se': + default: + if (this.marginLeft == null) { + this.marginLeft = this.xoffset + 'px'; + } + this.marginRight = '0px'; + break; + } + } + this.xoffset = 0; + } + + if (this.yoffset >0) { + if (this.placement == 'outside') { + switch (this.location) { + case 'sw': + case 's': + case 'se': + if (this.marginTop == null) { + this.marginTop = this.yoffset + 'px'; + } + this.marginBottom = '0px'; + break; + case 'ne': + case 'n': + case 'nw': + default: + if (this.marginBottom == null) { + this.marginBottom = this.yoffset + 'px'; + } + this.marginTop = '0px'; + break; + } + } + else if (this.placement == 'insideGrid') { + switch (this.location) { + case 'sw': + case 's': + case 'se': + if (this.marginBottom == null) { + this.marginBottom = this.yoffset + 'px'; + } + this.marginTop = '0px'; + break; + case 'ne': + case 'n': + case 'nw': + default: + if (this.marginTop == null) { + this.marginTop = this.yoffset + 'px'; + } + this.marginBottom = '0px'; + break; + } + } + this.yoffset = 0; + } + + // TO-DO: + // Handle case where offsets are < 0. + // + }; + + Legend.prototype.init = function() { + this.renderer = new this.renderer(); + this.renderer.init.call(this, this.rendererOptions); + }; + + Legend.prototype.draw = function(offsets) { + for (var i=0; i<$.jqplot.preDrawLegendHooks.length; i++){ + $.jqplot.preDrawLegendHooks[i].call(this, offsets); + } + return this.renderer.draw.call(this, offsets); + }; + + Legend.prototype.pack = function(offsets) { + this.renderer.pack.call(this, offsets); + }; + + /** + * Class: Title + * Plot Title object. Cannot be instantiated directly, but created + * by the Plot oject. Title properties can be set or overriden by the + * options passed in from the user. + * + * Parameters: + * text - text of the title. + */ + function Title(text) { + $.jqplot.ElemContainer.call(this); + // Group: Properties + + // prop: text + // text of the title; + this.text = text; + // prop: show + // wether or not to show the title + this.show = true; + // prop: fontFamily + // css font-family spec for the text. + this.fontFamily; + // prop: fontSize + // css font-size spec for the text. + this.fontSize ; + // prop: textAlign + // css text-align spec for the text. + this.textAlign; + // prop: textColor + // css color spec for the text. + this.textColor; + // prop: renderer + // A class for creating a DOM element for the title, + // see <$.jqplot.DivTitleRenderer>. + this.renderer = $.jqplot.DivTitleRenderer; + // prop: rendererOptions + // renderer specific options passed to the renderer. + this.rendererOptions = {}; + // prop: escapeHtml + // True to escape special characters with their html entity equivalents + // in title text. "<" becomes < and so on, so html tags are not rendered. + this.escapeHtml = false; + } + + Title.prototype = new $.jqplot.ElemContainer(); + Title.prototype.constructor = Title; + + Title.prototype.init = function() { + this.renderer = new this.renderer(); + this.renderer.init.call(this, this.rendererOptions); + }; + + Title.prototype.draw = function(width) { + return this.renderer.draw.call(this, width); + }; + + Title.prototype.pack = function() { + this.renderer.pack.call(this); + }; + + + /** + * Class: Series + * An individual data series object. Cannot be instantiated directly, but created + * by the Plot oject. Series properties can be set or overriden by the + * options passed in from the user. + */ + function Series() { + $.jqplot.ElemContainer.call(this); + // Group: Properties + // Properties will be assigned from a series array at the top level of the + // options. If you had two series and wanted to change the color and line + // width of the first and set the second to use the secondary y axis with + // no shadow and supply custom labels for each: + // > { + // > series:[ + // > {color: '#ff4466', lineWidth: 5, label:'good line'}, + // > {yaxis: 'y2axis', shadow: false, label:'bad line'} + // > ] + // > } + + // prop: show + // wether or not to draw the series. + this.show = true; + // prop: xaxis + // which x axis to use with this series, either 'xaxis' or 'x2axis'. + this.xaxis = 'xaxis'; + this._xaxis; + // prop: yaxis + // which y axis to use with this series, either 'yaxis' or 'y2axis'. + this.yaxis = 'yaxis'; + this._yaxis; + this.gridBorderWidth = 2.0; + // prop: renderer + // A class of a renderer which will draw the series, + // see <$.jqplot.LineRenderer>. + this.renderer = $.jqplot.LineRenderer; + // prop: rendererOptions + // Options to pass on to the renderer. + this.rendererOptions = {}; + this.data = []; + this.gridData = []; + // prop: label + // Line label to use in the legend. + this.label = ''; + // prop: showLabel + // true to show label for this series in the legend. + this.showLabel = true; + // prop: color + // css color spec for the series + this.color; + // prop: negativeColor + // css color spec used for filled (area) plots that are filled to zero and + // the "useNegativeColors" option is true. + this.negativeColor; + // prop: lineWidth + // width of the line in pixels. May have different meanings depending on renderer. + this.lineWidth = 2.5; + // prop: lineJoin + // Canvas lineJoin style between segments of series. + this.lineJoin = 'round'; + // prop: lineCap + // Canvas lineCap style at ends of line. + this.lineCap = 'round'; + // prop: linePattern + // line pattern 'dashed', 'dotted', 'solid', some combination + // of '-' and '.' characters such as '.-.' or a numerical array like + // [draw, skip, draw, skip, ...] such as [1, 10] to draw a dotted line, + // [1, 10, 20, 10] to draw a dot-dash line, and so on. + this.linePattern = 'solid'; + this.shadow = true; + // prop: shadowAngle + // Shadow angle in degrees + this.shadowAngle = 45; + // prop: shadowOffset + // Shadow offset from line in pixels + this.shadowOffset = 1.25; + // prop: shadowDepth + // Number of times shadow is stroked, each stroke offset shadowOffset from the last. + this.shadowDepth = 3; + // prop: shadowAlpha + // Alpha channel transparency of shadow. 0 = transparent. + this.shadowAlpha = '0.1'; + // prop: breakOnNull + // Wether line segments should be be broken at null value. + // False will join point on either side of line. + this.breakOnNull = false; + // prop: markerRenderer + // A class of a renderer which will draw marker (e.g. circle, square, ...) at the data points, + // see <$.jqplot.MarkerRenderer>. + this.markerRenderer = $.jqplot.MarkerRenderer; + // prop: markerOptions + // renderer specific options to pass to the markerRenderer, + // see <$.jqplot.MarkerRenderer>. + this.markerOptions = {}; + // prop: showLine + // wether to actually draw the line or not. Series will still be renderered, even if no line is drawn. + this.showLine = true; + // prop: showMarker + // wether or not to show the markers at the data points. + this.showMarker = true; + // prop: index + // 0 based index of this series in the plot series array. + this.index; + // prop: fill + // true or false, wether to fill under lines or in bars. + // May not be implemented in all renderers. + this.fill = false; + // prop: fillColor + // CSS color spec to use for fill under line. Defaults to line color. + this.fillColor; + // prop: fillAlpha + // Alpha transparency to apply to the fill under the line. + // Use this to adjust alpha separate from fill color. + this.fillAlpha; + // prop: fillAndStroke + // If true will stroke the line (with color this.color) as well as fill under it. + // Applies only when fill is true. + this.fillAndStroke = false; + // prop: disableStack + // true to not stack this series with other series in the plot. + // To render properly, non-stacked series must come after any stacked series + // in the plot's data series array. So, the plot's data series array would look like: + // > [stackedSeries1, stackedSeries2, ..., nonStackedSeries1, nonStackedSeries2, ...] + // disableStack will put a gap in the stacking order of series, and subsequent + // stacked series will not fill down through the non-stacked series and will + // most likely not stack properly on top of the non-stacked series. + this.disableStack = false; + // _stack is set by the Plot if the plot is a stacked chart. + // will stack lines or bars on top of one another to build a "mountain" style chart. + // May not be implemented in all renderers. + this._stack = false; + // prop: neighborThreshold + // how close or far (in pixels) the cursor must be from a point marker to detect the point. + this.neighborThreshold = 4; + // prop: fillToZero + // true will force bar and filled series to fill toward zero on the fill Axis. + this.fillToZero = false; + // prop: fillToValue + // fill a filled series to this value on the fill axis. + // Works in conjunction with fillToZero, so that must be true. + this.fillToValue = 0; + // prop: fillAxis + // Either 'x' or 'y'. Which axis to fill the line toward if fillToZero is true. + // 'y' means fill up/down to 0 on the y axis for this series. + this.fillAxis = 'y'; + // prop: useNegativeColors + // true to color negative values differently in filled and bar charts. + this.useNegativeColors = true; + this._stackData = []; + // _plotData accounts for stacking. If plots not stacked, _plotData and data are same. If + // stacked, _plotData is accumulation of stacking data. + this._plotData = []; + // _plotValues hold the individual x and y values that will be plotted for this series. + this._plotValues = {x:[], y:[]}; + // statistics about the intervals between data points. Used for auto scaling. + this._intervals = {x:{}, y:{}}; + // data from the previous series, for stacked charts. + this._prevPlotData = []; + this._prevGridData = []; + this._stackAxis = 'y'; + this._primaryAxis = '_xaxis'; + // give each series a canvas to draw on. This should allow for redrawing speedups. + this.canvas = new $.jqplot.GenericCanvas(); + this.shadowCanvas = new $.jqplot.GenericCanvas(); + this.plugins = {}; + // sum of y values in this series. + this._sumy = 0; + this._sumx = 0; + this._type = ''; + } + + Series.prototype = new $.jqplot.ElemContainer(); + Series.prototype.constructor = Series; + + Series.prototype.init = function(index, gridbw, plot) { + // weed out any null values in the data. + this.index = index; + this.gridBorderWidth = gridbw; + var d = this.data; + var temp = [], i; + for (i=0; i. + this.renderer = $.jqplot.CanvasGridRenderer; + // prop: rendererOptions + // Options to pass on to the renderer, + // see <$.jqplot.CanvasGridRenderer>. + this.rendererOptions = {}; + this._offsets = {top:null, bottom:null, left:null, right:null}; + } + + Grid.prototype = new $.jqplot.ElemContainer(); + Grid.prototype.constructor = Grid; + + Grid.prototype.init = function() { + this.renderer = new this.renderer(); + this.renderer.init.call(this, this.rendererOptions); + }; + + Grid.prototype.createElement = function(offsets,plot) { + this._offsets = offsets; + return this.renderer.createElement.call(this, plot); + }; + + Grid.prototype.draw = function() { + this.renderer.draw.call(this); + }; + + $.jqplot.GenericCanvas = function() { + $.jqplot.ElemContainer.call(this); + this._ctx; + }; + + $.jqplot.GenericCanvas.prototype = new $.jqplot.ElemContainer(); + $.jqplot.GenericCanvas.prototype.constructor = $.jqplot.GenericCanvas; + + $.jqplot.GenericCanvas.prototype.createElement = function(offsets, clss, plotDimensions, plot) { + this._offsets = offsets; + var klass = 'jqplot'; + if (clss != undefined) { + klass = clss; + } + var elem; + + elem = plot.canvasManager.getCanvas(); + + // if new plotDimensions supplied, use them. + if (plotDimensions != null) { + this._plotDimensions = plotDimensions; + } + + elem.width = this._plotDimensions.width - this._offsets.left - this._offsets.right; + elem.height = this._plotDimensions.height - this._offsets.top - this._offsets.bottom; + this._elem = $(elem); + this._elem.css({ position: 'absolute', left: this._offsets.left, top: this._offsets.top }); + + this._elem.addClass(klass); + + elem = plot.canvasManager.initCanvas(elem); + + elem = null; + return this._elem; + }; + + $.jqplot.GenericCanvas.prototype.setContext = function() { + this._ctx = this._elem.get(0).getContext("2d"); + return this._ctx; + }; + + // Memory Leaks patch + $.jqplot.GenericCanvas.prototype.resetCanvas = function() { + if (this._elem) { + if ($.jqplot.use_excanvas && window.G_vmlCanvasManager.uninitElement !== undefined) { + window.G_vmlCanvasManager.uninitElement(this._elem.get(0)); + } + + //this._elem.remove(); + this._elem.emptyForce(); + } + + this._ctx = null; + }; + + $.jqplot.HooksManager = function () { + this.hooks =[]; + this.args = []; + }; + + $.jqplot.HooksManager.prototype.addOnce = function(fn, args) { + args = args || []; + var havehook = false; + for (var i=0, l=this.hooks.length; i { + // > axesDefaults:{min:0}, + // > series:[{color:'#6633dd'}], + // > title: 'A Plot' + // > } + // + + // prop: animate + // True to animate the series on initial plot draw (renderer dependent). + // Actual animation functionality must be supported in the renderer. + this.animate = false; + // prop: animateReplot + // True to animate series after a call to the replot() method. + // Use with caution! Replots can happen very frequently under + // certain circumstances (e.g. resizing, dragging points) and + // animation in these situations can cause problems. + this.animateReplot = false; + // prop: axes + // up to 4 axes are supported, each with it's own options, + // See for axis specific options. + this.axes = {xaxis: new Axis('xaxis'), yaxis: new Axis('yaxis'), x2axis: new Axis('x2axis'), y2axis: new Axis('y2axis'), y3axis: new Axis('y3axis'), y4axis: new Axis('y4axis'), y5axis: new Axis('y5axis'), y6axis: new Axis('y6axis'), y7axis: new Axis('y7axis'), y8axis: new Axis('y8axis'), y9axis: new Axis('y9axis'), yMidAxis: new Axis('yMidAxis')}; + this.baseCanvas = new $.jqplot.GenericCanvas(); + // true to intercept right click events and fire a 'jqplotRightClick' event. + // this will also block the context menu. + this.captureRightClick = false; + // prop: data + // user's data. Data should *NOT* be specified in the options object, + // but be passed in as the second argument to the $.jqplot() function. + // The data property is described here soley for reference. + // The data should be in the form of an array of 2D or 1D arrays like + // > [ [[x1, y1], [x2, y2],...], [y1, y2, ...] ]. + this.data = []; + // prop: dataRenderer + // A callable which can be used to preprocess data passed into the plot. + // Will be called with 2 arguments, the plot data and a reference to the plot. + this.dataRenderer; + // prop: dataRendererOptions + // Options that will be passed to the dataRenderer. + // Can be of any type. + this.dataRendererOptions; + this.defaults = { + // prop: axesDefaults + // default options that will be applied to all axes. + // see for axes options. + axesDefaults: {}, + axes: {xaxis:{}, yaxis:{}, x2axis:{}, y2axis:{}, y3axis:{}, y4axis:{}, y5axis:{}, y6axis:{}, y7axis:{}, y8axis:{}, y9axis:{}, yMidAxis:{}}, + // prop: seriesDefaults + // default options that will be applied to all series. + // see for series options. + seriesDefaults: {}, + series:[] + }; + // prop: defaultAxisStart + // 1-D data series are internally converted into 2-D [x,y] data point arrays + // by jqPlot. This is the default starting value for the missing x or y value. + // The added data will be a monotonically increasing series (e.g. [1, 2, 3, ...]) + // starting at this value. + this.defaultAxisStart = 1; + // this.doCustomEventBinding = true; + // prop: drawIfHidden + // True to execute the draw method even if the plot target is hidden. + // Generally, this should be false. Most plot elements will not be sized/ + // positioned correclty if renderered into a hidden container. To render into + // a hidden container, call the replot method when the container is shown. + this.drawIfHidden = false; + this.eventCanvas = new $.jqplot.GenericCanvas(); + // prop: fillBetween + // Fill between 2 line series in a plot. + // Options object: + // { + // series1: first index (0 based) of series in fill + // series2: second index (0 based) of series in fill + // color: color of fill [default fillColor of series1] + // baseSeries: fill will be drawn below this series (0 based index) + // fill: false to turn off fill [default true]. + // } + this.fillBetween = { + series1: null, + series2: null, + color: null, + baseSeries: 0, + fill: true + }; + // prop; fontFamily + // css spec for the font-family attribute. Default for the entire plot. + this.fontFamily; + // prop: fontSize + // css spec for the font-size attribute. Default for the entire plot. + this.fontSize; + // prop: grid + // See for grid specific options. + this.grid = new Grid(); + // prop: legend + // see <$.jqplot.TableLegendRenderer> + this.legend = new Legend(); + // prop: noDataIndicator + // Options to set up a mock plot with a data loading indicator if no data is specified. + this.negativeSeriesColors = $.jqplot.config.defaultNegativeColors; + this.noDataIndicator = { + show: false, + indicator: 'Loading Data...', + axes: { + xaxis: { + min: 0, + max: 10, + tickInterval: 2, + show: true + }, + yaxis: { + min: 0, + max: 12, + tickInterval: 3, + show: true + } + } + }; + // container to hold all of the merged options. Convienence for plugins. + this.options = {}; + this.previousSeriesStack = []; + // Namespece to hold plugins. Generally non-renderer plugins add themselves to here. + this.plugins = {}; + // prop: series + // Array of series object options. + // see for series specific options. + this.series = []; + // array of series indicies. Keep track of order + // which series canvases are displayed, lowest + // to highest, back to front. + this.seriesStack = []; + // prop: seriesColors + // Ann array of CSS color specifications that will be applied, in order, + // to the series in the plot. Colors will wrap around so, if their + // are more series than colors, colors will be reused starting at the + // beginning. For pie charts, this specifies the colors of the slices. + this.seriesColors = $.jqplot.config.defaultColors; + // prop: sortData + // false to not sort the data passed in by the user. + // Many bar, stakced and other graphs as well as many plugins depend on + // having sorted data. + this.sortData = true; + // prop: stackSeries + // true or false, creates a stack or "mountain" plot. + // Not all series renderers may implement this option. + this.stackSeries = false; + // a shortcut for axis syncTicks options. Not implemented yet. + this.syncXTicks = true; + // a shortcut for axis syncTicks options. Not implemented yet. + this.syncYTicks = true; + // the jquery object for the dom target. + this.target = null; + // The id of the dom element to render the plot into + this.targetId = null; + // prop textColor + // css spec for the css color attribute. Default for the entire plot. + this.textColor; + // prop: title + // Title object. See for specific options. As a shortcut, you + // can specify the title option as just a string like: title: 'My Plot' + // and this will create a new title object with the specified text. + this.title = new Title(); + // Count how many times the draw method has been called while the plot is visible. + // Mostly used to test if plot has never been dran (=0), has been successfully drawn + // into a visible container once (=1) or draw more than once into a visible container. + // Can use this in tests to see if plot has been visibly drawn at least one time. + // After plot has been visibly drawn once, it generally doesn't need redrawn if its + // container is hidden and shown. + this._drawCount = 0; + // sum of y values for all series in plot. + // used in mekko chart. + this._sumy = 0; + this._sumx = 0; + // array to hold the cumulative stacked series data. + // used to ajust the individual series data, which won't have access to other + // series data. + this._stackData = []; + // array that holds the data to be plotted. This will be the series data + // merged with the the appropriate data from _stackData according to the stackAxis. + this._plotData = []; + this._width = null; + this._height = null; + this._plotDimensions = {height:null, width:null}; + this._gridPadding = {top:null, right:null, bottom:null, left:null}; + this._defaultGridPadding = {top:10, right:10, bottom:23, left:10}; + + this._addDomReference = $.jqplot.config.addDomReference; + + this.preInitHooks = new $.jqplot.HooksManager(); + this.postInitHooks = new $.jqplot.HooksManager(); + this.preParseOptionsHooks = new $.jqplot.HooksManager(); + this.postParseOptionsHooks = new $.jqplot.HooksManager(); + this.preDrawHooks = new $.jqplot.HooksManager(); + this.postDrawHooks = new $.jqplot.HooksManager(); + this.preDrawSeriesHooks = new $.jqplot.HooksManager(); + this.postDrawSeriesHooks = new $.jqplot.HooksManager(); + this.preDrawLegendHooks = new $.jqplot.HooksManager(); + this.addLegendRowHooks = new $.jqplot.HooksManager(); + this.preSeriesInitHooks = new $.jqplot.HooksManager(); + this.postSeriesInitHooks = new $.jqplot.HooksManager(); + this.preParseSeriesOptionsHooks = new $.jqplot.HooksManager(); + this.postParseSeriesOptionsHooks = new $.jqplot.HooksManager(); + this.eventListenerHooks = new $.jqplot.EventListenerManager(); + this.preDrawSeriesShadowHooks = new $.jqplot.HooksManager(); + this.postDrawSeriesShadowHooks = new $.jqplot.HooksManager(); + + this.colorGenerator = new $.jqplot.ColorGenerator(); + this.negativeColorGenerator = new $.jqplot.ColorGenerator(); + + this.canvasManager = new $.jqplot.CanvasManager(); + + this.themeEngine = new $.jqplot.ThemeEngine(); + + var seriesColorsIndex = 0; + + // Group: methods + // + // method: init + // sets the plot target, checks data and applies user + // options to plot. + this.init = function(target, data, options) { + options = options || {}; + for (var i=0; i<$.jqplot.preInitHooks.length; i++) { + $.jqplot.preInitHooks[i].call(this, target, data, options); + } + + for (var i=0; i<this.preInitHooks.hooks.length; i++) { + this.preInitHooks.hooks[i].call(this, target, data, options); + } + + this.targetId = '#'+target; + this.target = $('#'+target); + + ////// + // Add a reference to plot + ////// + if (this._addDomReference) { + this.target.data('jqplot_plot', this); + } + // remove any error class that may be stuck on target. + this.target.removeClass('jqplot-error'); + if (!this.target.get(0)) { + throw "No plot target specified"; + } + + // make sure the target is positioned by some means and set css + if (this.target.css('position') == 'static') { + this.target.css('position', 'relative'); + } + if (!this.target.hasClass('jqplot-target')) { + this.target.addClass('jqplot-target'); + } + + // if no height or width specified, use a default. + if (!this.target.height()) { + var h; + if (options && options.height) { + h = parseInt(options.height, 10); + } + else if (this.target.attr('data-height')) { + h = parseInt(this.target.attr('data-height'), 10); + } + else { + h = parseInt($.jqplot.config.defaultHeight, 10); + } + this._height = h; + this.target.css('height', h+'px'); + } + else { + this._height = h = this.target.height(); + } + if (!this.target.width()) { + var w; + if (options && options.width) { + w = parseInt(options.width, 10); + } + else if (this.target.attr('data-width')) { + w = parseInt(this.target.attr('data-width'), 10); + } + else { + w = parseInt($.jqplot.config.defaultWidth, 10); + } + this._width = w; + this.target.css('width', w+'px'); + } + else { + this._width = w = this.target.width(); + } + + this._plotDimensions.height = this._height; + this._plotDimensions.width = this._width; + this.grid._plotDimensions = this._plotDimensions; + this.title._plotDimensions = this._plotDimensions; + this.baseCanvas._plotDimensions = this._plotDimensions; + this.eventCanvas._plotDimensions = this._plotDimensions; + this.legend._plotDimensions = this._plotDimensions; + if (this._height <=0 || this._width <=0 || !this._height || !this._width) { + throw "Canvas dimension not set"; + } + + if (options.dataRenderer && jQuery.isFunction(options.dataRenderer)) { + if (options.dataRendererOptions) { + this.dataRendererOptions = options.dataRendererOptions; + } + this.dataRenderer = options.dataRenderer; + data = this.dataRenderer(data, this, this.dataRendererOptions); + } + + if (options.noDataIndicator && jQuery.isPlainObject(options.noDataIndicator)) { + $.extend(true, this.noDataIndicator, options.noDataIndicator); + } + + if (data == null || jQuery.isArray(data) == false || data.length == 0 || jQuery.isArray(data[0]) == false || data[0].length == 0) { + + if (this.noDataIndicator.show == false) { + throw{ + name: "DataError", + message: "No data to plot." + }; + } + + else { + // have to be descructive here in order for plot to not try and render series. + // This means that $.jqplot() will have to be called again when there is data. + //delete options.series; + + for (var ax in this.noDataIndicator.axes) { + for (var prop in this.noDataIndicator.axes[ax]) { + this.axes[ax][prop] = this.noDataIndicator.axes[ax][prop]; + } + } + + this.postDrawHooks.add(function() { + var eh = this.eventCanvas.getHeight(); + var ew = this.eventCanvas.getWidth(); + var temp = $('<div class="jqplot-noData-container" style="position:absolute;"></div>'); + this.target.append(temp); + temp.height(eh); + temp.width(ew); + temp.css('top', this.eventCanvas._offsets.top); + temp.css('left', this.eventCanvas._offsets.left); + + var temp2 = $('<div class="jqplot-noData-contents" style="text-align:center; position:relative; margin-left:auto; margin-right:auto;"></div>'); + temp.append(temp2); + temp2.html(this.noDataIndicator.indicator); + var th = temp2.height(); + var tw = temp2.width(); + temp2.height(th); + temp2.width(tw); + temp2.css('top', (eh - th)/2 + 'px'); + }); + + } + } + + this.data = data; + + this.parseOptions(options); + + if (this.textColor) { + this.target.css('color', this.textColor); + } + if (this.fontFamily) { + this.target.css('font-family', this.fontFamily); + } + if (this.fontSize) { + this.target.css('font-size', this.fontSize); + } + + this.title.init(); + this.legend.init(); + this._sumy = 0; + this._sumx = 0; + for (var i=0; i<this.series.length; i++) { + // set default stacking order for series canvases + this.seriesStack.push(i); + this.previousSeriesStack.push(i); + this.series[i].shadowCanvas._plotDimensions = this._plotDimensions; + this.series[i].canvas._plotDimensions = this._plotDimensions; + for (var j=0; j<$.jqplot.preSeriesInitHooks.length; j++) { + $.jqplot.preSeriesInitHooks[j].call(this.series[i], target, data, this.options.seriesDefaults, this.options.series[i], this); + } + for (var j=0; j<this.preSeriesInitHooks.hooks.length; j++) { + this.preSeriesInitHooks.hooks[j].call(this.series[i], target, data, this.options.seriesDefaults, this.options.series[i], this); + } + this.populatePlotData(this.series[i], i); + this.series[i]._plotDimensions = this._plotDimensions; + this.series[i].init(i, this.grid.borderWidth, this); + for (var j=0; j<$.jqplot.postSeriesInitHooks.length; j++) { + $.jqplot.postSeriesInitHooks[j].call(this.series[i], target, data, this.options.seriesDefaults, this.options.series[i], this); + } + for (var j=0; j<this.postSeriesInitHooks.hooks.length; j++) { + this.postSeriesInitHooks.hooks[j].call(this.series[i], target, data, this.options.seriesDefaults, this.options.series[i], this); + } + this._sumy += this.series[i]._sumy; + this._sumx += this.series[i]._sumx; + } + + var name; + for (var i=0; i<12; i++) { + name = _axisNames[i]; + this.axes[name]._plotDimensions = this._plotDimensions; + this.axes[name].init(); + if (this.axes[name].borderColor == null) { + if (name.charAt(0) !== 'x' && this.axes[name].useSeriesColor === true && this.axes[name].show) { + this.axes[name].borderColor = this.axes[name]._series[0].color; + } + else { + this.axes[name].borderColor = this.grid.borderColor; + } + } + } + + if (this.sortData) { + sortData(this.series); + } + this.grid.init(); + this.grid._axes = this.axes; + + this.legend._series = this.series; + + for (var i=0; i<$.jqplot.postInitHooks.length; i++) { + $.jqplot.postInitHooks[i].call(this, target, data, options); + } + + for (var i=0; i<this.postInitHooks.hooks.length; i++) { + this.postInitHooks.hooks[i].call(this, target, data, options); + } + }; + + // method: resetAxesScale + // Reset the specified axes min, max, numberTicks and tickInterval properties to null + // or reset these properties on all axes if no list of axes is provided. + // + // Parameters: + // axes - Boolean to reset or not reset all axes or an array or object of axis names to reset. + this.resetAxesScale = function(axes, options) { + var opts = options || {}; + var ax = axes || this.axes; + if (ax === true) { + ax = this.axes; + } + if (jQuery.isArray(ax)) { + for (var i = 0; i < ax.length; i++) { + this.axes[ax[i]].resetScale(opts[ax[i]]); + } + } + else if (typeof(ax) === 'object') { + for (var name in ax) { + this.axes[name].resetScale(opts[name]); + } + } + }; + // method: reInitialize + // reinitialize plot for replotting. + // not called directly. + this.reInitialize = function () { + // Plot should be visible and have a height and width. + // If plot doesn't have height and width for some + // reason, set it by other means. Plot must not have + // a display:none attribute, however. + + this._height = this.target.height(); + this._width = this.target.width(); + + if (this._height <=0 || this._width <=0 || !this._height || !this._width) { + throw "Target dimension not set"; + } + + this._plotDimensions.height = this._height; + this._plotDimensions.width = this._width; + this.grid._plotDimensions = this._plotDimensions; + this.title._plotDimensions = this._plotDimensions; + this.baseCanvas._plotDimensions = this._plotDimensions; + this.eventCanvas._plotDimensions = this._plotDimensions; + this.legend._plotDimensions = this._plotDimensions; + + for (var n in this.axes) { + this.axes[n]._plotWidth = this._width; + this.axes[n]._plotHeight = this._height; + } + + this.title._plotWidth = this._width; + + if (this.textColor) { + this.target.css('color', this.textColor); + } + if (this.fontFamily) { + this.target.css('font-family', this.fontFamily); + } + if (this.fontSize) { + this.target.css('font-size', this.fontSize); + } + + this._sumy = 0; + this._sumx = 0; + for (var i=0; i<this.series.length; i++) { + this.populatePlotData(this.series[i], i); + if (this.series[i]._type === 'line' && this.series[i].renderer.bands.show) { + this.series[i].renderer.initBands.call(this.series[i], this.series[i].renderer.options, this); + } + this.series[i]._plotDimensions = this._plotDimensions; + this.series[i].canvas._plotDimensions = this._plotDimensions; + //this.series[i].init(i, this.grid.borderWidth); + this._sumy += this.series[i]._sumy; + this._sumx += this.series[i]._sumx; + } + + var name; + + for (var j=0; j<12; j++) { + name = _axisNames[j]; + // Memory Leaks patch : clear ticks elements + var t = this.axes[name]._ticks; + for (var i = 0; i < t.length; i++) { + var el = t[i]._elem; + if (el) { + // if canvas renderer + if ($.jqplot.use_excanvas && window.G_vmlCanvasManager.uninitElement !== undefined) { + window.G_vmlCanvasManager.uninitElement(el.get(0)); + } + el.emptyForce(); + el = null; + t._elem = null; + } + } + t = null; + + this.axes[name]._plotDimensions = this._plotDimensions; + this.axes[name]._ticks = []; + // this.axes[name].renderer.init.call(this.axes[name], {}); + } + + if (this.sortData) { + sortData(this.series); + } + + this.grid._axes = this.axes; + + this.legend._series = this.series; + }; + + // sort the series data in increasing order. + function sortData(series) { + var d, sd, pd, ppd, ret; + for (var i=0; i<series.length; i++) { + var check; + var bat = [series[i].data, series[i]._stackData, series[i]._plotData, series[i]._prevPlotData]; + for (var n=0; n<4; n++) { + check = true; + d = bat[n]; + if (series[i]._stackAxis == 'x') { + for (var j = 0; j < d.length; j++) { + if (typeof(d[j][1]) != "number") { + check = false; + break; + } + } + if (check) { + d.sort(function(a,b) { return a[1] - b[1]; }); + } + } + else { + for (var j = 0; j < d.length; j++) { + if (typeof(d[j][0]) != "number") { + check = false; + break; + } + } + if (check) { + d.sort(function(a,b) { return a[0] - b[0]; }); + } + } + } + + } + } + + // populate the _stackData and _plotData arrays for the plot and the series. + this.populatePlotData = function(series, index) { + // if a stacked chart, compute the stacked data + this._plotData = []; + this._stackData = []; + series._stackData = []; + series._plotData = []; + var plotValues = {x:[], y:[]}; + if (this.stackSeries && !series.disableStack) { + series._stack = true; + var sidx = series._stackAxis == 'x' ? 0 : 1; + var idx = sidx ? 0 : 1; + // push the current data into stackData + //this._stackData.push(this.series[i].data); + var temp = $.extend(true, [], series.data); + // create the data that will be plotted for this series + var plotdata = $.extend(true, [], series.data); + // for first series, nothing to add to stackData. + for (var j=0; j<index; j++) { + var cd = this.series[j].data; + for (var k=0; k<cd.length; k++) { + temp[k][0] += cd[k][0]; + temp[k][1] += cd[k][1]; + // only need to sum up the stack axis column of data + plotdata[k][sidx] += cd[k][sidx]; + } + } + for (var i=0; i<plotdata.length; i++) { + plotValues.x.push(plotdata[i][0]); + plotValues.y.push(plotdata[i][1]); + } + this._plotData.push(plotdata); + this._stackData.push(temp); + series._stackData = temp; + series._plotData = plotdata; + series._plotValues = plotValues; + } + else { + for (var i=0; i<series.data.length; i++) { + plotValues.x.push(series.data[i][0]); + plotValues.y.push(series.data[i][1]); + } + this._stackData.push(series.data); + this.series[index]._stackData = series.data; + this._plotData.push(series.data); + series._plotData = series.data; + series._plotValues = plotValues; + } + if (index>0) { + series._prevPlotData = this.series[index-1]._plotData; + } + series._sumy = 0; + series._sumx = 0; + for (i=series.data.length-1; i>-1; i--) { + series._sumy += series.data[i][1]; + series._sumx += series.data[i][0]; + } + }; + + // function to safely return colors from the color array and wrap around at the end. + this.getNextSeriesColor = (function(t) { + var idx = 0; + var sc = t.seriesColors; + + return function () { + if (idx < sc.length) { + return sc[idx++]; + } + else { + idx = 0; + return sc[idx++]; + } + }; + })(this); + + this.parseOptions = function(options){ + for (var i=0; i<this.preParseOptionsHooks.hooks.length; i++) { + this.preParseOptionsHooks.hooks[i].call(this, options); + } + for (var i=0; i<$.jqplot.preParseOptionsHooks.length; i++) { + $.jqplot.preParseOptionsHooks[i].call(this, options); + } + this.options = $.extend(true, {}, this.defaults, options); + var opts = this.options; + this.animate = opts.animate; + this.animateReplot = opts.animateReplot; + this.stackSeries = opts.stackSeries; + if ($.isPlainObject(opts.fillBetween)) { + + var temp = ['series1', 'series2', 'color', 'baseSeries', 'fill'], + tempi; + + for (var i=0, l=temp.length; i<l; i++) { + tempi = temp[i]; + if (opts.fillBetween[tempi] != null) { + this.fillBetween[tempi] = opts.fillBetween[tempi]; + } + } + } + + if (opts.seriesColors) { + this.seriesColors = opts.seriesColors; + } + if (opts.negativeSeriesColors) { + this.negativeSeriesColors = opts.negativeSeriesColors; + } + if (opts.captureRightClick) { + this.captureRightClick = opts.captureRightClick; + } + this.defaultAxisStart = (options && options.defaultAxisStart != null) ? options.defaultAxisStart : this.defaultAxisStart; + this.colorGenerator.setColors(this.seriesColors); + this.negativeColorGenerator.setColors(this.negativeSeriesColors); + // var cg = new this.colorGenerator(this.seriesColors); + // var ncg = new this.colorGenerator(this.negativeSeriesColors); + // this._gridPadding = this.options.gridPadding; + $.extend(true, this._gridPadding, opts.gridPadding); + this.sortData = (opts.sortData != null) ? opts.sortData : this.sortData; + for (var i=0; i<12; i++) { + var n = _axisNames[i]; + var axis = this.axes[n]; + axis._options = $.extend(true, {}, opts.axesDefaults, opts.axes[n]); + $.extend(true, axis, opts.axesDefaults, opts.axes[n]); + axis._plotWidth = this._width; + axis._plotHeight = this._height; + } + // if (this.data.length == 0) { + // this.data = []; + // for (var i=0; i<this.options.series.length; i++) { + // this.data.push(this.options.series.data); + // } + // } + + var normalizeData = function(data, dir, start) { + // return data as an array of point arrays, + // in form [[x1,y1...], [x2,y2...], ...] + var temp = []; + var i; + dir = dir || 'vertical'; + if (!jQuery.isArray(data[0])) { + // we have a series of scalars. One line with just y values. + // turn the scalar list of data into a data array of form: + // [[1, data[0]], [2, data[1]], ...] + for (i=0; i<data.length; i++) { + if (dir == 'vertical') { + temp.push([start + i, data[i]]); + } + else { + temp.push([data[i], start+i]); + } + } + } + else { + // we have a properly formatted data series, copy it. + $.extend(true, temp, data); + } + return temp; + }; + + var colorIndex = 0; + for (var i=0; i<this.data.length; i++) { + var temp = new Series(); + for (var j=0; j<$.jqplot.preParseSeriesOptionsHooks.length; j++) { + $.jqplot.preParseSeriesOptionsHooks[j].call(temp, this.options.seriesDefaults, this.options.series[i]); + } + for (var j=0; j<this.preParseSeriesOptionsHooks.hooks.length; j++) { + this.preParseSeriesOptionsHooks.hooks[j].call(temp, this.options.seriesDefaults, this.options.series[i]); + } + $.extend(true, temp, {seriesColors:this.seriesColors, negativeSeriesColors:this.negativeSeriesColors}, this.options.seriesDefaults, this.options.series[i], {rendererOptions:{animation:{show: this.animate}}}); + var dir = 'vertical'; + if (temp.renderer === $.jqplot.BarRenderer && temp.rendererOptions && temp.rendererOptions.barDirection == 'horizontal' && temp.transposeData === true) { + dir = 'horizontal'; + } + temp.data = normalizeData(this.data[i], dir, this.defaultAxisStart); + switch (temp.xaxis) { + case 'xaxis': + temp._xaxis = this.axes.xaxis; + break; + case 'x2axis': + temp._xaxis = this.axes.x2axis; + break; + default: + break; + } + temp._yaxis = this.axes[temp.yaxis]; + temp._xaxis._series.push(temp); + temp._yaxis._series.push(temp); + if (temp.show) { + temp._xaxis.show = true; + temp._yaxis.show = true; + } + + // // parse the renderer options and apply default colors if not provided + // if (!temp.color && temp.show != false) { + // temp.color = cg.next(); + // colorIndex = cg.getIndex() - 1;; + // } + // if (!temp.negativeColor && temp.show != false) { + // temp.negativeColor = ncg.get(colorIndex); + // ncg.setIndex(colorIndex); + // } + if (!temp.label) { + temp.label = 'Series '+ (i+1).toString(); + } + // temp.rendererOptions.show = temp.show; + // $.extend(true, temp.renderer, {color:this.seriesColors[i]}, this.rendererOptions); + this.series.push(temp); + for (var j=0; j<$.jqplot.postParseSeriesOptionsHooks.length; j++) { + $.jqplot.postParseSeriesOptionsHooks[j].call(this.series[i], this.options.seriesDefaults, this.options.series[i]); + } + for (var j=0; j<this.postParseSeriesOptionsHooks.hooks.length; j++) { + this.postParseSeriesOptionsHooks.hooks[j].call(this.series[i], this.options.seriesDefaults, this.options.series[i]); + } + } + + // copy the grid and title options into this object. + $.extend(true, this.grid, this.options.grid); + // if axis border properties aren't set, set default. + for (var i=0; i<12; i++) { + var n = _axisNames[i]; + var axis = this.axes[n]; + if (axis.borderWidth == null) { + axis.borderWidth =this.grid.borderWidth; + } + } + + if (typeof this.options.title == 'string') { + this.title.text = this.options.title; + } + else if (typeof this.options.title == 'object') { + $.extend(true, this.title, this.options.title); + } + this.title._plotWidth = this._width; + this.legend.setOptions(this.options.legend); + + for (var i=0; i<$.jqplot.postParseOptionsHooks.length; i++) { + $.jqplot.postParseOptionsHooks[i].call(this, options); + } + for (var i=0; i<this.postParseOptionsHooks.hooks.length; i++) { + this.postParseOptionsHooks.hooks[i].call(this, options); + } + }; + + // method: destroy + // Releases all resources occupied by the plot + this.destroy = function() { + this.canvasManager.freeAllCanvases(); + if (this.eventCanvas && this.eventCanvas._elem) { + this.eventCanvas._elem.unbind(); + } + // Couple of posts on Stack Overflow indicate that empty() doesn't + // always cear up the dom and release memory. Sometimes setting + // innerHTML property to null is needed. Particularly on IE, may + // have to directly set it to null, bypassing jQuery. + this.target.empty(); + + this.target[0].innerHTML = ''; + }; + + // method: replot + // Does a reinitialization of the plot followed by + // a redraw. Method could be used to interactively + // change plot characteristics and then replot. + // + // Parameters: + // options - Options used for replotting. + // + // Properties: + // clear - false to not clear (empty) the plot container before replotting (default: true). + // resetAxes - true to reset all axes min, max, numberTicks and tickInterval setting so axes will rescale themselves. + // optionally pass in list of axes to reset (e.g. ['xaxis', 'y2axis']) (default: false). + this.replot = function(options) { + var opts = options || {}; + var clear = (opts.clear === false) ? false : true; + var resetAxes = opts.resetAxes || false; + this.target.trigger('jqplotPreReplot'); + + if (clear) { + this.destroy(); + } + this.reInitialize(); + if (resetAxes) { + this.resetAxesScale(resetAxes, opts.axes); + } + this.draw(); + this.target.trigger('jqplotPostReplot'); + }; + + // method: redraw + // Empties the plot target div and redraws the plot. + // This enables plot data and properties to be changed + // and then to comletely clear the plot and redraw. + // redraw *will not* reinitialize any plot elements. + // That is, axes will not be autoscaled and defaults + // will not be reapplied to any plot elements. redraw + // is used primarily with zooming. + // + // Parameters: + // clear - false to not clear (empty) the plot container before redrawing (default: true). + this.redraw = function(clear) { + clear = (clear != null) ? clear : true; + this.target.trigger('jqplotPreRedraw'); + if (clear) { + this.canvasManager.freeAllCanvases(); + this.eventCanvas._elem.unbind(); + // Dont think I bind any events to the target, this shouldn't be necessary. + // It will remove user's events. + // this.target.unbind(); + this.target.empty(); + } + for (var ax in this.axes) { + this.axes[ax]._ticks = []; + } + for (var i=0; i<this.series.length; i++) { + this.populatePlotData(this.series[i], i); + } + this._sumy = 0; + this._sumx = 0; + for (i=0; i<this.series.length; i++) { + this._sumy += this.series[i]._sumy; + this._sumx += this.series[i]._sumx; + } + this.draw(); + this.target.trigger('jqplotPostRedraw'); + }; + + // method: draw + // Draws all elements of the plot into the container. + // Does not clear the container before drawing. + this.draw = function(){ + if (this.drawIfHidden || this.target.is(':visible')) { + this.target.trigger('jqplotPreDraw'); + var i, + j, + l, + tempseries; + for (i=0, l=$.jqplot.preDrawHooks.length; i<l; i++) { + $.jqplot.preDrawHooks[i].call(this); + } + for (i=0, l=this.preDrawHooks.length; i<l; i++) { + this.preDrawHooks.hooks[i].apply(this, this.preDrawSeriesHooks.args[i]); + } + // create an underlying canvas to be used for special features. + this.target.append(this.baseCanvas.createElement({left:0, right:0, top:0, bottom:0}, 'jqplot-base-canvas', null, this)); + this.baseCanvas.setContext(); + this.target.append(this.title.draw()); + this.title.pack({top:0, left:0}); + + // make room for the legend between the grid and the edge. + var legendElem = this.legend.draw(); + + var gridPadding = {top:0, left:0, bottom:0, right:0}; + + if (this.legend.placement == "outsideGrid") { + // temporarily append the legend to get dimensions + this.target.append(legendElem); + switch (this.legend.location) { + case 'n': + gridPadding.top += this.legend.getHeight(); + break; + case 's': + gridPadding.bottom += this.legend.getHeight(); + break; + case 'ne': + case 'e': + case 'se': + gridPadding.right += this.legend.getWidth(); + break; + case 'nw': + case 'w': + case 'sw': + gridPadding.left += this.legend.getWidth(); + break; + default: // same as 'ne' + gridPadding.right += this.legend.getWidth(); + break; + } + legendElem = legendElem.detach(); + } + + var ax = this.axes; + var name; + // draw the yMidAxis first, so xaxis of pyramid chart can adjust itself if needed. + for (i=0; i<12; i++) { + name = _axisNames[i]; + this.target.append(ax[name].draw(this.baseCanvas._ctx, this)); + ax[name].set(); + } + if (ax.yaxis.show) { + gridPadding.left += ax.yaxis.getWidth(); + } + var ra = ['y2axis', 'y3axis', 'y4axis', 'y5axis', 'y6axis', 'y7axis', 'y8axis', 'y9axis']; + var rapad = [0, 0, 0, 0, 0, 0, 0, 0]; + var gpr = 0; + var n; + for (n=0; n<8; n++) { + if (ax[ra[n]].show) { + gpr += ax[ra[n]].getWidth(); + rapad[n] = gpr; + } + } + gridPadding.right += gpr; + if (ax.x2axis.show) { + gridPadding.top += ax.x2axis.getHeight(); + } + if (this.title.show) { + gridPadding.top += this.title.getHeight(); + } + if (ax.xaxis.show) { + gridPadding.bottom += ax.xaxis.getHeight(); + } + + // end of gridPadding adjustments. + + // if user passed in gridDimensions option, check against calculated gridPadding + if (this.options.gridDimensions && $.isPlainObject(this.options.gridDimensions)) { + var gdw = parseInt(this.options.gridDimensions.width, 10) || 0; + var gdh = parseInt(this.options.gridDimensions.height, 10) || 0; + var widthAdj = (this._width - gridPadding.left - gridPadding.right - gdw)/2; + var heightAdj = (this._height - gridPadding.top - gridPadding.bottom - gdh)/2; + + if (heightAdj >= 0 && widthAdj >= 0) { + gridPadding.top += heightAdj; + gridPadding.bottom += heightAdj; + gridPadding.left += widthAdj; + gridPadding.right += widthAdj; + } + } + var arr = ['top', 'bottom', 'left', 'right']; + for (var n in arr) { + if (this._gridPadding[arr[n]] == null && gridPadding[arr[n]] > 0) { + this._gridPadding[arr[n]] = gridPadding[arr[n]]; + } + else if (this._gridPadding[arr[n]] == null) { + this._gridPadding[arr[n]] = this._defaultGridPadding[arr[n]]; + } + } + + var legendPadding = (this.legend.placement == 'outsideGrid') ? {top:this.title.getHeight(), left: 0, right: 0, bottom: 0} : this._gridPadding; + + ax.xaxis.pack({position:'absolute', bottom:this._gridPadding.bottom - ax.xaxis.getHeight(), left:0, width:this._width}, {min:this._gridPadding.left, max:this._width - this._gridPadding.right}); + ax.yaxis.pack({position:'absolute', top:0, left:this._gridPadding.left - ax.yaxis.getWidth(), height:this._height}, {min:this._height - this._gridPadding.bottom, max: this._gridPadding.top}); + ax.x2axis.pack({position:'absolute', top:this._gridPadding.top - ax.x2axis.getHeight(), left:0, width:this._width}, {min:this._gridPadding.left, max:this._width - this._gridPadding.right}); + for (i=8; i>0; i--) { + ax[ra[i-1]].pack({position:'absolute', top:0, right:this._gridPadding.right - rapad[i-1]}, {min:this._height - this._gridPadding.bottom, max: this._gridPadding.top}); + } + var ltemp = (this._width - this._gridPadding.left - this._gridPadding.right)/2.0 + this._gridPadding.left - ax.yMidAxis.getWidth()/2.0; + ax.yMidAxis.pack({position:'absolute', top:0, left:ltemp, zIndex:9, textAlign: 'center'}, {min:this._height - this._gridPadding.bottom, max: this._gridPadding.top}); + + this.target.append(this.grid.createElement(this._gridPadding, this)); + this.grid.draw(); + + var series = this.series; + var seriesLength = series.length; + // put the shadow canvases behind the series canvases so shadows don't overlap on stacked bars. + for (i=0, l=seriesLength; i<l; i++) { + // draw series in order of stacking. This affects only + // order in which canvases are added to dom. + j = this.seriesStack[i]; + this.target.append(series[j].shadowCanvas.createElement(this._gridPadding, 'jqplot-series-shadowCanvas', null, this)); + series[j].shadowCanvas.setContext(); + series[j].shadowCanvas._elem.data('seriesIndex', j); + } + + for (i=0, l=seriesLength; i<l; i++) { + // draw series in order of stacking. This affects only + // order in which canvases are added to dom. + j = this.seriesStack[i]; + this.target.append(series[j].canvas.createElement(this._gridPadding, 'jqplot-series-canvas', null, this)); + series[j].canvas.setContext(); + series[j].canvas._elem.data('seriesIndex', j); + } + // Need to use filled canvas to capture events in IE. + // Also, canvas seems to block selection of other elements in document on FF. + this.target.append(this.eventCanvas.createElement(this._gridPadding, 'jqplot-event-canvas', null, this)); + this.eventCanvas.setContext(); + this.eventCanvas._ctx.fillStyle = 'rgba(0,0,0,0)'; + this.eventCanvas._ctx.fillRect(0,0,this.eventCanvas._ctx.canvas.width, this.eventCanvas._ctx.canvas.height); + + // bind custom event handlers to regular events. + this.bindCustomEvents(); + + // draw legend before series if the series needs to know the legend dimensions. + if (this.legend.preDraw) { + this.eventCanvas._elem.before(legendElem); + this.legend.pack(legendPadding); + if (this.legend._elem) { + this.drawSeries({legendInfo:{location:this.legend.location, placement:this.legend.placement, width:this.legend.getWidth(), height:this.legend.getHeight(), xoffset:this.legend.xoffset, yoffset:this.legend.yoffset}}); + } + else { + this.drawSeries(); + } + } + else { // draw series before legend + this.drawSeries(); + if (seriesLength) { + $(series[seriesLength-1].canvas._elem).after(legendElem); + } + this.legend.pack(legendPadding); + } + + // register event listeners on the overlay canvas + for (var i=0, l=$.jqplot.eventListenerHooks.length; i<l; i++) { + // in the handler, this will refer to the eventCanvas dom element. + // make sure there are references back into plot objects. + this.eventCanvas._elem.bind($.jqplot.eventListenerHooks[i][0], {plot:this}, $.jqplot.eventListenerHooks[i][1]); + } + + // register event listeners on the overlay canvas + for (var i=0, l=this.eventListenerHooks.hooks.length; i<l; i++) { + // in the handler, this will refer to the eventCanvas dom element. + // make sure there are references back into plot objects. + this.eventCanvas._elem.bind(this.eventListenerHooks.hooks[i][0], {plot:this}, this.eventListenerHooks.hooks[i][1]); + } + + var fb = this.fillBetween; + if (fb.fill && fb.series1 !== fb.series2 && fb.series1 < seriesLength && fb.series2 < seriesLength && series[fb.series1]._type === 'line' && series[fb.series2]._type === 'line') { + this.doFillBetweenLines(); + } + + for (var i=0, l=$.jqplot.postDrawHooks.length; i<l; i++) { + $.jqplot.postDrawHooks[i].call(this); + } + + for (var i=0, l=this.postDrawHooks.hooks.length; i<l; i++) { + this.postDrawHooks.hooks[i].apply(this, this.postDrawHooks.args[i]); + } + + if (this.target.is(':visible')) { + this._drawCount += 1; + } + + var temps, + tempr, + sel, + _els; + // ughh. ideally would hide all series then show them. + for (i=0, l=seriesLength; i<l; i++) { + temps = series[i]; + tempr = temps.renderer; + sel = '.jqplot-point-label.jqplot-series-'+i; + if (tempr.animation && tempr.animation._supported && tempr.animation.show && (this._drawCount < 2 || this.animateReplot)) { + _els = this.target.find(sel); + _els.stop(true, true).hide(); + temps.canvas._elem.stop(true, true).hide(); + temps.shadowCanvas._elem.stop(true, true).hide(); + temps.canvas._elem.jqplotEffect('blind', {mode: 'show', direction: tempr.animation.direction}, tempr.animation.speed); + temps.shadowCanvas._elem.jqplotEffect('blind', {mode: 'show', direction: tempr.animation.direction}, tempr.animation.speed); + _els.fadeIn(tempr.animation.speed*0.8); + } + } + _els = null; + + this.target.trigger('jqplotPostDraw', [this]); + } + }; + + jqPlot.prototype.doFillBetweenLines = function () { + var fb = this.fillBetween; + var sid1 = fb.series1; + var sid2 = fb.series2; + // first series should always be lowest index + var id1 = (sid1 < sid2) ? sid1 : sid2; + var id2 = (sid2 > sid1) ? sid2 : sid1; + + var series1 = this.series[id1]; + var series2 = this.series[id2]; + + if (series2.renderer.smooth) { + var tempgd = series2.renderer._smoothedData.slice(0).reverse(); + } + else { + var tempgd = series2.gridData.slice(0).reverse(); + } + + if (series1.renderer.smooth) { + var gd = series1.renderer._smoothedData.concat(tempgd); + } + else { + var gd = series1.gridData.concat(tempgd); + } + + var color = (fb.color !== null) ? fb.color : this.series[sid1].fillColor; + var baseSeries = (fb.baseSeries !== null) ? fb.baseSeries : id1; + + // now apply a fill to the shape on the lower series shadow canvas, + // so it is behind both series. + var sr = this.series[baseSeries].renderer.shapeRenderer; + var opts = {fillStyle: color, fill: true, closePath: true}; + sr.draw(series1.shadowCanvas._ctx, gd, opts); + }; + + this.bindCustomEvents = function() { + this.eventCanvas._elem.bind('click', {plot:this}, this.onClick); + this.eventCanvas._elem.bind('dblclick', {plot:this}, this.onDblClick); + this.eventCanvas._elem.bind('mousedown', {plot:this}, this.onMouseDown); + this.eventCanvas._elem.bind('mousemove', {plot:this}, this.onMouseMove); + this.eventCanvas._elem.bind('mouseenter', {plot:this}, this.onMouseEnter); + this.eventCanvas._elem.bind('mouseleave', {plot:this}, this.onMouseLeave); + if (this.captureRightClick) { + this.eventCanvas._elem.bind('mouseup', {plot:this}, this.onRightClick); + this.eventCanvas._elem.get(0).oncontextmenu = function() { + return false; + }; + } + else { + this.eventCanvas._elem.bind('mouseup', {plot:this}, this.onMouseUp); + } + }; + + function getEventPosition(ev) { + var plot = ev.data.plot; + var go = plot.eventCanvas._elem.offset(); + var gridPos = {x:ev.pageX - go.left, y:ev.pageY - go.top}; + var dataPos = {xaxis:null, yaxis:null, x2axis:null, y2axis:null, y3axis:null, y4axis:null, y5axis:null, y6axis:null, y7axis:null, y8axis:null, y9axis:null, yMidAxis:null}; + var an = ['xaxis', 'yaxis', 'x2axis', 'y2axis', 'y3axis', 'y4axis', 'y5axis', 'y6axis', 'y7axis', 'y8axis', 'y9axis', 'yMidAxis']; + var ax = plot.axes; + var n, axis; + for (n=11; n>0; n--) { + axis = an[n-1]; + if (ax[axis].show) { + dataPos[axis] = ax[axis].series_p2u(gridPos[axis.charAt(0)]); + } + } + + return {offsets:go, gridPos:gridPos, dataPos:dataPos}; + } + + + // function to check if event location is over a area area + function checkIntersection(gridpos, plot) { + var series = plot.series; + var i, j, k, s, r, x, y, theta, sm, sa, minang, maxang; + var d0, d, p, pp, points, bw; + var threshold, t; + for (k=plot.seriesStack.length-1; k>=0; k--) { + i = plot.seriesStack[k]; + s = series[i]; + switch (s.renderer.constructor) { + case $.jqplot.BarRenderer: + case $.jqplot.PyramidRenderer: + x = gridpos.x; + y = gridpos.y; + for (j=0; j<s._barPoints.length; j++) { + points = s._barPoints[j]; + p = s.gridData[j]; + if (x>points[0][0] && x<points[2][0] && y>points[2][1] && y<points[0][1]) { + return {seriesIndex:s.index, pointIndex:j, gridData:p, data:s.data[j], points:s._barPoints[j]}; + } + } + break; + + case $.jqplot.DonutRenderer: + sa = s.startAngle/180*Math.PI; + x = gridpos.x - s._center[0]; + y = gridpos.y - s._center[1]; + r = Math.sqrt(Math.pow(x, 2) + Math.pow(y, 2)); + if (x > 0 && -y >= 0) { + theta = 2*Math.PI - Math.atan(-y/x); + } + else if (x > 0 && -y < 0) { + theta = -Math.atan(-y/x); + } + else if (x < 0) { + theta = Math.PI - Math.atan(-y/x); + } + else if (x == 0 && -y > 0) { + theta = 3*Math.PI/2; + } + else if (x == 0 && -y < 0) { + theta = Math.PI/2; + } + else if (x == 0 && y == 0) { + theta = 0; + } + if (sa) { + theta -= sa; + if (theta < 0) { + theta += 2*Math.PI; + } + else if (theta > 2*Math.PI) { + theta -= 2*Math.PI; + } + } + + sm = s.sliceMargin/180*Math.PI; + if (r < s._radius && r > s._innerRadius) { + for (j=0; j<s.gridData.length; j++) { + minang = (j>0) ? s.gridData[j-1][1]+sm : sm; + maxang = s.gridData[j][1]; + if (theta > minang && theta < maxang) { + return {seriesIndex:s.index, pointIndex:j, gridData:s.gridData[j], data:s.data[j]}; + } + } + } + break; + + case $.jqplot.PieRenderer: + sa = s.startAngle/180*Math.PI; + x = gridpos.x - s._center[0]; + y = gridpos.y - s._center[1]; + r = Math.sqrt(Math.pow(x, 2) + Math.pow(y, 2)); + if (x > 0 && -y >= 0) { + theta = 2*Math.PI - Math.atan(-y/x); + } + else if (x > 0 && -y < 0) { + theta = -Math.atan(-y/x); + } + else if (x < 0) { + theta = Math.PI - Math.atan(-y/x); + } + else if (x == 0 && -y > 0) { + theta = 3*Math.PI/2; + } + else if (x == 0 && -y < 0) { + theta = Math.PI/2; + } + else if (x == 0 && y == 0) { + theta = 0; + } + if (sa) { + theta -= sa; + if (theta < 0) { + theta += 2*Math.PI; + } + else if (theta > 2*Math.PI) { + theta -= 2*Math.PI; + } + } + + sm = s.sliceMargin/180*Math.PI; + if (r < s._radius) { + for (j=0; j<s.gridData.length; j++) { + minang = (j>0) ? s.gridData[j-1][1]+sm : sm; + maxang = s.gridData[j][1]; + if (theta > minang && theta < maxang) { + return {seriesIndex:s.index, pointIndex:j, gridData:s.gridData[j], data:s.data[j]}; + } + } + } + break; + + case $.jqplot.BubbleRenderer: + x = gridpos.x; + y = gridpos.y; + var ret = null; + + if (s.show) { + for (var j=0; j<s.gridData.length; j++) { + p = s.gridData[j]; + d = Math.sqrt( (x-p[0]) * (x-p[0]) + (y-p[1]) * (y-p[1]) ); + if (d <= p[2] && (d <= d0 || d0 == null)) { + d0 = d; + ret = {seriesIndex: i, pointIndex:j, gridData:p, data:s.data[j]}; + } + } + if (ret != null) { + return ret; + } + } + break; + + case $.jqplot.FunnelRenderer: + x = gridpos.x; + y = gridpos.y; + var v = s._vertices, + vfirst = v[0], + vlast = v[v.length-1], + lex, + rex, + cv; + + // equations of right and left sides, returns x, y values given height of section (y value and 2 points) + + function findedge (l, p1 , p2) { + var m = (p1[1] - p2[1])/(p1[0] - p2[0]); + var b = p1[1] - m*p1[0]; + var y = l + p1[1]; + + return [(y - b)/m, y]; + } + + // check each section + lex = findedge(y, vfirst[0], vlast[3]); + rex = findedge(y, vfirst[1], vlast[2]); + for (j=0; j<v.length; j++) { + cv = v[j]; + if (y >= cv[0][1] && y <= cv[3][1] && x >= lex[0] && x <= rex[0]) { + return {seriesIndex:s.index, pointIndex:j, gridData:null, data:s.data[j]}; + } + } + break; + + case $.jqplot.LineRenderer: + x = gridpos.x; + y = gridpos.y; + r = s.renderer; + if (s.show) { + if ((s.fill || (s.renderer.bands.show && s.renderer.bands.fill)) && (!plot.plugins.highlighter || !plot.plugins.highlighter.show)) { + // first check if it is in bounding box + var inside = false; + if (x>s._boundingBox[0][0] && x<s._boundingBox[1][0] && y>s._boundingBox[1][1] && y<s._boundingBox[0][1]) { + // now check the crossing number + + var numPoints = s._areaPoints.length; + var ii; + var j = numPoints-1; + + for(var ii=0; ii < numPoints; ii++) { + var vertex1 = [s._areaPoints[ii][0], s._areaPoints[ii][1]]; + var vertex2 = [s._areaPoints[j][0], s._areaPoints[j][1]]; + + if (vertex1[1] < y && vertex2[1] >= y || vertex2[1] < y && vertex1[1] >= y) { + if (vertex1[0] + (y - vertex1[1]) / (vertex2[1] - vertex1[1]) * (vertex2[0] - vertex1[0]) < x) { + inside = !inside; + } + } + + j = ii; + } + } + if (inside) { + return {seriesIndex:i, pointIndex:null, gridData:s.gridData, data:s.data, points:s._areaPoints}; + } + break; + + } + + else { + t = s.markerRenderer.size/2+s.neighborThreshold; + threshold = (t > 0) ? t : 0; + for (var j=0; j<s.gridData.length; j++) { + p = s.gridData[j]; + // neighbor looks different to OHLC chart. + if (r.constructor == $.jqplot.OHLCRenderer) { + if (r.candleStick) { + var yp = s._yaxis.series_u2p; + if (x >= p[0]-r._bodyWidth/2 && x <= p[0]+r._bodyWidth/2 && y >= yp(s.data[j][2]) && y <= yp(s.data[j][3])) { + return {seriesIndex: i, pointIndex:j, gridData:p, data:s.data[j]}; + } + } + // if an open hi low close chart + else if (!r.hlc){ + var yp = s._yaxis.series_u2p; + if (x >= p[0]-r._tickLength && x <= p[0]+r._tickLength && y >= yp(s.data[j][2]) && y <= yp(s.data[j][3])) { + return {seriesIndex: i, pointIndex:j, gridData:p, data:s.data[j]}; + } + } + // a hi low close chart + else { + var yp = s._yaxis.series_u2p; + if (x >= p[0]-r._tickLength && x <= p[0]+r._tickLength && y >= yp(s.data[j][1]) && y <= yp(s.data[j][2])) { + return {seriesIndex: i, pointIndex:j, gridData:p, data:s.data[j]}; + } + } + + } + else if (p[0] != null && p[1] != null){ + d = Math.sqrt( (x-p[0]) * (x-p[0]) + (y-p[1]) * (y-p[1]) ); + if (d <= threshold && (d <= d0 || d0 == null)) { + d0 = d; + return {seriesIndex: i, pointIndex:j, gridData:p, data:s.data[j]}; + } + } + } + } + } + break; + + default: + x = gridpos.x; + y = gridpos.y; + r = s.renderer; + if (s.show) { + t = s.markerRenderer.size/2+s.neighborThreshold; + threshold = (t > 0) ? t : 0; + for (var j=0; j<s.gridData.length; j++) { + p = s.gridData[j]; + // neighbor looks different to OHLC chart. + if (r.constructor == $.jqplot.OHLCRenderer) { + if (r.candleStick) { + var yp = s._yaxis.series_u2p; + if (x >= p[0]-r._bodyWidth/2 && x <= p[0]+r._bodyWidth/2 && y >= yp(s.data[j][2]) && y <= yp(s.data[j][3])) { + return {seriesIndex: i, pointIndex:j, gridData:p, data:s.data[j]}; + } + } + // if an open hi low close chart + else if (!r.hlc){ + var yp = s._yaxis.series_u2p; + if (x >= p[0]-r._tickLength && x <= p[0]+r._tickLength && y >= yp(s.data[j][2]) && y <= yp(s.data[j][3])) { + return {seriesIndex: i, pointIndex:j, gridData:p, data:s.data[j]}; + } + } + // a hi low close chart + else { + var yp = s._yaxis.series_u2p; + if (x >= p[0]-r._tickLength && x <= p[0]+r._tickLength && y >= yp(s.data[j][1]) && y <= yp(s.data[j][2])) { + return {seriesIndex: i, pointIndex:j, gridData:p, data:s.data[j]}; + } + } + + } + else { + d = Math.sqrt( (x-p[0]) * (x-p[0]) + (y-p[1]) * (y-p[1]) ); + if (d <= threshold && (d <= d0 || d0 == null)) { + d0 = d; + return {seriesIndex: i, pointIndex:j, gridData:p, data:s.data[j]}; + } + } + } + } + break; + } + } + + return null; + } + + + + this.onClick = function(ev) { + // Event passed in is normalized and will have data attribute. + // Event passed out is unnormalized. + var positions = getEventPosition(ev); + var p = ev.data.plot; + var neighbor = checkIntersection(positions.gridPos, p); + var evt = jQuery.Event('jqplotClick'); + evt.pageX = ev.pageX; + evt.pageY = ev.pageY; + $(this).trigger(evt, [positions.gridPos, positions.dataPos, neighbor, p]); + }; + + this.onDblClick = function(ev) { + // Event passed in is normalized and will have data attribute. + // Event passed out is unnormalized. + var positions = getEventPosition(ev); + var p = ev.data.plot; + var neighbor = checkIntersection(positions.gridPos, p); + var evt = jQuery.Event('jqplotDblClick'); + evt.pageX = ev.pageX; + evt.pageY = ev.pageY; + $(this).trigger(evt, [positions.gridPos, positions.dataPos, neighbor, p]); + }; + + this.onMouseDown = function(ev) { + var positions = getEventPosition(ev); + var p = ev.data.plot; + var neighbor = checkIntersection(positions.gridPos, p); + var evt = jQuery.Event('jqplotMouseDown'); + evt.pageX = ev.pageX; + evt.pageY = ev.pageY; + $(this).trigger(evt, [positions.gridPos, positions.dataPos, neighbor, p]); + }; + + this.onMouseUp = function(ev) { + var positions = getEventPosition(ev); + var evt = jQuery.Event('jqplotMouseUp'); + evt.pageX = ev.pageX; + evt.pageY = ev.pageY; + $(this).trigger(evt, [positions.gridPos, positions.dataPos, null, ev.data.plot]); + }; + + this.onRightClick = function(ev) { + var positions = getEventPosition(ev); + var p = ev.data.plot; + var neighbor = checkIntersection(positions.gridPos, p); + if (p.captureRightClick) { + if (ev.which == 3) { + var evt = jQuery.Event('jqplotRightClick'); + evt.pageX = ev.pageX; + evt.pageY = ev.pageY; + $(this).trigger(evt, [positions.gridPos, positions.dataPos, neighbor, p]); + } + else { + var evt = jQuery.Event('jqplotMouseUp'); + evt.pageX = ev.pageX; + evt.pageY = ev.pageY; + $(this).trigger(evt, [positions.gridPos, positions.dataPos, neighbor, p]); + } + } + }; + + this.onMouseMove = function(ev) { + var positions = getEventPosition(ev); + var p = ev.data.plot; + var neighbor = checkIntersection(positions.gridPos, p); + var evt = jQuery.Event('jqplotMouseMove'); + evt.pageX = ev.pageX; + evt.pageY = ev.pageY; + $(this).trigger(evt, [positions.gridPos, positions.dataPos, neighbor, p]); + }; + + this.onMouseEnter = function(ev) { + var positions = getEventPosition(ev); + var p = ev.data.plot; + var evt = jQuery.Event('jqplotMouseEnter'); + evt.pageX = ev.pageX; + evt.pageY = ev.pageY; + evt.relatedTarget = ev.relatedTarget; + $(this).trigger(evt, [positions.gridPos, positions.dataPos, null, p]); + }; + + this.onMouseLeave = function(ev) { + var positions = getEventPosition(ev); + var p = ev.data.plot; + var evt = jQuery.Event('jqplotMouseLeave'); + evt.pageX = ev.pageX; + evt.pageY = ev.pageY; + evt.relatedTarget = ev.relatedTarget; + $(this).trigger(evt, [positions.gridPos, positions.dataPos, null, p]); + }; + + // method: drawSeries + // Redraws all or just one series on the plot. No axis scaling + // is performed and no other elements on the plot are redrawn. + // options is an options object to pass on to the series renderers. + // It can be an empty object {}. idx is the series index + // to redraw if only one series is to be redrawn. + this.drawSeries = function(options, idx){ + var i, series, ctx; + // if only one argument passed in and it is a number, use it ad idx. + idx = (typeof(options) === "number" && idx == null) ? options : idx; + options = (typeof(options) === "object") ? options : {}; + // draw specified series + if (idx != undefined) { + series = this.series[idx]; + ctx = series.shadowCanvas._ctx; + ctx.clearRect(0, 0, ctx.canvas.width, ctx.canvas.height); + series.drawShadow(ctx, options, this); + ctx = series.canvas._ctx; + ctx.clearRect(0, 0, ctx.canvas.width, ctx.canvas.height); + series.draw(ctx, options, this); + if (series.renderer.constructor == $.jqplot.BezierCurveRenderer) { + if (idx < this.series.length - 1) { + this.drawSeries(idx+1); + } + } + } + + else { + // if call series drawShadow method first, in case all series shadows + // should be drawn before any series. This will ensure, like for + // stacked bar plots, that shadows don't overlap series. + for (i=0; i<this.series.length; i++) { + // first clear the canvas + series = this.series[i]; + ctx = series.shadowCanvas._ctx; + ctx.clearRect(0, 0, ctx.canvas.width, ctx.canvas.height); + series.drawShadow(ctx, options, this); + ctx = series.canvas._ctx; + ctx.clearRect(0, 0, ctx.canvas.width, ctx.canvas.height); + series.draw(ctx, options, this); + } + } + options = idx = i = series = ctx = null; + }; + + // method: moveSeriesToFront + // This method requires jQuery 1.4+ + // Moves the specified series canvas in front of all other series canvases. + // This effectively "draws" the specified series on top of all other series, + // although it is performed through DOM manipulation, no redrawing is performed. + // + // Parameters: + // idx - 0 based index of the series to move. This will be the index of the series + // as it was first passed into the jqplot function. + this.moveSeriesToFront = function (idx) { + idx = parseInt(idx, 10); + var stackIndex = $.inArray(idx, this.seriesStack); + // if already in front, return + if (stackIndex == -1) { + return; + } + if (stackIndex == this.seriesStack.length -1) { + this.previousSeriesStack = this.seriesStack.slice(0); + return; + } + var opidx = this.seriesStack[this.seriesStack.length -1]; + var serelem = this.series[idx].canvas._elem.detach(); + var shadelem = this.series[idx].shadowCanvas._elem.detach(); + this.series[opidx].shadowCanvas._elem.after(shadelem); + this.series[opidx].canvas._elem.after(serelem); + this.previousSeriesStack = this.seriesStack.slice(0); + this.seriesStack.splice(stackIndex, 1); + this.seriesStack.push(idx); + }; + + // method: moveSeriesToBack + // This method requires jQuery 1.4+ + // Moves the specified series canvas behind all other series canvases. + // + // Parameters: + // idx - 0 based index of the series to move. This will be the index of the series + // as it was first passed into the jqplot function. + this.moveSeriesToBack = function (idx) { + idx = parseInt(idx, 10); + var stackIndex = $.inArray(idx, this.seriesStack); + // if already in back, return + if (stackIndex == 0 || stackIndex == -1) { + return; + } + var opidx = this.seriesStack[0]; + var serelem = this.series[idx].canvas._elem.detach(); + var shadelem = this.series[idx].shadowCanvas._elem.detach(); + this.series[opidx].shadowCanvas._elem.before(shadelem); + this.series[opidx].canvas._elem.before(serelem); + this.previousSeriesStack = this.seriesStack.slice(0); + this.seriesStack.splice(stackIndex, 1); + this.seriesStack.unshift(idx); + }; + + // method: restorePreviousSeriesOrder + // This method requires jQuery 1.4+ + // Restore the series canvas order to its previous state. + // Useful to put a series back where it belongs after moving + // it to the front. + this.restorePreviousSeriesOrder = function () { + var i, j, serelem, shadelem, temp, move, keep; + // if no change, return. + if (this.seriesStack == this.previousSeriesStack) { + return; + } + for (i=1; i<this.previousSeriesStack.length; i++) { + move = this.previousSeriesStack[i]; + keep = this.previousSeriesStack[i-1]; + serelem = this.series[move].canvas._elem.detach(); + shadelem = this.series[move].shadowCanvas._elem.detach(); + this.series[keep].shadowCanvas._elem.after(shadelem); + this.series[keep].canvas._elem.after(serelem); + } + temp = this.seriesStack.slice(0); + this.seriesStack = this.previousSeriesStack.slice(0); + this.previousSeriesStack = temp; + }; + + // method: restoreOriginalSeriesOrder + // This method requires jQuery 1.4+ + // Restore the series canvas order to its original order + // when the plot was created. + this.restoreOriginalSeriesOrder = function () { + var i, j, arr=[], serelem, shadelem; + for (i=0; i<this.series.length; i++) { + arr.push(i); + } + if (this.seriesStack == arr) { + return; + } + this.previousSeriesStack = this.seriesStack.slice(0); + this.seriesStack = arr; + for (i=1; i<this.seriesStack.length; i++) { + serelem = this.series[i].canvas._elem.detach(); + shadelem = this.series[i].shadowCanvas._elem.detach(); + this.series[i-1].shadowCanvas._elem.after(shadelem); + this.series[i-1].canvas._elem.after(serelem); + } + }; + + this.activateTheme = function (name) { + this.themeEngine.activate(this, name); + }; + } + + + // conpute a highlight color or array of highlight colors from given colors. + $.jqplot.computeHighlightColors = function(colors) { + var ret; + if (jQuery.isArray(colors)) { + ret = []; + for (var i=0; i<colors.length; i++){ + var rgba = $.jqplot.getColorComponents(colors[i]); + var newrgb = [rgba[0], rgba[1], rgba[2]]; + var sum = newrgb[0] + newrgb[1] + newrgb[2]; + for (var j=0; j<3; j++) { + // when darkening, lowest color component can be is 60. + newrgb[j] = (sum > 660) ? newrgb[j] * 0.85 : 0.73 * newrgb[j] + 90; + newrgb[j] = parseInt(newrgb[j], 10); + (newrgb[j] > 255) ? 255 : newrgb[j]; + } + // newrgb[3] = (rgba[3] > 0.4) ? rgba[3] * 0.4 : rgba[3] * 1.5; + // newrgb[3] = (rgba[3] > 0.5) ? 0.8 * rgba[3] - .1 : rgba[3] + 0.2; + newrgb[3] = 0.3 + 0.35 * rgba[3]; + ret.push('rgba('+newrgb[0]+','+newrgb[1]+','+newrgb[2]+','+newrgb[3]+')'); + } + } + else { + var rgba = $.jqplot.getColorComponents(colors); + var newrgb = [rgba[0], rgba[1], rgba[2]]; + var sum = newrgb[0] + newrgb[1] + newrgb[2]; + for (var j=0; j<3; j++) { + // when darkening, lowest color component can be is 60. + // newrgb[j] = (sum > 570) ? newrgb[j] * 0.8 : newrgb[j] + 0.3 * (255 - newrgb[j]); + // newrgb[j] = parseInt(newrgb[j], 10); + newrgb[j] = (sum > 660) ? newrgb[j] * 0.85 : 0.73 * newrgb[j] + 90; + newrgb[j] = parseInt(newrgb[j], 10); + (newrgb[j] > 255) ? 255 : newrgb[j]; + } + // newrgb[3] = (rgba[3] > 0.4) ? rgba[3] * 0.4 : rgba[3] * 1.5; + // newrgb[3] = (rgba[3] > 0.5) ? 0.8 * rgba[3] - .1 : rgba[3] + 0.2; + newrgb[3] = 0.3 + 0.35 * rgba[3]; + ret = 'rgba('+newrgb[0]+','+newrgb[1]+','+newrgb[2]+','+newrgb[3]+')'; + } + return ret; + }; + + $.jqplot.ColorGenerator = function(colors) { + colors = colors || $.jqplot.config.defaultColors; + var idx = 0; + + this.next = function () { + if (idx < colors.length) { + return colors[idx++]; + } + else { + idx = 0; + return colors[idx++]; + } + }; + + this.previous = function () { + if (idx > 0) { + return colors[idx--]; + } + else { + idx = colors.length-1; + return colors[idx]; + } + }; + + // get a color by index without advancing pointer. + this.get = function(i) { + var idx = i - colors.length * Math.floor(i/colors.length); + return colors[idx]; + }; + + this.setColors = function(c) { + colors = c; + }; + + this.reset = function() { + idx = 0; + }; + + this.getIndex = function() { + return idx; + }; + + this.setIndex = function(index) { + idx = index; + }; + }; + + // convert a hex color string to rgb string. + // h - 3 or 6 character hex string, with or without leading # + // a - optional alpha + $.jqplot.hex2rgb = function(h, a) { + h = h.replace('#', ''); + if (h.length == 3) { + h = h.charAt(0)+h.charAt(0)+h.charAt(1)+h.charAt(1)+h.charAt(2)+h.charAt(2); + } + var rgb; + rgb = 'rgba('+parseInt(h.slice(0,2), 16)+', '+parseInt(h.slice(2,4), 16)+', '+parseInt(h.slice(4,6), 16); + if (a) { + rgb += ', '+a; + } + rgb += ')'; + return rgb; + }; + + // convert an rgb color spec to a hex spec. ignore any alpha specification. + $.jqplot.rgb2hex = function(s) { + var pat = /rgba?\( *([0-9]{1,3}\.?[0-9]*%?) *, *([0-9]{1,3}\.?[0-9]*%?) *, *([0-9]{1,3}\.?[0-9]*%?) *(?:, *[0-9.]*)?\)/; + var m = s.match(pat); + var h = '#'; + for (var i=1; i<4; i++) { + var temp; + if (m[i].search(/%/) != -1) { + temp = parseInt(255*m[i]/100, 10).toString(16); + if (temp.length == 1) { + temp = '0'+temp; + } + } + else { + temp = parseInt(m[i], 10).toString(16); + if (temp.length == 1) { + temp = '0'+temp; + } + } + h += temp; + } + return h; + }; + + // given a css color spec, return an rgb css color spec + $.jqplot.normalize2rgb = function(s, a) { + if (s.search(/^ *rgba?\(/) != -1) { + return s; + } + else if (s.search(/^ *#?[0-9a-fA-F]?[0-9a-fA-F]/) != -1) { + return $.jqplot.hex2rgb(s, a); + } + else { + throw 'invalid color spec'; + } + }; + + // extract the r, g, b, a color components out of a css color spec. + $.jqplot.getColorComponents = function(s) { + // check to see if a color keyword. + s = $.jqplot.colorKeywordMap[s] || s; + var rgb = $.jqplot.normalize2rgb(s); + var pat = /rgba?\( *([0-9]{1,3}\.?[0-9]*%?) *, *([0-9]{1,3}\.?[0-9]*%?) *, *([0-9]{1,3}\.?[0-9]*%?) *,? *([0-9.]* *)?\)/; + var m = rgb.match(pat); + var ret = []; + for (var i=1; i<4; i++) { + if (m[i].search(/%/) != -1) { + ret[i-1] = parseInt(255*m[i]/100, 10); + } + else { + ret[i-1] = parseInt(m[i], 10); + } + } + ret[3] = parseFloat(m[4]) ? parseFloat(m[4]) : 1.0; + return ret; + }; + + $.jqplot.colorKeywordMap = { + aliceblue: 'rgb(240, 248, 255)', + antiquewhite: 'rgb(250, 235, 215)', + aqua: 'rgb( 0, 255, 255)', + aquamarine: 'rgb(127, 255, 212)', + azure: 'rgb(240, 255, 255)', + beige: 'rgb(245, 245, 220)', + bisque: 'rgb(255, 228, 196)', + black: 'rgb( 0, 0, 0)', + blanchedalmond: 'rgb(255, 235, 205)', + blue: 'rgb( 0, 0, 255)', + blueviolet: 'rgb(138, 43, 226)', + brown: 'rgb(165, 42, 42)', + burlywood: 'rgb(222, 184, 135)', + cadetblue: 'rgb( 95, 158, 160)', + chartreuse: 'rgb(127, 255, 0)', + chocolate: 'rgb(210, 105, 30)', + coral: 'rgb(255, 127, 80)', + cornflowerblue: 'rgb(100, 149, 237)', + cornsilk: 'rgb(255, 248, 220)', + crimson: 'rgb(220, 20, 60)', + cyan: 'rgb( 0, 255, 255)', + darkblue: 'rgb( 0, 0, 139)', + darkcyan: 'rgb( 0, 139, 139)', + darkgoldenrod: 'rgb(184, 134, 11)', + darkgray: 'rgb(169, 169, 169)', + darkgreen: 'rgb( 0, 100, 0)', + darkgrey: 'rgb(169, 169, 169)', + darkkhaki: 'rgb(189, 183, 107)', + darkmagenta: 'rgb(139, 0, 139)', + darkolivegreen: 'rgb( 85, 107, 47)', + darkorange: 'rgb(255, 140, 0)', + darkorchid: 'rgb(153, 50, 204)', + darkred: 'rgb(139, 0, 0)', + darksalmon: 'rgb(233, 150, 122)', + darkseagreen: 'rgb(143, 188, 143)', + darkslateblue: 'rgb( 72, 61, 139)', + darkslategray: 'rgb( 47, 79, 79)', + darkslategrey: 'rgb( 47, 79, 79)', + darkturquoise: 'rgb( 0, 206, 209)', + darkviolet: 'rgb(148, 0, 211)', + deeppink: 'rgb(255, 20, 147)', + deepskyblue: 'rgb( 0, 191, 255)', + dimgray: 'rgb(105, 105, 105)', + dimgrey: 'rgb(105, 105, 105)', + dodgerblue: 'rgb( 30, 144, 255)', + firebrick: 'rgb(178, 34, 34)', + floralwhite: 'rgb(255, 250, 240)', + forestgreen: 'rgb( 34, 139, 34)', + fuchsia: 'rgb(255, 0, 255)', + gainsboro: 'rgb(220, 220, 220)', + ghostwhite: 'rgb(248, 248, 255)', + gold: 'rgb(255, 215, 0)', + goldenrod: 'rgb(218, 165, 32)', + gray: 'rgb(128, 128, 128)', + grey: 'rgb(128, 128, 128)', + green: 'rgb( 0, 128, 0)', + greenyellow: 'rgb(173, 255, 47)', + honeydew: 'rgb(240, 255, 240)', + hotpink: 'rgb(255, 105, 180)', + indianred: 'rgb(205, 92, 92)', + indigo: 'rgb( 75, 0, 130)', + ivory: 'rgb(255, 255, 240)', + khaki: 'rgb(240, 230, 140)', + lavender: 'rgb(230, 230, 250)', + lavenderblush: 'rgb(255, 240, 245)', + lawngreen: 'rgb(124, 252, 0)', + lemonchiffon: 'rgb(255, 250, 205)', + lightblue: 'rgb(173, 216, 230)', + lightcoral: 'rgb(240, 128, 128)', + lightcyan: 'rgb(224, 255, 255)', + lightgoldenrodyellow: 'rgb(250, 250, 210)', + lightgray: 'rgb(211, 211, 211)', + lightgreen: 'rgb(144, 238, 144)', + lightgrey: 'rgb(211, 211, 211)', + lightpink: 'rgb(255, 182, 193)', + lightsalmon: 'rgb(255, 160, 122)', + lightseagreen: 'rgb( 32, 178, 170)', + lightskyblue: 'rgb(135, 206, 250)', + lightslategray: 'rgb(119, 136, 153)', + lightslategrey: 'rgb(119, 136, 153)', + lightsteelblue: 'rgb(176, 196, 222)', + lightyellow: 'rgb(255, 255, 224)', + lime: 'rgb( 0, 255, 0)', + limegreen: 'rgb( 50, 205, 50)', + linen: 'rgb(250, 240, 230)', + magenta: 'rgb(255, 0, 255)', + maroon: 'rgb(128, 0, 0)', + mediumaquamarine: 'rgb(102, 205, 170)', + mediumblue: 'rgb( 0, 0, 205)', + mediumorchid: 'rgb(186, 85, 211)', + mediumpurple: 'rgb(147, 112, 219)', + mediumseagreen: 'rgb( 60, 179, 113)', + mediumslateblue: 'rgb(123, 104, 238)', + mediumspringgreen: 'rgb( 0, 250, 154)', + mediumturquoise: 'rgb( 72, 209, 204)', + mediumvioletred: 'rgb(199, 21, 133)', + midnightblue: 'rgb( 25, 25, 112)', + mintcream: 'rgb(245, 255, 250)', + mistyrose: 'rgb(255, 228, 225)', + moccasin: 'rgb(255, 228, 181)', + navajowhite: 'rgb(255, 222, 173)', + navy: 'rgb( 0, 0, 128)', + oldlace: 'rgb(253, 245, 230)', + olive: 'rgb(128, 128, 0)', + olivedrab: 'rgb(107, 142, 35)', + orange: 'rgb(255, 165, 0)', + orangered: 'rgb(255, 69, 0)', + orchid: 'rgb(218, 112, 214)', + palegoldenrod: 'rgb(238, 232, 170)', + palegreen: 'rgb(152, 251, 152)', + paleturquoise: 'rgb(175, 238, 238)', + palevioletred: 'rgb(219, 112, 147)', + papayawhip: 'rgb(255, 239, 213)', + peachpuff: 'rgb(255, 218, 185)', + peru: 'rgb(205, 133, 63)', + pink: 'rgb(255, 192, 203)', + plum: 'rgb(221, 160, 221)', + powderblue: 'rgb(176, 224, 230)', + purple: 'rgb(128, 0, 128)', + red: 'rgb(255, 0, 0)', + rosybrown: 'rgb(188, 143, 143)', + royalblue: 'rgb( 65, 105, 225)', + saddlebrown: 'rgb(139, 69, 19)', + salmon: 'rgb(250, 128, 114)', + sandybrown: 'rgb(244, 164, 96)', + seagreen: 'rgb( 46, 139, 87)', + seashell: 'rgb(255, 245, 238)', + sienna: 'rgb(160, 82, 45)', + silver: 'rgb(192, 192, 192)', + skyblue: 'rgb(135, 206, 235)', + slateblue: 'rgb(106, 90, 205)', + slategray: 'rgb(112, 128, 144)', + slategrey: 'rgb(112, 128, 144)', + snow: 'rgb(255, 250, 250)', + springgreen: 'rgb( 0, 255, 127)', + steelblue: 'rgb( 70, 130, 180)', + tan: 'rgb(210, 180, 140)', + teal: 'rgb( 0, 128, 128)', + thistle: 'rgb(216, 191, 216)', + tomato: 'rgb(255, 99, 71)', + turquoise: 'rgb( 64, 224, 208)', + violet: 'rgb(238, 130, 238)', + wheat: 'rgb(245, 222, 179)', + white: 'rgb(255, 255, 255)', + whitesmoke: 'rgb(245, 245, 245)', + yellow: 'rgb(255, 255, 0)', + yellowgreen: 'rgb(154, 205, 50)' + }; + + + + // class: $.jqplot.AxisLabelRenderer + // Renderer to place labels on the axes. + $.jqplot.AxisLabelRenderer = function(options) { + // Group: Properties + $.jqplot.ElemContainer.call(this); + // name of the axis associated with this tick + this.axis; + // prop: show + // wether or not to show the tick (mark and label). + this.show = true; + // prop: label + // The text or html for the label. + this.label = ''; + this.fontFamily = null; + this.fontSize = null; + this.textColor = null; + this._elem; + // prop: escapeHTML + // true to escape HTML entities in the label. + this.escapeHTML = false; + + $.extend(true, this, options); + }; + + $.jqplot.AxisLabelRenderer.prototype = new $.jqplot.ElemContainer(); + $.jqplot.AxisLabelRenderer.prototype.constructor = $.jqplot.AxisLabelRenderer; + + $.jqplot.AxisLabelRenderer.prototype.init = function(options) { + $.extend(true, this, options); + }; + + $.jqplot.AxisLabelRenderer.prototype.draw = function(ctx, plot) { + // Memory Leaks patch + if (this._elem) { + this._elem.emptyForce(); + this._elem = null; + } + + this._elem = $('<div style="position:absolute;" class="jqplot-'+this.axis+'-label"></div>'); + + if (Number(this.label)) { + this._elem.css('white-space', 'nowrap'); + } + + if (!this.escapeHTML) { + this._elem.html(this.label); + } + else { + this._elem.text(this.label); + } + if (this.fontFamily) { + this._elem.css('font-family', this.fontFamily); + } + if (this.fontSize) { + this._elem.css('font-size', this.fontSize); + } + if (this.textColor) { + this._elem.css('color', this.textColor); + } + + return this._elem; + }; + + $.jqplot.AxisLabelRenderer.prototype.pack = function() { + }; + + // class: $.jqplot.AxisTickRenderer + // A "tick" object showing the value of a tick/gridline on the plot. + $.jqplot.AxisTickRenderer = function(options) { + // Group: Properties + $.jqplot.ElemContainer.call(this); + // prop: mark + // tick mark on the axis. One of 'inside', 'outside', 'cross', '' or null. + this.mark = 'outside'; + // name of the axis associated with this tick + this.axis; + // prop: showMark + // wether or not to show the mark on the axis. + this.showMark = true; + // prop: showGridline + // wether or not to draw the gridline on the grid at this tick. + this.showGridline = true; + // prop: isMinorTick + // if this is a minor tick. + this.isMinorTick = false; + // prop: size + // Length of the tick beyond the grid in pixels. + // DEPRECATED: This has been superceeded by markSize + this.size = 4; + // prop: markSize + // Length of the tick marks in pixels. For 'cross' style, length + // will be stoked above and below axis, so total length will be twice this. + this.markSize = 6; + // prop: show + // wether or not to show the tick (mark and label). + // Setting this to false requires more testing. It is recommended + // to set showLabel and showMark to false instead. + this.show = true; + // prop: showLabel + // wether or not to show the label. + this.showLabel = true; + this.label = null; + this.value = null; + this._styles = {}; + // prop: formatter + // A class of a formatter for the tick text. sprintf by default. + this.formatter = $.jqplot.DefaultTickFormatter; + // prop: prefix + // String to prepend to the tick label. + // Prefix is prepended to the formatted tick label. + this.prefix = ''; + // prop: formatString + // string passed to the formatter. + this.formatString = ''; + // prop: fontFamily + // css spec for the font-family css attribute. + this.fontFamily; + // prop: fontSize + // css spec for the font-size css attribute. + this.fontSize; + // prop: textColor + // css spec for the color attribute. + this.textColor; + // prop: escapeHTML + // true to escape HTML entities in the label. + this.escapeHTML = false; + this._elem; + this._breakTick = false; + + $.extend(true, this, options); + }; + + $.jqplot.AxisTickRenderer.prototype.init = function(options) { + $.extend(true, this, options); + }; + + $.jqplot.AxisTickRenderer.prototype = new $.jqplot.ElemContainer(); + $.jqplot.AxisTickRenderer.prototype.constructor = $.jqplot.AxisTickRenderer; + + $.jqplot.AxisTickRenderer.prototype.setTick = function(value, axisName, isMinor) { + this.value = value; + this.axis = axisName; + if (isMinor) { + this.isMinorTick = true; + } + return this; + }; + + $.jqplot.AxisTickRenderer.prototype.draw = function() { + if (this.label === null) { + this.label = this.prefix + this.formatter(this.formatString, this.value); + } + var style = {position: 'absolute'}; + if (Number(this.label)) { + style['whitSpace'] = 'nowrap'; + } + + // Memory Leaks patch + if (this._elem) { + this._elem.emptyForce(); + this._elem = null; + } + + this._elem = $(document.createElement('div')); + this._elem.addClass("jqplot-"+this.axis+"-tick"); + + if (!this.escapeHTML) { + this._elem.html(this.label); + } + else { + this._elem.text(this.label); + } + + this._elem.css(style); + + for (var s in this._styles) { + this._elem.css(s, this._styles[s]); + } + if (this.fontFamily) { + this._elem.css('font-family', this.fontFamily); + } + if (this.fontSize) { + this._elem.css('font-size', this.fontSize); + } + if (this.textColor) { + this._elem.css('color', this.textColor); + } + if (this._breakTick) { + this._elem.addClass('jqplot-breakTick'); + } + + return this._elem; + }; + + $.jqplot.DefaultTickFormatter = function (format, val) { + if (typeof val == 'number') { + if (!format) { + format = $.jqplot.config.defaultTickFormatString; + } + return $.jqplot.sprintf(format, val); + } + else { + return String(val); + } + }; + + $.jqplot.AxisTickRenderer.prototype.pack = function() { + }; + + // Class: $.jqplot.CanvasGridRenderer + // The default jqPlot grid renderer, creating a grid on a canvas element. + // The renderer has no additional options beyond the <Grid> class. + $.jqplot.CanvasGridRenderer = function(){ + this.shadowRenderer = new $.jqplot.ShadowRenderer(); + }; + + // called with context of Grid object + $.jqplot.CanvasGridRenderer.prototype.init = function(options) { + this._ctx; + $.extend(true, this, options); + // set the shadow renderer options + var sopts = {lineJoin:'miter', lineCap:'round', fill:false, isarc:false, angle:this.shadowAngle, offset:this.shadowOffset, alpha:this.shadowAlpha, depth:this.shadowDepth, lineWidth:this.shadowWidth, closePath:false, strokeStyle:this.shadowColor}; + this.renderer.shadowRenderer.init(sopts); + }; + + // called with context of Grid. + $.jqplot.CanvasGridRenderer.prototype.createElement = function(plot) { + var elem; + // Memory Leaks patch + if (this._elem) { + if ($.jqplot.use_excanvas && window.G_vmlCanvasManager.uninitElement !== undefined) { + elem = this._elem.get(0); + window.G_vmlCanvasManager.uninitElement(elem); + elem = null; + } + + this._elem.emptyForce(); + this._elem = null; + } + + elem = plot.canvasManager.getCanvas(); + + var w = this._plotDimensions.width; + var h = this._plotDimensions.height; + elem.width = w; + elem.height = h; + this._elem = $(elem); + this._elem.addClass('jqplot-grid-canvas'); + this._elem.css({ position: 'absolute', left: 0, top: 0 }); + + elem = plot.canvasManager.initCanvas(elem); + + this._top = this._offsets.top; + this._bottom = h - this._offsets.bottom; + this._left = this._offsets.left; + this._right = w - this._offsets.right; + this._width = this._right - this._left; + this._height = this._bottom - this._top; + // avoid memory leak + elem = null; + return this._elem; + }; + + $.jqplot.CanvasGridRenderer.prototype.draw = function() { + this._ctx = this._elem.get(0).getContext("2d"); + var ctx = this._ctx; + var axes = this._axes; + // Add the grid onto the grid canvas. This is the bottom most layer. + ctx.save(); + ctx.clearRect(0, 0, this._plotDimensions.width, this._plotDimensions.height); + ctx.fillStyle = this.backgroundColor || this.background; + ctx.fillRect(this._left, this._top, this._width, this._height); + + ctx.save(); + ctx.lineJoin = 'miter'; + ctx.lineCap = 'butt'; + ctx.lineWidth = this.gridLineWidth; + ctx.strokeStyle = this.gridLineColor; + var b, e, s, m; + var ax = ['xaxis', 'yaxis', 'x2axis', 'y2axis']; + for (var i=4; i>0; i--) { + var name = ax[i-1]; + var axis = axes[name]; + var ticks = axis._ticks; + var numticks = ticks.length; + if (axis.show) { + if (axis.drawBaseline) { + var bopts = {}; + if (axis.baselineWidth !== null) { + bopts.lineWidth = axis.baselineWidth; + } + if (axis.baselineColor !== null) { + bopts.strokeStyle = axis.baselineColor; + } + switch (name) { + case 'xaxis': + drawLine (this._left, this._bottom, this._right, this._bottom, bopts); + break; + case 'yaxis': + drawLine (this._left, this._bottom, this._left, this._top, bopts); + break; + case 'x2axis': + drawLine (this._left, this._bottom, this._right, this._bottom, bopts); + break; + case 'y2axis': + drawLine (this._right, this._bottom, this._right, this._top, bopts); + break; + } + } + for (var j=numticks; j>0; j--) { + var t = ticks[j-1]; + if (t.show) { + var pos = Math.round(axis.u2p(t.value)) + 0.5; + switch (name) { + case 'xaxis': + // draw the grid line if we should + if (t.showGridline && this.drawGridlines && ((!t.isMinorTick && axis.drawMajorGridlines) || (t.isMinorTick && axis.drawMinorGridlines)) ) { + drawLine(pos, this._top, pos, this._bottom); + } + // draw the mark + if (t.showMark && t.mark && ((!t.isMinorTick && axis.drawMajorTickMarks) || (t.isMinorTick && axis.drawMinorTickMarks)) ) { + s = t.markSize; + m = t.mark; + var pos = Math.round(axis.u2p(t.value)) + 0.5; + switch (m) { + case 'outside': + b = this._bottom; + e = this._bottom+s; + break; + case 'inside': + b = this._bottom-s; + e = this._bottom; + break; + case 'cross': + b = this._bottom-s; + e = this._bottom+s; + break; + default: + b = this._bottom; + e = this._bottom+s; + break; + } + // draw the shadow + if (this.shadow) { + this.renderer.shadowRenderer.draw(ctx, [[pos,b],[pos,e]], {lineCap:'butt', lineWidth:this.gridLineWidth, offset:this.gridLineWidth*0.75, depth:2, fill:false, closePath:false}); + } + // draw the line + drawLine(pos, b, pos, e); + } + break; + case 'yaxis': + // draw the grid line + if (t.showGridline && this.drawGridlines && ((!t.isMinorTick && axis.drawMajorGridlines) || (t.isMinorTick && axis.drawMinorGridlines)) ) { + drawLine(this._right, pos, this._left, pos); + } + // draw the mark + if (t.showMark && t.mark && ((!t.isMinorTick && axis.drawMajorTickMarks) || (t.isMinorTick && axis.drawMinorTickMarks)) ) { + s = t.markSize; + m = t.mark; + var pos = Math.round(axis.u2p(t.value)) + 0.5; + switch (m) { + case 'outside': + b = this._left-s; + e = this._left; + break; + case 'inside': + b = this._left; + e = this._left+s; + break; + case 'cross': + b = this._left-s; + e = this._left+s; + break; + default: + b = this._left-s; + e = this._left; + break; + } + // draw the shadow + if (this.shadow) { + this.renderer.shadowRenderer.draw(ctx, [[b, pos], [e, pos]], {lineCap:'butt', lineWidth:this.gridLineWidth*1.5, offset:this.gridLineWidth*0.75, fill:false, closePath:false}); + } + drawLine(b, pos, e, pos, {strokeStyle:axis.borderColor}); + } + break; + case 'x2axis': + // draw the grid line + if (t.showGridline && this.drawGridlines && ((!t.isMinorTick && axis.drawMajorGridlines) || (t.isMinorTick && axis.drawMinorGridlines)) ) { + drawLine(pos, this._bottom, pos, this._top); + } + // draw the mark + if (t.showMark && t.mark && ((!t.isMinorTick && axis.drawMajorTickMarks) || (t.isMinorTick && axis.drawMinorTickMarks)) ) { + s = t.markSize; + m = t.mark; + var pos = Math.round(axis.u2p(t.value)) + 0.5; + switch (m) { + case 'outside': + b = this._top-s; + e = this._top; + break; + case 'inside': + b = this._top; + e = this._top+s; + break; + case 'cross': + b = this._top-s; + e = this._top+s; + break; + default: + b = this._top-s; + e = this._top; + break; + } + // draw the shadow + if (this.shadow) { + this.renderer.shadowRenderer.draw(ctx, [[pos,b],[pos,e]], {lineCap:'butt', lineWidth:this.gridLineWidth, offset:this.gridLineWidth*0.75, depth:2, fill:false, closePath:false}); + } + drawLine(pos, b, pos, e); + } + break; + case 'y2axis': + // draw the grid line + if (t.showGridline && this.drawGridlines && ((!t.isMinorTick && axis.drawMajorGridlines) || (t.isMinorTick && axis.drawMinorGridlines)) ) { + drawLine(this._left, pos, this._right, pos); + } + // draw the mark + if (t.showMark && t.mark && ((!t.isMinorTick && axis.drawMajorTickMarks) || (t.isMinorTick && axis.drawMinorTickMarks)) ) { + s = t.markSize; + m = t.mark; + var pos = Math.round(axis.u2p(t.value)) + 0.5; + switch (m) { + case 'outside': + b = this._right; + e = this._right+s; + break; + case 'inside': + b = this._right-s; + e = this._right; + break; + case 'cross': + b = this._right-s; + e = this._right+s; + break; + default: + b = this._right; + e = this._right+s; + break; + } + // draw the shadow + if (this.shadow) { + this.renderer.shadowRenderer.draw(ctx, [[b, pos], [e, pos]], {lineCap:'butt', lineWidth:this.gridLineWidth*1.5, offset:this.gridLineWidth*0.75, fill:false, closePath:false}); + } + drawLine(b, pos, e, pos, {strokeStyle:axis.borderColor}); + } + break; + default: + break; + } + } + } + t = null; + } + axis = null; + ticks = null; + } + // Now draw grid lines for additional y axes + ////// + // TO DO: handle yMidAxis + ////// + ax = ['y3axis', 'y4axis', 'y5axis', 'y6axis', 'y7axis', 'y8axis', 'y9axis', 'yMidAxis']; + for (var i=7; i>0; i--) { + var axis = axes[ax[i-1]]; + var ticks = axis._ticks; + if (axis.show) { + var tn = ticks[axis.numberTicks-1]; + var t0 = ticks[0]; + var left = axis.getLeft(); + var points = [[left, tn.getTop() + tn.getHeight()/2], [left, t0.getTop() + t0.getHeight()/2 + 1.0]]; + // draw the shadow + if (this.shadow) { + this.renderer.shadowRenderer.draw(ctx, points, {lineCap:'butt', fill:false, closePath:false}); + } + // draw the line + drawLine(points[0][0], points[0][1], points[1][0], points[1][1], {lineCap:'butt', strokeStyle:axis.borderColor, lineWidth:axis.borderWidth}); + // draw the tick marks + for (var j=ticks.length; j>0; j--) { + var t = ticks[j-1]; + s = t.markSize; + m = t.mark; + var pos = Math.round(axis.u2p(t.value)) + 0.5; + if (t.showMark && t.mark) { + switch (m) { + case 'outside': + b = left; + e = left+s; + break; + case 'inside': + b = left-s; + e = left; + break; + case 'cross': + b = left-s; + e = left+s; + break; + default: + b = left; + e = left+s; + break; + } + points = [[b,pos], [e,pos]]; + // draw the shadow + if (this.shadow) { + this.renderer.shadowRenderer.draw(ctx, points, {lineCap:'butt', lineWidth:this.gridLineWidth*1.5, offset:this.gridLineWidth*0.75, fill:false, closePath:false}); + } + // draw the line + drawLine(b, pos, e, pos, {strokeStyle:axis.borderColor}); + } + t = null; + } + t0 = null; + } + axis = null; + ticks = null; + } + + ctx.restore(); + + function drawLine(bx, by, ex, ey, opts) { + ctx.save(); + opts = opts || {}; + if (opts.lineWidth == null || opts.lineWidth != 0){ + $.extend(true, ctx, opts); + ctx.beginPath(); + ctx.moveTo(bx, by); + ctx.lineTo(ex, ey); + ctx.stroke(); + ctx.restore(); + } + } + + if (this.shadow) { + var points = [[this._left, this._bottom], [this._right, this._bottom], [this._right, this._top]]; + this.renderer.shadowRenderer.draw(ctx, points); + } + // Now draw border around grid. Use axis border definitions. start at + // upper left and go clockwise. + if (this.borderWidth != 0 && this.drawBorder) { + drawLine (this._left, this._top, this._right, this._top, {lineCap:'round', strokeStyle:axes.x2axis.borderColor, lineWidth:axes.x2axis.borderWidth}); + drawLine (this._right, this._top, this._right, this._bottom, {lineCap:'round', strokeStyle:axes.y2axis.borderColor, lineWidth:axes.y2axis.borderWidth}); + drawLine (this._right, this._bottom, this._left, this._bottom, {lineCap:'round', strokeStyle:axes.xaxis.borderColor, lineWidth:axes.xaxis.borderWidth}); + drawLine (this._left, this._bottom, this._left, this._top, {lineCap:'round', strokeStyle:axes.yaxis.borderColor, lineWidth:axes.yaxis.borderWidth}); + } + // ctx.lineWidth = this.borderWidth; + // ctx.strokeStyle = this.borderColor; + // ctx.strokeRect(this._left, this._top, this._width, this._height); + + ctx.restore(); + ctx = null; + axes = null; + }; + + // Class: $.jqplot.DivTitleRenderer + // The default title renderer for jqPlot. This class has no options beyond the <Title> class. + $.jqplot.DivTitleRenderer = function() { + }; + + $.jqplot.DivTitleRenderer.prototype.init = function(options) { + $.extend(true, this, options); + }; + + $.jqplot.DivTitleRenderer.prototype.draw = function() { + // Memory Leaks patch + if (this._elem) { + this._elem.emptyForce(); + this._elem = null; + } + + var r = this.renderer; + var elem = document.createElement('div'); + this._elem = $(elem); + this._elem.addClass('jqplot-title'); + + if (!this.text) { + this.show = false; + this._elem.height(0); + this._elem.width(0); + } + else if (this.text) { + var color; + if (this.color) { + color = this.color; + } + else if (this.textColor) { + color = this.textColor; + } + + // don't trust that a stylesheet is present, set the position. + var styles = {position:'absolute', top:'0px', left:'0px'}; + + if (this._plotWidth) { + styles['width'] = this._plotWidth+'px'; + } + if (this.fontSize) { + styles['fontSize'] = this.fontSize; + } + if (typeof this.textAlign === 'string') { + styles['textAlign'] = this.textAlign; + } + else { + styles['textAlign'] = 'center'; + } + if (color) { + styles['color'] = color; + } + if (this.paddingBottom) { + styles['paddingBottom'] = this.paddingBottom; + } + if (this.fontFamily) { + styles['fontFamily'] = this.fontFamily; + } + + this._elem.css(styles); + if (this.escapeHtml) { + this._elem.text(this.text); + } + else { + this._elem.html(this.text); + } + + + // styletext += (this._plotWidth) ? 'width:'+this._plotWidth+'px;' : ''; + // styletext += (this.fontSize) ? 'font-size:'+this.fontSize+';' : ''; + // styletext += (this.textAlign) ? 'text-align:'+this.textAlign+';' : 'text-align:center;'; + // styletext += (color) ? 'color:'+color+';' : ''; + // styletext += (this.paddingBottom) ? 'padding-bottom:'+this.paddingBottom+';' : ''; + // this._elem = $('<div class="jqplot-title" style="'+styletext+'">'+this.text+'</div>'); + // if (this.fontFamily) { + // this._elem.css('font-family', this.fontFamily); + // } + } + + elem = null; + + return this._elem; + }; + + $.jqplot.DivTitleRenderer.prototype.pack = function() { + // nothing to do here + }; + + + var dotlen = 0.1; + + $.jqplot.LinePattern = function (ctx, pattern) { + + var defaultLinePatterns = { + dotted: [ dotlen, $.jqplot.config.dotGapLength ], + dashed: [ $.jqplot.config.dashLength, $.jqplot.config.gapLength ], + solid: null + }; + + if (typeof pattern === 'string') { + if (pattern[0] === '.' || pattern[0] === '-') { + var s = pattern; + pattern = []; + for (var i=0, imax=s.length; i<imax; i++) { + if (s[i] === '.') { + pattern.push( dotlen ); + } + else if (s[i] === '-') { + pattern.push( $.jqplot.config.dashLength ); + } + else { + continue; + } + pattern.push( $.jqplot.config.gapLength ); + } + } + else { + pattern = defaultLinePatterns[pattern]; + } + } + + if (!(pattern && pattern.length)) { + return ctx; + } + + var patternIndex = 0; + var patternDistance = pattern[0]; + var px = 0; + var py = 0; + var pathx0 = 0; + var pathy0 = 0; + + var moveTo = function (x, y) { + ctx.moveTo( x, y ); + px = x; + py = y; + pathx0 = x; + pathy0 = y; + }; + + var lineTo = function (x, y) { + var scale = ctx.lineWidth; + var dx = x - px; + var dy = y - py; + var dist = Math.sqrt(dx*dx+dy*dy); + if ((dist > 0) && (scale > 0)) { + dx /= dist; + dy /= dist; + while (true) { + var dp = scale * patternDistance; + if (dp < dist) { + px += dp * dx; + py += dp * dy; + if ((patternIndex & 1) == 0) { + ctx.lineTo( px, py ); + } + else { + ctx.moveTo( px, py ); + } + dist -= dp; + patternIndex++; + if (patternIndex >= pattern.length) { + patternIndex = 0; + } + patternDistance = pattern[patternIndex]; + } + else { + px = x; + py = y; + if ((patternIndex & 1) == 0) { + ctx.lineTo( px, py ); + } + else { + ctx.moveTo( px, py ); + } + patternDistance -= dist / scale; + break; + } + } + } + }; + + var beginPath = function () { + ctx.beginPath(); + }; + + var closePath = function () { + lineTo( pathx0, pathy0 ); + }; + + return { + moveTo: moveTo, + lineTo: lineTo, + beginPath: beginPath, + closePath: closePath + }; + }; + + // Class: $.jqplot.LineRenderer + // The default line renderer for jqPlot, this class has no options beyond the <Series> class. + // Draws series as a line. + $.jqplot.LineRenderer = function(){ + this.shapeRenderer = new $.jqplot.ShapeRenderer(); + this.shadowRenderer = new $.jqplot.ShadowRenderer(); + }; + + // called with scope of series. + $.jqplot.LineRenderer.prototype.init = function(options, plot) { + // Group: Properties + // + options = options || {}; + this._type='line'; + this.renderer.animation = { + show: false, + direction: 'left', + speed: 2500, + _supported: true + }; + // prop: smooth + // True to draw a smoothed (interpolated) line through the data points + // with automatically computed number of smoothing points. + // Set to an integer number > 2 to specify number of smoothing points + // to use between each data point. + this.renderer.smooth = false; // true or a number > 2 for smoothing. + this.renderer.tension = null; // null to auto compute or a number typically > 6. Fewer points requires higher tension. + // prop: constrainSmoothing + // True to use a more accurate smoothing algorithm that will + // not overshoot any data points. False to allow overshoot but + // produce a smoother looking line. + this.renderer.constrainSmoothing = true; + // this is smoothed data in grid coordinates, like gridData + this.renderer._smoothedData = []; + // this is smoothed data in plot units (plot coordinates), like plotData. + this.renderer._smoothedPlotData = []; + this.renderer._hiBandGridData = []; + this.renderer._lowBandGridData = []; + this.renderer._hiBandSmoothedData = []; + this.renderer._lowBandSmoothedData = []; + + // prop: bandData + // Data used to draw error bands or confidence intervals above/below a line. + // + // bandData can be input in 3 forms. jqPlot will figure out which is the + // low band line and which is the high band line for all forms: + // + // A 2 dimensional array like [[yl1, yl2, ...], [yu1, yu2, ...]] where + // [yl1, yl2, ...] are y values of the lower line and + // [yu1, yu2, ...] are y values of the upper line. + // In this case there must be the same number of y data points as data points + // in the series and the bands will inherit the x values of the series. + // + // A 2 dimensional array like [[[xl1, yl1], [xl2, yl2], ...], [[xh1, yh1], [xh2, yh2], ...]] + // where [xl1, yl1] are x,y data points for the lower line and + // [xh1, yh1] are x,y data points for the high line. + // x values do not have to correspond to the x values of the series and can + // be of any arbitrary length. + // + // Can be of form [[yl1, yu1], [yl2, yu2], [yl3, yu3], ...] where + // there must be 3 or more arrays and there must be the same number of arrays + // as there are data points in the series. In this case, + // [yl1, yu1] specifies the lower and upper y values for the 1st + // data point and so on. The bands will inherit the x + // values from the series. + this.renderer.bandData = []; + + // Group: bands + // Banding around line, e.g error bands or confidence intervals. + this.renderer.bands = { + // prop: show + // true to show the bands. If bandData or interval is + // supplied, show will be set to true by default. + show: false, + hiData: [], + lowData: [], + // prop: color + // color of lines at top and bottom of bands [default: series color]. + color: this.color, + // prop: showLines + // True to show lines at top and bottom of bands [default: false]. + showLines: false, + // prop: fill + // True to fill area between bands [default: true]. + fill: true, + // prop: fillColor + // css color spec for filled area. [default: series color]. + fillColor: null, + _min: null, + _max: null, + // prop: interval + // User specified interval above and below line for bands [default: '3%'']. + // Can be a value like 3 or a string like '3%' + // or an upper/lower array like [1, -2] or ['2%', '-1.5%'] + interval: '3%' + }; + + + var lopts = {highlightMouseOver: options.highlightMouseOver, highlightMouseDown: options.highlightMouseDown, highlightColor: options.highlightColor}; + + delete (options.highlightMouseOver); + delete (options.highlightMouseDown); + delete (options.highlightColor); + + $.extend(true, this.renderer, options); + + this.renderer.options = options; + + // if we are given some band data, and bands aren't explicity set to false in options, turn them on. + if (this.renderer.bandData.length > 1 && (!options.bands || options.bands.show == null)) { + this.renderer.bands.show = true; + } + + // if we are given an interval, and bands aren't explicity set to false in options, turn them on. + else if (options.bands && options.bands.show == null && options.bands.interval != null) { + this.renderer.bands.show = true; + } + + // if plot is filled, turn off bands. + if (this.fill) { + this.renderer.bands.show = false; + } + + if (this.renderer.bands.show) { + this.renderer.initBands.call(this, this.renderer.options, plot); + } + + + // smoothing is not compatible with stacked lines, disable + if (this._stack) { + this.renderer.smooth = false; + } + + // set the shape renderer options + var opts = {lineJoin:this.lineJoin, lineCap:this.lineCap, fill:this.fill, isarc:false, strokeStyle:this.color, fillStyle:this.fillColor, lineWidth:this.lineWidth, linePattern:this.linePattern, closePath:this.fill}; + this.renderer.shapeRenderer.init(opts); + + var shadow_offset = options.shadowOffset; + // set the shadow renderer options + if (shadow_offset == null) { + // scale the shadowOffset to the width of the line. + if (this.lineWidth > 2.5) { + shadow_offset = 1.25 * (1 + (Math.atan((this.lineWidth/2.5))/0.785398163 - 1)*0.6); + // var shadow_offset = this.shadowOffset; + } + // for skinny lines, don't make such a big shadow. + else { + shadow_offset = 1.25 * Math.atan((this.lineWidth/2.5))/0.785398163; + } + } + + var sopts = {lineJoin:this.lineJoin, lineCap:this.lineCap, fill:this.fill, isarc:false, angle:this.shadowAngle, offset:shadow_offset, alpha:this.shadowAlpha, depth:this.shadowDepth, lineWidth:this.lineWidth, linePattern:this.linePattern, closePath:this.fill}; + this.renderer.shadowRenderer.init(sopts); + this._areaPoints = []; + this._boundingBox = [[],[]]; + + if (!this.isTrendline && this.fill || this.renderer.bands.show) { + // Group: Properties + // + // prop: highlightMouseOver + // True to highlight area on a filled plot when moused over. + // This must be false to enable highlightMouseDown to highlight when clicking on an area on a filled plot. + this.highlightMouseOver = true; + // prop: highlightMouseDown + // True to highlight when a mouse button is pressed over an area on a filled plot. + // This will be disabled if highlightMouseOver is true. + this.highlightMouseDown = false; + // prop: highlightColor + // color to use when highlighting an area on a filled plot. + this.highlightColor = null; + // if user has passed in highlightMouseDown option and not set highlightMouseOver, disable highlightMouseOver + if (lopts.highlightMouseDown && lopts.highlightMouseOver == null) { + lopts.highlightMouseOver = false; + } + + $.extend(true, this, {highlightMouseOver: lopts.highlightMouseOver, highlightMouseDown: lopts.highlightMouseDown, highlightColor: lopts.highlightColor}); + + if (!this.highlightColor) { + var fc = (this.renderer.bands.show) ? this.renderer.bands.fillColor : this.fillColor; + this.highlightColor = $.jqplot.computeHighlightColors(fc); + } + // turn off (disable) the highlighter plugin + if (this.highlighter) { + this.highlighter.show = false; + } + } + + if (!this.isTrendline && plot) { + plot.plugins.lineRenderer = {}; + plot.postInitHooks.addOnce(postInit); + plot.postDrawHooks.addOnce(postPlotDraw); + plot.eventListenerHooks.addOnce('jqplotMouseMove', handleMove); + plot.eventListenerHooks.addOnce('jqplotMouseDown', handleMouseDown); + plot.eventListenerHooks.addOnce('jqplotMouseUp', handleMouseUp); + plot.eventListenerHooks.addOnce('jqplotClick', handleClick); + plot.eventListenerHooks.addOnce('jqplotRightClick', handleRightClick); + } + + }; + + $.jqplot.LineRenderer.prototype.initBands = function(options, plot) { + // use bandData if no data specified in bands option + //var bd = this.renderer.bandData; + var bd = options.bandData || []; + var bands = this.renderer.bands; + bands.hiData = []; + bands.lowData = []; + var data = this.data; + bands._max = null; + bands._min = null; + // If 2 arrays, and each array greater than 2 elements, assume it is hi and low data bands of y values. + if (bd.length == 2) { + // Do we have an array of x,y values? + // like [[[1,1], [2,4], [3,3]], [[1,3], [2,6], [3,5]]] + if ($.isArray(bd[0][0])) { + // since an arbitrary array of points, spin through all of them to determine max and min lines. + + var p; + var bdminidx = 0, bdmaxidx = 0; + for (var i = 0, l = bd[0].length; i<l; i++) { + p = bd[0][i]; + if ((p[1] != null && p[1] > bands._max) || bands._max == null) { + bands._max = p[1]; + } + if ((p[1] != null && p[1] < bands._min) || bands._min == null) { + bands._min = p[1]; + } + } + for (var i = 0, l = bd[1].length; i<l; i++) { + p = bd[1][i]; + if ((p[1] != null && p[1] > bands._max) || bands._max == null) { + bands._max = p[1]; + bdmaxidx = 1; + } + if ((p[1] != null && p[1] < bands._min) || bands._min == null) { + bands._min = p[1]; + bdminidx = 1; + } + } + + if (bdmaxidx === bdminidx) { + bands.show = false; + } + + bands.hiData = bd[bdmaxidx]; + bands.lowData = bd[bdminidx]; + } + // else data is arrays of y values + // like [[1,4,3], [3,6,5]] + // must have same number of band data points as points in series + else if (bd[0].length === data.length && bd[1].length === data.length) { + var hi = (bd[0][0] > bd[1][0]) ? 0 : 1; + var low = (hi) ? 0 : 1; + for (var i=0, l=data.length; i < l; i++) { + bands.hiData.push([data[i][0], bd[hi][i]]); + bands.lowData.push([data[i][0], bd[low][i]]); + } + } + + // we don't have proper data array, don't show bands. + else { + bands.show = false; + } + } + + // if more than 2 arrays, have arrays of [ylow, yhi] values. + // note, can't distinguish case of [[ylow, yhi], [ylow, yhi]] from [[ylow, ylow], [yhi, yhi]] + // this is assumed to be of the latter form. + else if (bd.length > 2 && !$.isArray(bd[0][0])) { + var hi = (bd[0][0] > bd[0][1]) ? 0 : 1; + var low = (hi) ? 0 : 1; + for (var i=0, l=bd.length; i<l; i++) { + bands.hiData.push([data[i][0], bd[i][hi]]); + bands.lowData.push([data[i][0], bd[i][low]]); + } + } + + // don't have proper data, auto calculate + else { + var intrv = bands.interval; + var a = null; + var b = null; + var afunc = null; + var bfunc = null; + + if ($.isArray(intrv)) { + a = intrv[0]; + b = intrv[1]; + } + else { + a = intrv; + } + + if (isNaN(a)) { + // we have a string + if (a.charAt(a.length - 1) === '%') { + afunc = 'multiply'; + a = parseFloat(a)/100 + 1; + } + } + + else { + a = parseFloat(a); + afunc = 'add'; + } + + if (b !== null && isNaN(b)) { + // we have a string + if (b.charAt(b.length - 1) === '%') { + bfunc = 'multiply'; + b = parseFloat(b)/100 + 1; + } + } + + else if (b !== null) { + b = parseFloat(b); + bfunc = 'add'; + } + + if (a !== null) { + if (b === null) { + b = -a; + bfunc = afunc; + if (bfunc === 'multiply') { + b += 2; + } + } + + // make sure a always applies to hi band. + if (a < b) { + var temp = a; + a = b; + b = temp; + temp = afunc; + afunc = bfunc; + bfunc = temp; + } + + for (var i=0, l = data.length; i < l; i++) { + switch (afunc) { + case 'add': + bands.hiData.push([data[i][0], data[i][1] + a]); + break; + case 'multiply': + bands.hiData.push([data[i][0], data[i][1] * a]); + break; + } + switch (bfunc) { + case 'add': + bands.lowData.push([data[i][0], data[i][1] + b]); + break; + case 'multiply': + bands.lowData.push([data[i][0], data[i][1] * b]); + break; + } + } + } + + else { + bands.show = false; + } + } + + var hd = bands.hiData; + var ld = bands.lowData; + for (var i = 0, l = hd.length; i<l; i++) { + if ((hd[i][1] != null && hd[i][1] > bands._max) || bands._max == null) { + bands._max = hd[i][1]; + } + } + for (var i = 0, l = ld.length; i<l; i++) { + if ((ld[i][1] != null && ld[i][1] < bands._min) || bands._min == null) { + bands._min = ld[i][1]; + } + } + + // one last check for proper data + // these don't apply any more since allowing arbitrary x,y values + // if (bands.hiData.length != bands.lowData.length) { + // bands.show = false; + // } + + // if (bands.hiData.length != this.data.length) { + // bands.show = false; + // } + + if (bands.fillColor === null) { + var c = $.jqplot.getColorComponents(bands.color); + // now adjust alpha to differentiate fill + c[3] = c[3] * 0.5; + bands.fillColor = 'rgba(' + c[0] +', '+ c[1] +', '+ c[2] +', '+ c[3] + ')'; + } + }; + + function getSteps (d, f) { + return (3.4182054+f) * Math.pow(d, -0.3534992); + } + + function computeSteps (d1, d2) { + var s = Math.sqrt(Math.pow((d2[0]- d1[0]), 2) + Math.pow ((d2[1] - d1[1]), 2)); + return 5.7648 * Math.log(s) + 7.4456; + } + + function tanh (x) { + var a = (Math.exp(2*x) - 1) / (Math.exp(2*x) + 1); + return a; + } + + ////////// + // computeConstrainedSmoothedData + // An implementation of the constrained cubic spline interpolation + // method as presented in: + // + // Kruger, CJC, Constrained Cubic Spine Interpolation for Chemical Engineering Applications + // http://www.korf.co.uk/spline.pdf + // + // The implementation below borrows heavily from the sample Visual Basic + // implementation by CJC Kruger found in http://www.korf.co.uk/spline.xls + // + ///////// + + // called with scope of series + function computeConstrainedSmoothedData (gd) { + var smooth = this.renderer.smooth; + var dim = this.canvas.getWidth(); + var xp = this._xaxis.series_p2u; + var yp = this._yaxis.series_p2u; + var steps =null; + var _steps = null; + var dist = gd.length/dim; + var _smoothedData = []; + var _smoothedPlotData = []; + + if (!isNaN(parseFloat(smooth))) { + steps = parseFloat(smooth); + } + else { + steps = getSteps(dist, 0.5); + } + + var yy = []; + var xx = []; + + for (var i=0, l = gd.length; i<l; i++) { + yy.push(gd[i][1]); + xx.push(gd[i][0]); + } + + function dxx(x1, x0) { + if (x1 - x0 == 0) { + return Math.pow(10,10); + } + else { + return x1 - x0; + } + } + + var A, B, C, D; + // loop through each line segment. Have # points - 1 line segments. Nmber segments starting at 1. + var nmax = gd.length - 1; + for (var num = 1, gdl = gd.length; num<gdl; num++) { + var gxx = []; + var ggxx = []; + // point at each end of segment. + for (var j = 0; j < 2; j++) { + var i = num - 1 + j; // point number, 0 to # points. + + if (i == 0 || i == nmax) { + gxx[j] = Math.pow(10, 10); + } + else if (yy[i+1] - yy[i] == 0 || yy[i] - yy[i-1] == 0) { + gxx[j] = 0; + } + else if (((xx[i+1] - xx[i]) / (yy[i+1] - yy[i]) + (xx[i] - xx[i-1]) / (yy[i] - yy[i-1])) == 0 ) { + gxx[j] = 0; + } + else if ( (yy[i+1] - yy[i]) * (yy[i] - yy[i-1]) < 0 ) { + gxx[j] = 0; + } + + else { + gxx[j] = 2 / (dxx(xx[i + 1], xx[i]) / (yy[i + 1] - yy[i]) + dxx(xx[i], xx[i - 1]) / (yy[i] - yy[i - 1])); + } + } + + // Reset first derivative (slope) at first and last point + if (num == 1) { + // First point has 0 2nd derivative + gxx[0] = 3 / 2 * (yy[1] - yy[0]) / dxx(xx[1], xx[0]) - gxx[1] / 2; + } + else if (num == nmax) { + // Last point has 0 2nd derivative + gxx[1] = 3 / 2 * (yy[nmax] - yy[nmax - 1]) / dxx(xx[nmax], xx[nmax - 1]) - gxx[0] / 2; + } + + // Calc second derivative at points + ggxx[0] = -2 * (gxx[1] + 2 * gxx[0]) / dxx(xx[num], xx[num - 1]) + 6 * (yy[num] - yy[num - 1]) / Math.pow(dxx(xx[num], xx[num - 1]), 2); + ggxx[1] = 2 * (2 * gxx[1] + gxx[0]) / dxx(xx[num], xx[num - 1]) - 6 * (yy[num] - yy[num - 1]) / Math.pow(dxx(xx[num], xx[num - 1]), 2); + + // Calc constants for cubic interpolation + D = 1 / 6 * (ggxx[1] - ggxx[0]) / dxx(xx[num], xx[num - 1]); + C = 1 / 2 * (xx[num] * ggxx[0] - xx[num - 1] * ggxx[1]) / dxx(xx[num], xx[num - 1]); + B = (yy[num] - yy[num - 1] - C * (Math.pow(xx[num], 2) - Math.pow(xx[num - 1], 2)) - D * (Math.pow(xx[num], 3) - Math.pow(xx[num - 1], 3))) / dxx(xx[num], xx[num - 1]); + A = yy[num - 1] - B * xx[num - 1] - C * Math.pow(xx[num - 1], 2) - D * Math.pow(xx[num - 1], 3); + + var increment = (xx[num] - xx[num - 1]) / steps; + var temp, tempx; + + for (var j = 0, l = steps; j < l; j++) { + temp = []; + tempx = xx[num - 1] + j * increment; + temp.push(tempx); + temp.push(A + B * tempx + C * Math.pow(tempx, 2) + D * Math.pow(tempx, 3)); + _smoothedData.push(temp); + _smoothedPlotData.push([xp(temp[0]), yp(temp[1])]); + } + } + + _smoothedData.push(gd[i]); + _smoothedPlotData.push([xp(gd[i][0]), yp(gd[i][1])]); + + return [_smoothedData, _smoothedPlotData]; + } + + /////// + // computeHermiteSmoothedData + // A hermite spline smoothing of the plot data. + // This implementation is derived from the one posted + // by krypin on the jqplot-users mailing list: + // + // http://groups.google.com/group/jqplot-users/browse_thread/thread/748be6a445723cea?pli=1 + // + // with a blog post: + // + // http://blog.statscollector.com/a-plugin-renderer-for-jqplot-to-draw-a-hermite-spline/ + // + // and download of the original plugin: + // + // http://blog.statscollector.com/wp-content/uploads/2010/02/jqplot.hermiteSplineRenderer.js + ////////// + + // called with scope of series + function computeHermiteSmoothedData (gd) { + var smooth = this.renderer.smooth; + var tension = this.renderer.tension; + var dim = this.canvas.getWidth(); + var xp = this._xaxis.series_p2u; + var yp = this._yaxis.series_p2u; + var steps =null; + var _steps = null; + var a = null; + var a1 = null; + var a2 = null; + var slope = null; + var slope2 = null; + var temp = null; + var t, s, h1, h2, h3, h4; + var TiX, TiY, Ti1X, Ti1Y; + var pX, pY, p; + var sd = []; + var spd = []; + var dist = gd.length/dim; + var min, max, stretch, scale, shift; + var _smoothedData = []; + var _smoothedPlotData = []; + if (!isNaN(parseFloat(smooth))) { + steps = parseFloat(smooth); + } + else { + steps = getSteps(dist, 0.5); + } + if (!isNaN(parseFloat(tension))) { + tension = parseFloat(tension); + } + + for (var i=0, l = gd.length-1; i < l; i++) { + + if (tension === null) { + slope = Math.abs((gd[i+1][1] - gd[i][1]) / (gd[i+1][0] - gd[i][0])); + + min = 0.3; + max = 0.6; + stretch = (max - min)/2.0; + scale = 2.5; + shift = -1.4; + + temp = slope/scale + shift; + + a1 = stretch * tanh(temp) - stretch * tanh(shift) + min; + + // if have both left and right line segments, will use minimum tension. + if (i > 0) { + slope2 = Math.abs((gd[i][1] - gd[i-1][1]) / (gd[i][0] - gd[i-1][0])); + } + temp = slope2/scale + shift; + + a2 = stretch * tanh(temp) - stretch * tanh(shift) + min; + + a = (a1 + a2)/2.0; + + } + else { + a = tension; + } + for (t=0; t < steps; t++) { + s = t / steps; + h1 = (1 + 2*s)*Math.pow((1-s),2); + h2 = s*Math.pow((1-s),2); + h3 = Math.pow(s,2)*(3-2*s); + h4 = Math.pow(s,2)*(s-1); + + if (gd[i-1]) { + TiX = a * (gd[i+1][0] - gd[i-1][0]); + TiY = a * (gd[i+1][1] - gd[i-1][1]); + } else { + TiX = a * (gd[i+1][0] - gd[i][0]); + TiY = a * (gd[i+1][1] - gd[i][1]); + } + if (gd[i+2]) { + Ti1X = a * (gd[i+2][0] - gd[i][0]); + Ti1Y = a * (gd[i+2][1] - gd[i][1]); + } else { + Ti1X = a * (gd[i+1][0] - gd[i][0]); + Ti1Y = a * (gd[i+1][1] - gd[i][1]); + } + + pX = h1*gd[i][0] + h3*gd[i+1][0] + h2*TiX + h4*Ti1X; + pY = h1*gd[i][1] + h3*gd[i+1][1] + h2*TiY + h4*Ti1Y; + p = [pX, pY]; + + _smoothedData.push(p); + _smoothedPlotData.push([xp(pX), yp(pY)]); + } + } + _smoothedData.push(gd[l]); + _smoothedPlotData.push([xp(gd[l][0]), yp(gd[l][1])]); + + return [_smoothedData, _smoothedPlotData]; + } + + // setGridData + // converts the user data values to grid coordinates and stores them + // in the gridData array. + // Called with scope of a series. + $.jqplot.LineRenderer.prototype.setGridData = function(plot) { + // recalculate the grid data + var xp = this._xaxis.series_u2p; + var yp = this._yaxis.series_u2p; + var data = this._plotData; + var pdata = this._prevPlotData; + this.gridData = []; + this._prevGridData = []; + this.renderer._smoothedData = []; + this.renderer._smoothedPlotData = []; + this.renderer._hiBandGridData = []; + this.renderer._lowBandGridData = []; + this.renderer._hiBandSmoothedData = []; + this.renderer._lowBandSmoothedData = []; + var bands = this.renderer.bands; + var hasNull = false; + for (var i=0, l=this.data.length; i < l; i++) { + // if not a line series or if no nulls in data, push the converted point onto the array. + if (data[i][0] != null && data[i][1] != null) { + this.gridData.push([xp.call(this._xaxis, data[i][0]), yp.call(this._yaxis, data[i][1])]); + } + // else if there is a null, preserve it. + else if (data[i][0] == null) { + hasNull = true; + this.gridData.push([null, yp.call(this._yaxis, data[i][1])]); + } + else if (data[i][1] == null) { + hasNull = true; + this.gridData.push([xp.call(this._xaxis, data[i][0]), null]); + } + // if not a line series or if no nulls in data, push the converted point onto the array. + if (pdata[i] != null && pdata[i][0] != null && pdata[i][1] != null) { + this._prevGridData.push([xp.call(this._xaxis, pdata[i][0]), yp.call(this._yaxis, pdata[i][1])]); + } + // else if there is a null, preserve it. + else if (pdata[i] != null && pdata[i][0] == null) { + this._prevGridData.push([null, yp.call(this._yaxis, pdata[i][1])]); + } + else if (pdata[i] != null && pdata[i][0] != null && pdata[i][1] == null) { + this._prevGridData.push([xp.call(this._xaxis, pdata[i][0]), null]); + } + } + + // don't do smoothing or bands on broken lines. + if (hasNull) { + this.renderer.smooth = false; + if (this._type === 'line') { + bands.show = false; + } + } + + if (this._type === 'line' && bands.show) { + for (var i=0, l=bands.hiData.length; i<l; i++) { + this.renderer._hiBandGridData.push([xp.call(this._xaxis, bands.hiData[i][0]), yp.call(this._yaxis, bands.hiData[i][1])]); + } + for (var i=0, l=bands.lowData.length; i<l; i++) { + this.renderer._lowBandGridData.push([xp.call(this._xaxis, bands.lowData[i][0]), yp.call(this._yaxis, bands.lowData[i][1])]); + } + } + + // calculate smoothed data if enough points and no nulls + if (this._type === 'line' && this.renderer.smooth && this.gridData.length > 2) { + var ret; + if (this.renderer.constrainSmoothing) { + ret = computeConstrainedSmoothedData.call(this, this.gridData); + this.renderer._smoothedData = ret[0]; + this.renderer._smoothedPlotData = ret[1]; + + if (bands.show) { + ret = computeConstrainedSmoothedData.call(this, this.renderer._hiBandGridData); + this.renderer._hiBandSmoothedData = ret[0]; + ret = computeConstrainedSmoothedData.call(this, this.renderer._lowBandGridData); + this.renderer._lowBandSmoothedData = ret[0]; + } + + ret = null; + } + else { + ret = computeHermiteSmoothedData.call(this, this.gridData); + this.renderer._smoothedData = ret[0]; + this.renderer._smoothedPlotData = ret[1]; + + if (bands.show) { + ret = computeHermiteSmoothedData.call(this, this.renderer._hiBandGridData); + this.renderer._hiBandSmoothedData = ret[0]; + ret = computeHermiteSmoothedData.call(this, this.renderer._lowBandGridData); + this.renderer._lowBandSmoothedData = ret[0]; + } + + ret = null; + } + } + }; + + // makeGridData + // converts any arbitrary data values to grid coordinates and + // returns them. This method exists so that plugins can use a series' + // linerenderer to generate grid data points without overwriting the + // grid data associated with that series. + // Called with scope of a series. + $.jqplot.LineRenderer.prototype.makeGridData = function(data, plot) { + // recalculate the grid data + var xp = this._xaxis.series_u2p; + var yp = this._yaxis.series_u2p; + var gd = []; + var pgd = []; + this.renderer._smoothedData = []; + this.renderer._smoothedPlotData = []; + this.renderer._hiBandGridData = []; + this.renderer._lowBandGridData = []; + this.renderer._hiBandSmoothedData = []; + this.renderer._lowBandSmoothedData = []; + var bands = this.renderer.bands; + var hasNull = false; + for (var i=0; i<data.length; i++) { + // if not a line series or if no nulls in data, push the converted point onto the array. + if (data[i][0] != null && data[i][1] != null) { + gd.push([xp.call(this._xaxis, data[i][0]), yp.call(this._yaxis, data[i][1])]); + } + // else if there is a null, preserve it. + else if (data[i][0] == null) { + hasNull = true; + gd.push([null, yp.call(this._yaxis, data[i][1])]); + } + else if (data[i][1] == null) { + hasNull = true; + gd.push([xp.call(this._xaxis, data[i][0]), null]); + } + } + + // don't do smoothing or bands on broken lines. + if (hasNull) { + this.renderer.smooth = false; + if (this._type === 'line') { + bands.show = false; + } + } + + if (this._type === 'line' && bands.show) { + for (var i=0, l=bands.hiData.length; i<l; i++) { + this.renderer._hiBandGridData.push([xp.call(this._xaxis, bands.hiData[i][0]), yp.call(this._yaxis, bands.hiData[i][1])]); + } + for (var i=0, l=bands.lowData.length; i<l; i++) { + this.renderer._lowBandGridData.push([xp.call(this._xaxis, bands.lowData[i][0]), yp.call(this._yaxis, bands.lowData[i][1])]); + } + } + + if (this._type === 'line' && this.renderer.smooth && gd.length > 2) { + var ret; + if (this.renderer.constrainSmoothing) { + ret = computeConstrainedSmoothedData.call(this, gd); + this.renderer._smoothedData = ret[0]; + this.renderer._smoothedPlotData = ret[1]; + + if (bands.show) { + ret = computeConstrainedSmoothedData.call(this, this.renderer._hiBandGridData); + this.renderer._hiBandSmoothedData = ret[0]; + ret = computeConstrainedSmoothedData.call(this, this.renderer._lowBandGridData); + this.renderer._lowBandSmoothedData = ret[0]; + } + + ret = null; + } + else { + ret = computeHermiteSmoothedData.call(this, gd); + this.renderer._smoothedData = ret[0]; + this.renderer._smoothedPlotData = ret[1]; + + if (bands.show) { + ret = computeHermiteSmoothedData.call(this, this.renderer._hiBandGridData); + this.renderer._hiBandSmoothedData = ret[0]; + ret = computeHermiteSmoothedData.call(this, this.renderer._lowBandGridData); + this.renderer._lowBandSmoothedData = ret[0]; + } + + ret = null; + } + } + return gd; + }; + + + // called within scope of series. + $.jqplot.LineRenderer.prototype.draw = function(ctx, gd, options, plot) { + var i; + // get a copy of the options, so we don't modify the original object. + var opts = $.extend(true, {}, options); + var shadow = (opts.shadow != undefined) ? opts.shadow : this.shadow; + var showLine = (opts.showLine != undefined) ? opts.showLine : this.showLine; + var fill = (opts.fill != undefined) ? opts.fill : this.fill; + var fillAndStroke = (opts.fillAndStroke != undefined) ? opts.fillAndStroke : this.fillAndStroke; + var xmin, ymin, xmax, ymax; + ctx.save(); + if (gd.length) { + if (showLine) { + // if we fill, we'll have to add points to close the curve. + if (fill) { + if (this.fillToZero) { + // have to break line up into shapes at axis crossings + var negativeColor = this.negativeColor; + if (! this.useNegativeColors) { + negativeColor = opts.fillStyle; + } + var isnegative = false; + var posfs = opts.fillStyle; + + // if stoking line as well as filling, get a copy of line data. + if (fillAndStroke) { + var fasgd = gd.slice(0); + } + // if not stacked, fill down to axis + if (this.index == 0 || !this._stack) { + + var tempgd = []; + var pd = (this.renderer.smooth) ? this.renderer._smoothedPlotData : this._plotData; + this._areaPoints = []; + var pyzero = this._yaxis.series_u2p(this.fillToValue); + var pxzero = this._xaxis.series_u2p(this.fillToValue); + + opts.closePath = true; + + if (this.fillAxis == 'y') { + tempgd.push([gd[0][0], pyzero]); + this._areaPoints.push([gd[0][0], pyzero]); + + for (var i=0; i<gd.length-1; i++) { + tempgd.push(gd[i]); + this._areaPoints.push(gd[i]); + // do we have an axis crossing? + if (pd[i][1] * pd[i+1][1] < 0) { + if (pd[i][1] < 0) { + isnegative = true; + opts.fillStyle = negativeColor; + } + else { + isnegative = false; + opts.fillStyle = posfs; + } + + var xintercept = gd[i][0] + (gd[i+1][0] - gd[i][0]) * (pyzero-gd[i][1])/(gd[i+1][1] - gd[i][1]); + tempgd.push([xintercept, pyzero]); + this._areaPoints.push([xintercept, pyzero]); + // now draw this shape and shadow. + if (shadow) { + this.renderer.shadowRenderer.draw(ctx, tempgd, opts); + } + this.renderer.shapeRenderer.draw(ctx, tempgd, opts); + // now empty temp array and continue + tempgd = [[xintercept, pyzero]]; + // this._areaPoints = [[xintercept, pyzero]]; + } + } + if (pd[gd.length-1][1] < 0) { + isnegative = true; + opts.fillStyle = negativeColor; + } + else { + isnegative = false; + opts.fillStyle = posfs; + } + tempgd.push(gd[gd.length-1]); + this._areaPoints.push(gd[gd.length-1]); + tempgd.push([gd[gd.length-1][0], pyzero]); + this._areaPoints.push([gd[gd.length-1][0], pyzero]); + } + // now draw the last area. + if (shadow) { + this.renderer.shadowRenderer.draw(ctx, tempgd, opts); + } + this.renderer.shapeRenderer.draw(ctx, tempgd, opts); + + + // var gridymin = this._yaxis.series_u2p(0); + // // IE doesn't return new length on unshift + // gd.unshift([gd[0][0], gridymin]); + // len = gd.length; + // gd.push([gd[len - 1][0], gridymin]); + } + // if stacked, fill to line below + else { + var prev = this._prevGridData; + for (var i=prev.length; i>0; i--) { + gd.push(prev[i-1]); + // this._areaPoints.push(prev[i-1]); + } + if (shadow) { + this.renderer.shadowRenderer.draw(ctx, gd, opts); + } + this._areaPoints = gd; + this.renderer.shapeRenderer.draw(ctx, gd, opts); + } + } + ///////////////////////// + // Not filled to zero + //////////////////////// + else { + // if stoking line as well as filling, get a copy of line data. + if (fillAndStroke) { + var fasgd = gd.slice(0); + } + // if not stacked, fill down to axis + if (this.index == 0 || !this._stack) { + // var gridymin = this._yaxis.series_u2p(this._yaxis.min) - this.gridBorderWidth / 2; + var gridymin = ctx.canvas.height; + // IE doesn't return new length on unshift + gd.unshift([gd[0][0], gridymin]); + var len = gd.length; + gd.push([gd[len - 1][0], gridymin]); + } + // if stacked, fill to line below + else { + var prev = this._prevGridData; + for (var i=prev.length; i>0; i--) { + gd.push(prev[i-1]); + } + } + this._areaPoints = gd; + + if (shadow) { + this.renderer.shadowRenderer.draw(ctx, gd, opts); + } + + this.renderer.shapeRenderer.draw(ctx, gd, opts); + } + if (fillAndStroke) { + var fasopts = $.extend(true, {}, opts, {fill:false, closePath:false}); + this.renderer.shapeRenderer.draw(ctx, fasgd, fasopts); + ////////// + // TODO: figure out some way to do shadows nicely + // if (shadow) { + // this.renderer.shadowRenderer.draw(ctx, fasgd, fasopts); + // } + // now draw the markers + if (this.markerRenderer.show) { + if (this.renderer.smooth) { + fasgd = this.gridData; + } + for (i=0; i<fasgd.length; i++) { + this.markerRenderer.draw(fasgd[i][0], fasgd[i][1], ctx, opts.markerOptions); + } + } + } + } + else { + + if (this.renderer.bands.show) { + var bdat; + var bopts = $.extend(true, {}, opts); + if (this.renderer.bands.showLines) { + bdat = (this.renderer.smooth) ? this.renderer._hiBandSmoothedData : this.renderer._hiBandGridData; + this.renderer.shapeRenderer.draw(ctx, bdat, opts); + bdat = (this.renderer.smooth) ? this.renderer._lowBandSmoothedData : this.renderer._lowBandGridData; + this.renderer.shapeRenderer.draw(ctx, bdat, bopts); + } + + if (this.renderer.bands.fill) { + if (this.renderer.smooth) { + bdat = this.renderer._hiBandSmoothedData.concat(this.renderer._lowBandSmoothedData.reverse()); + } + else { + bdat = this.renderer._hiBandGridData.concat(this.renderer._lowBandGridData.reverse()); + } + this._areaPoints = bdat; + bopts.closePath = true; + bopts.fill = true; + bopts.fillStyle = this.renderer.bands.fillColor; + this.renderer.shapeRenderer.draw(ctx, bdat, bopts); + } + } + + if (shadow) { + this.renderer.shadowRenderer.draw(ctx, gd, opts); + } + + this.renderer.shapeRenderer.draw(ctx, gd, opts); + } + } + // calculate the bounding box + var xmin = xmax = ymin = ymax = null; + for (i=0; i<this._areaPoints.length; i++) { + var p = this._areaPoints[i]; + if (xmin > p[0] || xmin == null) { + xmin = p[0]; + } + if (ymax < p[1] || ymax == null) { + ymax = p[1]; + } + if (xmax < p[0] || xmax == null) { + xmax = p[0]; + } + if (ymin > p[1] || ymin == null) { + ymin = p[1]; + } + } + + if (this.type === 'line' && this.renderer.bands.show) { + ymax = this._yaxis.series_u2p(this.renderer.bands._min); + ymin = this._yaxis.series_u2p(this.renderer.bands._max); + } + + this._boundingBox = [[xmin, ymax], [xmax, ymin]]; + + // now draw the markers + if (this.markerRenderer.show && !fill) { + if (this.renderer.smooth) { + gd = this.gridData; + } + for (i=0; i<gd.length; i++) { + if (gd[i][0] != null && gd[i][1] != null) { + this.markerRenderer.draw(gd[i][0], gd[i][1], ctx, opts.markerOptions); + } + } + } + } + + ctx.restore(); + }; + + $.jqplot.LineRenderer.prototype.drawShadow = function(ctx, gd, options) { + // This is a no-op, shadows drawn with lines. + }; + + // called with scope of plot. + // make sure to not leave anything highlighted. + function postInit(target, data, options) { + for (var i=0; i<this.series.length; i++) { + if (this.series[i].renderer.constructor == $.jqplot.LineRenderer) { + // don't allow mouseover and mousedown at same time. + if (this.series[i].highlightMouseOver) { + this.series[i].highlightMouseDown = false; + } + } + } + } + + // called within context of plot + // create a canvas which we can draw on. + // insert it before the eventCanvas, so eventCanvas will still capture events. + function postPlotDraw() { + // Memory Leaks patch + if (this.plugins.lineRenderer && this.plugins.lineRenderer.highlightCanvas) { + this.plugins.lineRenderer.highlightCanvas.resetCanvas(); + this.plugins.lineRenderer.highlightCanvas = null; + } + + this.plugins.lineRenderer.highlightedSeriesIndex = null; + this.plugins.lineRenderer.highlightCanvas = new $.jqplot.GenericCanvas(); + + this.eventCanvas._elem.before(this.plugins.lineRenderer.highlightCanvas.createElement(this._gridPadding, 'jqplot-lineRenderer-highlight-canvas', this._plotDimensions, this)); + this.plugins.lineRenderer.highlightCanvas.setContext(); + this.eventCanvas._elem.bind('mouseleave', {plot:this}, function (ev) { unhighlight(ev.data.plot); }); + } + + function highlight (plot, sidx, pidx, points) { + var s = plot.series[sidx]; + var canvas = plot.plugins.lineRenderer.highlightCanvas; + canvas._ctx.clearRect(0,0,canvas._ctx.canvas.width, canvas._ctx.canvas.height); + s._highlightedPoint = pidx; + plot.plugins.lineRenderer.highlightedSeriesIndex = sidx; + var opts = {fillStyle: s.highlightColor}; + if (s.type === 'line' && s.renderer.bands.show) { + opts.fill = true; + opts.closePath = true; + } + s.renderer.shapeRenderer.draw(canvas._ctx, points, opts); + canvas = null; + } + + function unhighlight (plot) { + var canvas = plot.plugins.lineRenderer.highlightCanvas; + canvas._ctx.clearRect(0,0, canvas._ctx.canvas.width, canvas._ctx.canvas.height); + for (var i=0; i<plot.series.length; i++) { + plot.series[i]._highlightedPoint = null; + } + plot.plugins.lineRenderer.highlightedSeriesIndex = null; + plot.target.trigger('jqplotDataUnhighlight'); + canvas = null; + } + + + function handleMove(ev, gridpos, datapos, neighbor, plot) { + if (neighbor) { + var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data]; + var evt1 = jQuery.Event('jqplotDataMouseOver'); + evt1.pageX = ev.pageX; + evt1.pageY = ev.pageY; + plot.target.trigger(evt1, ins); + if (plot.series[ins[0]].highlightMouseOver && !(ins[0] == plot.plugins.lineRenderer.highlightedSeriesIndex)) { + var evt = jQuery.Event('jqplotDataHighlight'); + evt.pageX = ev.pageX; + evt.pageY = ev.pageY; + plot.target.trigger(evt, ins); + highlight (plot, neighbor.seriesIndex, neighbor.pointIndex, neighbor.points); + } + } + else if (neighbor == null) { + unhighlight (plot); + } + } + + function handleMouseDown(ev, gridpos, datapos, neighbor, plot) { + if (neighbor) { + var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data]; + if (plot.series[ins[0]].highlightMouseDown && !(ins[0] == plot.plugins.lineRenderer.highlightedSeriesIndex)) { + var evt = jQuery.Event('jqplotDataHighlight'); + evt.pageX = ev.pageX; + evt.pageY = ev.pageY; + plot.target.trigger(evt, ins); + highlight (plot, neighbor.seriesIndex, neighbor.pointIndex, neighbor.points); + } + } + else if (neighbor == null) { + unhighlight (plot); + } + } + + function handleMouseUp(ev, gridpos, datapos, neighbor, plot) { + var idx = plot.plugins.lineRenderer.highlightedSeriesIndex; + if (idx != null && plot.series[idx].highlightMouseDown) { + unhighlight(plot); + } + } + + function handleClick(ev, gridpos, datapos, neighbor, plot) { + if (neighbor) { + var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data]; + var evt = jQuery.Event('jqplotDataClick'); + evt.pageX = ev.pageX; + evt.pageY = ev.pageY; + plot.target.trigger(evt, ins); + } + } + + function handleRightClick(ev, gridpos, datapos, neighbor, plot) { + if (neighbor) { + var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data]; + var idx = plot.plugins.lineRenderer.highlightedSeriesIndex; + if (idx != null && plot.series[idx].highlightMouseDown) { + unhighlight(plot); + } + var evt = jQuery.Event('jqplotDataRightClick'); + evt.pageX = ev.pageX; + evt.pageY = ev.pageY; + plot.target.trigger(evt, ins); + } + } + + + // class: $.jqplot.LinearAxisRenderer + // The default jqPlot axis renderer, creating a numeric axis. + $.jqplot.LinearAxisRenderer = function() { + }; + + // called with scope of axis object. + $.jqplot.LinearAxisRenderer.prototype.init = function(options){ + // prop: breakPoints + // EXPERIMENTAL!! Use at your own risk! + // Works only with linear axes and the default tick renderer. + // Array of [start, stop] points to create a broken axis. + // Broken axes have a "jump" in them, which is an immediate + // transition from a smaller value to a larger value. + // Currently, axis ticks MUST be manually assigned if using breakPoints + // by using the axis ticks array option. + this.breakPoints = null; + // prop: breakTickLabel + // Label to use at the axis break if breakPoints are specified. + this.breakTickLabel = "≈"; + // prop: drawBaseline + // True to draw the axis baseline. + this.drawBaseline = true; + // prop: baselineWidth + // width of the baseline in pixels. + this.baselineWidth = null; + // prop: baselineColor + // CSS color spec for the baseline. + this.baselineColor = null; + // prop: forceTickAt0 + // This will ensure that there is always a tick mark at 0. + // If data range is strictly positive or negative, + // this will force 0 to be inside the axis bounds unless + // the appropriate axis pad (pad, padMin or padMax) is set + // to 0, then this will force an axis min or max value at 0. + // This has know effect when any of the following options + // are set: autoscale, min, max, numberTicks or tickInterval. + this.forceTickAt0 = false; + // prop: forceTickAt100 + // This will ensure that there is always a tick mark at 100. + // If data range is strictly above or below 100, + // this will force 100 to be inside the axis bounds unless + // the appropriate axis pad (pad, padMin or padMax) is set + // to 0, then this will force an axis min or max value at 100. + // This has know effect when any of the following options + // are set: autoscale, min, max, numberTicks or tickInterval. + this.forceTickAt100 = false; + // prop: tickInset + // Controls the amount to inset the first and last ticks from + // the edges of the grid, in multiples of the tick interval. + // 0 is no inset, 0.5 is one half a tick interval, 1 is a full + // tick interval, etc. + this.tickInset = 0; + // prop: minorTicks + // Number of ticks to add between "major" ticks. + // Major ticks are ticks supplied by user or auto computed. + // Minor ticks cannot be created by user. + this.minorTicks = 0; + // prop: alignTicks + // true to align tick marks across opposed axes + // such as from the y2axis to yaxis. + this.alignTicks = false; + this._autoFormatString = ''; + this._overrideFormatString = false; + this._scalefact = 1.0; + $.extend(true, this, options); + if (this.breakPoints) { + if (!$.isArray(this.breakPoints)) { + this.breakPoints = null; + } + else if (this.breakPoints.length < 2 || this.breakPoints[1] <= this.breakPoints[0]) { + this.breakPoints = null; + } + } + if (this.numberTicks != null && this.numberTicks < 2) { + this.numberTicks = 2; + } + this.resetDataBounds(); + }; + + // called with scope of axis + $.jqplot.LinearAxisRenderer.prototype.draw = function(ctx, plot) { + if (this.show) { + // populate the axis label and value properties. + // createTicks is a method on the renderer, but + // call it within the scope of the axis. + this.renderer.createTicks.call(this, plot); + // fill a div with axes labels in the right direction. + // Need to pregenerate each axis to get it's bounds and + // position it and the labels correctly on the plot. + var dim=0; + var temp; + // Added for theming. + if (this._elem) { + // Memory Leaks patch + //this._elem.empty(); + this._elem.emptyForce(); + this._elem = null; + } + + this._elem = $(document.createElement('div')); + this._elem.addClass('jqplot-axis jqplot-'+this.name); + this._elem.css('position', 'absolute'); + + + if (this.name == 'xaxis' || this.name == 'x2axis') { + this._elem.width(this._plotDimensions.width); + } + else { + this._elem.height(this._plotDimensions.height); + } + + // create a _label object. + this.labelOptions.axis = this.name; + this._label = new this.labelRenderer(this.labelOptions); + if (this._label.show) { + var elem = this._label.draw(ctx, plot); + elem.appendTo(this._elem); + elem = null; + } + + var t = this._ticks; + var tick; + for (var i=0; i<t.length; i++) { + tick = t[i]; + if (tick.show && tick.showLabel && (!tick.isMinorTick || this.showMinorTicks)) { + this._elem.append(tick.draw(ctx, plot)); + } + } + tick = null; + t = null; + } + return this._elem; + }; + + // called with scope of an axis + $.jqplot.LinearAxisRenderer.prototype.reset = function() { + this.min = this._options.min; + this.max = this._options.max; + this.tickInterval = this._options.tickInterval; + this.numberTicks = this._options.numberTicks; + this._autoFormatString = ''; + if (this._overrideFormatString && this.tickOptions && this.tickOptions.formatString) { + this.tickOptions.formatString = ''; + } + + // this._ticks = this.__ticks; + }; + + // called with scope of axis + $.jqplot.LinearAxisRenderer.prototype.set = function() { + var dim = 0; + var temp; + var w = 0; + var h = 0; + var lshow = (this._label == null) ? false : this._label.show; + if (this.show) { + var t = this._ticks; + var tick; + for (var i=0; i<t.length; i++) { + tick = t[i]; + if (!tick._breakTick && tick.show && tick.showLabel && (!tick.isMinorTick || this.showMinorTicks)) { + if (this.name == 'xaxis' || this.name == 'x2axis') { + temp = tick._elem.outerHeight(true); + } + else { + temp = tick._elem.outerWidth(true); + } + if (temp > dim) { + dim = temp; + } + } + } + tick = null; + t = null; + + if (lshow) { + w = this._label._elem.outerWidth(true); + h = this._label._elem.outerHeight(true); + } + if (this.name == 'xaxis') { + dim = dim + h; + this._elem.css({'height':dim+'px', left:'0px', bottom:'0px'}); + } + else if (this.name == 'x2axis') { + dim = dim + h; + this._elem.css({'height':dim+'px', left:'0px', top:'0px'}); + } + else if (this.name == 'yaxis') { + dim = dim + w; + this._elem.css({'width':dim+'px', left:'0px', top:'0px'}); + if (lshow && this._label.constructor == $.jqplot.AxisLabelRenderer) { + this._label._elem.css('width', w+'px'); + } + } + else { + dim = dim + w; + this._elem.css({'width':dim+'px', right:'0px', top:'0px'}); + if (lshow && this._label.constructor == $.jqplot.AxisLabelRenderer) { + this._label._elem.css('width', w+'px'); + } + } + } + }; + + // called with scope of axis + $.jqplot.LinearAxisRenderer.prototype.createTicks = function(plot) { + // we're are operating on an axis here + var ticks = this._ticks; + var userTicks = this.ticks; + var name = this.name; + // databounds were set on axis initialization. + var db = this._dataBounds; + var dim = (this.name.charAt(0) === 'x') ? this._plotDimensions.width : this._plotDimensions.height; + var interval; + var min, max; + var pos1, pos2; + var tt, i; + // get a copy of user's settings for min/max. + var userMin = this.min; + var userMax = this.max; + var userNT = this.numberTicks; + var userTI = this.tickInterval; + + var threshold = 30; + this._scalefact = (Math.max(dim, threshold+1) - threshold)/300.0; + + // if we already have ticks, use them. + // ticks must be in order of increasing value. + + if (userTicks.length) { + // ticks could be 1D or 2D array of [val, val, ,,,] or [[val, label], [val, label], ...] or mixed + for (i=0; i<userTicks.length; i++){ + var ut = userTicks[i]; + var t = new this.tickRenderer(this.tickOptions); + if ($.isArray(ut)) { + t.value = ut[0]; + if (this.breakPoints) { + if (ut[0] == this.breakPoints[0]) { + t.label = this.breakTickLabel; + t._breakTick = true; + t.showGridline = false; + t.showMark = false; + } + else if (ut[0] > this.breakPoints[0] && ut[0] <= this.breakPoints[1]) { + t.show = false; + t.showGridline = false; + t.label = ut[1]; + } + else { + t.label = ut[1]; + } + } + else { + t.label = ut[1]; + } + t.setTick(ut[0], this.name); + this._ticks.push(t); + } + + else if ($.isPlainObject(ut)) { + $.extend(true, t, ut); + t.axis = this.name; + this._ticks.push(t); + } + + else { + t.value = ut; + if (this.breakPoints) { + if (ut == this.breakPoints[0]) { + t.label = this.breakTickLabel; + t._breakTick = true; + t.showGridline = false; + t.showMark = false; + } + else if (ut > this.breakPoints[0] && ut <= this.breakPoints[1]) { + t.show = false; + t.showGridline = false; + } + } + t.setTick(ut, this.name); + this._ticks.push(t); + } + } + this.numberTicks = userTicks.length; + this.min = this._ticks[0].value; + this.max = this._ticks[this.numberTicks-1].value; + this.tickInterval = (this.max - this.min) / (this.numberTicks - 1); + } + + // we don't have any ticks yet, let's make some! + else { + if (name == 'xaxis' || name == 'x2axis') { + dim = this._plotDimensions.width; + } + else { + dim = this._plotDimensions.height; + } + + var _numberTicks = this.numberTicks; + + // if aligning this axis, use number of ticks from previous axis. + // Do I need to reset somehow if alignTicks is changed and then graph is replotted?? + if (this.alignTicks) { + if (this.name === 'x2axis' && plot.axes.xaxis.show) { + _numberTicks = plot.axes.xaxis.numberTicks; + } + else if (this.name.charAt(0) === 'y' && this.name !== 'yaxis' && this.name !== 'yMidAxis' && plot.axes.yaxis.show) { + _numberTicks = plot.axes.yaxis.numberTicks; + } + } + + min = ((this.min != null) ? this.min : db.min); + max = ((this.max != null) ? this.max : db.max); + + var range = max - min; + var rmin, rmax; + var temp; + + if (this.tickOptions == null || !this.tickOptions.formatString) { + this._overrideFormatString = true; + } + + // Doing complete autoscaling + if (this.min == null && this.max == null && this.tickInterval == null && !this.autoscale) { + // Check if user must have tick at 0 or 100 and ensure they are in range. + // The autoscaling algorithm will always place ticks at 0 and 100 if they are in range. + if (this.forceTickAt0) { + if (min > 0) { + min = 0; + } + if (max < 0) { + max = 0; + } + } + + if (this.forceTickAt100) { + if (min > 100) { + min = 100; + } + if (max < 100) { + max = 100; + } + } + + // var threshold = 30; + // var tdim = Math.max(dim, threshold+1); + // this._scalefact = (tdim-threshold)/300.0; + var ret = $.jqplot.LinearTickGenerator(min, max, this._scalefact, _numberTicks); + // calculate a padded max and min, points should be less than these + // so that they aren't too close to the edges of the plot. + // User can adjust how much padding is allowed with pad, padMin and PadMax options. + var tumin = min + range*(this.padMin - 1); + var tumax = max - range*(this.padMax - 1); + + // if they're equal, we shouldn't have to do anything, right? + // if (min <=tumin || max >= tumax) { + if (min <tumin || max > tumax) { + tumin = min - range*(this.padMin - 1); + tumax = max + range*(this.padMax - 1); + ret = $.jqplot.LinearTickGenerator(tumin, tumax, this._scalefact, _numberTicks); + } + + this.min = ret[0]; + this.max = ret[1]; + // if numberTicks specified, it should return the same. + this.numberTicks = ret[2]; + this._autoFormatString = ret[3]; + this.tickInterval = ret[4]; + } + + // User has specified some axis scale related option, can use auto algorithm + else { + + // if min and max are same, space them out a bit + if (min == max) { + var adj = 0.05; + if (min > 0) { + adj = Math.max(Math.log(min)/Math.LN10, 0.05); + } + min -= adj; + max += adj; + } + + // autoscale. Can't autoscale if min or max is supplied. + // Will use numberTicks and tickInterval if supplied. Ticks + // across multiple axes may not line up depending on how + // bars are to be plotted. + if (this.autoscale && this.min == null && this.max == null) { + var rrange, ti, margin; + var forceMinZero = false; + var forceZeroLine = false; + var intervals = {min:null, max:null, average:null, stddev:null}; + // if any series are bars, or if any are fill to zero, and if this + // is the axis to fill toward, check to see if we can start axis at zero. + for (var i=0; i<this._series.length; i++) { + var s = this._series[i]; + var faname = (s.fillAxis == 'x') ? s._xaxis.name : s._yaxis.name; + // check to see if this is the fill axis + if (this.name == faname) { + var vals = s._plotValues[s.fillAxis]; + var vmin = vals[0]; + var vmax = vals[0]; + for (var j=1; j<vals.length; j++) { + if (vals[j] < vmin) { + vmin = vals[j]; + } + else if (vals[j] > vmax) { + vmax = vals[j]; + } + } + var dp = (vmax - vmin) / vmax; + // is this sries a bar? + if (s.renderer.constructor == $.jqplot.BarRenderer) { + // if no negative values and could also check range. + if (vmin >= 0 && (s.fillToZero || dp > 0.1)) { + forceMinZero = true; + } + else { + forceMinZero = false; + if (s.fill && s.fillToZero && vmin < 0 && vmax > 0) { + forceZeroLine = true; + } + else { + forceZeroLine = false; + } + } + } + + // if not a bar and filling, use appropriate method. + else if (s.fill) { + if (vmin >= 0 && (s.fillToZero || dp > 0.1)) { + forceMinZero = true; + } + else if (vmin < 0 && vmax > 0 && s.fillToZero) { + forceMinZero = false; + forceZeroLine = true; + } + else { + forceMinZero = false; + forceZeroLine = false; + } + } + + // if not a bar and not filling, only change existing state + // if it doesn't make sense + else if (vmin < 0) { + forceMinZero = false; + } + } + } + + // check if we need make axis min at 0. + if (forceMinZero) { + // compute number of ticks + this.numberTicks = 2 + Math.ceil((dim-(this.tickSpacing-1))/this.tickSpacing); + this.min = 0; + userMin = 0; + // what order is this range? + // what tick interval does that give us? + ti = max/(this.numberTicks-1); + temp = Math.pow(10, Math.abs(Math.floor(Math.log(ti)/Math.LN10))); + if (ti/temp == parseInt(ti/temp, 10)) { + ti += temp; + } + this.tickInterval = Math.ceil(ti/temp) * temp; + this.max = this.tickInterval * (this.numberTicks - 1); + } + + // check if we need to make sure there is a tick at 0. + else if (forceZeroLine) { + // compute number of ticks + this.numberTicks = 2 + Math.ceil((dim-(this.tickSpacing-1))/this.tickSpacing); + var ntmin = Math.ceil(Math.abs(min)/range*(this.numberTicks-1)); + var ntmax = this.numberTicks - 1 - ntmin; + ti = Math.max(Math.abs(min/ntmin), Math.abs(max/ntmax)); + temp = Math.pow(10, Math.abs(Math.floor(Math.log(ti)/Math.LN10))); + this.tickInterval = Math.ceil(ti/temp) * temp; + this.max = this.tickInterval * ntmax; + this.min = -this.tickInterval * ntmin; + } + + // if nothing else, do autoscaling which will try to line up ticks across axes. + else { + if (this.numberTicks == null){ + if (this.tickInterval) { + this.numberTicks = 3 + Math.ceil(range / this.tickInterval); + } + else { + this.numberTicks = 2 + Math.ceil((dim-(this.tickSpacing-1))/this.tickSpacing); + } + } + + if (this.tickInterval == null) { + // get a tick interval + ti = range/(this.numberTicks - 1); + + if (ti < 1) { + temp = Math.pow(10, Math.abs(Math.floor(Math.log(ti)/Math.LN10))); + } + else { + temp = 1; + } + this.tickInterval = Math.ceil(ti*temp*this.pad)/temp; + } + else { + temp = 1 / this.tickInterval; + } + + // try to compute a nicer, more even tick interval + // temp = Math.pow(10, Math.floor(Math.log(ti)/Math.LN10)); + // this.tickInterval = Math.ceil(ti/temp) * temp; + rrange = this.tickInterval * (this.numberTicks - 1); + margin = (rrange - range)/2; + + if (this.min == null) { + this.min = Math.floor(temp*(min-margin))/temp; + } + if (this.max == null) { + this.max = this.min + rrange; + } + } + + // Compute a somewhat decent format string if it is needed. + // get precision of interval and determine a format string. + var sf = $.jqplot.getSignificantFigures(this.tickInterval); + + var fstr; + + // if we have only a whole number, use integer formatting + if (sf.digitsLeft >= sf.significantDigits) { + fstr = '%d'; + } + + else { + var temp = Math.max(0, 5 - sf.digitsLeft); + temp = Math.min(temp, sf.digitsRight); + fstr = '%.'+ temp + 'f'; + } + + this._autoFormatString = fstr; + } + + // Use the default algorithm which pads each axis to make the chart + // centered nicely on the grid. + else { + + rmin = (this.min != null) ? this.min : min - range*(this.padMin - 1); + rmax = (this.max != null) ? this.max : max + range*(this.padMax - 1); + range = rmax - rmin; + + if (this.numberTicks == null){ + // if tickInterval is specified by user, we will ignore computed maximum. + // max will be equal or greater to fit even # of ticks. + if (this.tickInterval != null) { + this.numberTicks = Math.ceil((rmax - rmin)/this.tickInterval)+1; + } + else if (dim > 100) { + this.numberTicks = parseInt(3+(dim-100)/75, 10); + } + else { + this.numberTicks = 2; + } + } + + if (this.tickInterval == null) { + this.tickInterval = range / (this.numberTicks-1); + } + + if (this.max == null) { + rmax = rmin + this.tickInterval*(this.numberTicks - 1); + } + if (this.min == null) { + rmin = rmax - this.tickInterval*(this.numberTicks - 1); + } + + // get precision of interval and determine a format string. + var sf = $.jqplot.getSignificantFigures(this.tickInterval); + + var fstr; + + // if we have only a whole number, use integer formatting + if (sf.digitsLeft >= sf.significantDigits) { + fstr = '%d'; + } + + else { + var temp = Math.max(0, 5 - sf.digitsLeft); + temp = Math.min(temp, sf.digitsRight); + fstr = '%.'+ temp + 'f'; + } + + + this._autoFormatString = fstr; + + this.min = rmin; + this.max = rmax; + } + + if (this.renderer.constructor == $.jqplot.LinearAxisRenderer && this._autoFormatString == '') { + // fix for misleading tick display with small range and low precision. + range = this.max - this.min; + // figure out precision + var temptick = new this.tickRenderer(this.tickOptions); + // use the tick formatString or, the default. + var fs = temptick.formatString || $.jqplot.config.defaultTickFormatString; + var fs = fs.match($.jqplot.sprintf.regex)[0]; + var precision = 0; + if (fs) { + if (fs.search(/[fFeEgGpP]/) > -1) { + var m = fs.match(/\%\.(\d{0,})?[eEfFgGpP]/); + if (m) { + precision = parseInt(m[1], 10); + } + else { + precision = 6; + } + } + else if (fs.search(/[di]/) > -1) { + precision = 0; + } + // fact will be <= 1; + var fact = Math.pow(10, -precision); + if (this.tickInterval < fact) { + // need to correct underrange + if (userNT == null && userTI == null) { + this.tickInterval = fact; + if (userMax == null && userMin == null) { + // this.min = Math.floor((this._dataBounds.min - this.tickInterval)/fact) * fact; + this.min = Math.floor(this._dataBounds.min/fact) * fact; + if (this.min == this._dataBounds.min) { + this.min = this._dataBounds.min - this.tickInterval; + } + // this.max = Math.ceil((this._dataBounds.max + this.tickInterval)/fact) * fact; + this.max = Math.ceil(this._dataBounds.max/fact) * fact; + if (this.max == this._dataBounds.max) { + this.max = this._dataBounds.max + this.tickInterval; + } + var n = (this.max - this.min)/this.tickInterval; + n = n.toFixed(11); + n = Math.ceil(n); + this.numberTicks = n + 1; + } + else if (userMax == null) { + // add one tick for top of range. + var n = (this._dataBounds.max - this.min) / this.tickInterval; + n = n.toFixed(11); + this.numberTicks = Math.ceil(n) + 2; + this.max = this.min + this.tickInterval * (this.numberTicks-1); + } + else if (userMin == null) { + // add one tick for bottom of range. + var n = (this.max - this._dataBounds.min) / this.tickInterval; + n = n.toFixed(11); + this.numberTicks = Math.ceil(n) + 2; + this.min = this.max - this.tickInterval * (this.numberTicks-1); + } + else { + // calculate a number of ticks so max is within axis scale + this.numberTicks = Math.ceil((userMax - userMin)/this.tickInterval) + 1; + // if user's min and max don't fit evenly in ticks, adjust. + // This takes care of cases such as user min set to 0, max set to 3.5 but tick + // format string set to %d (integer ticks) + this.min = Math.floor(userMin*Math.pow(10, precision))/Math.pow(10, precision); + this.max = Math.ceil(userMax*Math.pow(10, precision))/Math.pow(10, precision); + // this.max = this.min + this.tickInterval*(this.numberTicks-1); + this.numberTicks = Math.ceil((this.max - this.min)/this.tickInterval) + 1; + } + } + } + } + } + + } + + if (this._overrideFormatString && this._autoFormatString != '') { + this.tickOptions = this.tickOptions || {}; + this.tickOptions.formatString = this._autoFormatString; + } + + var t, to; + for (var i=0; i<this.numberTicks; i++){ + tt = this.min + i * this.tickInterval; + t = new this.tickRenderer(this.tickOptions); + // var t = new $.jqplot.AxisTickRenderer(this.tickOptions); + + t.setTick(tt, this.name); + this._ticks.push(t); + + if (i < this.numberTicks - 1) { + for (var j=0; j<this.minorTicks; j++) { + tt += this.tickInterval/(this.minorTicks+1); + to = $.extend(true, {}, this.tickOptions, {name:this.name, value:tt, label:'', isMinorTick:true}); + t = new this.tickRenderer(to); + this._ticks.push(t); + } + } + t = null; + } + } + + if (this.tickInset) { + this.min = this.min - this.tickInset * this.tickInterval; + this.max = this.max + this.tickInset * this.tickInterval; + } + + ticks = null; + }; + + // Used to reset just the values of the ticks and then repack, which will + // recalculate the positioning functions. It is assuemd that the + // number of ticks is the same and the values of the new array are at the + // proper interval. + // This method needs to be called with the scope of an axis object, like: + // + // > plot.axes.yaxis.renderer.resetTickValues.call(plot.axes.yaxis, yarr); + // + $.jqplot.LinearAxisRenderer.prototype.resetTickValues = function(opts) { + if ($.isArray(opts) && opts.length == this._ticks.length) { + var t; + for (var i=0; i<opts.length; i++) { + t = this._ticks[i]; + t.value = opts[i]; + t.label = t.formatter(t.formatString, opts[i]); + t.label = t.prefix + t.label; + t._elem.html(t.label); + } + t = null; + this.min = $.jqplot.arrayMin(opts); + this.max = $.jqplot.arrayMax(opts); + this.pack(); + } + // Not implemented yet. + // else if ($.isPlainObject(opts)) { + // + // } + }; + + // called with scope of axis + $.jqplot.LinearAxisRenderer.prototype.pack = function(pos, offsets) { + // Add defaults for repacking from resetTickValues function. + pos = pos || {}; + offsets = offsets || this._offsets; + + var ticks = this._ticks; + var max = this.max; + var min = this.min; + var offmax = offsets.max; + var offmin = offsets.min; + var lshow = (this._label == null) ? false : this._label.show; + + for (var p in pos) { + this._elem.css(p, pos[p]); + } + + this._offsets = offsets; + // pixellength will be + for x axes and - for y axes becasue pixels always measured from top left. + var pixellength = offmax - offmin; + var unitlength = max - min; + + // point to unit and unit to point conversions references to Plot DOM element top left corner. + if (this.breakPoints) { + unitlength = unitlength - this.breakPoints[1] + this.breakPoints[0]; + + this.p2u = function(p){ + return (p - offmin) * unitlength / pixellength + min; + }; + + this.u2p = function(u){ + if (u > this.breakPoints[0] && u < this.breakPoints[1]){ + u = this.breakPoints[0]; + } + if (u <= this.breakPoints[0]) { + return (u - min) * pixellength / unitlength + offmin; + } + else { + return (u - this.breakPoints[1] + this.breakPoints[0] - min) * pixellength / unitlength + offmin; + } + }; + + if (this.name.charAt(0) == 'x'){ + this.series_u2p = function(u){ + if (u > this.breakPoints[0] && u < this.breakPoints[1]){ + u = this.breakPoints[0]; + } + if (u <= this.breakPoints[0]) { + return (u - min) * pixellength / unitlength; + } + else { + return (u - this.breakPoints[1] + this.breakPoints[0] - min) * pixellength / unitlength; + } + }; + this.series_p2u = function(p){ + return p * unitlength / pixellength + min; + }; + } + + else { + this.series_u2p = function(u){ + if (u > this.breakPoints[0] && u < this.breakPoints[1]){ + u = this.breakPoints[0]; + } + if (u >= this.breakPoints[1]) { + return (u - max) * pixellength / unitlength; + } + else { + return (u + this.breakPoints[1] - this.breakPoints[0] - max) * pixellength / unitlength; + } + }; + this.series_p2u = function(p){ + return p * unitlength / pixellength + max; + }; + } + } + else { + this.p2u = function(p){ + return (p - offmin) * unitlength / pixellength + min; + }; + + this.u2p = function(u){ + return (u - min) * pixellength / unitlength + offmin; + }; + + if (this.name == 'xaxis' || this.name == 'x2axis'){ + this.series_u2p = function(u){ + return (u - min) * pixellength / unitlength; + }; + this.series_p2u = function(p){ + return p * unitlength / pixellength + min; + }; + } + + else { + this.series_u2p = function(u){ + return (u - max) * pixellength / unitlength; + }; + this.series_p2u = function(p){ + return p * unitlength / pixellength + max; + }; + } + } + + if (this.show) { + if (this.name == 'xaxis' || this.name == 'x2axis') { + for (var i=0; i<ticks.length; i++) { + var t = ticks[i]; + if (t.show && t.showLabel) { + var shim; + + if (t.constructor == $.jqplot.CanvasAxisTickRenderer && t.angle) { + // will need to adjust auto positioning based on which axis this is. + var temp = (this.name == 'xaxis') ? 1 : -1; + switch (t.labelPosition) { + case 'auto': + // position at end + if (temp * t.angle < 0) { + shim = -t.getWidth() + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2; + } + // position at start + else { + shim = -t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2; + } + break; + case 'end': + shim = -t.getWidth() + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2; + break; + case 'start': + shim = -t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2; + break; + case 'middle': + shim = -t.getWidth()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2; + break; + default: + shim = -t.getWidth()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2; + break; + } + } + else { + shim = -t.getWidth()/2; + } + var val = this.u2p(t.value) + shim + 'px'; + t._elem.css('left', val); + t.pack(); + } + } + if (lshow) { + var w = this._label._elem.outerWidth(true); + this._label._elem.css('left', offmin + pixellength/2 - w/2 + 'px'); + if (this.name == 'xaxis') { + this._label._elem.css('bottom', '0px'); + } + else { + this._label._elem.css('top', '0px'); + } + this._label.pack(); + } + } + else { + for (var i=0; i<ticks.length; i++) { + var t = ticks[i]; + if (t.show && t.showLabel) { + var shim; + if (t.constructor == $.jqplot.CanvasAxisTickRenderer && t.angle) { + // will need to adjust auto positioning based on which axis this is. + var temp = (this.name == 'yaxis') ? 1 : -1; + switch (t.labelPosition) { + case 'auto': + // position at end + case 'end': + if (temp * t.angle < 0) { + shim = -t._textRenderer.height * Math.cos(-t._textRenderer.angle) / 2; + } + else { + shim = -t.getHeight() + t._textRenderer.height * Math.cos(t._textRenderer.angle) / 2; + } + break; + case 'start': + if (t.angle > 0) { + shim = -t._textRenderer.height * Math.cos(-t._textRenderer.angle) / 2; + } + else { + shim = -t.getHeight() + t._textRenderer.height * Math.cos(t._textRenderer.angle) / 2; + } + break; + case 'middle': + // if (t.angle > 0) { + // shim = -t.getHeight()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2; + // } + // else { + // shim = -t.getHeight()/2 - t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2; + // } + shim = -t.getHeight()/2; + break; + default: + shim = -t.getHeight()/2; + break; + } + } + else { + shim = -t.getHeight()/2; + } + + var val = this.u2p(t.value) + shim + 'px'; + t._elem.css('top', val); + t.pack(); + } + } + if (lshow) { + var h = this._label._elem.outerHeight(true); + this._label._elem.css('top', offmax - pixellength/2 - h/2 + 'px'); + if (this.name == 'yaxis') { + this._label._elem.css('left', '0px'); + } + else { + this._label._elem.css('right', '0px'); + } + this._label.pack(); + } + } + } + + ticks = null; + }; + + + /** + * The following code was generaously given to me a while back by Scott Prahl. + * He did a good job at computing axes min, max and number of ticks for the + * case where the user has not set any scale related parameters (tickInterval, + * numberTicks, min or max). I had ignored this use case for a long time, + * focusing on the more difficult case where user has set some option controlling + * tick generation. Anyway, about time I got this into jqPlot. + * Thanks Scott!! + */ + + /** + * Copyright (c) 2010 Scott Prahl + * The next three routines are currently available for use in all personal + * or commercial projects under both the MIT and GPL version 2.0 licenses. + * This means that you can choose the license that best suits your project + * and use it accordingly. + */ + + // A good format string depends on the interval. If the interval is greater + // than 1 then there is no need to show any decimal digits. If it is < 1.0, then + // use the magnitude of the interval to determine the number of digits to show. + function bestFormatString (interval) + { + var fstr; + interval = Math.abs(interval); + if (interval >= 10) { + fstr = '%d'; + } + + else if (interval > 1) { + if (interval === parseInt(interval, 10)) { + fstr = '%d'; + } + else { + fstr = '%.1f'; + } + } + + else { + var expv = -Math.floor(Math.log(interval)/Math.LN10); + fstr = '%.' + expv + 'f'; + } + + return fstr; + } + + var _factors = [0.1, 0.2, 0.3, 0.4, 0.5, 0.8, 1, 2, 3, 4, 5]; + + var _getLowerFactor = function(f) { + var i = _factors.indexOf(f); + if (i > 0) { + return _factors[i-1]; + } + else { + return _factors[_factors.length - 1] / 100; + } + }; + + var _getHigherFactor = function(f) { + var i = _factors.indexOf(f); + if (i < _factors.length-1) { + return _factors[i+1]; + } + else { + return _factors[0] * 100; + } + }; + + // Given a fixed minimum and maximum and a target number ot ticks + // figure out the best interval and + // return min, max, number ticks, format string and tick interval + function bestConstrainedInterval(min, max, nttarget) { + // run through possible number to ticks and see which interval is best + var low = Math.floor(nttarget/2); + var hi = Math.ceil(nttarget*1.5); + var badness = Number.MAX_VALUE; + var r = (max - min); + var temp; + var sd; + var bestNT; + var fsd; + var fs; + var gsf = $.jqplot.getSignificantFigures; + var currentNT; + var bestPrec; + + for (var i=0, l=hi-low+1; i<l; i++) { + currentNT = low + i; + temp = r/(currentNT-1); + sd = gsf(temp); + + temp = Math.abs(nttarget - currentNT) + sd.digitsRight; + if (temp < badness) { + badness = temp; + bestNT = currentNT; + bestPrec = sd.digitsRight; + } + else if (temp === badness) { + // let nicer ticks trump number ot ticks + if (sd.digitsRight < bestPrec) { + bestNT = currentNT; + bestPrec = sd.digitsRight; + } + } + + } + + fsd = Math.max(bestPrec, Math.max(gsf(min).digitsRight, gsf(max).digitsRight)); + if (fsd === 0) { + fs = '%d'; + } + else { + fs = '%.' + fsd + 'f'; + } + temp = r / (bestNT - 1); + // min, max, number ticks, format string, tick interval + return [min, max, bestNT, fs, temp]; + } + + // This will return an interval of form 2 * 10^n, 5 * 10^n or 10 * 10^n + // it is based soley on the range and number of ticks. So if user specifies + // number of ticks, use this. + function bestInterval(range, numberTicks) { + numberTicks = numberTicks || 7; + var minimum = range / (numberTicks - 1); + var magnitude = Math.pow(10, Math.floor(Math.log(minimum) / Math.LN10)); + var residual = minimum / magnitude; + var interval; + // "nicest" ranges are 1, 2, 5 or powers of these. + // for magnitudes below 1, only allow these. + if (magnitude < 1) { + if (residual > 5) { + interval = 10 * magnitude; + } + else if (residual > 2) { + interval = 5 * magnitude; + } + else if (residual > 1) { + interval = 2 * magnitude; + } + else { + interval = magnitude; + } + } + // for large ranges (whole integers), allow intervals like 3, 4 or powers of these. + // this helps a lot with poor choices for number of ticks. + else { + if (residual > 5) { + interval = 10 * magnitude; + } + else if (residual > 4) { + interval = 5 * magnitude; + } + else if (residual > 3) { + interval = 4 * magnitude; + } + else if (residual > 2) { + interval = 3 * magnitude; + } + else if (residual > 1) { + interval = 2 * magnitude; + } + else { + interval = magnitude; + } + } + + return interval; + } + + // This will return an interval of form 2 * 10^n, 5 * 10^n or 10 * 10^n + // it is based soley on the range of data, number of ticks must be computed later. + function bestLinearInterval(range, scalefact) { + scalefact = scalefact || 1; + var expv = Math.floor(Math.log(range)/Math.LN10); + var magnitude = Math.pow(10, expv); + // 0 < f < 10 + var f = range / magnitude; + var fact; + // for large plots, scalefact will decrease f and increase number of ticks. + // for small plots, scalefact will increase f and decrease number of ticks. + f = f/scalefact; + + // for large plots, smaller interval, more ticks. + if (f<=0.38) { + fact = 0.1; + } + else if (f<=1.6) { + fact = 0.2; + } + else if (f<=4.0) { + fact = 0.5; + } + else if (f<=8.0) { + fact = 1.0; + } + // for very small plots, larger interval, less ticks in number ticks + else if (f<=16.0) { + fact = 2; + } + else { + fact = 5; + } + + return fact*magnitude; + } + + function bestLinearComponents(range, scalefact) { + var expv = Math.floor(Math.log(range)/Math.LN10); + var magnitude = Math.pow(10, expv); + // 0 < f < 10 + var f = range / magnitude; + var interval; + var fact; + // for large plots, scalefact will decrease f and increase number of ticks. + // for small plots, scalefact will increase f and decrease number of ticks. + f = f/scalefact; + + // for large plots, smaller interval, more ticks. + if (f<=0.38) { + fact = 0.1; + } + else if (f<=1.6) { + fact = 0.2; + } + else if (f<=4.0) { + fact = 0.5; + } + else if (f<=8.0) { + fact = 1.0; + } + // for very small plots, larger interval, less ticks in number ticks + else if (f<=16.0) { + fact = 2; + } + // else if (f<=20.0) { + // fact = 3; + // } + // else if (f<=24.0) { + // fact = 4; + // } + else { + fact = 5; + } + + interval = fact * magnitude; + + return [interval, fact, magnitude]; + } + + // Given the min and max for a dataset, return suitable endpoints + // for the graphing, a good number for the number of ticks, and a + // format string so that extraneous digits are not displayed. + // returned is an array containing [min, max, nTicks, format] + $.jqplot.LinearTickGenerator = function(axis_min, axis_max, scalefact, numberTicks) { + // if endpoints are equal try to include zero otherwise include one + if (axis_min === axis_max) { + axis_max = (axis_max) ? 0 : 1; + } + + scalefact = scalefact || 1.0; + + // make sure range is positive + if (axis_max < axis_min) { + var a = axis_max; + axis_max = axis_min; + axis_min = a; + } + + var r = []; + var ss = bestLinearInterval(axis_max - axis_min, scalefact); + + if (numberTicks == null) { + + // Figure out the axis min, max and number of ticks + // the min and max will be some multiple of the tick interval, + // 1*10^n, 2*10^n or 5*10^n. This gaurantees that, if the + // axis min is negative, 0 will be a tick. + r[0] = Math.floor(axis_min / ss) * ss; // min + r[1] = Math.ceil(axis_max / ss) * ss; // max + r[2] = Math.round((r[1]-r[0])/ss+1.0); // number of ticks + r[3] = bestFormatString(ss); // format string + r[4] = ss; // tick Interval + } + + else { + var tempr = []; + + // Figure out the axis min, max and number of ticks + // the min and max will be some multiple of the tick interval, + // 1*10^n, 2*10^n or 5*10^n. This gaurantees that, if the + // axis min is negative, 0 will be a tick. + tempr[0] = Math.floor(axis_min / ss) * ss; // min + tempr[1] = Math.ceil(axis_max / ss) * ss; // max + tempr[2] = Math.round((tempr[1]-tempr[0])/ss+1.0); // number of ticks + tempr[3] = bestFormatString(ss); // format string + tempr[4] = ss; // tick Interval + + // first, see if we happen to get the right number of ticks + if (tempr[2] === numberTicks) { + r = tempr; + } + + else { + + var newti = bestInterval(tempr[1] - tempr[0], numberTicks); + + r[0] = tempr[0]; + r[2] = numberTicks; + r[4] = newti; + r[3] = bestFormatString(newti); + r[1] = r[0] + (r[2] - 1) * r[4]; // max + } + } + + return r; + }; + + $.jqplot.LinearTickGenerator.bestLinearInterval = bestLinearInterval; + $.jqplot.LinearTickGenerator.bestInterval = bestInterval; + $.jqplot.LinearTickGenerator.bestLinearComponents = bestLinearComponents; + $.jqplot.LinearTickGenerator.bestConstrainedInterval = bestConstrainedInterval; + + + // class: $.jqplot.MarkerRenderer + // The default jqPlot marker renderer, rendering the points on the line. + $.jqplot.MarkerRenderer = function(options){ + // Group: Properties + + // prop: show + // wether or not to show the marker. + this.show = true; + // prop: style + // One of diamond, circle, square, x, plus, dash, filledDiamond, filledCircle, filledSquare + this.style = 'filledCircle'; + // prop: lineWidth + // size of the line for non-filled markers. + this.lineWidth = 2; + // prop: size + // Size of the marker (diameter or circle, length of edge of square, etc.) + this.size = 9.0; + // prop: color + // color of marker. Will be set to color of series by default on init. + this.color = '#666666'; + // prop: shadow + // wether or not to draw a shadow on the line + this.shadow = true; + // prop: shadowAngle + // Shadow angle in degrees + this.shadowAngle = 45; + // prop: shadowOffset + // Shadow offset from line in pixels + this.shadowOffset = 1; + // prop: shadowDepth + // Number of times shadow is stroked, each stroke offset shadowOffset from the last. + this.shadowDepth = 3; + // prop: shadowAlpha + // Alpha channel transparency of shadow. 0 = transparent. + this.shadowAlpha = '0.07'; + // prop: shadowRenderer + // Renderer that will draws the shadows on the marker. + this.shadowRenderer = new $.jqplot.ShadowRenderer(); + // prop: shapeRenderer + // Renderer that will draw the marker. + this.shapeRenderer = new $.jqplot.ShapeRenderer(); + + $.extend(true, this, options); + }; + + $.jqplot.MarkerRenderer.prototype.init = function(options) { + $.extend(true, this, options); + var sdopt = {angle:this.shadowAngle, offset:this.shadowOffset, alpha:this.shadowAlpha, lineWidth:this.lineWidth, depth:this.shadowDepth, closePath:true}; + if (this.style.indexOf('filled') != -1) { + sdopt.fill = true; + } + if (this.style.indexOf('ircle') != -1) { + sdopt.isarc = true; + sdopt.closePath = false; + } + this.shadowRenderer.init(sdopt); + + var shopt = {fill:false, isarc:false, strokeStyle:this.color, fillStyle:this.color, lineWidth:this.lineWidth, closePath:true}; + if (this.style.indexOf('filled') != -1) { + shopt.fill = true; + } + if (this.style.indexOf('ircle') != -1) { + shopt.isarc = true; + shopt.closePath = false; + } + this.shapeRenderer.init(shopt); + }; + + $.jqplot.MarkerRenderer.prototype.drawDiamond = function(x, y, ctx, fill, options) { + var stretch = 1.2; + var dx = this.size/2/stretch; + var dy = this.size/2*stretch; + var points = [[x-dx, y], [x, y+dy], [x+dx, y], [x, y-dy]]; + if (this.shadow) { + this.shadowRenderer.draw(ctx, points); + } + this.shapeRenderer.draw(ctx, points, options); + }; + + $.jqplot.MarkerRenderer.prototype.drawPlus = function(x, y, ctx, fill, options) { + var stretch = 1.0; + var dx = this.size/2*stretch; + var dy = this.size/2*stretch; + var points1 = [[x, y-dy], [x, y+dy]]; + var points2 = [[x+dx, y], [x-dx, y]]; + var opts = $.extend(true, {}, this.options, {closePath:false}); + if (this.shadow) { + this.shadowRenderer.draw(ctx, points1, {closePath:false}); + this.shadowRenderer.draw(ctx, points2, {closePath:false}); + } + this.shapeRenderer.draw(ctx, points1, opts); + this.shapeRenderer.draw(ctx, points2, opts); + }; + + $.jqplot.MarkerRenderer.prototype.drawX = function(x, y, ctx, fill, options) { + var stretch = 1.0; + var dx = this.size/2*stretch; + var dy = this.size/2*stretch; + var opts = $.extend(true, {}, this.options, {closePath:false}); + var points1 = [[x-dx, y-dy], [x+dx, y+dy]]; + var points2 = [[x-dx, y+dy], [x+dx, y-dy]]; + if (this.shadow) { + this.shadowRenderer.draw(ctx, points1, {closePath:false}); + this.shadowRenderer.draw(ctx, points2, {closePath:false}); + } + this.shapeRenderer.draw(ctx, points1, opts); + this.shapeRenderer.draw(ctx, points2, opts); + }; + + $.jqplot.MarkerRenderer.prototype.drawDash = function(x, y, ctx, fill, options) { + var stretch = 1.0; + var dx = this.size/2*stretch; + var dy = this.size/2*stretch; + var points = [[x-dx, y], [x+dx, y]]; + if (this.shadow) { + this.shadowRenderer.draw(ctx, points); + } + this.shapeRenderer.draw(ctx, points, options); + }; + + $.jqplot.MarkerRenderer.prototype.drawLine = function(p1, p2, ctx, fill, options) { + var points = [p1, p2]; + if (this.shadow) { + this.shadowRenderer.draw(ctx, points); + } + this.shapeRenderer.draw(ctx, points, options); + }; + + $.jqplot.MarkerRenderer.prototype.drawSquare = function(x, y, ctx, fill, options) { + var stretch = 1.0; + var dx = this.size/2/stretch; + var dy = this.size/2*stretch; + var points = [[x-dx, y-dy], [x-dx, y+dy], [x+dx, y+dy], [x+dx, y-dy]]; + if (this.shadow) { + this.shadowRenderer.draw(ctx, points); + } + this.shapeRenderer.draw(ctx, points, options); + }; + + $.jqplot.MarkerRenderer.prototype.drawCircle = function(x, y, ctx, fill, options) { + var radius = this.size/2; + var end = 2*Math.PI; + var points = [x, y, radius, 0, end, true]; + if (this.shadow) { + this.shadowRenderer.draw(ctx, points); + } + this.shapeRenderer.draw(ctx, points, options); + }; + + $.jqplot.MarkerRenderer.prototype.draw = function(x, y, ctx, options) { + options = options || {}; + // hack here b/c shape renderer uses canvas based color style options + // and marker uses css style names. + if (options.show == null || options.show != false) { + if (options.color && !options.fillStyle) { + options.fillStyle = options.color; + } + if (options.color && !options.strokeStyle) { + options.strokeStyle = options.color; + } + switch (this.style) { + case 'diamond': + this.drawDiamond(x,y,ctx, false, options); + break; + case 'filledDiamond': + this.drawDiamond(x,y,ctx, true, options); + break; + case 'circle': + this.drawCircle(x,y,ctx, false, options); + break; + case 'filledCircle': + this.drawCircle(x,y,ctx, true, options); + break; + case 'square': + this.drawSquare(x,y,ctx, false, options); + break; + case 'filledSquare': + this.drawSquare(x,y,ctx, true, options); + break; + case 'x': + this.drawX(x,y,ctx, true, options); + break; + case 'plus': + this.drawPlus(x,y,ctx, true, options); + break; + case 'dash': + this.drawDash(x,y,ctx, true, options); + break; + case 'line': + this.drawLine(x, y, ctx, false, options); + break; + default: + this.drawDiamond(x,y,ctx, false, options); + break; + } + } + }; + + // class: $.jqplot.shadowRenderer + // The default jqPlot shadow renderer, rendering shadows behind shapes. + $.jqplot.ShadowRenderer = function(options){ + // Group: Properties + + // prop: angle + // Angle of the shadow in degrees. Measured counter-clockwise from the x axis. + this.angle = 45; + // prop: offset + // Pixel offset at the given shadow angle of each shadow stroke from the last stroke. + this.offset = 1; + // prop: alpha + // alpha transparency of shadow stroke. + this.alpha = 0.07; + // prop: lineWidth + // width of the shadow line stroke. + this.lineWidth = 1.5; + // prop: lineJoin + // How line segments of the shadow are joined. + this.lineJoin = 'miter'; + // prop: lineCap + // how ends of the shadow line are rendered. + this.lineCap = 'round'; + // prop; closePath + // whether line path segment is closed upon itself. + this.closePath = false; + // prop: fill + // whether to fill the shape. + this.fill = false; + // prop: depth + // how many times the shadow is stroked. Each stroke will be offset by offset at angle degrees. + this.depth = 3; + this.strokeStyle = 'rgba(0,0,0,0.1)'; + // prop: isarc + // wether the shadow is an arc or not. + this.isarc = false; + + $.extend(true, this, options); + }; + + $.jqplot.ShadowRenderer.prototype.init = function(options) { + $.extend(true, this, options); + }; + + // function: draw + // draws an transparent black (i.e. gray) shadow. + // + // ctx - canvas drawing context + // points - array of points or [x, y, radius, start angle (rad), end angle (rad)] + $.jqplot.ShadowRenderer.prototype.draw = function(ctx, points, options) { + ctx.save(); + var opts = (options != null) ? options : {}; + var fill = (opts.fill != null) ? opts.fill : this.fill; + var fillRect = (opts.fillRect != null) ? opts.fillRect : this.fillRect; + var closePath = (opts.closePath != null) ? opts.closePath : this.closePath; + var offset = (opts.offset != null) ? opts.offset : this.offset; + var alpha = (opts.alpha != null) ? opts.alpha : this.alpha; + var depth = (opts.depth != null) ? opts.depth : this.depth; + var isarc = (opts.isarc != null) ? opts.isarc : this.isarc; + var linePattern = (opts.linePattern != null) ? opts.linePattern : this.linePattern; + ctx.lineWidth = (opts.lineWidth != null) ? opts.lineWidth : this.lineWidth; + ctx.lineJoin = (opts.lineJoin != null) ? opts.lineJoin : this.lineJoin; + ctx.lineCap = (opts.lineCap != null) ? opts.lineCap : this.lineCap; + ctx.strokeStyle = opts.strokeStyle || this.strokeStyle || 'rgba(0,0,0,'+alpha+')'; + ctx.fillStyle = opts.fillStyle || this.fillStyle || 'rgba(0,0,0,'+alpha+')'; + for (var j=0; j<depth; j++) { + var ctxPattern = $.jqplot.LinePattern(ctx, linePattern); + ctx.translate(Math.cos(this.angle*Math.PI/180)*offset, Math.sin(this.angle*Math.PI/180)*offset); + ctxPattern.beginPath(); + if (isarc) { + ctx.arc(points[0], points[1], points[2], points[3], points[4], true); + } + else if (fillRect) { + if (fillRect) { + ctx.fillRect(points[0], points[1], points[2], points[3]); + } + } + else if (points && points.length){ + var move = true; + for (var i=0; i<points.length; i++) { + // skip to the first non-null point and move to it. + if (points[i][0] != null && points[i][1] != null) { + if (move) { + ctxPattern.moveTo(points[i][0], points[i][1]); + move = false; + } + else { + ctxPattern.lineTo(points[i][0], points[i][1]); + } + } + else { + move = true; + } + } + + } + if (closePath) { + ctxPattern.closePath(); + } + if (fill) { + ctx.fill(); + } + else { + ctx.stroke(); + } + } + ctx.restore(); + }; + + // class: $.jqplot.shapeRenderer + // The default jqPlot shape renderer. Given a set of points will + // plot them and either stroke a line (fill = false) or fill them (fill = true). + // If a filled shape is desired, closePath = true must also be set to close + // the shape. + $.jqplot.ShapeRenderer = function(options){ + + this.lineWidth = 1.5; + // prop: linePattern + // line pattern 'dashed', 'dotted', 'solid', some combination + // of '-' and '.' characters such as '.-.' or a numerical array like + // [draw, skip, draw, skip, ...] such as [1, 10] to draw a dotted line, + // [1, 10, 20, 10] to draw a dot-dash line, and so on. + this.linePattern = 'solid'; + // prop: lineJoin + // How line segments of the shadow are joined. + this.lineJoin = 'miter'; + // prop: lineCap + // how ends of the shadow line are rendered. + this.lineCap = 'round'; + // prop; closePath + // whether line path segment is closed upon itself. + this.closePath = false; + // prop: fill + // whether to fill the shape. + this.fill = false; + // prop: isarc + // wether the shadow is an arc or not. + this.isarc = false; + // prop: fillRect + // true to draw shape as a filled rectangle. + this.fillRect = false; + // prop: strokeRect + // true to draw shape as a stroked rectangle. + this.strokeRect = false; + // prop: clearRect + // true to cear a rectangle. + this.clearRect = false; + // prop: strokeStyle + // css color spec for the stoke style + this.strokeStyle = '#999999'; + // prop: fillStyle + // css color spec for the fill style. + this.fillStyle = '#999999'; + + $.extend(true, this, options); + }; + + $.jqplot.ShapeRenderer.prototype.init = function(options) { + $.extend(true, this, options); + }; + + // function: draw + // draws the shape. + // + // ctx - canvas drawing context + // points - array of points for shapes or + // [x, y, width, height] for rectangles or + // [x, y, radius, start angle (rad), end angle (rad)] for circles and arcs. + $.jqplot.ShapeRenderer.prototype.draw = function(ctx, points, options) { + ctx.save(); + var opts = (options != null) ? options : {}; + var fill = (opts.fill != null) ? opts.fill : this.fill; + var closePath = (opts.closePath != null) ? opts.closePath : this.closePath; + var fillRect = (opts.fillRect != null) ? opts.fillRect : this.fillRect; + var strokeRect = (opts.strokeRect != null) ? opts.strokeRect : this.strokeRect; + var clearRect = (opts.clearRect != null) ? opts.clearRect : this.clearRect; + var isarc = (opts.isarc != null) ? opts.isarc : this.isarc; + var linePattern = (opts.linePattern != null) ? opts.linePattern : this.linePattern; + var ctxPattern = $.jqplot.LinePattern(ctx, linePattern); + ctx.lineWidth = opts.lineWidth || this.lineWidth; + ctx.lineJoin = opts.lineJoin || this.lineJoin; + ctx.lineCap = opts.lineCap || this.lineCap; + ctx.strokeStyle = (opts.strokeStyle || opts.color) || this.strokeStyle; + ctx.fillStyle = opts.fillStyle || this.fillStyle; + ctx.beginPath(); + if (isarc) { + ctx.arc(points[0], points[1], points[2], points[3], points[4], true); + if (closePath) { + ctx.closePath(); + } + if (fill) { + ctx.fill(); + } + else { + ctx.stroke(); + } + ctx.restore(); + return; + } + else if (clearRect) { + ctx.clearRect(points[0], points[1], points[2], points[3]); + ctx.restore(); + return; + } + else if (fillRect || strokeRect) { + if (fillRect) { + ctx.fillRect(points[0], points[1], points[2], points[3]); + } + if (strokeRect) { + ctx.strokeRect(points[0], points[1], points[2], points[3]); + ctx.restore(); + return; + } + } + else if (points && points.length){ + var move = true; + for (var i=0; i<points.length; i++) { + // skip to the first non-null point and move to it. + if (points[i][0] != null && points[i][1] != null) { + if (move) { + ctxPattern.moveTo(points[i][0], points[i][1]); + move = false; + } + else { + ctxPattern.lineTo(points[i][0], points[i][1]); + } + } + else { + move = true; + } + } + if (closePath) { + ctxPattern.closePath(); + } + if (fill) { + ctx.fill(); + } + else { + ctx.stroke(); + } + } + ctx.restore(); + }; + + // class $.jqplot.TableLegendRenderer + // The default legend renderer for jqPlot. + $.jqplot.TableLegendRenderer = function(){ + // + }; + + $.jqplot.TableLegendRenderer.prototype.init = function(options) { + $.extend(true, this, options); + }; + + $.jqplot.TableLegendRenderer.prototype.addrow = function (label, color, pad, reverse) { + var rs = (pad) ? this.rowSpacing+'px' : '0px'; + var tr; + var td; + var elem; + var div0; + var div1; + elem = document.createElement('tr'); + tr = $(elem); + tr.addClass('jqplot-table-legend'); + elem = null; + + if (reverse){ + tr.prependTo(this._elem); + } + + else{ + tr.appendTo(this._elem); + } + + if (this.showSwatches) { + td = $(document.createElement('td')); + td.addClass('jqplot-table-legend jqplot-table-legend-swatch'); + td.css({textAlign: 'center', paddingTop: rs}); + + div0 = $(document.createElement('div')); + div0.addClass('jqplot-table-legend-swatch-outline'); + div1 = $(document.createElement('div')); + div1.addClass('jqplot-table-legend-swatch'); + div1.css({backgroundColor: color, borderColor: color}); + + tr.append(td.append(div0.append(div1))); + + // $('<td class="jqplot-table-legend" style="text-align:center;padding-top:'+rs+';">'+ + // '<div><div class="jqplot-table-legend-swatch" style="background-color:'+color+';border-color:'+color+';"></div>'+ + // '</div></td>').appendTo(tr); + } + if (this.showLabels) { + td = $(document.createElement('td')); + td.addClass('jqplot-table-legend jqplot-table-legend-label'); + td.css('paddingTop', rs); + tr.append(td); + + // elem = $('<td class="jqplot-table-legend" style="padding-top:'+rs+';"></td>'); + // elem.appendTo(tr); + if (this.escapeHtml) { + td.text(label); + } + else { + td.html(label); + } + } + td = null; + div0 = null; + div1 = null; + tr = null; + elem = null; + }; + + // called with scope of legend + $.jqplot.TableLegendRenderer.prototype.draw = function() { + if (this._elem) { + this._elem.emptyForce(); + this._elem = null; + } + + if (this.show) { + var series = this._series; + // make a table. one line label per row. + var elem = document.createElement('table'); + this._elem = $(elem); + this._elem.addClass('jqplot-table-legend'); + + var ss = {position:'absolute'}; + if (this.background) { + ss['background'] = this.background; + } + if (this.border) { + ss['border'] = this.border; + } + if (this.fontSize) { + ss['fontSize'] = this.fontSize; + } + if (this.fontFamily) { + ss['fontFamily'] = this.fontFamily; + } + if (this.textColor) { + ss['textColor'] = this.textColor; + } + if (this.marginTop != null) { + ss['marginTop'] = this.marginTop; + } + if (this.marginBottom != null) { + ss['marginBottom'] = this.marginBottom; + } + if (this.marginLeft != null) { + ss['marginLeft'] = this.marginLeft; + } + if (this.marginRight != null) { + ss['marginRight'] = this.marginRight; + } + + + var pad = false, + reverse = false, + s; + for (var i = 0; i< series.length; i++) { + s = series[i]; + if (s._stack || s.renderer.constructor == $.jqplot.BezierCurveRenderer){ + reverse = true; + } + if (s.show && s.showLabel) { + var lt = this.labels[i] || s.label.toString(); + if (lt) { + var color = s.color; + if (reverse && i < series.length - 1){ + pad = true; + } + else if (reverse && i == series.length - 1){ + pad = false; + } + this.renderer.addrow.call(this, lt, color, pad, reverse); + pad = true; + } + // let plugins add more rows to legend. Used by trend line plugin. + for (var j=0; j<$.jqplot.addLegendRowHooks.length; j++) { + var item = $.jqplot.addLegendRowHooks[j].call(this, s); + if (item) { + this.renderer.addrow.call(this, item.label, item.color, pad); + pad = true; + } + } + lt = null; + } + } + } + return this._elem; + }; + + $.jqplot.TableLegendRenderer.prototype.pack = function(offsets) { + if (this.show) { + if (this.placement == 'insideGrid') { + switch (this.location) { + case 'nw': + var a = offsets.left; + var b = offsets.top; + this._elem.css('left', a); + this._elem.css('top', b); + break; + case 'n': + var a = (offsets.left + (this._plotDimensions.width - offsets.right))/2 - this.getWidth()/2; + var b = offsets.top; + this._elem.css('left', a); + this._elem.css('top', b); + break; + case 'ne': + var a = offsets.right; + var b = offsets.top; + this._elem.css({right:a, top:b}); + break; + case 'e': + var a = offsets.right; + var b = (offsets.top + (this._plotDimensions.height - offsets.bottom))/2 - this.getHeight()/2; + this._elem.css({right:a, top:b}); + break; + case 'se': + var a = offsets.right; + var b = offsets.bottom; + this._elem.css({right:a, bottom:b}); + break; + case 's': + var a = (offsets.left + (this._plotDimensions.width - offsets.right))/2 - this.getWidth()/2; + var b = offsets.bottom; + this._elem.css({left:a, bottom:b}); + break; + case 'sw': + var a = offsets.left; + var b = offsets.bottom; + this._elem.css({left:a, bottom:b}); + break; + case 'w': + var a = offsets.left; + var b = (offsets.top + (this._plotDimensions.height - offsets.bottom))/2 - this.getHeight()/2; + this._elem.css({left:a, top:b}); + break; + default: // same as 'se' + var a = offsets.right; + var b = offsets.bottom; + this._elem.css({right:a, bottom:b}); + break; + } + + } + else if (this.placement == 'outside'){ + switch (this.location) { + case 'nw': + var a = this._plotDimensions.width - offsets.left; + var b = offsets.top; + this._elem.css('right', a); + this._elem.css('top', b); + break; + case 'n': + var a = (offsets.left + (this._plotDimensions.width - offsets.right))/2 - this.getWidth()/2; + var b = this._plotDimensions.height - offsets.top; + this._elem.css('left', a); + this._elem.css('bottom', b); + break; + case 'ne': + var a = this._plotDimensions.width - offsets.right; + var b = offsets.top; + this._elem.css({left:a, top:b}); + break; + case 'e': + var a = this._plotDimensions.width - offsets.right; + var b = (offsets.top + (this._plotDimensions.height - offsets.bottom))/2 - this.getHeight()/2; + this._elem.css({left:a, top:b}); + break; + case 'se': + var a = this._plotDimensions.width - offsets.right; + var b = offsets.bottom; + this._elem.css({left:a, bottom:b}); + break; + case 's': + var a = (offsets.left + (this._plotDimensions.width - offsets.right))/2 - this.getWidth()/2; + var b = this._plotDimensions.height - offsets.bottom; + this._elem.css({left:a, top:b}); + break; + case 'sw': + var a = this._plotDimensions.width - offsets.left; + var b = offsets.bottom; + this._elem.css({right:a, bottom:b}); + break; + case 'w': + var a = this._plotDimensions.width - offsets.left; + var b = (offsets.top + (this._plotDimensions.height - offsets.bottom))/2 - this.getHeight()/2; + this._elem.css({right:a, top:b}); + break; + default: // same as 'se' + var a = offsets.right; + var b = offsets.bottom; + this._elem.css({right:a, bottom:b}); + break; + } + } + else { + switch (this.location) { + case 'nw': + this._elem.css({left:0, top:offsets.top}); + break; + case 'n': + var a = (offsets.left + (this._plotDimensions.width - offsets.right))/2 - this.getWidth()/2; + this._elem.css({left: a, top:offsets.top}); + break; + case 'ne': + this._elem.css({right:0, top:offsets.top}); + break; + case 'e': + var b = (offsets.top + (this._plotDimensions.height - offsets.bottom))/2 - this.getHeight()/2; + this._elem.css({right:offsets.right, top:b}); + break; + case 'se': + this._elem.css({right:offsets.right, bottom:offsets.bottom}); + break; + case 's': + var a = (offsets.left + (this._plotDimensions.width - offsets.right))/2 - this.getWidth()/2; + this._elem.css({left: a, bottom:offsets.bottom}); + break; + case 'sw': + this._elem.css({left:offsets.left, bottom:offsets.bottom}); + break; + case 'w': + var b = (offsets.top + (this._plotDimensions.height - offsets.bottom))/2 - this.getHeight()/2; + this._elem.css({left:offsets.left, top:b}); + break; + default: // same as 'se' + this._elem.css({right:offsets.right, bottom:offsets.bottom}); + break; + } + } + } + }; + + /** + * Class: $.jqplot.ThemeEngine + * Theme Engine provides a programatic way to change some of the more + * common jqplot styling options such as fonts, colors and grid options. + * A theme engine instance is created with each plot. The theme engine + * manages a collection of themes which can be modified, added to, or + * applied to the plot. + * + * The themeEngine class is not instantiated directly. + * When a plot is initialized, the current plot options are scanned + * an a default theme named "Default" is created. This theme is + * used as the basis for other themes added to the theme engine and + * is always available. + * + * A theme is a simple javascript object with styling parameters for + * various entities of the plot. A theme has the form: + * + * + * > { + * > _name:f "Default", + * > target: { + * > backgroundColor: "transparent" + * > }, + * > legend: { + * > textColor: null, + * > fontFamily: null, + * > fontSize: null, + * > border: null, + * > background: null + * > }, + * > title: { + * > textColor: "rgb(102, 102, 102)", + * > fontFamily: "'Trebuchet MS',Arial,Helvetica,sans-serif", + * > fontSize: "19.2px", + * > textAlign: "center" + * > }, + * > seriesStyles: {}, + * > series: [{ + * > color: "#4bb2c5", + * > lineWidth: 2.5, + * > linePattern: "solid", + * > shadow: true, + * > fillColor: "#4bb2c5", + * > showMarker: true, + * > markerOptions: { + * > color: "#4bb2c5", + * > show: true, + * > style: 'filledCircle', + * > lineWidth: 1.5, + * > size: 4, + * > shadow: true + * > } + * > }], + * > grid: { + * > drawGridlines: true, + * > gridLineColor: "#cccccc", + * > gridLineWidth: 1, + * > backgroundColor: "#fffdf6", + * > borderColor: "#999999", + * > borderWidth: 2, + * > shadow: true + * > }, + * > axesStyles: { + * > label: {}, + * > ticks: {} + * > }, + * > axes: { + * > xaxis: { + * > borderColor: "#999999", + * > borderWidth: 2, + * > ticks: { + * > show: true, + * > showGridline: true, + * > showLabel: true, + * > showMark: true, + * > size: 4, + * > textColor: "", + * > whiteSpace: "nowrap", + * > fontSize: "12px", + * > fontFamily: "'Trebuchet MS',Arial,Helvetica,sans-serif" + * > }, + * > label: { + * > textColor: "rgb(102, 102, 102)", + * > whiteSpace: "normal", + * > fontSize: "14.6667px", + * > fontFamily: "'Trebuchet MS',Arial,Helvetica,sans-serif", + * > fontWeight: "400" + * > } + * > }, + * > yaxis: { + * > borderColor: "#999999", + * > borderWidth: 2, + * > ticks: { + * > show: true, + * > showGridline: true, + * > showLabel: true, + * > showMark: true, + * > size: 4, + * > textColor: "", + * > whiteSpace: "nowrap", + * > fontSize: "12px", + * > fontFamily: "'Trebuchet MS',Arial,Helvetica,sans-serif" + * > }, + * > label: { + * > textColor: null, + * > whiteSpace: null, + * > fontSize: null, + * > fontFamily: null, + * > fontWeight: null + * > } + * > }, + * > x2axis: {... + * > }, + * > ... + * > y9axis: {... + * > } + * > } + * > } + * + * "seriesStyles" is a style object that will be applied to all series in the plot. + * It will forcibly override any styles applied on the individual series. "axesStyles" is + * a style object that will be applied to all axes in the plot. It will also forcibly + * override any styles on the individual axes. + * + * The example shown above has series options for a line series. Options for other + * series types are shown below: + * + * Bar Series: + * + * > { + * > color: "#4bb2c5", + * > seriesColors: ["#4bb2c5", "#EAA228", "#c5b47f", "#579575", "#839557", "#958c12", "#953579", "#4b5de4", "#d8b83f", "#ff5800", "#0085cc", "#c747a3", "#cddf54", "#FBD178", "#26B4E3", "#bd70c7"], + * > lineWidth: 2.5, + * > shadow: true, + * > barPadding: 2, + * > barMargin: 10, + * > barWidth: 15.09375, + * > highlightColors: ["rgb(129,201,214)", "rgb(129,201,214)", "rgb(129,201,214)", "rgb(129,201,214)", "rgb(129,201,214)", "rgb(129,201,214)", "rgb(129,201,214)", "rgb(129,201,214)"] + * > } + * + * Pie Series: + * + * > { + * > seriesColors: ["#4bb2c5", "#EAA228", "#c5b47f", "#579575", "#839557", "#958c12", "#953579", "#4b5de4", "#d8b83f", "#ff5800", "#0085cc", "#c747a3", "#cddf54", "#FBD178", "#26B4E3", "#bd70c7"], + * > padding: 20, + * > sliceMargin: 0, + * > fill: true, + * > shadow: true, + * > startAngle: 0, + * > lineWidth: 2.5, + * > highlightColors: ["rgb(129,201,214)", "rgb(240,189,104)", "rgb(214,202,165)", "rgb(137,180,158)", "rgb(168,180,137)", "rgb(180,174,89)", "rgb(180,113,161)", "rgb(129,141,236)", "rgb(227,205,120)", "rgb(255,138,76)", "rgb(76,169,219)", "rgb(215,126,190)", "rgb(220,232,135)", "rgb(200,167,96)", "rgb(103,202,235)", "rgb(208,154,215)"] + * > } + * + * Funnel Series: + * + * > { + * > color: "#4bb2c5", + * > lineWidth: 2, + * > shadow: true, + * > padding: { + * > top: 20, + * > right: 20, + * > bottom: 20, + * > left: 20 + * > }, + * > sectionMargin: 6, + * > seriesColors: ["#4bb2c5", "#EAA228", "#c5b47f", "#579575", "#839557", "#958c12", "#953579", "#4b5de4", "#d8b83f", "#ff5800", "#0085cc", "#c747a3", "#cddf54", "#FBD178", "#26B4E3", "#bd70c7"], + * > highlightColors: ["rgb(147,208,220)", "rgb(242,199,126)", "rgb(220,210,178)", "rgb(154,191,172)", "rgb(180,191,154)", "rgb(191,186,112)", "rgb(191,133,174)", "rgb(147,157,238)", "rgb(231,212,139)", "rgb(255,154,102)", "rgb(102,181,224)", "rgb(221,144,199)", "rgb(225,235,152)", "rgb(200,167,96)", "rgb(124,210,238)", "rgb(215,169,221)"] + * > } + * + */ + $.jqplot.ThemeEngine = function(){ + // Group: Properties + // + // prop: themes + // hash of themes managed by the theme engine. + // Indexed by theme name. + this.themes = {}; + // prop: activeTheme + // Pointer to currently active theme + this.activeTheme=null; + + }; + + // called with scope of plot + $.jqplot.ThemeEngine.prototype.init = function() { + // get the Default theme from the current plot settings. + var th = new $.jqplot.Theme({_name:'Default'}); + var n, i, nn; + + for (n in th.target) { + if (n == "textColor") { + th.target[n] = this.target.css('color'); + } + else { + th.target[n] = this.target.css(n); + } + } + + if (this.title.show && this.title._elem) { + for (n in th.title) { + if (n == "textColor") { + th.title[n] = this.title._elem.css('color'); + } + else { + th.title[n] = this.title._elem.css(n); + } + } + } + + for (n in th.grid) { + th.grid[n] = this.grid[n]; + } + if (th.grid.backgroundColor == null && this.grid.background != null) { + th.grid.backgroundColor = this.grid.background; + } + if (this.legend.show && this.legend._elem) { + for (n in th.legend) { + if (n == 'textColor') { + th.legend[n] = this.legend._elem.css('color'); + } + else { + th.legend[n] = this.legend._elem.css(n); + } + } + } + var s; + + for (i=0; i<this.series.length; i++) { + s = this.series[i]; + if (s.renderer.constructor == $.jqplot.LineRenderer) { + th.series.push(new LineSeriesProperties()); + } + else if (s.renderer.constructor == $.jqplot.BarRenderer) { + th.series.push(new BarSeriesProperties()); + } + else if (s.renderer.constructor == $.jqplot.PieRenderer) { + th.series.push(new PieSeriesProperties()); + } + else if (s.renderer.constructor == $.jqplot.DonutRenderer) { + th.series.push(new DonutSeriesProperties()); + } + else if (s.renderer.constructor == $.jqplot.FunnelRenderer) { + th.series.push(new FunnelSeriesProperties()); + } + else if (s.renderer.constructor == $.jqplot.MeterGaugeRenderer) { + th.series.push(new MeterSeriesProperties()); + } + else { + th.series.push({}); + } + for (n in th.series[i]) { + th.series[i][n] = s[n]; + } + } + var a, ax; + for (n in this.axes) { + ax = this.axes[n]; + a = th.axes[n] = new AxisProperties(); + a.borderColor = ax.borderColor; + a.borderWidth = ax.borderWidth; + if (ax._ticks && ax._ticks[0]) { + for (nn in a.ticks) { + if (ax._ticks[0].hasOwnProperty(nn)) { + a.ticks[nn] = ax._ticks[0][nn]; + } + else if (ax._ticks[0]._elem){ + a.ticks[nn] = ax._ticks[0]._elem.css(nn); + } + } + } + if (ax._label && ax._label.show) { + for (nn in a.label) { + // a.label[nn] = ax._label._elem.css(nn); + if (ax._label[nn]) { + a.label[nn] = ax._label[nn]; + } + else if (ax._label._elem){ + if (nn == 'textColor') { + a.label[nn] = ax._label._elem.css('color'); + } + else { + a.label[nn] = ax._label._elem.css(nn); + } + } + } + } + } + this.themeEngine._add(th); + this.themeEngine.activeTheme = this.themeEngine.themes[th._name]; + }; + /** + * Group: methods + * + * method: get + * + * Get and return the named theme or the active theme if no name given. + * + * parameter: + * + * name - name of theme to get. + * + * returns: + * + * Theme instance of given name. + */ + $.jqplot.ThemeEngine.prototype.get = function(name) { + if (!name) { + // return the active theme + return this.activeTheme; + } + else { + return this.themes[name]; + } + }; + + function numericalOrder(a,b) { return a-b; } + + /** + * method: getThemeNames + * + * Return the list of theme names in this manager in alpha-numerical order. + * + * parameter: + * + * None + * + * returns: + * + * A the list of theme names in this manager in alpha-numerical order. + */ + $.jqplot.ThemeEngine.prototype.getThemeNames = function() { + var tn = []; + for (var n in this.themes) { + tn.push(n); + } + return tn.sort(numericalOrder); + }; + + /** + * method: getThemes + * + * Return a list of themes in alpha-numerical order by name. + * + * parameter: + * + * None + * + * returns: + * + * A list of themes in alpha-numerical order by name. + */ + $.jqplot.ThemeEngine.prototype.getThemes = function() { + var tn = []; + var themes = []; + for (var n in this.themes) { + tn.push(n); + } + tn.sort(numericalOrder); + for (var i=0; i<tn.length; i++) { + themes.push(this.themes[tn[i]]); + } + return themes; + }; + + $.jqplot.ThemeEngine.prototype.activate = function(plot, name) { + // sometimes need to redraw whole plot. + var redrawPlot = false; + if (!name && this.activeTheme && this.activeTheme._name) { + name = this.activeTheme._name; + } + if (!this.themes.hasOwnProperty(name)) { + throw new Error("No theme of that name"); + } + else { + var th = this.themes[name]; + this.activeTheme = th; + var val, checkBorderColor = false, checkBorderWidth = false; + var arr = ['xaxis', 'x2axis', 'yaxis', 'y2axis']; + + for (i=0; i<arr.length; i++) { + var ax = arr[i]; + if (th.axesStyles.borderColor != null) { + plot.axes[ax].borderColor = th.axesStyles.borderColor; + } + if (th.axesStyles.borderWidth != null) { + plot.axes[ax].borderWidth = th.axesStyles.borderWidth; + } + } + + for (var axname in plot.axes) { + var axis = plot.axes[axname]; + if (axis.show) { + var thaxis = th.axes[axname] || {}; + var thaxstyle = th.axesStyles; + var thax = $.jqplot.extend(true, {}, thaxis, thaxstyle); + val = (th.axesStyles.borderColor != null) ? th.axesStyles.borderColor : thax.borderColor; + if (thax.borderColor != null) { + axis.borderColor = thax.borderColor; + redrawPlot = true; + } + val = (th.axesStyles.borderWidth != null) ? th.axesStyles.borderWidth : thax.borderWidth; + if (thax.borderWidth != null) { + axis.borderWidth = thax.borderWidth; + redrawPlot = true; + } + if (axis._ticks && axis._ticks[0]) { + for (var nn in thax.ticks) { + // val = null; + // if (th.axesStyles.ticks && th.axesStyles.ticks[nn] != null) { + // val = th.axesStyles.ticks[nn]; + // } + // else if (thax.ticks[nn] != null){ + // val = thax.ticks[nn] + // } + val = thax.ticks[nn]; + if (val != null) { + axis.tickOptions[nn] = val; + axis._ticks = []; + redrawPlot = true; + } + } + } + if (axis._label && axis._label.show) { + for (var nn in thax.label) { + // val = null; + // if (th.axesStyles.label && th.axesStyles.label[nn] != null) { + // val = th.axesStyles.label[nn]; + // } + // else if (thax.label && thax.label[nn] != null){ + // val = thax.label[nn] + // } + val = thax.label[nn]; + if (val != null) { + axis.labelOptions[nn] = val; + redrawPlot = true; + } + } + } + + } + } + + for (var n in th.grid) { + if (th.grid[n] != null) { + plot.grid[n] = th.grid[n]; + } + } + if (!redrawPlot) { + plot.grid.draw(); + } + + if (plot.legend.show) { + for (n in th.legend) { + if (th.legend[n] != null) { + plot.legend[n] = th.legend[n]; + } + } + } + if (plot.title.show) { + for (n in th.title) { + if (th.title[n] != null) { + plot.title[n] = th.title[n]; + } + } + } + + var i; + for (i=0; i<th.series.length; i++) { + var opts = {}; + var redrawSeries = false; + for (n in th.series[i]) { + val = (th.seriesStyles[n] != null) ? th.seriesStyles[n] : th.series[i][n]; + if (val != null) { + opts[n] = val; + if (n == 'color') { + plot.series[i].renderer.shapeRenderer.fillStyle = val; + plot.series[i].renderer.shapeRenderer.strokeStyle = val; + plot.series[i][n] = val; + } + else if ((n == 'lineWidth') || (n == 'linePattern')) { + plot.series[i].renderer.shapeRenderer[n] = val; + plot.series[i][n] = val; + } + else if (n == 'markerOptions') { + merge (plot.series[i].markerOptions, val); + merge (plot.series[i].markerRenderer, val); + } + else { + plot.series[i][n] = val; + } + redrawPlot = true; + } + } + } + + if (redrawPlot) { + plot.target.empty(); + plot.draw(); + } + + for (n in th.target) { + if (th.target[n] != null) { + plot.target.css(n, th.target[n]); + } + } + } + + }; + + $.jqplot.ThemeEngine.prototype._add = function(theme, name) { + if (name) { + theme._name = name; + } + if (!theme._name) { + theme._name = Date.parse(new Date()); + } + if (!this.themes.hasOwnProperty(theme._name)) { + this.themes[theme._name] = theme; + } + else { + throw new Error("jqplot.ThemeEngine Error: Theme already in use"); + } + }; + + // method remove + // Delete the named theme, return true on success, false on failure. + + + /** + * method: remove + * + * Remove the given theme from the themeEngine. + * + * parameters: + * + * name - name of the theme to remove. + * + * returns: + * + * true on success, false on failure. + */ + $.jqplot.ThemeEngine.prototype.remove = function(name) { + if (name == 'Default') { + return false; + } + return delete this.themes[name]; + }; + + /** + * method: newTheme + * + * Create a new theme based on the default theme, adding it the themeEngine. + * + * parameters: + * + * name - name of the new theme. + * obj - optional object of styles to be applied to this new theme. + * + * returns: + * + * new Theme object. + */ + $.jqplot.ThemeEngine.prototype.newTheme = function(name, obj) { + if (typeof(name) == 'object') { + obj = obj || name; + name = null; + } + if (obj && obj._name) { + name = obj._name; + } + else { + name = name || Date.parse(new Date()); + } + // var th = new $.jqplot.Theme(name); + var th = this.copy(this.themes['Default']._name, name); + $.jqplot.extend(th, obj); + return th; + }; + + // function clone(obj) { + // return eval(obj.toSource()); + // } + + function clone(obj){ + if(obj == null || typeof(obj) != 'object'){ + return obj; + } + + var temp = new obj.constructor(); + for(var key in obj){ + temp[key] = clone(obj[key]); + } + return temp; + } + + $.jqplot.clone = clone; + + function merge(obj1, obj2) { + if (obj2 == null || typeof(obj2) != 'object') { + return; + } + for (var key in obj2) { + if (key == 'highlightColors') { + obj1[key] = clone(obj2[key]); + } + if (obj2[key] != null && typeof(obj2[key]) == 'object') { + if (!obj1.hasOwnProperty(key)) { + obj1[key] = {}; + } + merge(obj1[key], obj2[key]); + } + else { + obj1[key] = obj2[key]; + } + } + } + + $.jqplot.merge = merge; + + // Use the jQuery 1.3.2 extend function since behaviour in jQuery 1.4 seems problematic + $.jqplot.extend = function() { + // copy reference to target object + var target = arguments[0] || {}, i = 1, length = arguments.length, deep = false, options; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !toString.call(target) === "[object Function]" ) { + target = {}; + } + + for ( ; i < length; i++ ){ + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( var name in options ) { + var src = target[ name ], copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging object values + if ( deep && copy && typeof copy === "object" && !copy.nodeType ) { + target[ name ] = $.jqplot.extend( deep, + // Never move original objects, clone them + src || ( copy.length != null ? [ ] : { } ) + , copy ); + } + // Don't bring in undefined values + else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + // Return the modified object + return target; + }; + + /** + * method: rename + * + * Rename a theme. + * + * parameters: + * + * oldName - current name of the theme. + * newName - desired name of the theme. + * + * returns: + * + * new Theme object. + */ + $.jqplot.ThemeEngine.prototype.rename = function (oldName, newName) { + if (oldName == 'Default' || newName == 'Default') { + throw new Error ("jqplot.ThemeEngine Error: Cannot rename from/to Default"); + } + if (this.themes.hasOwnProperty(newName)) { + throw new Error ("jqplot.ThemeEngine Error: New name already in use."); + } + else if (this.themes.hasOwnProperty(oldName)) { + var th = this.copy (oldName, newName); + this.remove(oldName); + return th; + } + throw new Error("jqplot.ThemeEngine Error: Old name or new name invalid"); + }; + + /** + * method: copy + * + * Create a copy of an existing theme in the themeEngine, adding it the themeEngine. + * + * parameters: + * + * sourceName - name of the existing theme. + * targetName - name of the copy. + * obj - optional object of style parameter to apply to the new theme. + * + * returns: + * + * new Theme object. + */ + $.jqplot.ThemeEngine.prototype.copy = function (sourceName, targetName, obj) { + if (targetName == 'Default') { + throw new Error ("jqplot.ThemeEngine Error: Cannot copy over Default theme"); + } + if (!this.themes.hasOwnProperty(sourceName)) { + var s = "jqplot.ThemeEngine Error: Source name invalid"; + throw new Error(s); + } + if (this.themes.hasOwnProperty(targetName)) { + var s = "jqplot.ThemeEngine Error: Target name invalid"; + throw new Error(s); + } + else { + var th = clone(this.themes[sourceName]); + th._name = targetName; + $.jqplot.extend(true, th, obj); + this._add(th); + return th; + } + }; + + + $.jqplot.Theme = function(name, obj) { + if (typeof(name) == 'object') { + obj = obj || name; + name = null; + } + name = name || Date.parse(new Date()); + this._name = name; + this.target = { + backgroundColor: null + }; + this.legend = { + textColor: null, + fontFamily: null, + fontSize: null, + border: null, + background: null + }; + this.title = { + textColor: null, + fontFamily: null, + fontSize: null, + textAlign: null + }; + this.seriesStyles = {}; + this.series = []; + this.grid = { + drawGridlines: null, + gridLineColor: null, + gridLineWidth: null, + backgroundColor: null, + borderColor: null, + borderWidth: null, + shadow: null + }; + this.axesStyles = {label:{}, ticks:{}}; + this.axes = {}; + if (typeof(obj) == 'string') { + this._name = obj; + } + else if(typeof(obj) == 'object') { + $.jqplot.extend(true, this, obj); + } + }; + + var AxisProperties = function() { + this.borderColor = null; + this.borderWidth = null; + this.ticks = new AxisTicks(); + this.label = new AxisLabel(); + }; + + var AxisTicks = function() { + this.show = null; + this.showGridline = null; + this.showLabel = null; + this.showMark = null; + this.size = null; + this.textColor = null; + this.whiteSpace = null; + this.fontSize = null; + this.fontFamily = null; + }; + + var AxisLabel = function() { + this.textColor = null; + this.whiteSpace = null; + this.fontSize = null; + this.fontFamily = null; + this.fontWeight = null; + }; + + var LineSeriesProperties = function() { + this.color=null; + this.lineWidth=null; + this.linePattern=null; + this.shadow=null; + this.fillColor=null; + this.showMarker=null; + this.markerOptions = new MarkerOptions(); + }; + + var MarkerOptions = function() { + this.show = null; + this.style = null; + this.lineWidth = null; + this.size = null; + this.color = null; + this.shadow = null; + }; + + var BarSeriesProperties = function() { + this.color=null; + this.seriesColors=null; + this.lineWidth=null; + this.shadow=null; + this.barPadding=null; + this.barMargin=null; + this.barWidth=null; + this.highlightColors=null; + }; + + var PieSeriesProperties = function() { + this.seriesColors=null; + this.padding=null; + this.sliceMargin=null; + this.fill=null; + this.shadow=null; + this.startAngle=null; + this.lineWidth=null; + this.highlightColors=null; + }; + + var DonutSeriesProperties = function() { + this.seriesColors=null; + this.padding=null; + this.sliceMargin=null; + this.fill=null; + this.shadow=null; + this.startAngle=null; + this.lineWidth=null; + this.innerDiameter=null; + this.thickness=null; + this.ringMargin=null; + this.highlightColors=null; + }; + + var FunnelSeriesProperties = function() { + this.color=null; + this.lineWidth=null; + this.shadow=null; + this.padding=null; + this.sectionMargin=null; + this.seriesColors=null; + this.highlightColors=null; + }; + + var MeterSeriesProperties = function() { + this.padding=null; + this.backgroundColor=null; + this.ringColor=null; + this.tickColor=null; + this.ringWidth=null; + this.intervalColors=null; + this.intervalInnerRadius=null; + this.intervalOuterRadius=null; + this.hubRadius=null; + this.needleThickness=null; + this.needlePad=null; + }; + + + + + $.fn.jqplotChildText = function() { + return $(this).contents().filter(function() { + return this.nodeType == 3; // Node.TEXT_NODE not defined in I7 + }).text(); + }; + + // Returns font style as abbreviation for "font" property. + $.fn.jqplotGetComputedFontStyle = function() { + var css = window.getComputedStyle ? window.getComputedStyle(this[0]) : this[0].currentStyle; + var attrs = css['font-style'] ? ['font-style', 'font-weight', 'font-size', 'font-family'] : ['fontStyle', 'fontWeight', 'fontSize', 'fontFamily']; + var style = []; + + for (var i=0 ; i < attrs.length; ++i) { + var attr = String(css[attrs[i]]); + + if (attr && attr != 'normal') { + style.push(attr); + } + } + return style.join(' '); + }; + + /** + * Namespace: $.fn + * jQuery namespace to attach functions to jQuery elements. + * + */ + + $.fn.jqplotToImageCanvas = function(options) { + + options = options || {}; + var x_offset = (options.x_offset == null) ? 0 : options.x_offset; + var y_offset = (options.y_offset == null) ? 0 : options.y_offset; + var backgroundColor = (options.backgroundColor == null) ? 'rgb(255,255,255)' : options.backgroundColor; + + if ($(this).width() == 0 || $(this).height() == 0) { + return null; + } + + // excanvas and hence IE < 9 do not support toDataURL and cannot export images. + if (!$.jqplot.support_canvas) { + return null; + } + + var newCanvas = document.createElement("canvas"); + var h = $(this).outerHeight(true); + var w = $(this).outerWidth(true); + var offs = $(this).offset(); + var plotleft = offs.left; + var plottop = offs.top; + var transx = 0, transy = 0; + + // have to check if any elements are hanging outside of plot area before rendering, + // since changing width of canvas will erase canvas. + + var clses = ['jqplot-table-legend', 'jqplot-xaxis-tick', 'jqplot-x2axis-tick', 'jqplot-yaxis-tick', 'jqplot-y2axis-tick', 'jqplot-y3axis-tick', + 'jqplot-y4axis-tick', 'jqplot-y5axis-tick', 'jqplot-y6axis-tick', 'jqplot-y7axis-tick', 'jqplot-y8axis-tick', 'jqplot-y9axis-tick', + 'jqplot-xaxis-label', 'jqplot-x2axis-label', 'jqplot-yaxis-label', 'jqplot-y2axis-label', 'jqplot-y3axis-label', 'jqplot-y4axis-label', + 'jqplot-y5axis-label', 'jqplot-y6axis-label', 'jqplot-y7axis-label', 'jqplot-y8axis-label', 'jqplot-y9axis-label' ]; + + var temptop, templeft, tempbottom, tempright; + + for (var i in clses) { + $(this).find('.'+clses[i]).each(function() { + temptop = $(this).offset().top - plottop; + templeft = $(this).offset().left - plotleft; + tempright = templeft + $(this).outerWidth(true) + transx; + tempbottom = temptop + $(this).outerHeight(true) + transy; + if (templeft < -transx) { + w = w - transx - templeft; + transx = -templeft; + } + if (temptop < -transy) { + h = h - transy - temptop; + transy = - temptop; + } + if (tempright > w) { + w = tempright; + } + if (tempbottom > h) { + h = tempbottom; + } + }); + } + + newCanvas.width = w + Number(x_offset); + newCanvas.height = h + Number(y_offset); + + var newContext = newCanvas.getContext("2d"); + + newContext.save(); + newContext.fillStyle = backgroundColor; + newContext.fillRect(0,0, newCanvas.width, newCanvas.height); + newContext.restore(); + + newContext.translate(transx, transy); + newContext.textAlign = 'left'; + newContext.textBaseline = 'top'; + + function getLineheight(el) { + var lineheight = parseInt($(el).css('line-height'), 10); + + if (isNaN(lineheight)) { + lineheight = parseInt($(el).css('font-size'), 10) * 1.2; + } + return lineheight; + } + + function writeWrappedText (el, context, text, left, top, canvasWidth) { + var lineheight = getLineheight(el); + var tagwidth = $(el).innerWidth(); + var tagheight = $(el).innerHeight(); + var words = text.split(/\s+/); + var wl = words.length; + var w = ''; + var breaks = []; + var temptop = top; + var templeft = left; + + for (var i=0; i<wl; i++) { + w += words[i]; + if (context.measureText(w).width > tagwidth) { + breaks.push(i); + w = ''; + } + } + if (breaks.length === 0) { + // center text if necessary + if ($(el).css('textAlign') === 'center') { + templeft = left + (canvasWidth - context.measureText(w).width)/2 - transx; + } + context.fillText(text, templeft, top); + } + else { + w = words.slice(0, breaks[0]).join(' '); + // center text if necessary + if ($(el).css('textAlign') === 'center') { + templeft = left + (canvasWidth - context.measureText(w).width)/2 - transx; + } + context.fillText(w, templeft, temptop); + temptop += lineheight; + for (var i=1, l=breaks.length; i<l; i++) { + w = words.slice(breaks[i-1], breaks[i]).join(' '); + // center text if necessary + if ($(el).css('textAlign') === 'center') { + templeft = left + (canvasWidth - context.measureText(w).width)/2 - transx; + } + context.fillText(w, templeft, temptop); + temptop += lineheight; + } + w = words.slice(breaks[i-1], words.length).join(' '); + // center text if necessary + if ($(el).css('textAlign') === 'center') { + templeft = left + (canvasWidth - context.measureText(w).width)/2 - transx; + } + context.fillText(w, templeft, temptop); + } + + } + + function _jqpToImage(el, x_offset, y_offset) { + var tagname = el.tagName.toLowerCase(); + var p = $(el).position(); + var css = window.getComputedStyle ? window.getComputedStyle(el) : el.currentStyle; // for IE < 9 + var left = x_offset + p.left + parseInt(css.marginLeft, 10) + parseInt(css.borderLeftWidth, 10) + parseInt(css.paddingLeft, 10); + var top = y_offset + p.top + parseInt(css.marginTop, 10) + parseInt(css.borderTopWidth, 10)+ parseInt(css.paddingTop, 10); + var w = newCanvas.width; + // var left = x_offset + p.left + $(el).css('marginLeft') + $(el).css('borderLeftWidth') + + if ((tagname == 'div' || tagname == 'span') && !$(el).hasClass('jqplot-highlighter-tooltip')) { + $(el).children().each(function() { + _jqpToImage(this, left, top); + }); + var text = $(el).jqplotChildText(); + + if (text) { + newContext.font = $(el).jqplotGetComputedFontStyle(); + newContext.fillStyle = $(el).css('color'); + + writeWrappedText(el, newContext, text, left, top, w); + } + } + + // handle the standard table legend + + else if (tagname === 'table' && $(el).hasClass('jqplot-table-legend')) { + newContext.strokeStyle = $(el).css('border-top-color'); + newContext.fillStyle = $(el).css('background-color'); + newContext.fillRect(left, top, $(el).innerWidth(), $(el).innerHeight()); + if (parseInt($(el).css('border-top-width'), 10) > 0) { + newContext.strokeRect(left, top, $(el).innerWidth(), $(el).innerHeight()); + } + + // find all the swatches + $(el).find('div.jqplot-table-legend-swatch-outline').each(function() { + // get the first div and stroke it + var elem = $(this); + newContext.strokeStyle = elem.css('border-top-color'); + var l = left + elem.position().left; + var t = top + elem.position().top; + newContext.strokeRect(l, t, elem.innerWidth(), elem.innerHeight()); + + // now fill the swatch + + l += parseInt(elem.css('padding-left'), 10); + t += parseInt(elem.css('padding-top'), 10); + var h = elem.innerHeight() - 2 * parseInt(elem.css('padding-top'), 10); + var w = elem.innerWidth() - 2 * parseInt(elem.css('padding-left'), 10); + + var swatch = elem.children('div.jqplot-table-legend-swatch'); + newContext.fillStyle = swatch.css('background-color'); + newContext.fillRect(l, t, w, h); + }); + + // now add text + + $(el).find('td.jqplot-table-legend-label').each(function(){ + var elem = $(this); + var l = left + elem.position().left; + var t = top + elem.position().top + parseInt(elem.css('padding-top'), 10); + newContext.font = elem.jqplotGetComputedFontStyle(); + newContext.fillStyle = elem.css('color'); + newContext.fillText(elem.text(), l, t); + }); + + var elem = null; + } + + else if (tagname == 'canvas') { + newContext.drawImage(el, left, top); + } + } + $(this).children().each(function() { + _jqpToImage(this, x_offset, y_offset); + }); + return newCanvas; + }; + + $.fn.jqplotToImageStr = function(options) { + var imgCanvas = $(this).jqplotToImageCanvas(options); + if (imgCanvas) { + return imgCanvas.toDataURL("image/png"); + } + else { + return null; + } + }; + + // create an <img> element and return it. + // Should work on canvas supporting browsers. + $.fn.jqplotToImageElem = function(options) { + var elem = document.createElement("img"); + var str = $(this).jqplotToImageStr(options); + elem.src = str; + return elem; + }; + + // create an <img> element and return it. + // Should work on canvas supporting browsers. + $.fn.jqplotToImageElemStr = function(options) { + var str = '<img src='+$(this).jqplotToImageStr(options)+' />'; + return str; + }; + + // Not gauranteed to work, even on canvas supporting browsers due to + // limitations with location.href and browser support. + $.fn.jqplotSaveImage = function() { + var imgData = $(this).jqplotToImageStr({}); + if (imgData) { + window.location.href = imgData.replace("image/png", "image/octet-stream"); + } + + }; + + // Not gauranteed to work, even on canvas supporting browsers due to + // limitations with window.open and arbitrary data. + $.fn.jqplotViewImage = function() { + var imgStr = $(this).jqplotToImageElemStr({}); + var imgData = $(this).jqplotToImageStr({}); + if (imgStr) { + var w = window.open(''); + w.document.open("image/png"); + w.document.write(imgStr); + w.document.close(); + w = null; + } + }; + + + + /** + * @description + * <p>Object with extended date parsing and formatting capabilities. + * This library borrows many concepts and ideas from the Date Instance + * Methods by Ken Snyder along with some parts of Ken's actual code.</p> + * + * <p>jsDate takes a different approach by not extending the built-in + * Date Object, improving date parsing, allowing for multiple formatting + * syntaxes and multiple and more easily expandable localization.</p> + * + * @author Chris Leonello + * @date #date# + * @version #VERSION# + * @copyright (c) 2010 Chris Leonello + * jsDate is currently available for use in all personal or commercial projects + * under both the MIT and GPL version 2.0 licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * <p>Ken's origianl Date Instance Methods and copyright notice:</p> + * <pre> + * Ken Snyder (ken d snyder at gmail dot com) + * 2008-09-10 + * version 2.0.2 (http://kendsnyder.com/sandbox/date/) + * Creative Commons Attribution License 3.0 (http://creativecommons.org/licenses/by/3.0/) + * </pre> + * + * @class + * @name jsDate + * @param {String | Number | Array | Date Object | Options Object} arguments Optional arguments, either a parsable date/time string, + * a JavaScript timestamp, an array of numbers of form [year, month, day, hours, minutes, seconds, milliseconds], + * a Date object, or an options object of form {syntax: "perl", date:some Date} where all options are optional. + */ + + var jsDate = function () { + + this.syntax = jsDate.config.syntax; + this._type = "jsDate"; + this.proxy = new Date(); + this.options = {}; + this.locale = jsDate.regional.getLocale(); + this.formatString = ''; + this.defaultCentury = jsDate.config.defaultCentury; + + switch ( arguments.length ) { + case 0: + break; + case 1: + // other objects either won't have a _type property or, + // if they do, it shouldn't be set to "jsDate", so + // assume it is an options argument. + if (get_type(arguments[0]) == "[object Object]" && arguments[0]._type != "jsDate") { + var opts = this.options = arguments[0]; + this.syntax = opts.syntax || this.syntax; + this.defaultCentury = opts.defaultCentury || this.defaultCentury; + this.proxy = jsDate.createDate(opts.date); + } + else { + this.proxy = jsDate.createDate(arguments[0]); + } + break; + default: + var a = []; + for ( var i=0; i<arguments.length; i++ ) { + a.push(arguments[i]); + } + // this should be the current date/time? + this.proxy = new Date(); + this.proxy.setFullYear.apply( this.proxy, a.slice(0,3) ); + if ( a.slice(3).length ) { + this.proxy.setHours.apply( this.proxy, a.slice(3) ); + } + break; + } + }; + + /** + * @namespace Configuration options that will be used as defaults for all instances on the page. + * @property {String} defaultLocale The default locale to use [en]. + * @property {String} syntax The default syntax to use [perl]. + * @property {Number} defaultCentury The default centry for 2 digit dates. + */ + jsDate.config = { + defaultLocale: 'en', + syntax: 'perl', + defaultCentury: 1900 + }; + + /** + * Add an arbitrary amount to the currently stored date + * + * @param {Number} number + * @param {String} unit + * @returns {jsDate} + */ + + jsDate.prototype.add = function(number, unit) { + var factor = multipliers[unit] || multipliers.day; + if (typeof factor == 'number') { + this.proxy.setTime(this.proxy.getTime() + (factor * number)); + } else { + factor.add(this, number); + } + return this; + }; + + /** + * Create a new jqplot.date object with the same date + * + * @returns {jsDate} + */ + + jsDate.prototype.clone = function() { + return new jsDate(this.proxy.getTime()); + }; + + /** + * Get the UTC TimeZone Offset of this date in milliseconds. + * + * @returns {Number} + */ + + jsDate.prototype.getUtcOffset = function() { + return this.proxy.getTimezoneOffset() * 60000; + }; + + /** + * Find the difference between this jsDate and another date. + * + * @param {String| Number| Array| jsDate Object| Date Object} dateObj + * @param {String} unit + * @param {Boolean} allowDecimal + * @returns {Number} Number of units difference between dates. + */ + + jsDate.prototype.diff = function(dateObj, unit, allowDecimal) { + // ensure we have a Date object + dateObj = new jsDate(dateObj); + if (dateObj === null) { + return null; + } + // get the multiplying factor integer or factor function + var factor = multipliers[unit] || multipliers.day; + if (typeof factor == 'number') { + // multiply + var unitDiff = (this.proxy.getTime() - dateObj.proxy.getTime()) / factor; + } else { + // run function + var unitDiff = factor.diff(this.proxy, dateObj.proxy); + } + // if decimals are not allowed, round toward zero + return (allowDecimal ? unitDiff : Math[unitDiff > 0 ? 'floor' : 'ceil'](unitDiff)); + }; + + /** + * Get the abbreviated name of the current week day + * + * @returns {String} + */ + + jsDate.prototype.getAbbrDayName = function() { + return jsDate.regional[this.locale]["dayNamesShort"][this.proxy.getDay()]; + }; + + /** + * Get the abbreviated name of the current month + * + * @returns {String} + */ + + jsDate.prototype.getAbbrMonthName = function() { + return jsDate.regional[this.locale]["monthNamesShort"][this.proxy.getMonth()]; + }; + + /** + * Get UPPER CASE AM or PM for the current time + * + * @returns {String} + */ + + jsDate.prototype.getAMPM = function() { + return this.proxy.getHours() >= 12 ? 'PM' : 'AM'; + }; + + /** + * Get lower case am or pm for the current time + * + * @returns {String} + */ + + jsDate.prototype.getAmPm = function() { + return this.proxy.getHours() >= 12 ? 'pm' : 'am'; + }; + + /** + * Get the century (19 for 20th Century) + * + * @returns {Integer} Century (19 for 20th century). + */ + jsDate.prototype.getCentury = function() { + return parseInt(this.proxy.getFullYear()/100, 10); + }; + + /** + * Implements Date functionality + */ + jsDate.prototype.getDate = function() { + return this.proxy.getDate(); + }; + + /** + * Implements Date functionality + */ + jsDate.prototype.getDay = function() { + return this.proxy.getDay(); + }; + + /** + * Get the Day of week 1 (Monday) thru 7 (Sunday) + * + * @returns {Integer} Day of week 1 (Monday) thru 7 (Sunday) + */ + jsDate.prototype.getDayOfWeek = function() { + var dow = this.proxy.getDay(); + return dow===0?7:dow; + }; + + /** + * Get the day of the year + * + * @returns {Integer} 1 - 366, day of the year + */ + jsDate.prototype.getDayOfYear = function() { + var d = this.proxy; + var ms = d - new Date('' + d.getFullYear() + '/1/1 GMT'); + ms += d.getTimezoneOffset()*60000; + d = null; + return parseInt(ms/60000/60/24, 10)+1; + }; + + /** + * Get the name of the current week day + * + * @returns {String} + */ + + jsDate.prototype.getDayName = function() { + return jsDate.regional[this.locale]["dayNames"][this.proxy.getDay()]; + }; + + /** + * Get the week number of the given year, starting with the first Sunday as the first week + * @returns {Integer} Week number (13 for the 13th full week of the year). + */ + jsDate.prototype.getFullWeekOfYear = function() { + var d = this.proxy; + var doy = this.getDayOfYear(); + var rdow = 6-d.getDay(); + var woy = parseInt((doy+rdow)/7, 10); + return woy; + }; + + /** + * Implements Date functionality + */ + jsDate.prototype.getFullYear = function() { + return this.proxy.getFullYear(); + }; + + /** + * Get the GMT offset in hours and minutes (e.g. +06:30) + * + * @returns {String} + */ + + jsDate.prototype.getGmtOffset = function() { + // divide the minutes offset by 60 + var hours = this.proxy.getTimezoneOffset() / 60; + // decide if we are ahead of or behind GMT + var prefix = hours < 0 ? '+' : '-'; + // remove the negative sign if any + hours = Math.abs(hours); + // add the +/- to the padded number of hours to : to the padded minutes + return prefix + addZeros(Math.floor(hours), 2) + ':' + addZeros((hours % 1) * 60, 2); + }; + + /** + * Implements Date functionality + */ + jsDate.prototype.getHours = function() { + return this.proxy.getHours(); + }; + + /** + * Get the current hour on a 12-hour scheme + * + * @returns {Integer} + */ + + jsDate.prototype.getHours12 = function() { + var hours = this.proxy.getHours(); + return hours > 12 ? hours - 12 : (hours == 0 ? 12 : hours); + }; + + + jsDate.prototype.getIsoWeek = function() { + var d = this.proxy; + var woy = d.getWeekOfYear(); + var dow1_1 = (new Date('' + d.getFullYear() + '/1/1')).getDay(); + // First week is 01 and not 00 as in the case of %U and %W, + // so we add 1 to the final result except if day 1 of the year + // is a Monday (then %W returns 01). + // We also need to subtract 1 if the day 1 of the year is + // Friday-Sunday, so the resulting equation becomes: + var idow = woy + (dow1_1 > 4 || dow1_1 <= 1 ? 0 : 1); + if(idow == 53 && (new Date('' + d.getFullYear() + '/12/31')).getDay() < 4) + { + idow = 1; + } + else if(idow === 0) + { + d = new jsDate(new Date('' + (d.getFullYear()-1) + '/12/31')); + idow = d.getIsoWeek(); + } + d = null; + return idow; + }; + + /** + * Implements Date functionality + */ + jsDate.prototype.getMilliseconds = function() { + return this.proxy.getMilliseconds(); + }; + + /** + * Implements Date functionality + */ + jsDate.prototype.getMinutes = function() { + return this.proxy.getMinutes(); + }; + + /** + * Implements Date functionality + */ + jsDate.prototype.getMonth = function() { + return this.proxy.getMonth(); + }; + + /** + * Get the name of the current month + * + * @returns {String} + */ + + jsDate.prototype.getMonthName = function() { + return jsDate.regional[this.locale]["monthNames"][this.proxy.getMonth()]; + }; + + /** + * Get the number of the current month, 1-12 + * + * @returns {Integer} + */ + + jsDate.prototype.getMonthNumber = function() { + return this.proxy.getMonth() + 1; + }; + + /** + * Implements Date functionality + */ + jsDate.prototype.getSeconds = function() { + return this.proxy.getSeconds(); + }; + + /** + * Return a proper two-digit year integer + * + * @returns {Integer} + */ + + jsDate.prototype.getShortYear = function() { + return this.proxy.getYear() % 100; + }; + + /** + * Implements Date functionality + */ + jsDate.prototype.getTime = function() { + return this.proxy.getTime(); + }; + + /** + * Get the timezone abbreviation + * + * @returns {String} Abbreviation for the timezone + */ + jsDate.prototype.getTimezoneAbbr = function() { + return this.proxy.toString().replace(/^.*\(([^)]+)\)$/, '$1'); + }; + + /** + * Get the browser-reported name for the current timezone (e.g. MDT, Mountain Daylight Time) + * + * @returns {String} + */ + jsDate.prototype.getTimezoneName = function() { + var match = /(?:\((.+)\)$| ([A-Z]{3}) )/.exec(this.toString()); + return match[1] || match[2] || 'GMT' + this.getGmtOffset(); + }; + + /** + * Implements Date functionality + */ + jsDate.prototype.getTimezoneOffset = function() { + return this.proxy.getTimezoneOffset(); + }; + + + /** + * Get the week number of the given year, starting with the first Monday as the first week + * @returns {Integer} Week number (13 for the 13th week of the year). + */ + jsDate.prototype.getWeekOfYear = function() { + var doy = this.getDayOfYear(); + var rdow = 7 - this.getDayOfWeek(); + var woy = parseInt((doy+rdow)/7, 10); + return woy; + }; + + /** + * Get the current date as a Unix timestamp + * + * @returns {Integer} + */ + + jsDate.prototype.getUnix = function() { + return Math.round(this.proxy.getTime() / 1000, 0); + }; + + /** + * Implements Date functionality + */ + jsDate.prototype.getYear = function() { + return this.proxy.getYear(); + }; + + /** + * Return a date one day ahead (or any other unit) + * + * @param {String} unit Optional, year | month | day | week | hour | minute | second | millisecond + * @returns {jsDate} + */ + + jsDate.prototype.next = function(unit) { + unit = unit || 'day'; + return this.clone().add(1, unit); + }; + + /** + * Set the jsDate instance to a new date. + * + * @param {String | Number | Array | Date Object | jsDate Object | Options Object} arguments Optional arguments, + * either a parsable date/time string, + * a JavaScript timestamp, an array of numbers of form [year, month, day, hours, minutes, seconds, milliseconds], + * a Date object, jsDate Object or an options object of form {syntax: "perl", date:some Date} where all options are optional. + */ + jsDate.prototype.set = function() { + switch ( arguments.length ) { + case 0: + this.proxy = new Date(); + break; + case 1: + // other objects either won't have a _type property or, + // if they do, it shouldn't be set to "jsDate", so + // assume it is an options argument. + if (get_type(arguments[0]) == "[object Object]" && arguments[0]._type != "jsDate") { + var opts = this.options = arguments[0]; + this.syntax = opts.syntax || this.syntax; + this.defaultCentury = opts.defaultCentury || this.defaultCentury; + this.proxy = jsDate.createDate(opts.date); + } + else { + this.proxy = jsDate.createDate(arguments[0]); + } + break; + default: + var a = []; + for ( var i=0; i<arguments.length; i++ ) { + a.push(arguments[i]); + } + // this should be the current date/time + this.proxy = new Date(); + this.proxy.setFullYear.apply( this.proxy, a.slice(0,3) ); + if ( a.slice(3).length ) { + this.proxy.setHours.apply( this.proxy, a.slice(3) ); + } + break; + } + return this; + }; + + /** + * Sets the day of the month for a specified date according to local time. + * @param {Integer} dayValue An integer from 1 to 31, representing the day of the month. + */ + jsDate.prototype.setDate = function(n) { + this.proxy.setDate(n); + return this; + }; + + /** + * Sets the full year for a specified date according to local time. + * @param {Integer} yearValue The numeric value of the year, for example, 1995. + * @param {Integer} monthValue Optional, between 0 and 11 representing the months January through December. + * @param {Integer} dayValue Optional, between 1 and 31 representing the day of the month. If you specify the dayValue parameter, you must also specify the monthValue. + */ + jsDate.prototype.setFullYear = function() { + this.proxy.setFullYear.apply(this.proxy, arguments); + return this; + }; + + /** + * Sets the hours for a specified date according to local time. + * + * @param {Integer} hoursValue An integer between 0 and 23, representing the hour. + * @param {Integer} minutesValue Optional, An integer between 0 and 59, representing the minutes. + * @param {Integer} secondsValue Optional, An integer between 0 and 59, representing the seconds. + * If you specify the secondsValue parameter, you must also specify the minutesValue. + * @param {Integer} msValue Optional, A number between 0 and 999, representing the milliseconds. + * If you specify the msValue parameter, you must also specify the minutesValue and secondsValue. + */ + jsDate.prototype.setHours = function() { + this.proxy.setHours.apply(this.proxy, arguments); + return this; + }; + + /** + * Implements Date functionality + */ + jsDate.prototype.setMilliseconds = function(n) { + this.proxy.setMilliseconds(n); + return this; + }; + + /** + * Implements Date functionality + */ + jsDate.prototype.setMinutes = function() { + this.proxy.setMinutes.apply(this.proxy, arguments); + return this; + }; + + /** + * Implements Date functionality + */ + jsDate.prototype.setMonth = function() { + this.proxy.setMonth.apply(this.proxy, arguments); + return this; + }; + + /** + * Implements Date functionality + */ + jsDate.prototype.setSeconds = function() { + this.proxy.setSeconds.apply(this.proxy, arguments); + return this; + }; + + /** + * Implements Date functionality + */ + jsDate.prototype.setTime = function(n) { + this.proxy.setTime(n); + return this; + }; + + /** + * Implements Date functionality + */ + jsDate.prototype.setYear = function() { + this.proxy.setYear.apply(this.proxy, arguments); + return this; + }; + + /** + * Provide a formatted string representation of this date. + * + * @param {String} formatString A format string. + * See: {@link jsDate.formats}. + * @returns {String} Date String. + */ + + jsDate.prototype.strftime = function(formatString) { + formatString = formatString || this.formatString || jsDate.regional[this.locale]['formatString']; + return jsDate.strftime(this, formatString, this.syntax); + }; + + /** + * Return a String representation of this jsDate object. + * @returns {String} Date string. + */ + + jsDate.prototype.toString = function() { + return this.proxy.toString(); + }; + + /** + * Convert the current date to an 8-digit integer (%Y%m%d) + * + * @returns {Integer} + */ + + jsDate.prototype.toYmdInt = function() { + return (this.proxy.getFullYear() * 10000) + (this.getMonthNumber() * 100) + this.proxy.getDate(); + }; + + /** + * @namespace Holds localizations for month/day names. + * <p>jsDate attempts to detect locale when loaded and defaults to 'en'. + * If a localization is detected which is not available, jsDate defaults to 'en'. + * Additional localizations can be added after jsDate loads. After adding a localization, + * call the jsDate.regional.getLocale() method. Currently, en, fr and de are defined.</p> + * + * <p>Localizations must be an object and have the following properties defined: monthNames, monthNamesShort, dayNames, dayNamesShort and Localizations are added like:</p> + * <pre class="code"> + * jsDate.regional['en'] = { + * monthNames : 'January February March April May June July August September October November December'.split(' '), + * monthNamesShort : 'Jan Feb Mar Apr May Jun Jul Aug Sep Oct Nov Dec'.split(' '), + * dayNames : 'Sunday Monday Tuesday Wednesday Thursday Friday Saturday'.split(' '), + * dayNamesShort : 'Sun Mon Tue Wed Thu Fri Sat'.split(' ') + * }; + * </pre> + * <p>After adding localizations, call <code>jsDate.regional.getLocale();</code> to update the locale setting with the + * new localizations.</p> + */ + + jsDate.regional = { + 'en': { + monthNames: ['January','February','March','April','May','June','July','August','September','October','November','December'], + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun','Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], + formatString: '%Y-%m-%d %H:%M:%S' + }, + + 'fr': { + monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin','Juillet','Août','Septembre','Octobre','Novembre','Décembre'], + monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun','Jul','Aoû','Sep','Oct','Nov','Déc'], + dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'], + dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'], + formatString: '%Y-%m-%d %H:%M:%S' + }, + + 'de': { + monthNames: ['Januar','Februar','März','April','Mai','Juni','Juli','August','September','Oktober','November','Dezember'], + monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun','Jul','Aug','Sep','Okt','Nov','Dez'], + dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'], + dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'], + formatString: '%Y-%m-%d %H:%M:%S' + }, + + 'es': { + monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio', 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'], + monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun', 'Jul','Ago','Sep','Oct','Nov','Dic'], + dayNames: ['Domingo','Lunes','Martes','Miércoles','Jueves','Viernes','Sábado'], + dayNamesShort: ['Dom','Lun','Mar','Mié','Juv','Vie','Sáb'], + formatString: '%Y-%m-%d %H:%M:%S' + }, + + 'ru': { + monthNames: ['Январь','Февраль','Март','Апрель','Май','Июнь','Июль','Август','Сентябрь','Октябрь','Ноябрь','Декабрь'], + monthNamesShort: ['Янв','Фев','Мар','Апр','Май','Июн','Июл','Авг','Сен','Окт','Ноя','Дек'], + dayNames: ['воскресенье','понедельник','вторник','среда','четверг','пятница','суббота'], + dayNamesShort: ['вск','пнд','втр','срд','чтв','птн','сбт'], + formatString: '%Y-%m-%d %H:%M:%S' + }, + + 'ar': { + monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران','تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'], + monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'], + dayNames: ['السبت', 'الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'], + dayNamesShort: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'], + formatString: '%Y-%m-%d %H:%M:%S' + }, + + 'pt': { + monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho','Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'], + monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun','Jul','Ago','Set','Out','Nov','Dez'], + dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sábado'], + dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sáb'], + formatString: '%Y-%m-%d %H:%M:%S' + }, + + 'pt-BR': { + monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho', 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'], + monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun','Jul','Ago','Set','Out','Nov','Dez'], + dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sábado'], + dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sáb'], + formatString: '%Y-%m-%d %H:%M:%S' + } + + + }; + + // Set english variants to 'en' + jsDate.regional['en-US'] = jsDate.regional['en-GB'] = jsDate.regional['en']; + + /** + * Try to determine the users locale based on the lang attribute of the html page. Defaults to 'en' + * if it cannot figure out a locale of if the locale does not have a localization defined. + * @returns {String} locale + */ + + jsDate.regional.getLocale = function () { + var l = jsDate.config.defaultLocale; + + if ( document && document.getElementsByTagName('html') && document.getElementsByTagName('html')[0].lang ) { + l = document.getElementsByTagName('html')[0].lang; + if (!jsDate.regional.hasOwnProperty(l)) { + l = jsDate.config.defaultLocale; + } + } + + return l; + }; + + // ms in day + var day = 24 * 60 * 60 * 1000; + + // padd a number with zeros + var addZeros = function(num, digits) { + num = String(num); + var i = digits - num.length; + var s = String(Math.pow(10, i)).slice(1); + return s.concat(num); + }; + + // representations used for calculating differences between dates. + // This borrows heavily from Ken Snyder's work. + var multipliers = { + millisecond: 1, + second: 1000, + minute: 60 * 1000, + hour: 60 * 60 * 1000, + day: day, + week: 7 * day, + month: { + // add a number of months + add: function(d, number) { + // add any years needed (increments of 12) + multipliers.year.add(d, Math[number > 0 ? 'floor' : 'ceil'](number / 12)); + // ensure that we properly wrap betwen December and January + // 11 % 12 = 11 + // 12 % 12 = 0 + var prevMonth = d.getMonth() + (number % 12); + if (prevMonth == 12) { + prevMonth = 0; + d.setYear(d.getFullYear() + 1); + } else if (prevMonth == -1) { + prevMonth = 11; + d.setYear(d.getFullYear() - 1); + } + d.setMonth(prevMonth); + }, + // get the number of months between two Date objects (decimal to the nearest day) + diff: function(d1, d2) { + // get the number of years + var diffYears = d1.getFullYear() - d2.getFullYear(); + // get the number of remaining months + var diffMonths = d1.getMonth() - d2.getMonth() + (diffYears * 12); + // get the number of remaining days + var diffDays = d1.getDate() - d2.getDate(); + // return the month difference with the days difference as a decimal + return diffMonths + (diffDays / 30); + } + }, + year: { + // add a number of years + add: function(d, number) { + d.setYear(d.getFullYear() + Math[number > 0 ? 'floor' : 'ceil'](number)); + }, + // get the number of years between two Date objects (decimal to the nearest day) + diff: function(d1, d2) { + return multipliers.month.diff(d1, d2) / 12; + } + } + }; + // + // Alias each multiplier with an 's' to allow 'year' and 'years' for example. + // This comes from Ken Snyders work. + // + for (var unit in multipliers) { + if (unit.substring(unit.length - 1) != 's') { // IE will iterate newly added properties :| + multipliers[unit + 's'] = multipliers[unit]; + } + } + + // + // take a jsDate instance and a format code and return the formatted value. + // This is a somewhat modified version of Ken Snyder's method. + // + var format = function(d, code, syntax) { + // if shorcut codes are used, recursively expand those. + if (jsDate.formats[syntax]["shortcuts"][code]) { + return jsDate.strftime(d, jsDate.formats[syntax]["shortcuts"][code], syntax); + } else { + // get the format code function and addZeros() argument + var getter = (jsDate.formats[syntax]["codes"][code] || '').split('.'); + var nbr = d['get' + getter[0]] ? d['get' + getter[0]]() : ''; + if (getter[1]) { + nbr = addZeros(nbr, getter[1]); + } + return nbr; + } + }; + + /** + * @static + * Static function for convert a date to a string according to a given format. Also acts as namespace for strftime format codes. + * <p>strftime formatting can be accomplished without creating a jsDate object by calling jsDate.strftime():</p> + * <pre class="code"> + * var formattedDate = jsDate.strftime('Feb 8, 2006 8:48:32', '%Y-%m-%d %H:%M:%S'); + * </pre> + * @param {String | Number | Array | jsDate Object | Date Object} date A parsable date string, JavaScript time stamp, Array of form [year, month, day, hours, minutes, seconds, milliseconds], jsDate Object or Date object. + * @param {String} formatString String with embedded date formatting codes. + * See: {@link jsDate.formats}. + * @param {String} syntax Optional syntax to use [default perl]. + * @param {String} locale Optional locale to use. + * @returns {String} Formatted representation of the date. + */ + // + // Logic as implemented here is very similar to Ken Snyder's Date Instance Methods. + // + jsDate.strftime = function(d, formatString, syntax, locale) { + var syn = 'perl'; + var loc = jsDate.regional.getLocale(); + + // check if syntax and locale are available or reversed + if (syntax && jsDate.formats.hasOwnProperty(syntax)) { + syn = syntax; + } + else if (syntax && jsDate.regional.hasOwnProperty(syntax)) { + loc = syntax; + } + + if (locale && jsDate.formats.hasOwnProperty(locale)) { + syn = locale; + } + else if (locale && jsDate.regional.hasOwnProperty(locale)) { + loc = locale; + } + + if (get_type(d) != "[object Object]" || d._type != "jsDate") { + d = new jsDate(d); + d.locale = loc; + } + if (!formatString) { + formatString = d.formatString || jsDate.regional[loc]['formatString']; + } + // default the format string to year-month-day + var source = formatString || '%Y-%m-%d', + result = '', + match; + // replace each format code + while (source.length > 0) { + if (match = source.match(jsDate.formats[syn].codes.matcher)) { + result += source.slice(0, match.index); + result += (match[1] || '') + format(d, match[2], syn); + source = source.slice(match.index + match[0].length); + } else { + result += source; + source = ''; + } + } + return result; + }; + + /** + * @namespace + * Namespace to hold format codes and format shortcuts. "perl" and "php" format codes + * and shortcuts are defined by default. Additional codes and shortcuts can be + * added like: + * + * <pre class="code"> + * jsDate.formats["perl"] = { + * "codes": { + * matcher: /someregex/, + * Y: "fullYear", // name of "get" method without the "get", + * ..., // more codes + * }, + * "shortcuts": { + * F: '%Y-%m-%d', + * ..., // more shortcuts + * } + * }; + * </pre> + * + * <p>Additionally, ISO and SQL shortcuts are defined and can be accesses via: + * <code>jsDate.formats.ISO</code> and <code>jsDate.formats.SQL</code> + */ + + jsDate.formats = { + ISO:'%Y-%m-%dT%H:%M:%S.%N%G', + SQL:'%Y-%m-%d %H:%M:%S' + }; + + /** + * Perl format codes and shortcuts for strftime. + * + * A hash (object) of codes where each code must be an array where the first member is + * the name of a Date.prototype or jsDate.prototype function to call + * and optionally a second member indicating the number to pass to addZeros() + * + * <p>The following format codes are defined:</p> + * + * <pre class="code"> + * Code Result Description + * == Years == + * %Y 2008 Four-digit year + * %y 08 Two-digit year + * + * == Months == + * %m 09 Two-digit month + * %#m 9 One or two-digit month + * %B September Full month name + * %b Sep Abbreviated month name + * + * == Days == + * %d 05 Two-digit day of month + * %#d 5 One or two-digit day of month + * %e 5 One or two-digit day of month + * %A Sunday Full name of the day of the week + * %a Sun Abbreviated name of the day of the week + * %w 0 Number of the day of the week (0 = Sunday, 6 = Saturday) + * + * == Hours == + * %H 23 Hours in 24-hour format (two digits) + * %#H 3 Hours in 24-hour integer format (one or two digits) + * %I 11 Hours in 12-hour format (two digits) + * %#I 3 Hours in 12-hour integer format (one or two digits) + * %p PM AM or PM + * + * == Minutes == + * %M 09 Minutes (two digits) + * %#M 9 Minutes (one or two digits) + * + * == Seconds == + * %S 02 Seconds (two digits) + * %#S 2 Seconds (one or two digits) + * %s 1206567625723 Unix timestamp (Seconds past 1970-01-01 00:00:00) + * + * == Milliseconds == + * %N 008 Milliseconds (three digits) + * %#N 8 Milliseconds (one to three digits) + * + * == Timezone == + * %O 360 difference in minutes between local time and GMT + * %Z Mountain Standard Time Name of timezone as reported by browser + * %G 06:00 Hours and minutes between GMT + * + * == Shortcuts == + * %F 2008-03-26 %Y-%m-%d + * %T 05:06:30 %H:%M:%S + * %X 05:06:30 %H:%M:%S + * %x 03/26/08 %m/%d/%y + * %D 03/26/08 %m/%d/%y + * %#c Wed Mar 26 15:31:00 2008 %a %b %e %H:%M:%S %Y + * %v 3-Sep-2008 %e-%b-%Y + * %R 15:31 %H:%M + * %r 03:31:00 PM %I:%M:%S %p + * + * == Characters == + * %n \n Newline + * %t \t Tab + * %% % Percent Symbol + * </pre> + * + * <p>Formatting shortcuts that will be translated into their longer version. + * Be sure that format shortcuts do not refer to themselves: this will cause an infinite loop.</p> + * + * <p>Format codes and format shortcuts can be redefined after the jsDate + * module is imported.</p> + * + * <p>Note that if you redefine the whole hash (object), you must supply a "matcher" + * regex for the parser. The default matcher is:</p> + * + * <code>/()%(#?(%|[a-z]))/i</code> + * + * <p>which corresponds to the Perl syntax used by default.</p> + * + * <p>By customizing the matcher and format codes, nearly any strftime functionality is possible.</p> + */ + + jsDate.formats.perl = { + codes: { + // + // 2-part regex matcher for format codes + // + // first match must be the character before the code (to account for escaping) + // second match must be the format code character(s) + // + matcher: /()%(#?(%|[a-z]))/i, + // year + Y: 'FullYear', + y: 'ShortYear.2', + // month + m: 'MonthNumber.2', + '#m': 'MonthNumber', + B: 'MonthName', + b: 'AbbrMonthName', + // day + d: 'Date.2', + '#d': 'Date', + e: 'Date', + A: 'DayName', + a: 'AbbrDayName', + w: 'Day', + // hours + H: 'Hours.2', + '#H': 'Hours', + I: 'Hours12.2', + '#I': 'Hours12', + p: 'AMPM', + // minutes + M: 'Minutes.2', + '#M': 'Minutes', + // seconds + S: 'Seconds.2', + '#S': 'Seconds', + s: 'Unix', + // milliseconds + N: 'Milliseconds.3', + '#N': 'Milliseconds', + // timezone + O: 'TimezoneOffset', + Z: 'TimezoneName', + G: 'GmtOffset' + }, + + shortcuts: { + // date + F: '%Y-%m-%d', + // time + T: '%H:%M:%S', + X: '%H:%M:%S', + // local format date + x: '%m/%d/%y', + D: '%m/%d/%y', + // local format extended + '#c': '%a %b %e %H:%M:%S %Y', + // local format short + v: '%e-%b-%Y', + R: '%H:%M', + r: '%I:%M:%S %p', + // tab and newline + t: '\t', + n: '\n', + '%': '%' + } + }; + + /** + * PHP format codes and shortcuts for strftime. + * + * A hash (object) of codes where each code must be an array where the first member is + * the name of a Date.prototype or jsDate.prototype function to call + * and optionally a second member indicating the number to pass to addZeros() + * + * <p>The following format codes are defined:</p> + * + * <pre class="code"> + * Code Result Description + * === Days === + * %a Sun through Sat An abbreviated textual representation of the day + * %A Sunday - Saturday A full textual representation of the day + * %d 01 to 31 Two-digit day of the month (with leading zeros) + * %e 1 to 31 Day of the month, with a space preceding single digits. + * %j 001 to 366 Day of the year, 3 digits with leading zeros + * %u 1 - 7 (Mon - Sun) ISO-8601 numeric representation of the day of the week + * %w 0 - 6 (Sun - Sat) Numeric representation of the day of the week + * + * === Week === + * %U 13 Full Week number, starting with the first Sunday as the first week + * %V 01 through 53 ISO-8601:1988 week number, starting with the first week of the year + * with at least 4 weekdays, with Monday being the start of the week + * %W 46 A numeric representation of the week of the year, + * starting with the first Monday as the first week + * === Month === + * %b Jan through Dec Abbreviated month name, based on the locale + * %B January - December Full month name, based on the locale + * %h Jan through Dec Abbreviated month name, based on the locale (an alias of %b) + * %m 01 - 12 (Jan - Dec) Two digit representation of the month + * + * === Year === + * %C 19 Two digit century (year/100, truncated to an integer) + * %y 09 for 2009 Two digit year + * %Y 2038 Four digit year + * + * === Time === + * %H 00 through 23 Two digit representation of the hour in 24-hour format + * %I 01 through 12 Two digit representation of the hour in 12-hour format + * %l 1 through 12 Hour in 12-hour format, with a space preceeding single digits + * %M 00 through 59 Two digit representation of the minute + * %p AM/PM UPPER-CASE 'AM' or 'PM' based on the given time + * %P am/pm lower-case 'am' or 'pm' based on the given time + * %r 09:34:17 PM Same as %I:%M:%S %p + * %R 00:35 Same as %H:%M + * %S 00 through 59 Two digit representation of the second + * %T 21:34:17 Same as %H:%M:%S + * %X 03:59:16 Preferred time representation based on locale, without the date + * %z -0500 or EST Either the time zone offset from UTC or the abbreviation + * %Z -0500 or EST The time zone offset/abbreviation option NOT given by %z + * + * === Time and Date === + * %D 02/05/09 Same as %m/%d/%y + * %F 2009-02-05 Same as %Y-%m-%d (commonly used in database datestamps) + * %s 305815200 Unix Epoch Time timestamp (same as the time() function) + * %x 02/05/09 Preferred date representation, without the time + * + * === Miscellaneous === + * %n --- A newline character (\n) + * %t --- A Tab character (\t) + * %% --- A literal percentage character (%) + * </pre> + */ + + jsDate.formats.php = { + codes: { + // + // 2-part regex matcher for format codes + // + // first match must be the character before the code (to account for escaping) + // second match must be the format code character(s) + // + matcher: /()%((%|[a-z]))/i, + // day + a: 'AbbrDayName', + A: 'DayName', + d: 'Date.2', + e: 'Date', + j: 'DayOfYear.3', + u: 'DayOfWeek', + w: 'Day', + // week + U: 'FullWeekOfYear.2', + V: 'IsoWeek.2', + W: 'WeekOfYear.2', + // month + b: 'AbbrMonthName', + B: 'MonthName', + m: 'MonthNumber.2', + h: 'AbbrMonthName', + // year + C: 'Century.2', + y: 'ShortYear.2', + Y: 'FullYear', + // time + H: 'Hours.2', + I: 'Hours12.2', + l: 'Hours12', + p: 'AMPM', + P: 'AmPm', + M: 'Minutes.2', + S: 'Seconds.2', + s: 'Unix', + O: 'TimezoneOffset', + z: 'GmtOffset', + Z: 'TimezoneAbbr' + }, + + shortcuts: { + D: '%m/%d/%y', + F: '%Y-%m-%d', + T: '%H:%M:%S', + X: '%H:%M:%S', + x: '%m/%d/%y', + R: '%H:%M', + r: '%I:%M:%S %p', + t: '\t', + n: '\n', + '%': '%' + } + }; + // + // Conceptually, the logic implemented here is similar to Ken Snyder's Date Instance Methods. + // I use his idea of a set of parsers which can be regular expressions or functions, + // iterating through those, and then seeing if Date.parse() will create a date. + // The parser expressions and functions are a little different and some bugs have been + // worked out. Also, a lot of "pre-parsing" is done to fix implementation + // variations of Date.parse() between browsers. + // + jsDate.createDate = function(date) { + // if passing in multiple arguments, try Date constructor + if (date == null) { + return new Date(); + } + // If the passed value is already a date object, return it + if (date instanceof Date) { + return date; + } + // if (typeof date == 'number') return new Date(date * 1000); + // If the passed value is an integer, interpret it as a javascript timestamp + if (typeof date == 'number') { + return new Date(date); + } + + // Before passing strings into Date.parse(), have to normalize them for certain conditions. + // If strings are not formatted staccording to the EcmaScript spec, results from Date parse will be implementation dependent. + // + // For example: + // * FF and Opera assume 2 digit dates are pre y2k, Chome assumes <50 is pre y2k, 50+ is 21st century. + // * Chrome will correctly parse '1984-1-25' into localtime, FF and Opera will not parse. + // * Both FF, Chrome and Opera will parse '1984/1/25' into localtime. + + // remove leading and trailing spaces + var parsable = String(date).replace(/^\s*(.+)\s*$/g, '$1'); + + // replace dahses (-) with slashes (/) in dates like n[nnn]/n[n]/n[nnn] + parsable = parsable.replace(/^([0-9]{1,4})-([0-9]{1,2})-([0-9]{1,4})/, "$1/$2/$3"); + + ///////// + // Need to check for '15-Dec-09' also. + // FF will not parse, but Chrome will. + // Chrome will set date to 2009 as well. + ///////// + + // first check for 'dd-mmm-yyyy' or 'dd/mmm/yyyy' like '15-Dec-2010' + parsable = parsable.replace(/^(3[01]|[0-2]?\d)[-\/]([a-z]{3,})[-\/](\d{4})/i, "$1 $2 $3"); + + // Now check for 'dd-mmm-yy' or 'dd/mmm/yy' and normalize years to default century. + var match = parsable.match(/^(3[01]|[0-2]?\d)[-\/]([a-z]{3,})[-\/](\d{2})\D*/i); + if (match && match.length > 3) { + var m3 = parseFloat(match[3]); + var ny = jsDate.config.defaultCentury + m3; + ny = String(ny); + + // now replace 2 digit year with 4 digit year + parsable = parsable.replace(/^(3[01]|[0-2]?\d)[-\/]([a-z]{3,})[-\/](\d{2})\D*/i, match[1] +' '+ match[2] +' '+ ny); + + } + + // Check for '1/19/70 8:14PM' + // where starts with mm/dd/yy or yy/mm/dd and have something after + // Check if 1st postiion is greater than 31, assume it is year. + // Assme all 2 digit years are 1900's. + // Finally, change them into US style mm/dd/yyyy representations. + match = parsable.match(/^([0-9]{1,2})[-\/]([0-9]{1,2})[-\/]([0-9]{1,2})[^0-9]/); + + function h1(parsable, match) { + var m1 = parseFloat(match[1]); + var m2 = parseFloat(match[2]); + var m3 = parseFloat(match[3]); + var cent = jsDate.config.defaultCentury; + var ny, nd, nm, str; + + if (m1 > 31) { // first number is a year + nd = m3; + nm = m2; + ny = cent + m1; + } + + else { // last number is the year + nd = m2; + nm = m1; + ny = cent + m3; + } + + str = nm+'/'+nd+'/'+ny; + + // now replace 2 digit year with 4 digit year + return parsable.replace(/^([0-9]{1,2})[-\/]([0-9]{1,2})[-\/]([0-9]{1,2})/, str); + + } + + if (match && match.length > 3) { + parsable = h1(parsable, match); + } + + // Now check for '1/19/70' with nothing after and do as above + var match = parsable.match(/^([0-9]{1,2})[-\/]([0-9]{1,2})[-\/]([0-9]{1,2})$/); + + if (match && match.length > 3) { + parsable = h1(parsable, match); + } + + + var i = 0; + var length = jsDate.matchers.length; + var pattern, + ms, + current = parsable, + obj; + while (i < length) { + ms = Date.parse(current); + if (!isNaN(ms)) { + return new Date(ms); + } + pattern = jsDate.matchers[i]; + if (typeof pattern == 'function') { + obj = pattern.call(jsDate, current); + if (obj instanceof Date) { + return obj; + } + } else { + current = parsable.replace(pattern[0], pattern[1]); + } + i++; + } + return NaN; + }; + + + /** + * @static + * Handy static utility function to return the number of days in a given month. + * @param {Integer} year Year + * @param {Integer} month Month (1-12) + * @returns {Integer} Number of days in the month. + */ + // + // handy utility method Borrowed right from Ken Snyder's Date Instance Mehtods. + // + jsDate.daysInMonth = function(year, month) { + if (month == 2) { + return new Date(year, 1, 29).getDate() == 29 ? 29 : 28; + } + return [undefined,31,undefined,31,30,31,30,31,31,30,31,30,31][month]; + }; + + + // + // An Array of regular expressions or functions that will attempt to match the date string. + // Functions are called with scope of a jsDate instance. + // + jsDate.matchers = [ + // convert dd.mmm.yyyy to mm/dd/yyyy (world date to US date). + [/(3[01]|[0-2]\d)\s*\.\s*(1[0-2]|0\d)\s*\.\s*([1-9]\d{3})/, '$2/$1/$3'], + // convert yyyy-mm-dd to mm/dd/yyyy (ISO date to US date). + [/([1-9]\d{3})\s*-\s*(1[0-2]|0\d)\s*-\s*(3[01]|[0-2]\d)/, '$2/$3/$1'], + // Handle 12 hour or 24 hour time with milliseconds am/pm and optional date part. + function(str) { + var match = str.match(/^(?:(.+)\s+)?([012]?\d)(?:\s*\:\s*(\d\d))?(?:\s*\:\s*(\d\d(\.\d*)?))?\s*(am|pm)?\s*$/i); + // opt. date hour opt. minute opt. second opt. msec opt. am or pm + if (match) { + if (match[1]) { + var d = this.createDate(match[1]); + if (isNaN(d)) { + return; + } + } else { + var d = new Date(); + d.setMilliseconds(0); + } + var hour = parseFloat(match[2]); + if (match[6]) { + hour = match[6].toLowerCase() == 'am' ? (hour == 12 ? 0 : hour) : (hour == 12 ? 12 : hour + 12); + } + d.setHours(hour, parseInt(match[3] || 0, 10), parseInt(match[4] || 0, 10), ((parseFloat(match[5] || 0)) || 0)*1000); + return d; + } + else { + return str; + } + }, + // Handle ISO timestamp with time zone. + function(str) { + var match = str.match(/^(?:(.+))[T|\s+]([012]\d)(?:\:(\d\d))(?:\:(\d\d))(?:\.\d+)([\+\-]\d\d\:\d\d)$/i); + if (match) { + if (match[1]) { + var d = this.createDate(match[1]); + if (isNaN(d)) { + return; + } + } else { + var d = new Date(); + d.setMilliseconds(0); + } + var hour = parseFloat(match[2]); + d.setHours(hour, parseInt(match[3], 10), parseInt(match[4], 10), parseFloat(match[5])*1000); + return d; + } + else { + return str; + } + }, + // Try to match ambiguous strings like 12/8/22. + // Use FF date assumption that 2 digit years are 20th century (i.e. 1900's). + // This may be redundant with pre processing of date already performed. + function(str) { + var match = str.match(/^([0-3]?\d)\s*[-\/.\s]{1}\s*([a-zA-Z]{3,9})\s*[-\/.\s]{1}\s*([0-3]?\d)$/); + if (match) { + var d = new Date(); + var cent = jsDate.config.defaultCentury; + var m1 = parseFloat(match[1]); + var m3 = parseFloat(match[3]); + var ny, nd, nm; + if (m1 > 31) { // first number is a year + nd = m3; + ny = cent + m1; + } + + else { // last number is the year + nd = m1; + ny = cent + m3; + } + + var nm = inArray(match[2], jsDate.regional[jsDate.regional.getLocale()]["monthNamesShort"]); + + if (nm == -1) { + nm = inArray(match[2], jsDate.regional[jsDate.regional.getLocale()]["monthNames"]); + } + + d.setFullYear(ny, nm, nd); + d.setHours(0,0,0,0); + return d; + } + + else { + return str; + } + } + ]; + + // + // I think John Reisig published this method on his blog, ejohn. + // + function inArray( elem, array ) { + if ( array.indexOf ) { + return array.indexOf( elem ); + } + + for ( var i = 0, length = array.length; i < length; i++ ) { + if ( array[ i ] === elem ) { + return i; + } + } + + return -1; + } + + // + // Thanks to Kangax, Christian Sciberras and Stack Overflow for this method. + // + function get_type(thing){ + if(thing===null) return "[object Null]"; // special case + return Object.prototype.toString.call(thing); + } + + $.jsDate = jsDate; + + + /** + * JavaScript printf/sprintf functions. + * + * This code has been adapted from the publicly available sprintf methods + * by Ash Searle. His original header follows: + * + * This code is unrestricted: you are free to use it however you like. + * + * The functions should work as expected, performing left or right alignment, + * truncating strings, outputting numbers with a required precision etc. + * + * For complex cases, these functions follow the Perl implementations of + * (s)printf, allowing arguments to be passed out-of-order, and to set the + * precision or length of the output based on arguments instead of fixed + * numbers. + * + * See http://perldoc.perl.org/functions/sprintf.html for more information. + * + * Implemented: + * - zero and space-padding + * - right and left-alignment, + * - base X prefix (binary, octal and hex) + * - positive number prefix + * - (minimum) width + * - precision / truncation / maximum width + * - out of order arguments + * + * Not implemented (yet): + * - vector flag + * - size (bytes, words, long-words etc.) + * + * Will not implement: + * - %n or %p (no pass-by-reference in JavaScript) + * + * @version 2007.04.27 + * @author Ash Searle + * + * You can see the original work and comments on his blog: + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + */ + + /** + * @Modifications 2009.05.26 + * @author Chris Leonello + * + * Added %p %P specifier + * Acts like %g or %G but will not add more significant digits to the output than present in the input. + * Example: + * Format: '%.3p', Input: 0.012, Output: 0.012 + * Format: '%.3g', Input: 0.012, Output: 0.0120 + * Format: '%.4p', Input: 12.0, Output: 12.0 + * Format: '%.4g', Input: 12.0, Output: 12.00 + * Format: '%.4p', Input: 4.321e-5, Output: 4.321e-5 + * Format: '%.4g', Input: 4.321e-5, Output: 4.3210e-5 + * + * Example: + * >>> $.jqplot.sprintf('%.2f, %d', 23.3452, 43.23) + * "23.35, 43" + * >>> $.jqplot.sprintf("no value: %n, decimal with thousands separator: %'d", 23.3452, 433524) + * "no value: , decimal with thousands separator: 433,524" + */ + $.jqplot.sprintf = function() { + function pad(str, len, chr, leftJustify) { + var padding = (str.length >= len) ? '' : Array(1 + len - str.length >>> 0).join(chr); + return leftJustify ? str + padding : padding + str; + + } + + function thousand_separate(value) { + var value_str = new String(value); + for (var i=10; i>0; i--) { + if (value_str == (value_str = value_str.replace(/^(\d+)(\d{3})/, "$1"+$.jqplot.sprintf.thousandsSeparator+"$2"))) break; + } + return value_str; + } + + function justify(value, prefix, leftJustify, minWidth, zeroPad, htmlSpace) { + var diff = minWidth - value.length; + if (diff > 0) { + var spchar = ' '; + if (htmlSpace) { spchar = ' '; } + if (leftJustify || !zeroPad) { + value = pad(value, minWidth, spchar, leftJustify); + } else { + value = value.slice(0, prefix.length) + pad('', diff, '0', true) + value.slice(prefix.length); + } + } + return value; + } + + function formatBaseX(value, base, prefix, leftJustify, minWidth, precision, zeroPad, htmlSpace) { + // Note: casts negative numbers to positive ones + var number = value >>> 0; + prefix = prefix && number && {'2': '0b', '8': '0', '16': '0x'}[base] || ''; + value = prefix + pad(number.toString(base), precision || 0, '0', false); + return justify(value, prefix, leftJustify, minWidth, zeroPad, htmlSpace); + } + + function formatString(value, leftJustify, minWidth, precision, zeroPad, htmlSpace) { + if (precision != null) { + value = value.slice(0, precision); + } + return justify(value, '', leftJustify, minWidth, zeroPad, htmlSpace); + } + + var a = arguments, i = 0, format = a[i++]; + + return format.replace($.jqplot.sprintf.regex, function(substring, valueIndex, flags, minWidth, _, precision, type) { + if (substring == '%%') { return '%'; } + + // parse flags + var leftJustify = false, positivePrefix = '', zeroPad = false, prefixBaseX = false, htmlSpace = false, thousandSeparation = false; + for (var j = 0; flags && j < flags.length; j++) switch (flags.charAt(j)) { + case ' ': positivePrefix = ' '; break; + case '+': positivePrefix = '+'; break; + case '-': leftJustify = true; break; + case '0': zeroPad = true; break; + case '#': prefixBaseX = true; break; + case '&': htmlSpace = true; break; + case '\'': thousandSeparation = true; break; + } + + // parameters may be null, undefined, empty-string or real valued + // we want to ignore null, undefined and empty-string values + + if (!minWidth) { + minWidth = 0; + } + else if (minWidth == '*') { + minWidth = +a[i++]; + } + else if (minWidth.charAt(0) == '*') { + minWidth = +a[minWidth.slice(1, -1)]; + } + else { + minWidth = +minWidth; + } + + // Note: undocumented perl feature: + if (minWidth < 0) { + minWidth = -minWidth; + leftJustify = true; + } + + if (!isFinite(minWidth)) { + throw new Error('$.jqplot.sprintf: (minimum-)width must be finite'); + } + + if (!precision) { + precision = 'fFeE'.indexOf(type) > -1 ? 6 : (type == 'd') ? 0 : void(0); + } + else if (precision == '*') { + precision = +a[i++]; + } + else if (precision.charAt(0) == '*') { + precision = +a[precision.slice(1, -1)]; + } + else { + precision = +precision; + } + + // grab value using valueIndex if required? + var value = valueIndex ? a[valueIndex.slice(0, -1)] : a[i++]; + + switch (type) { + case 's': { + if (value == null) { + return ''; + } + return formatString(String(value), leftJustify, minWidth, precision, zeroPad, htmlSpace); + } + case 'c': return formatString(String.fromCharCode(+value), leftJustify, minWidth, precision, zeroPad, htmlSpace); + case 'b': return formatBaseX(value, 2, prefixBaseX, leftJustify, minWidth, precision, zeroPad,htmlSpace); + case 'o': return formatBaseX(value, 8, prefixBaseX, leftJustify, minWidth, precision, zeroPad, htmlSpace); + case 'x': return formatBaseX(value, 16, prefixBaseX, leftJustify, minWidth, precision, zeroPad, htmlSpace); + case 'X': return formatBaseX(value, 16, prefixBaseX, leftJustify, minWidth, precision, zeroPad, htmlSpace).toUpperCase(); + case 'u': return formatBaseX(value, 10, prefixBaseX, leftJustify, minWidth, precision, zeroPad, htmlSpace); + case 'i': { + var number = parseInt(+value, 10); + if (isNaN(number)) { + return ''; + } + var prefix = number < 0 ? '-' : positivePrefix; + var number_str = thousandSeparation ? thousand_separate(String(Math.abs(number))): String(Math.abs(number)); + value = prefix + pad(number_str, precision, '0', false); + //value = prefix + pad(String(Math.abs(number)), precision, '0', false); + return justify(value, prefix, leftJustify, minWidth, zeroPad, htmlSpace); + } + case 'd': { + var number = Math.round(+value); + if (isNaN(number)) { + return ''; + } + var prefix = number < 0 ? '-' : positivePrefix; + var number_str = thousandSeparation ? thousand_separate(String(Math.abs(number))): String(Math.abs(number)); + value = prefix + pad(number_str, precision, '0', false); + return justify(value, prefix, leftJustify, minWidth, zeroPad, htmlSpace); + } + case 'e': + case 'E': + case 'f': + case 'F': + case 'g': + case 'G': + { + var number = +value; + if (isNaN(number)) { + return ''; + } + var prefix = number < 0 ? '-' : positivePrefix; + var method = ['toExponential', 'toFixed', 'toPrecision']['efg'.indexOf(type.toLowerCase())]; + var textTransform = ['toString', 'toUpperCase']['eEfFgG'.indexOf(type) % 2]; + var number_str = Math.abs(number)[method](precision); + number_str = thousandSeparation ? thousand_separate(number_str): number_str; + value = prefix + number_str; + return justify(value, prefix, leftJustify, minWidth, zeroPad, htmlSpace)[textTransform](); + } + case 'p': + case 'P': + { + // make sure number is a number + var number = +value; + if (isNaN(number)) { + return ''; + } + var prefix = number < 0 ? '-' : positivePrefix; + + var parts = String(Number(Math.abs(number)).toExponential()).split(/e|E/); + var sd = (parts[0].indexOf('.') != -1) ? parts[0].length - 1 : parts[0].length; + var zeros = (parts[1] < 0) ? -parts[1] - 1 : 0; + + if (Math.abs(number) < 1) { + if (sd + zeros <= precision) { + value = prefix + Math.abs(number).toPrecision(sd); + } + else { + if (sd <= precision - 1) { + value = prefix + Math.abs(number).toExponential(sd-1); + } + else { + value = prefix + Math.abs(number).toExponential(precision-1); + } + } + } + else { + var prec = (sd <= precision) ? sd : precision; + value = prefix + Math.abs(number).toPrecision(prec); + } + var textTransform = ['toString', 'toUpperCase']['pP'.indexOf(type) % 2]; + return justify(value, prefix, leftJustify, minWidth, zeroPad, htmlSpace)[textTransform](); + } + case 'n': return ''; + default: return substring; + } + }); + }; + + $.jqplot.sprintf.thousandsSeparator = ','; + + $.jqplot.sprintf.regex = /%%|%(\d+\$)?([-+#0&\' ]*)(\*\d+\$|\*|\d+)?(\.(\*\d+\$|\*|\d+))?([nAscboxXuidfegpEGP])/g; + + $.jqplot.getSignificantFigures = function(number) { + var parts = String(Number(Math.abs(number)).toExponential()).split(/e|E/); + // total significant digits + var sd = (parts[0].indexOf('.') != -1) ? parts[0].length - 1 : parts[0].length; + var zeros = (parts[1] < 0) ? -parts[1] - 1 : 0; + // exponent + var expn = parseInt(parts[1], 10); + // digits to the left of the decimal place + var dleft = (expn + 1 > 0) ? expn + 1 : 0; + // digits to the right of the decimal place + var dright = (sd <= dleft) ? 0 : sd - expn - 1; + return {significantDigits: sd, digitsLeft: dleft, digitsRight: dright, zeros: zeros, exponent: expn} ; + }; + + $.jqplot.getPrecision = function(number) { + return $.jqplot.getSignificantFigures(number).digitsRight; + }; + +})(jQuery); + + + var backCompat = $.uiBackCompat !== false; + + $.jqplot.effects = { + effect: {} + }; + + // prefix used for storing data on .data() + var dataSpace = "jqplot.storage."; + + /******************************************************************************/ + /*********************************** EFFECTS **********************************/ + /******************************************************************************/ + + $.extend( $.jqplot.effects, { + version: "1.9pre", + + // Saves a set of properties in a data storage + save: function( element, set ) { + for( var i=0; i < set.length; i++ ) { + if ( set[ i ] !== null ) { + element.data( dataSpace + set[ i ], element[ 0 ].style[ set[ i ] ] ); + } + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function( element, set ) { + for( var i=0; i < set.length; i++ ) { + if ( set[ i ] !== null ) { + element.css( set[ i ], element.data( dataSpace + set[ i ] ) ); + } + } + }, + + setMode: function( el, mode ) { + if (mode === "toggle") { + mode = el.is( ":hidden" ) ? "show" : "hide"; + } + return mode; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function( element ) { + + // if the element is already wrapped, return it + if ( element.parent().is( ".ui-effects-wrapper" )) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + "float": element.css( "float" ) + }, + wrapper = $( "<div></div>" ) + .addClass( "ui-effects-wrapper" ) + .css({ + fontSize: "100%", + background: "transparent", + border: "none", + margin: 0, + padding: 0 + }), + // Store the size in case width/height are defined in % - Fixes #5245 + size = { + width: element.width(), + height: element.height() + }, + active = document.activeElement; + + element.wrap( wrapper ); + + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if ( element.css( "position" ) === "static" ) { + wrapper.css({ position: "relative" }); + element.css({ position: "relative" }); + } else { + $.extend( props, { + position: element.css( "position" ), + zIndex: element.css( "z-index" ) + }); + $.each([ "top", "left", "bottom", "right" ], function(i, pos) { + props[ pos ] = element.css( pos ); + if ( isNaN( parseInt( props[ pos ], 10 ) ) ) { + props[ pos ] = "auto"; + } + }); + element.css({ + position: "relative", + top: 0, + left: 0, + right: "auto", + bottom: "auto" + }); + } + element.css(size); + + return wrapper.css( props ).show(); + }, + + removeWrapper: function( element ) { + var active = document.activeElement; + + if ( element.parent().is( ".ui-effects-wrapper" ) ) { + element.parent().replaceWith( element ); + + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + } + + + return element; + } + }); + + // return an effect options object for the given parameters: + function _normalizeArguments( effect, options, speed, callback ) { + + // short path for passing an effect options object: + if ( $.isPlainObject( effect ) ) { + return effect; + } + + // convert to an object + effect = { effect: effect }; + + // catch (effect) + if ( options === undefined ) { + options = {}; + } + + // catch (effect, callback) + if ( $.isFunction( options ) ) { + callback = options; + speed = null; + options = {}; + } + + // catch (effect, speed, ?) + if ( $.type( options ) === "number" || $.fx.speeds[ options ]) { + callback = speed; + speed = options; + options = {}; + } + + // catch (effect, options, callback) + if ( $.isFunction( speed ) ) { + callback = speed; + speed = null; + } + + // add options to effect + if ( options ) { + $.extend( effect, options ); + } + + speed = speed || options.duration; + effect.duration = $.fx.off ? 0 : typeof speed === "number" + ? speed : speed in $.fx.speeds ? $.fx.speeds[ speed ] : $.fx.speeds._default; + + effect.complete = callback || options.complete; + + return effect; + } + + function standardSpeed( speed ) { + // valid standard speeds + if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { + return true; + } + + // invalid strings - treat as "normal" speed + if ( typeof speed === "string" && !$.jqplot.effects.effect[ speed ] ) { + // TODO: remove in 2.0 (#7115) + if ( backCompat && $.jqplot.effects[ speed ] ) { + return false; + } + return true; + } + + return false; + } + + $.fn.extend({ + jqplotEffect: function( effect, options, speed, callback ) { + var args = _normalizeArguments.apply( this, arguments ), + mode = args.mode, + queue = args.queue, + effectMethod = $.jqplot.effects.effect[ args.effect ], + + // DEPRECATED: remove in 2.0 (#7115) + oldEffectMethod = !effectMethod && backCompat && $.jqplot.effects[ args.effect ]; + + if ( $.fx.off || !( effectMethod || oldEffectMethod ) ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args.duration, args.complete ); + } else { + return this.each( function() { + if ( args.complete ) { + args.complete.call( this ); + } + }); + } + } + + function run( next ) { + var elem = $( this ), + complete = args.complete, + mode = args.mode; + + function done() { + if ( $.isFunction( complete ) ) { + complete.call( elem[0] ); + } + if ( $.isFunction( next ) ) { + next(); + } + } + + // if the element is hiddden and mode is hide, + // or element is visible and mode is show + if ( elem.is( ":hidden" ) ? mode === "hide" : mode === "show" ) { + done(); + } else { + effectMethod.call( elem[0], args, done ); + } + } + + // TODO: remove this check in 2.0, effectMethod will always be true + if ( effectMethod ) { + return queue === false ? this.each( run ) : this.queue( queue || "fx", run ); + } else { + // DEPRECATED: remove in 2.0 (#7115) + return oldEffectMethod.call(this, { + options: args, + duration: args.duration, + callback: args.complete, + mode: args.mode + }); + } + } + }); + + + + + var rvertical = /up|down|vertical/, + rpositivemotion = /up|left|vertical|horizontal/; + + $.jqplot.effects.effect.blind = function( o, done ) { + // Create element + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + mode = $.jqplot.effects.setMode( el, o.mode || "hide" ), + direction = o.direction || "up", + vertical = rvertical.test( direction ), + ref = vertical ? "height" : "width", + ref2 = vertical ? "top" : "left", + motion = rpositivemotion.test( direction ), + animation = {}, + show = mode === "show", + wrapper, distance, top; + + // // if already wrapped, the wrapper's properties are my property. #6245 + if ( el.parent().is( ".ui-effects-wrapper" ) ) { + $.jqplot.effects.save( el.parent(), props ); + } else { + $.jqplot.effects.save( el, props ); + } + el.show(); + top = parseInt(el.css('top'), 10); + wrapper = $.jqplot.effects.createWrapper( el ).css({ + overflow: "hidden" + }); + + distance = vertical ? wrapper[ ref ]() + top : wrapper[ ref ](); + + animation[ ref ] = show ? String(distance) : '0'; + if ( !motion ) { + el + .css( vertical ? "bottom" : "right", 0 ) + .css( vertical ? "top" : "left", "" ) + .css({ position: "absolute" }); + animation[ ref2 ] = show ? '0' : String(distance); + } + + // // start at 0 if we are showing + if ( show ) { + wrapper.css( ref, 0 ); + if ( ! motion ) { + wrapper.css( ref2, distance ); + } + } + + // // Animate + wrapper.animate( animation, { + duration: o.duration, + easing: o.easing, + queue: false, + complete: function() { + if ( mode === "hide" ) { + el.hide(); + } + $.jqplot.effects.restore( el, props ); + $.jqplot.effects.removeWrapper( el ); + done(); + } + }); + + }; + + diff --git a/www/protected/extensions/jqplot/jquery.jqplot.min.css b/www/protected/extensions/jqplot/jquery.jqplot.min.css new file mode 100644 index 0000000..de15fff --- /dev/null +++ b/www/protected/extensions/jqplot/jquery.jqplot.min.css @@ -0,0 +1 @@ +.jqplot-target{position:relative;color:#666;font-family:"Trebuchet MS",Arial,Helvetica,sans-serif;font-size:1em;}.jqplot-axis{font-size:.75em;}.jqplot-xaxis{margin-top:10px;}.jqplot-x2axis{margin-bottom:10px;}.jqplot-yaxis{margin-right:10px;}.jqplot-y2axis,.jqplot-y3axis,.jqplot-y4axis,.jqplot-y5axis,.jqplot-y6axis,.jqplot-y7axis,.jqplot-y8axis,.jqplot-y9axis,.jqplot-yMidAxis{margin-left:10px;margin-right:10px;}.jqplot-axis-tick,.jqplot-xaxis-tick,.jqplot-yaxis-tick,.jqplot-x2axis-tick,.jqplot-y2axis-tick,.jqplot-y3axis-tick,.jqplot-y4axis-tick,.jqplot-y5axis-tick,.jqplot-y6axis-tick,.jqplot-y7axis-tick,.jqplot-y8axis-tick,.jqplot-y9axis-tick,.jqplot-yMidAxis-tick{position:absolute;white-space:pre;}.jqplot-xaxis-tick{top:0;left:15px;vertical-align:top;}.jqplot-x2axis-tick{bottom:0;left:15px;vertical-align:bottom;}.jqplot-yaxis-tick{right:0;top:15px;text-align:right;}.jqplot-yaxis-tick.jqplot-breakTick{right:-20px;margin-right:0;padding:1px 5px 1px 5px;z-index:2;font-size:1.5em;}.jqplot-y2axis-tick,.jqplot-y3axis-tick,.jqplot-y4axis-tick,.jqplot-y5axis-tick,.jqplot-y6axis-tick,.jqplot-y7axis-tick,.jqplot-y8axis-tick,.jqplot-y9axis-tick{left:0;top:15px;text-align:left;}.jqplot-yMidAxis-tick{text-align:center;white-space:nowrap;}.jqplot-xaxis-label{margin-top:10px;font-size:11pt;position:absolute;}.jqplot-x2axis-label{margin-bottom:10px;font-size:11pt;position:absolute;}.jqplot-yaxis-label{margin-right:10px;font-size:11pt;position:absolute;}.jqplot-yMidAxis-label{font-size:11pt;position:absolute;}.jqplot-y2axis-label,.jqplot-y3axis-label,.jqplot-y4axis-label,.jqplot-y5axis-label,.jqplot-y6axis-label,.jqplot-y7axis-label,.jqplot-y8axis-label,.jqplot-y9axis-label{font-size:11pt;margin-left:10px;position:absolute;}.jqplot-meterGauge-tick{font-size:.75em;color:#999;}.jqplot-meterGauge-label{font-size:1em;color:#999;}table.jqplot-table-legend{margin-top:12px;margin-bottom:12px;margin-left:12px;margin-right:12px;}table.jqplot-table-legend,table.jqplot-cursor-legend{background-color:rgba(255,255,255,0.6);border:1px solid #ccc;position:absolute;font-size:.75em;}td.jqplot-table-legend{vertical-align:middle;}td.jqplot-seriesToggle:hover,td.jqplot-seriesToggle:active{cursor:pointer;}.jqplot-table-legend .jqplot-series-hidden{text-decoration:line-through;}div.jqplot-table-legend-swatch-outline{border:1px solid #ccc;padding:1px;}div.jqplot-table-legend-swatch{width:0;height:0;border-top-width:5px;border-bottom-width:5px;border-left-width:6px;border-right-width:6px;border-top-style:solid;border-bottom-style:solid;border-left-style:solid;border-right-style:solid;}.jqplot-title{top:0;left:0;padding-bottom:.5em;font-size:1.2em;}table.jqplot-cursor-tooltip{border:1px solid #ccc;font-size:.75em;}.jqplot-cursor-tooltip{border:1px solid #ccc;font-size:.75em;white-space:nowrap;background:rgba(208,208,208,0.5);padding:1px;}.jqplot-highlighter-tooltip,.jqplot-canvasOverlay-tooltip{border:1px solid #ccc;font-size:.75em;white-space:nowrap;background:rgba(208,208,208,0.5);padding:1px;}.jqplot-point-label{font-size:.75em;z-index:2;}td.jqplot-cursor-legend-swatch{vertical-align:middle;text-align:center;}div.jqplot-cursor-legend-swatch{width:1.2em;height:.7em;}.jqplot-error{text-align:center;}.jqplot-error-message{position:relative;top:46%;display:inline-block;}div.jqplot-bubble-label{font-size:.8em;padding-left:2px;padding-right:2px;color:rgb(20%,20%,20%);}div.jqplot-bubble-label.jqplot-bubble-label-highlight{background:rgba(90%,90%,90%,0.7);}div.jqplot-noData-container{text-align:center;background-color:rgba(96%,96%,96%,0.3);} \ No newline at end of file diff --git a/www/protected/extensions/jqplot/jquery.jqplot.min.js b/www/protected/extensions/jqplot/jquery.jqplot.min.js new file mode 100644 index 0000000..52b5750 --- /dev/null +++ b/www/protected/extensions/jqplot/jquery.jqplot.min.js @@ -0,0 +1,57 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + * included jsDate library by Chris Leonello: + * + * Copyright (c) 2010-2011 Chris Leonello + * + * jsDate is currently available for use in all personal or commercial projects + * under both the MIT and GPL version 2.0 licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * jsDate borrows many concepts and ideas from the Date Instance + * Methods by Ken Snyder along with some parts of Ken's actual code. + * + * Ken's origianl Date Instance Methods and copyright notice: + * + * Ken Snyder (ken d snyder at gmail dot com) + * 2008-09-10 + * version 2.0.2 (http://kendsnyder.com/sandbox/date/) + * Creative Commons Attribution License 3.0 (http://creativecommons.org/licenses/by/3.0/) + * + * jqplotToImage function based on Larry Siden's export-jqplot-to-png.js. + * Larry has generously given permission to adapt his code for inclusion + * into jqPlot. + * + * Larry's original code can be found here: + * + * https://github.com/lsiden/export-jqplot-to-png + * + * + */ +(function(H){var r;H.fn.emptyForce=function(){for(var ab=0,ac;(ac=H(this)[ab])!=null;ab++){if(ac.nodeType===1){jQuery.cleanData(ac.getElementsByTagName("*"))}if(H.jqplot_use_excanvas){ac.outerHTML=""}else{while(ac.firstChild){ac.removeChild(ac.firstChild)}}ac=null}return H(this)};H.fn.removeChildForce=function(ab){while(ab.firstChild){this.removeChildForce(ab.firstChild);ab.removeChild(ab.firstChild)}};H.jqplot=function(ah,ae,ac){var ad,ab;if(ac==null){if(jQuery.isArray(ae)){ad=ae;ab=null}else{if(typeof(ae)==="object"){ad=null;ab=ae}}}else{ad=ae;ab=ac}var ag=new N();H("#"+ah).removeClass("jqplot-error");if(H.jqplot.config.catchErrors){try{ag.init(ah,ad,ab);ag.draw();ag.themeEngine.init.call(ag);return ag}catch(af){var ai=H.jqplot.config.errorMessage||af.message;H("#"+ah).append('<div class="jqplot-error-message">'+ai+"</div>");H("#"+ah).addClass("jqplot-error");document.getElementById(ah).style.background=H.jqplot.config.errorBackground;document.getElementById(ah).style.border=H.jqplot.config.errorBorder;document.getElementById(ah).style.fontFamily=H.jqplot.config.errorFontFamily;document.getElementById(ah).style.fontSize=H.jqplot.config.errorFontSize;document.getElementById(ah).style.fontStyle=H.jqplot.config.errorFontStyle;document.getElementById(ah).style.fontWeight=H.jqplot.config.errorFontWeight}}else{ag.init(ah,ad,ab);ag.draw();ag.themeEngine.init.call(ag);return ag}};H.jqplot.version="1.0.0b2_r1012";H.jqplot.CanvasManager=function(){if(typeof H.jqplot.CanvasManager.canvases=="undefined"){H.jqplot.CanvasManager.canvases=[];H.jqplot.CanvasManager.free=[]}var ab=[];this.getCanvas=function(){var ae;var ad=true;if(!H.jqplot.use_excanvas){for(var af=0,ac=H.jqplot.CanvasManager.canvases.length;af<ac;af++){if(H.jqplot.CanvasManager.free[af]===true){ad=false;ae=H.jqplot.CanvasManager.canvases[af];H.jqplot.CanvasManager.free[af]=false;ab.push(af);break}}}if(ad){ae=document.createElement("canvas");ab.push(H.jqplot.CanvasManager.canvases.length);H.jqplot.CanvasManager.canvases.push(ae);H.jqplot.CanvasManager.free.push(false)}return ae};this.initCanvas=function(ac){if(H.jqplot.use_excanvas){return window.G_vmlCanvasManager.initElement(ac)}return ac};this.freeAllCanvases=function(){for(var ad=0,ac=ab.length;ad<ac;ad++){this.freeCanvas(ab[ad])}ab=[]};this.freeCanvas=function(ac){if(H.jqplot.use_excanvas&&window.G_vmlCanvasManager.uninitElement!==r){window.G_vmlCanvasManager.uninitElement(H.jqplot.CanvasManager.canvases[ac]);H.jqplot.CanvasManager.canvases[ac]=null}else{var ad=H.jqplot.CanvasManager.canvases[ac];ad.getContext("2d").clearRect(0,0,ad.width,ad.height);H(ad).unbind().removeAttr("class").removeAttr("style");H(ad).css({left:"",top:"",position:""});ad.width=0;ad.height=0;H.jqplot.CanvasManager.free[ac]=true}}};H.jqplot.log=function(){if(window.console){window.console.log.apply(window.console,arguments)}};H.jqplot.config={addDomReference:false,enablePlugins:false,defaultHeight:300,defaultWidth:400,UTCAdjust:false,timezoneOffset:new Date(new Date().getTimezoneOffset()*60000),errorMessage:"",errorBackground:"",errorBorder:"",errorFontFamily:"",errorFontSize:"",errorFontStyle:"",errorFontWeight:"",catchErrors:false,defaultTickFormatString:"%.1f",defaultColors:["#4bb2c5","#EAA228","#c5b47f","#579575","#839557","#958c12","#953579","#4b5de4","#d8b83f","#ff5800","#0085cc","#c747a3","#cddf54","#FBD178","#26B4E3","#bd70c7"],defaultNegativeColors:["#498991","#C08840","#9F9274","#546D61","#646C4A","#6F6621","#6E3F5F","#4F64B0","#A89050","#C45923","#187399","#945381","#959E5C","#C7AF7B","#478396","#907294"],dashLength:4,gapLength:4,dotGapLength:2.5,srcLocation:"jqplot/src/",pluginLocation:"jqplot/src/plugins/"};H.jqplot.arrayMax=function(ab){return Math.max.apply(Math,ab)};H.jqplot.arrayMin=function(ab){return Math.min.apply(Math,ab)};H.jqplot.enablePlugins=H.jqplot.config.enablePlugins;H.jqplot.support_canvas=function(){if(typeof H.jqplot.support_canvas.result=="undefined"){H.jqplot.support_canvas.result=!!document.createElement("canvas").getContext}return H.jqplot.support_canvas.result};H.jqplot.support_canvas_text=function(){if(typeof H.jqplot.support_canvas_text.result=="undefined"){if(window.G_vmlCanvasManager!==r&&window.G_vmlCanvasManager._version>887){H.jqplot.support_canvas_text.result=true}else{H.jqplot.support_canvas_text.result=!!(document.createElement("canvas").getContext&&typeof document.createElement("canvas").getContext("2d").fillText=="function")}}return H.jqplot.support_canvas_text.result};H.jqplot.use_excanvas=(H.browser.msie&&!H.jqplot.support_canvas())?true:false;H.jqplot.preInitHooks=[];H.jqplot.postInitHooks=[];H.jqplot.preParseOptionsHooks=[];H.jqplot.postParseOptionsHooks=[];H.jqplot.preDrawHooks=[];H.jqplot.postDrawHooks=[];H.jqplot.preDrawSeriesHooks=[];H.jqplot.postDrawSeriesHooks=[];H.jqplot.preDrawLegendHooks=[];H.jqplot.addLegendRowHooks=[];H.jqplot.preSeriesInitHooks=[];H.jqplot.postSeriesInitHooks=[];H.jqplot.preParseSeriesOptionsHooks=[];H.jqplot.postParseSeriesOptionsHooks=[];H.jqplot.eventListenerHooks=[];H.jqplot.preDrawSeriesShadowHooks=[];H.jqplot.postDrawSeriesShadowHooks=[];H.jqplot.ElemContainer=function(){this._elem;this._plotWidth;this._plotHeight;this._plotDimensions={height:null,width:null}};H.jqplot.ElemContainer.prototype.createElement=function(ae,ag,ac,ad,ah){this._offsets=ag;var ab=ac||"jqplot";var af=document.createElement(ae);this._elem=H(af);this._elem.addClass(ab);this._elem.css(ad);this._elem.attr(ah);af=null;return this._elem};H.jqplot.ElemContainer.prototype.getWidth=function(){if(this._elem){return this._elem.outerWidth(true)}else{return null}};H.jqplot.ElemContainer.prototype.getHeight=function(){if(this._elem){return this._elem.outerHeight(true)}else{return null}};H.jqplot.ElemContainer.prototype.getPosition=function(){if(this._elem){return this._elem.position()}else{return{top:null,left:null,bottom:null,right:null}}};H.jqplot.ElemContainer.prototype.getTop=function(){return this.getPosition().top};H.jqplot.ElemContainer.prototype.getLeft=function(){return this.getPosition().left};H.jqplot.ElemContainer.prototype.getBottom=function(){return this._elem.css("bottom")};H.jqplot.ElemContainer.prototype.getRight=function(){return this._elem.css("right")};function s(ab){H.jqplot.ElemContainer.call(this);this.name=ab;this._series=[];this.show=false;this.tickRenderer=H.jqplot.AxisTickRenderer;this.tickOptions={};this.labelRenderer=H.jqplot.AxisLabelRenderer;this.labelOptions={};this.label=null;this.showLabel=true;this.min=null;this.max=null;this.autoscale=false;this.pad=1.2;this.padMax=null;this.padMin=null;this.ticks=[];this.numberTicks;this.tickInterval;this.renderer=H.jqplot.LinearAxisRenderer;this.rendererOptions={};this.showTicks=true;this.showTickMarks=true;this.showMinorTicks=true;this.drawMajorGridlines=true;this.drawMinorGridlines=false;this.drawMajorTickMarks=true;this.drawMinorTickMarks=true;this.useSeriesColor=false;this.borderWidth=null;this.borderColor=null;this._dataBounds={min:null,max:null};this._intervalStats=[];this._offsets={min:null,max:null};this._ticks=[];this._label=null;this.syncTicks=null;this.tickSpacing=75;this._min=null;this._max=null;this._tickInterval=null;this._numberTicks=null;this.__ticks=null;this._options={}}s.prototype=new H.jqplot.ElemContainer();s.prototype.constructor=s;s.prototype.init=function(){this.renderer=new this.renderer();this.tickOptions.axis=this.name;if(this.tickOptions.showMark==null){this.tickOptions.showMark=this.showTicks}if(this.tickOptions.showMark==null){this.tickOptions.showMark=this.showTickMarks}if(this.tickOptions.showLabel==null){this.tickOptions.showLabel=this.showTicks}if(this.label==null||this.label==""){this.showLabel=false}else{this.labelOptions.label=this.label}if(this.showLabel==false){this.labelOptions.show=false}if(this.pad==0){this.pad=1}if(this.padMax==0){this.padMax=1}if(this.padMin==0){this.padMin=1}if(this.padMax==null){this.padMax=(this.pad-1)/2+1}if(this.padMin==null){this.padMin=(this.pad-1)/2+1}this.pad=this.padMax+this.padMin-1;if(this.min!=null||this.max!=null){this.autoscale=false}if(this.syncTicks==null&&this.name.indexOf("y")>-1){this.syncTicks=true}else{if(this.syncTicks==null){this.syncTicks=false}}this.renderer.init.call(this,this.rendererOptions)};s.prototype.draw=function(ab,ac){if(this.__ticks){this.__ticks=null}return this.renderer.draw.call(this,ab,ac)};s.prototype.set=function(){this.renderer.set.call(this)};s.prototype.pack=function(ac,ab){if(this.show){this.renderer.pack.call(this,ac,ab)}if(this._min==null){this._min=this.min;this._max=this.max;this._tickInterval=this.tickInterval;this._numberTicks=this.numberTicks;this.__ticks=this._ticks}};s.prototype.reset=function(){this.renderer.reset.call(this)};s.prototype.resetScale=function(ab){H.extend(true,this,{min:null,max:null,numberTicks:null,tickInterval:null,_ticks:[],ticks:[]},ab);this.resetDataBounds()};s.prototype.resetDataBounds=function(){var ai=this._dataBounds;ai.min=null;ai.max=null;var ac,aj,ag;var ad=(this.show)?true:false;for(var af=0;af<this._series.length;af++){aj=this._series[af];if(aj.show){ag=aj._plotData;if(aj._type==="line"&&aj.renderer.bands.show&&this.name.charAt(0)!=="x"){ag=[[0,aj.renderer.bands._min],[1,aj.renderer.bands._max]]}var ab=1,ah=1;if(aj._type!=null&&aj._type=="ohlc"){ab=3;ah=2}for(var ae=0,ac=ag.length;ae<ac;ae++){if(this.name=="xaxis"||this.name=="x2axis"){if((ag[ae][0]!=null&&ag[ae][0]<ai.min)||ai.min==null){ai.min=ag[ae][0]}if((ag[ae][0]!=null&&ag[ae][0]>ai.max)||ai.max==null){ai.max=ag[ae][0]}}else{if((ag[ae][ab]!=null&&ag[ae][ab]<ai.min)||ai.min==null){ai.min=ag[ae][ab]}if((ag[ae][ah]!=null&&ag[ae][ah]>ai.max)||ai.max==null){ai.max=ag[ae][ah]}}}if(ad&&aj.renderer.constructor!==H.jqplot.BarRenderer){ad=false}else{if(ad&&this._options.hasOwnProperty("forceTickAt0")&&this._options.forceTickAt0==false){ad=false}else{if(ad&&aj.renderer.constructor===H.jqplot.BarRenderer){if(aj.barDirection=="vertical"&&this.name!="xaxis"&&this.name!="x2axis"){if(this._options.pad!=null||this._options.padMin!=null){ad=false}}else{if(aj.barDirection=="horizontal"&&(this.name=="xaxis"||this.name=="x2axis")){if(this._options.pad!=null||this._options.padMin!=null){ad=false}}}}}}}}if(ad&&this.renderer.constructor===H.jqplot.LinearAxisRenderer&&ai.min>=0){this.padMin=1;this.forceTickAt0=true}};function n(ab){H.jqplot.ElemContainer.call(this);this.show=false;this.location="ne";this.labels=[];this.showLabels=true;this.showSwatches=true;this.placement="insideGrid";this.xoffset=0;this.yoffset=0;this.border;this.background;this.textColor;this.fontFamily;this.fontSize;this.rowSpacing="0.5em";this.renderer=H.jqplot.TableLegendRenderer;this.rendererOptions={};this.preDraw=false;this.marginTop=null;this.marginRight=null;this.marginBottom=null;this.marginLeft=null;this.escapeHtml=false;this._series=[];H.extend(true,this,ab)}n.prototype=new H.jqplot.ElemContainer();n.prototype.constructor=n;n.prototype.setOptions=function(ab){H.extend(true,this,ab);if(this.placement=="inside"){this.placement="insideGrid"}if(this.xoffset>0){if(this.placement=="insideGrid"){switch(this.location){case"nw":case"w":case"sw":if(this.marginLeft==null){this.marginLeft=this.xoffset+"px"}this.marginRight="0px";break;case"ne":case"e":case"se":default:if(this.marginRight==null){this.marginRight=this.xoffset+"px"}this.marginLeft="0px";break}}else{if(this.placement=="outside"){switch(this.location){case"nw":case"w":case"sw":if(this.marginRight==null){this.marginRight=this.xoffset+"px"}this.marginLeft="0px";break;case"ne":case"e":case"se":default:if(this.marginLeft==null){this.marginLeft=this.xoffset+"px"}this.marginRight="0px";break}}}this.xoffset=0}if(this.yoffset>0){if(this.placement=="outside"){switch(this.location){case"sw":case"s":case"se":if(this.marginTop==null){this.marginTop=this.yoffset+"px"}this.marginBottom="0px";break;case"ne":case"n":case"nw":default:if(this.marginBottom==null){this.marginBottom=this.yoffset+"px"}this.marginTop="0px";break}}else{if(this.placement=="insideGrid"){switch(this.location){case"sw":case"s":case"se":if(this.marginBottom==null){this.marginBottom=this.yoffset+"px"}this.marginTop="0px";break;case"ne":case"n":case"nw":default:if(this.marginTop==null){this.marginTop=this.yoffset+"px"}this.marginBottom="0px";break}}}this.yoffset=0}};n.prototype.init=function(){this.renderer=new this.renderer();this.renderer.init.call(this,this.rendererOptions)};n.prototype.draw=function(ac){for(var ab=0;ab<H.jqplot.preDrawLegendHooks.length;ab++){H.jqplot.preDrawLegendHooks[ab].call(this,ac)}return this.renderer.draw.call(this,ac)};n.prototype.pack=function(ab){this.renderer.pack.call(this,ab)};function u(ab){H.jqplot.ElemContainer.call(this);this.text=ab;this.show=true;this.fontFamily;this.fontSize;this.textAlign;this.textColor;this.renderer=H.jqplot.DivTitleRenderer;this.rendererOptions={};this.escapeHtml=false}u.prototype=new H.jqplot.ElemContainer();u.prototype.constructor=u;u.prototype.init=function(){this.renderer=new this.renderer();this.renderer.init.call(this,this.rendererOptions)};u.prototype.draw=function(ab){return this.renderer.draw.call(this,ab)};u.prototype.pack=function(){this.renderer.pack.call(this)};function O(){H.jqplot.ElemContainer.call(this);this.show=true;this.xaxis="xaxis";this._xaxis;this.yaxis="yaxis";this._yaxis;this.gridBorderWidth=2;this.renderer=H.jqplot.LineRenderer;this.rendererOptions={};this.data=[];this.gridData=[];this.label="";this.showLabel=true;this.color;this.negativeColor;this.lineWidth=2.5;this.lineJoin="round";this.lineCap="round";this.linePattern="solid";this.shadow=true;this.shadowAngle=45;this.shadowOffset=1.25;this.shadowDepth=3;this.shadowAlpha="0.1";this.breakOnNull=false;this.markerRenderer=H.jqplot.MarkerRenderer;this.markerOptions={};this.showLine=true;this.showMarker=true;this.index;this.fill=false;this.fillColor;this.fillAlpha;this.fillAndStroke=false;this.disableStack=false;this._stack=false;this.neighborThreshold=4;this.fillToZero=false;this.fillToValue=0;this.fillAxis="y";this.useNegativeColors=true;this._stackData=[];this._plotData=[];this._plotValues={x:[],y:[]};this._intervals={x:{},y:{}};this._prevPlotData=[];this._prevGridData=[];this._stackAxis="y";this._primaryAxis="_xaxis";this.canvas=new H.jqplot.GenericCanvas();this.shadowCanvas=new H.jqplot.GenericCanvas();this.plugins={};this._sumy=0;this._sumx=0;this._type=""}O.prototype=new H.jqplot.ElemContainer();O.prototype.constructor=O;O.prototype.init=function(ad,ah,af){this.index=ad;this.gridBorderWidth=ah;var ag=this.data;var ac=[],ae;for(ae=0;ae<ag.length;ae++){if(!this.breakOnNull){if(ag[ae]==null||ag[ae][0]==null||ag[ae][1]==null){continue}else{ac.push(ag[ae])}}else{ac.push(ag[ae])}}this.data=ac;if(!this.color&&this.show){this.color=af.colorGenerator.get(this.index)}if(!this.negativeColor&&this.show){this.negativeColor=af.negativeColorGenerator.get(this.index)}if(!this.fillColor){this.fillColor=this.color}if(this.fillAlpha){var ab=H.jqplot.normalize2rgb(this.fillColor);var ab=H.jqplot.getColorComponents(ab);this.fillColor="rgba("+ab[0]+","+ab[1]+","+ab[2]+","+this.fillAlpha+")"}this.renderer=new this.renderer();this.renderer.init.call(this,this.rendererOptions,af);this.markerRenderer=new this.markerRenderer();if(!this.markerOptions.color){this.markerOptions.color=this.color}if(this.markerOptions.show==null){this.markerOptions.show=this.showMarker}this.showMarker=this.markerOptions.show;this.markerRenderer.init(this.markerOptions)};O.prototype.draw=function(ah,ae,ag){var ac=(ae==r)?{}:ae;ah=(ah==r)?this.canvas._ctx:ah;var ab,af,ad;for(ab=0;ab<H.jqplot.preDrawSeriesHooks.length;ab++){H.jqplot.preDrawSeriesHooks[ab].call(this,ah,ac)}if(this.show){this.renderer.setGridData.call(this,ag);if(!ac.preventJqPlotSeriesDrawTrigger){H(ah.canvas).trigger("jqplotSeriesDraw",[this.data,this.gridData])}af=[];if(ac.data){af=ac.data}else{if(!this._stack){af=this.data}else{af=this._plotData}}ad=ac.gridData||this.renderer.makeGridData.call(this,af,ag);if(this._type==="line"&&this.renderer.smooth&&this.renderer._smoothedData.length){ad=this.renderer._smoothedData}this.renderer.draw.call(this,ah,ad,ac,ag)}for(ab=0;ab<H.jqplot.postDrawSeriesHooks.length;ab++){H.jqplot.postDrawSeriesHooks[ab].call(this,ah,ac,ag)}ah=ae=ag=ab=af=ad=null};O.prototype.drawShadow=function(ah,ae,ag){var ac=(ae==r)?{}:ae;ah=(ah==r)?this.shadowCanvas._ctx:ah;var ab,af,ad;for(ab=0;ab<H.jqplot.preDrawSeriesShadowHooks.length;ab++){H.jqplot.preDrawSeriesShadowHooks[ab].call(this,ah,ac)}if(this.shadow){this.renderer.setGridData.call(this,ag);af=[];if(ac.data){af=ac.data}else{if(!this._stack){af=this.data}else{af=this._plotData}}ad=ac.gridData||this.renderer.makeGridData.call(this,af,ag);this.renderer.drawShadow.call(this,ah,ad,ac)}for(ab=0;ab<H.jqplot.postDrawSeriesShadowHooks.length;ab++){H.jqplot.postDrawSeriesShadowHooks[ab].call(this,ah,ac)}ah=ae=ag=ab=af=ad=null};O.prototype.toggleDisplay=function(ac){var ab,ad;if(ac.data.series){ab=ac.data.series}else{ab=this}if(ac.data.speed){ad=ac.data.speed}if(ad){if(ab.canvas._elem.is(":hidden")){ab.canvas._elem.removeClass("jqplot-series-hidden");if(ab.shadowCanvas._elem){ab.shadowCanvas._elem.fadeIn(ad)}ab.canvas._elem.fadeIn(ad);ab.canvas._elem.nextAll(".jqplot-point-label.jqplot-series-"+ab.index).fadeIn(ad)}else{ab.canvas._elem.addClass("jqplot-series-hidden");if(ab.shadowCanvas._elem){ab.shadowCanvas._elem.fadeOut(ad)}ab.canvas._elem.fadeOut(ad);ab.canvas._elem.nextAll(".jqplot-point-label.jqplot-series-"+ab.index).fadeOut(ad)}}else{if(ab.canvas._elem.is(":hidden")){ab.canvas._elem.removeClass("jqplot-series-hidden");if(ab.shadowCanvas._elem){ab.shadowCanvas._elem.show()}ab.canvas._elem.show();ab.canvas._elem.nextAll(".jqplot-point-label.jqplot-series-"+ab.index).show()}else{ab.canvas._elem.addClass("jqplot-series-hidden");if(ab.shadowCanvas._elem){ab.shadowCanvas._elem.hide()}ab.canvas._elem.hide();ab.canvas._elem.nextAll(".jqplot-point-label.jqplot-series-"+ab.index).hide()}}};function I(){H.jqplot.ElemContainer.call(this);this.drawGridlines=true;this.gridLineColor="#cccccc";this.gridLineWidth=1;this.background="#fffdf6";this.borderColor="#999999";this.borderWidth=2;this.drawBorder=true;this.shadow=true;this.shadowAngle=45;this.shadowOffset=1.5;this.shadowWidth=3;this.shadowDepth=3;this.shadowColor=null;this.shadowAlpha="0.07";this._left;this._top;this._right;this._bottom;this._width;this._height;this._axes=[];this.renderer=H.jqplot.CanvasGridRenderer;this.rendererOptions={};this._offsets={top:null,bottom:null,left:null,right:null}}I.prototype=new H.jqplot.ElemContainer();I.prototype.constructor=I;I.prototype.init=function(){this.renderer=new this.renderer();this.renderer.init.call(this,this.rendererOptions)};I.prototype.createElement=function(ab,ac){this._offsets=ab;return this.renderer.createElement.call(this,ac)};I.prototype.draw=function(){this.renderer.draw.call(this)};H.jqplot.GenericCanvas=function(){H.jqplot.ElemContainer.call(this);this._ctx};H.jqplot.GenericCanvas.prototype=new H.jqplot.ElemContainer();H.jqplot.GenericCanvas.prototype.constructor=H.jqplot.GenericCanvas;H.jqplot.GenericCanvas.prototype.createElement=function(af,ad,ac,ag){this._offsets=af;var ab="jqplot";if(ad!=r){ab=ad}var ae;ae=ag.canvasManager.getCanvas();if(ac!=null){this._plotDimensions=ac}ae.width=this._plotDimensions.width-this._offsets.left-this._offsets.right;ae.height=this._plotDimensions.height-this._offsets.top-this._offsets.bottom;this._elem=H(ae);this._elem.css({position:"absolute",left:this._offsets.left,top:this._offsets.top});this._elem.addClass(ab);ae=ag.canvasManager.initCanvas(ae);ae=null;return this._elem};H.jqplot.GenericCanvas.prototype.setContext=function(){this._ctx=this._elem.get(0).getContext("2d");return this._ctx};H.jqplot.GenericCanvas.prototype.resetCanvas=function(){if(this._elem){if(H.jqplot.use_excanvas&&window.G_vmlCanvasManager.uninitElement!==r){window.G_vmlCanvasManager.uninitElement(this._elem.get(0))}this._elem.emptyForce()}this._ctx=null};H.jqplot.HooksManager=function(){this.hooks=[];this.args=[]};H.jqplot.HooksManager.prototype.addOnce=function(ae,ac){ac=ac||[];var af=false;for(var ad=0,ab=this.hooks.length;ad<ab;ad++){if(this.hooks[ad][0]==ae){af=true}}if(!af){this.hooks.push(ae);this.args.push(ac)}};H.jqplot.HooksManager.prototype.add=function(ac,ab){ab=ab||[];this.hooks.push(ac);this.args.push(ab)};H.jqplot.EventListenerManager=function(){this.hooks=[]};H.jqplot.EventListenerManager.prototype.addOnce=function(af,ae){var ag=false,ad,ac;for(var ac=0,ab=this.hooks.length;ac<ab;ac++){ad=this.hooks[ac];if(ad[0]==af&&ad[1]==ae){ag=true}}if(!ag){this.hooks.push([af,ae])}};H.jqplot.EventListenerManager.prototype.add=function(ac,ab){this.hooks.push([ac,ab])};var Q=["yMidAxis","xaxis","yaxis","x2axis","y2axis","y3axis","y4axis","y5axis","y6axis","y7axis","y8axis","y9axis"];function N(){this.animate=false;this.animateReplot=false;this.axes={xaxis:new s("xaxis"),yaxis:new s("yaxis"),x2axis:new s("x2axis"),y2axis:new s("y2axis"),y3axis:new s("y3axis"),y4axis:new s("y4axis"),y5axis:new s("y5axis"),y6axis:new s("y6axis"),y7axis:new s("y7axis"),y8axis:new s("y8axis"),y9axis:new s("y9axis"),yMidAxis:new s("yMidAxis")};this.baseCanvas=new H.jqplot.GenericCanvas();this.captureRightClick=false;this.data=[];this.dataRenderer;this.dataRendererOptions;this.defaults={axesDefaults:{},axes:{xaxis:{},yaxis:{},x2axis:{},y2axis:{},y3axis:{},y4axis:{},y5axis:{},y6axis:{},y7axis:{},y8axis:{},y9axis:{},yMidAxis:{}},seriesDefaults:{},series:[]};this.defaultAxisStart=1;this.drawIfHidden=false;this.eventCanvas=new H.jqplot.GenericCanvas();this.fillBetween={series1:null,series2:null,color:null,baseSeries:0,fill:true};this.fontFamily;this.fontSize;this.grid=new I();this.legend=new n();this.negativeSeriesColors=H.jqplot.config.defaultNegativeColors;this.noDataIndicator={show:false,indicator:"Loading Data...",axes:{xaxis:{min:0,max:10,tickInterval:2,show:true},yaxis:{min:0,max:12,tickInterval:3,show:true}}};this.options={};this.previousSeriesStack=[];this.plugins={};this.series=[];this.seriesStack=[];this.seriesColors=H.jqplot.config.defaultColors;this.sortData=true;this.stackSeries=false;this.syncXTicks=true;this.syncYTicks=true;this.target=null;this.targetId=null;this.textColor;this.title=new u();this._drawCount=0;this._sumy=0;this._sumx=0;this._stackData=[];this._plotData=[];this._width=null;this._height=null;this._plotDimensions={height:null,width:null};this._gridPadding={top:null,right:null,bottom:null,left:null};this._defaultGridPadding={top:10,right:10,bottom:23,left:10};this._addDomReference=H.jqplot.config.addDomReference;this.preInitHooks=new H.jqplot.HooksManager();this.postInitHooks=new H.jqplot.HooksManager();this.preParseOptionsHooks=new H.jqplot.HooksManager();this.postParseOptionsHooks=new H.jqplot.HooksManager();this.preDrawHooks=new H.jqplot.HooksManager();this.postDrawHooks=new H.jqplot.HooksManager();this.preDrawSeriesHooks=new H.jqplot.HooksManager();this.postDrawSeriesHooks=new H.jqplot.HooksManager();this.preDrawLegendHooks=new H.jqplot.HooksManager();this.addLegendRowHooks=new H.jqplot.HooksManager();this.preSeriesInitHooks=new H.jqplot.HooksManager();this.postSeriesInitHooks=new H.jqplot.HooksManager();this.preParseSeriesOptionsHooks=new H.jqplot.HooksManager();this.postParseSeriesOptionsHooks=new H.jqplot.HooksManager();this.eventListenerHooks=new H.jqplot.EventListenerManager();this.preDrawSeriesShadowHooks=new H.jqplot.HooksManager();this.postDrawSeriesShadowHooks=new H.jqplot.HooksManager();this.colorGenerator=new H.jqplot.ColorGenerator();this.negativeColorGenerator=new H.jqplot.ColorGenerator();this.canvasManager=new H.jqplot.CanvasManager();this.themeEngine=new H.jqplot.ThemeEngine();var ad=0;this.init=function(am,aj,ao){ao=ao||{};for(var ak=0;ak<H.jqplot.preInitHooks.length;ak++){H.jqplot.preInitHooks[ak].call(this,am,aj,ao)}for(var ak=0;ak<this.preInitHooks.hooks.length;ak++){this.preInitHooks.hooks[ak].call(this,am,aj,ao)}this.targetId="#"+am;this.target=H("#"+am);if(this._addDomReference){this.target.data("jqplot_plot",this)}this.target.removeClass("jqplot-error");if(!this.target.get(0)){throw"No plot target specified"}if(this.target.css("position")=="static"){this.target.css("position","relative")}if(!this.target.hasClass("jqplot-target")){this.target.addClass("jqplot-target")}if(!this.target.height()){var al;if(ao&&ao.height){al=parseInt(ao.height,10)}else{if(this.target.attr("data-height")){al=parseInt(this.target.attr("data-height"),10)}else{al=parseInt(H.jqplot.config.defaultHeight,10)}}this._height=al;this.target.css("height",al+"px")}else{this._height=al=this.target.height()}if(!this.target.width()){var an;if(ao&&ao.width){an=parseInt(ao.width,10)}else{if(this.target.attr("data-width")){an=parseInt(this.target.attr("data-width"),10)}else{an=parseInt(H.jqplot.config.defaultWidth,10)}}this._width=an;this.target.css("width",an+"px")}else{this._width=an=this.target.width()}this._plotDimensions.height=this._height;this._plotDimensions.width=this._width;this.grid._plotDimensions=this._plotDimensions;this.title._plotDimensions=this._plotDimensions;this.baseCanvas._plotDimensions=this._plotDimensions;this.eventCanvas._plotDimensions=this._plotDimensions;this.legend._plotDimensions=this._plotDimensions;if(this._height<=0||this._width<=0||!this._height||!this._width){throw"Canvas dimension not set"}if(ao.dataRenderer&&jQuery.isFunction(ao.dataRenderer)){if(ao.dataRendererOptions){this.dataRendererOptions=ao.dataRendererOptions}this.dataRenderer=ao.dataRenderer;aj=this.dataRenderer(aj,this,this.dataRendererOptions)}if(ao.noDataIndicator&&jQuery.isPlainObject(ao.noDataIndicator)){H.extend(true,this.noDataIndicator,ao.noDataIndicator)}if(aj==null||jQuery.isArray(aj)==false||aj.length==0||jQuery.isArray(aj[0])==false||aj[0].length==0){if(this.noDataIndicator.show==false){throw {name:"DataError",message:"No data to plot."}}else{for(var af in this.noDataIndicator.axes){for(var ah in this.noDataIndicator.axes[af]){this.axes[af][ah]=this.noDataIndicator.axes[af][ah]}}this.postDrawHooks.add(function(){var av=this.eventCanvas.getHeight();var ar=this.eventCanvas.getWidth();var aq=H('<div class="jqplot-noData-container" style="position:absolute;"></div>');this.target.append(aq);aq.height(av);aq.width(ar);aq.css("top",this.eventCanvas._offsets.top);aq.css("left",this.eventCanvas._offsets.left);var au=H('<div class="jqplot-noData-contents" style="text-align:center; position:relative; margin-left:auto; margin-right:auto;"></div>');aq.append(au);au.html(this.noDataIndicator.indicator);var at=au.height();var ap=au.width();au.height(at);au.width(ap);au.css("top",(av-at)/2+"px")})}}this.data=aj;this.parseOptions(ao);if(this.textColor){this.target.css("color",this.textColor)}if(this.fontFamily){this.target.css("font-family",this.fontFamily)}if(this.fontSize){this.target.css("font-size",this.fontSize)}this.title.init();this.legend.init();this._sumy=0;this._sumx=0;for(var ak=0;ak<this.series.length;ak++){this.seriesStack.push(ak);this.previousSeriesStack.push(ak);this.series[ak].shadowCanvas._plotDimensions=this._plotDimensions;this.series[ak].canvas._plotDimensions=this._plotDimensions;for(var ai=0;ai<H.jqplot.preSeriesInitHooks.length;ai++){H.jqplot.preSeriesInitHooks[ai].call(this.series[ak],am,aj,this.options.seriesDefaults,this.options.series[ak],this)}for(var ai=0;ai<this.preSeriesInitHooks.hooks.length;ai++){this.preSeriesInitHooks.hooks[ai].call(this.series[ak],am,aj,this.options.seriesDefaults,this.options.series[ak],this)}this.populatePlotData(this.series[ak],ak);this.series[ak]._plotDimensions=this._plotDimensions;this.series[ak].init(ak,this.grid.borderWidth,this);for(var ai=0;ai<H.jqplot.postSeriesInitHooks.length;ai++){H.jqplot.postSeriesInitHooks[ai].call(this.series[ak],am,aj,this.options.seriesDefaults,this.options.series[ak],this)}for(var ai=0;ai<this.postSeriesInitHooks.hooks.length;ai++){this.postSeriesInitHooks.hooks[ai].call(this.series[ak],am,aj,this.options.seriesDefaults,this.options.series[ak],this)}this._sumy+=this.series[ak]._sumy;this._sumx+=this.series[ak]._sumx}var ag;for(var ak=0;ak<12;ak++){ag=Q[ak];this.axes[ag]._plotDimensions=this._plotDimensions;this.axes[ag].init();if(this.axes[ag].borderColor==null){if(ag.charAt(0)!=="x"&&this.axes[ag].useSeriesColor===true&&this.axes[ag].show){this.axes[ag].borderColor=this.axes[ag]._series[0].color}else{this.axes[ag].borderColor=this.grid.borderColor}}}if(this.sortData){ab(this.series)}this.grid.init();this.grid._axes=this.axes;this.legend._series=this.series;for(var ak=0;ak<H.jqplot.postInitHooks.length;ak++){H.jqplot.postInitHooks[ak].call(this,am,aj,ao)}for(var ak=0;ak<this.postInitHooks.hooks.length;ak++){this.postInitHooks.hooks[ak].call(this,am,aj,ao)}};this.resetAxesScale=function(ak,ag){var ai=ag||{};var aj=ak||this.axes;if(aj===true){aj=this.axes}if(jQuery.isArray(aj)){for(var ah=0;ah<aj.length;ah++){this.axes[aj[ah]].resetScale(ai[aj[ah]])}}else{if(typeof(aj)==="object"){for(var af in aj){this.axes[af].resetScale(ai[af])}}}};this.reInitialize=function(){this._height=this.target.height();this._width=this.target.width();if(this._height<=0||this._width<=0||!this._height||!this._width){throw"Target dimension not set"}this._plotDimensions.height=this._height;this._plotDimensions.width=this._width;this.grid._plotDimensions=this._plotDimensions;this.title._plotDimensions=this._plotDimensions;this.baseCanvas._plotDimensions=this._plotDimensions;this.eventCanvas._plotDimensions=this._plotDimensions;this.legend._plotDimensions=this._plotDimensions;for(var ak in this.axes){this.axes[ak]._plotWidth=this._width;this.axes[ak]._plotHeight=this._height}this.title._plotWidth=this._width;if(this.textColor){this.target.css("color",this.textColor)}if(this.fontFamily){this.target.css("font-family",this.fontFamily)}if(this.fontSize){this.target.css("font-size",this.fontSize)}this._sumy=0;this._sumx=0;for(var ai=0;ai<this.series.length;ai++){this.populatePlotData(this.series[ai],ai);if(this.series[ai]._type==="line"&&this.series[ai].renderer.bands.show){this.series[ai].renderer.initBands.call(this.series[ai],this.series[ai].renderer.options,this)}this.series[ai]._plotDimensions=this._plotDimensions;this.series[ai].canvas._plotDimensions=this._plotDimensions;this._sumy+=this.series[ai]._sumy;this._sumx+=this.series[ai]._sumx}var ag;for(var af=0;af<12;af++){ag=Q[af];var ah=this.axes[ag]._ticks;for(var ai=0;ai<ah.length;ai++){var aj=ah[ai]._elem;if(aj){if(H.jqplot.use_excanvas&&window.G_vmlCanvasManager.uninitElement!==r){window.G_vmlCanvasManager.uninitElement(aj.get(0))}aj.emptyForce();aj=null;ah._elem=null}}ah=null;this.axes[ag]._plotDimensions=this._plotDimensions;this.axes[ag]._ticks=[]}if(this.sortData){ab(this.series)}this.grid._axes=this.axes;this.legend._series=this.series};function ab(aj){var an,ao,ap,af,am;for(var ak=0;ak<aj.length;ak++){var ag;var al=[aj[ak].data,aj[ak]._stackData,aj[ak]._plotData,aj[ak]._prevPlotData];for(var ah=0;ah<4;ah++){ag=true;an=al[ah];if(aj[ak]._stackAxis=="x"){for(var ai=0;ai<an.length;ai++){if(typeof(an[ai][1])!="number"){ag=false;break}}if(ag){an.sort(function(ar,aq){return ar[1]-aq[1]})}}else{for(var ai=0;ai<an.length;ai++){if(typeof(an[ai][0])!="number"){ag=false;break}}if(ag){an.sort(function(ar,aq){return ar[0]-aq[0]})}}}}}this.populatePlotData=function(aj,ak){this._plotData=[];this._stackData=[];aj._stackData=[];aj._plotData=[];var an={x:[],y:[]};if(this.stackSeries&&!aj.disableStack){aj._stack=true;var al=aj._stackAxis=="x"?0:1;var am=al?0:1;var ao=H.extend(true,[],aj.data);var ap=H.extend(true,[],aj.data);for(var ah=0;ah<ak;ah++){var af=this.series[ah].data;for(var ag=0;ag<af.length;ag++){ao[ag][0]+=af[ag][0];ao[ag][1]+=af[ag][1];ap[ag][al]+=af[ag][al]}}for(var ai=0;ai<ap.length;ai++){an.x.push(ap[ai][0]);an.y.push(ap[ai][1])}this._plotData.push(ap);this._stackData.push(ao);aj._stackData=ao;aj._plotData=ap;aj._plotValues=an}else{for(var ai=0;ai<aj.data.length;ai++){an.x.push(aj.data[ai][0]);an.y.push(aj.data[ai][1])}this._stackData.push(aj.data);this.series[ak]._stackData=aj.data;this._plotData.push(aj.data);aj._plotData=aj.data;aj._plotValues=an}if(ak>0){aj._prevPlotData=this.series[ak-1]._plotData}aj._sumy=0;aj._sumx=0;for(ai=aj.data.length-1;ai>-1;ai--){aj._sumy+=aj.data[ai][1];aj._sumx+=aj.data[ai][0]}};this.getNextSeriesColor=(function(ag){var af=0;var ah=ag.seriesColors;return function(){if(af<ah.length){return ah[af++]}else{af=0;return ah[af++]}}})(this);this.parseOptions=function(aq){for(var al=0;al<this.preParseOptionsHooks.hooks.length;al++){this.preParseOptionsHooks.hooks[al].call(this,aq)}for(var al=0;al<H.jqplot.preParseOptionsHooks.length;al++){H.jqplot.preParseOptionsHooks[al].call(this,aq)}this.options=H.extend(true,{},this.defaults,aq);var af=this.options;this.animate=af.animate;this.animateReplot=af.animateReplot;this.stackSeries=af.stackSeries;if(H.isPlainObject(af.fillBetween)){var ap=["series1","series2","color","baseSeries","fill"],am;for(var al=0,aj=ap.length;al<aj;al++){am=ap[al];if(af.fillBetween[am]!=null){this.fillBetween[am]=af.fillBetween[am]}}}if(af.seriesColors){this.seriesColors=af.seriesColors}if(af.negativeSeriesColors){this.negativeSeriesColors=af.negativeSeriesColors}if(af.captureRightClick){this.captureRightClick=af.captureRightClick}this.defaultAxisStart=(aq&&aq.defaultAxisStart!=null)?aq.defaultAxisStart:this.defaultAxisStart;this.colorGenerator.setColors(this.seriesColors);this.negativeColorGenerator.setColors(this.negativeSeriesColors);H.extend(true,this._gridPadding,af.gridPadding);this.sortData=(af.sortData!=null)?af.sortData:this.sortData;for(var al=0;al<12;al++){var ag=Q[al];var ai=this.axes[ag];ai._options=H.extend(true,{},af.axesDefaults,af.axes[ag]);H.extend(true,ai,af.axesDefaults,af.axes[ag]);ai._plotWidth=this._width;ai._plotHeight=this._height}var ao=function(av,at,aw){var ar=[];var au;at=at||"vertical";if(!jQuery.isArray(av[0])){for(au=0;au<av.length;au++){if(at=="vertical"){ar.push([aw+au,av[au]])}else{ar.push([av[au],aw+au])}}}else{H.extend(true,ar,av)}return ar};var an=0;for(var al=0;al<this.data.length;al++){var ap=new O();for(var ak=0;ak<H.jqplot.preParseSeriesOptionsHooks.length;ak++){H.jqplot.preParseSeriesOptionsHooks[ak].call(ap,this.options.seriesDefaults,this.options.series[al])}for(var ak=0;ak<this.preParseSeriesOptionsHooks.hooks.length;ak++){this.preParseSeriesOptionsHooks.hooks[ak].call(ap,this.options.seriesDefaults,this.options.series[al])}H.extend(true,ap,{seriesColors:this.seriesColors,negativeSeriesColors:this.negativeSeriesColors},this.options.seriesDefaults,this.options.series[al],{rendererOptions:{animation:{show:this.animate}}});var ah="vertical";if(ap.renderer===H.jqplot.BarRenderer&&ap.rendererOptions&&ap.rendererOptions.barDirection=="horizontal"&&ap.transposeData===true){ah="horizontal"}ap.data=ao(this.data[al],ah,this.defaultAxisStart);switch(ap.xaxis){case"xaxis":ap._xaxis=this.axes.xaxis;break;case"x2axis":ap._xaxis=this.axes.x2axis;break;default:break}ap._yaxis=this.axes[ap.yaxis];ap._xaxis._series.push(ap);ap._yaxis._series.push(ap);if(ap.show){ap._xaxis.show=true;ap._yaxis.show=true}if(!ap.label){ap.label="Series "+(al+1).toString()}this.series.push(ap);for(var ak=0;ak<H.jqplot.postParseSeriesOptionsHooks.length;ak++){H.jqplot.postParseSeriesOptionsHooks[ak].call(this.series[al],this.options.seriesDefaults,this.options.series[al])}for(var ak=0;ak<this.postParseSeriesOptionsHooks.hooks.length;ak++){this.postParseSeriesOptionsHooks.hooks[ak].call(this.series[al],this.options.seriesDefaults,this.options.series[al])}}H.extend(true,this.grid,this.options.grid);for(var al=0;al<12;al++){var ag=Q[al];var ai=this.axes[ag];if(ai.borderWidth==null){ai.borderWidth=this.grid.borderWidth}}if(typeof this.options.title=="string"){this.title.text=this.options.title}else{if(typeof this.options.title=="object"){H.extend(true,this.title,this.options.title)}}this.title._plotWidth=this._width;this.legend.setOptions(this.options.legend);for(var al=0;al<H.jqplot.postParseOptionsHooks.length;al++){H.jqplot.postParseOptionsHooks[al].call(this,aq)}for(var al=0;al<this.postParseOptionsHooks.hooks.length;al++){this.postParseOptionsHooks.hooks[al].call(this,aq)}};this.destroy=function(){this.canvasManager.freeAllCanvases();if(this.eventCanvas&&this.eventCanvas._elem){this.eventCanvas._elem.unbind()}this.target.empty();this.target[0].innerHTML=""};this.replot=function(ag){var ah=ag||{};var af=(ah.clear===false)?false:true;var ai=ah.resetAxes||false;this.target.trigger("jqplotPreReplot");if(af){this.destroy()}this.reInitialize();if(ai){this.resetAxesScale(ai,ah.axes)}this.draw();this.target.trigger("jqplotPostReplot")};this.redraw=function(af){af=(af!=null)?af:true;this.target.trigger("jqplotPreRedraw");if(af){this.canvasManager.freeAllCanvases();this.eventCanvas._elem.unbind();this.target.empty()}for(var ah in this.axes){this.axes[ah]._ticks=[]}for(var ag=0;ag<this.series.length;ag++){this.populatePlotData(this.series[ag],ag)}this._sumy=0;this._sumx=0;for(ag=0;ag<this.series.length;ag++){this._sumy+=this.series[ag]._sumy;this._sumx+=this.series[ag]._sumx}this.draw();this.target.trigger("jqplotPostRedraw")};this.draw=function(){if(this.drawIfHidden||this.target.is(":visible")){this.target.trigger("jqplotPreDraw");var aB,az,ay,ai;for(aB=0,ay=H.jqplot.preDrawHooks.length;aB<ay;aB++){H.jqplot.preDrawHooks[aB].call(this)}for(aB=0,ay=this.preDrawHooks.length;aB<ay;aB++){this.preDrawHooks.hooks[aB].apply(this,this.preDrawSeriesHooks.args[aB])}this.target.append(this.baseCanvas.createElement({left:0,right:0,top:0,bottom:0},"jqplot-base-canvas",null,this));this.baseCanvas.setContext();this.target.append(this.title.draw());this.title.pack({top:0,left:0});var aF=this.legend.draw();var af={top:0,left:0,bottom:0,right:0};if(this.legend.placement=="outsideGrid"){this.target.append(aF);switch(this.legend.location){case"n":af.top+=this.legend.getHeight();break;case"s":af.bottom+=this.legend.getHeight();break;case"ne":case"e":case"se":af.right+=this.legend.getWidth();break;case"nw":case"w":case"sw":af.left+=this.legend.getWidth();break;default:af.right+=this.legend.getWidth();break}aF=aF.detach()}var al=this.axes;var aG;for(aB=0;aB<12;aB++){aG=Q[aB];this.target.append(al[aG].draw(this.baseCanvas._ctx,this));al[aG].set()}if(al.yaxis.show){af.left+=al.yaxis.getWidth()}var aA=["y2axis","y3axis","y4axis","y5axis","y6axis","y7axis","y8axis","y9axis"];var ar=[0,0,0,0,0,0,0,0];var av=0;var au;for(au=0;au<8;au++){if(al[aA[au]].show){av+=al[aA[au]].getWidth();ar[au]=av}}af.right+=av;if(al.x2axis.show){af.top+=al.x2axis.getHeight()}if(this.title.show){af.top+=this.title.getHeight()}if(al.xaxis.show){af.bottom+=al.xaxis.getHeight()}if(this.options.gridDimensions&&H.isPlainObject(this.options.gridDimensions)){var am=parseInt(this.options.gridDimensions.width,10)||0;var aC=parseInt(this.options.gridDimensions.height,10)||0;var ah=(this._width-af.left-af.right-am)/2;var aE=(this._height-af.top-af.bottom-aC)/2;if(aE>=0&&ah>=0){af.top+=aE;af.bottom+=aE;af.left+=ah;af.right+=ah}}var ag=["top","bottom","left","right"];for(var au in ag){if(this._gridPadding[ag[au]]==null&&af[ag[au]]>0){this._gridPadding[ag[au]]=af[ag[au]]}else{if(this._gridPadding[ag[au]]==null){this._gridPadding[ag[au]]=this._defaultGridPadding[ag[au]]}}}var at=(this.legend.placement=="outsideGrid")?{top:this.title.getHeight(),left:0,right:0,bottom:0}:this._gridPadding;al.xaxis.pack({position:"absolute",bottom:this._gridPadding.bottom-al.xaxis.getHeight(),left:0,width:this._width},{min:this._gridPadding.left,max:this._width-this._gridPadding.right});al.yaxis.pack({position:"absolute",top:0,left:this._gridPadding.left-al.yaxis.getWidth(),height:this._height},{min:this._height-this._gridPadding.bottom,max:this._gridPadding.top});al.x2axis.pack({position:"absolute",top:this._gridPadding.top-al.x2axis.getHeight(),left:0,width:this._width},{min:this._gridPadding.left,max:this._width-this._gridPadding.right});for(aB=8;aB>0;aB--){al[aA[aB-1]].pack({position:"absolute",top:0,right:this._gridPadding.right-ar[aB-1]},{min:this._height-this._gridPadding.bottom,max:this._gridPadding.top})}var an=(this._width-this._gridPadding.left-this._gridPadding.right)/2+this._gridPadding.left-al.yMidAxis.getWidth()/2;al.yMidAxis.pack({position:"absolute",top:0,left:an,zIndex:9,textAlign:"center"},{min:this._height-this._gridPadding.bottom,max:this._gridPadding.top});this.target.append(this.grid.createElement(this._gridPadding,this));this.grid.draw();var ak=this.series;var aD=ak.length;for(aB=0,ay=aD;aB<ay;aB++){az=this.seriesStack[aB];this.target.append(ak[az].shadowCanvas.createElement(this._gridPadding,"jqplot-series-shadowCanvas",null,this));ak[az].shadowCanvas.setContext();ak[az].shadowCanvas._elem.data("seriesIndex",az)}for(aB=0,ay=aD;aB<ay;aB++){az=this.seriesStack[aB];this.target.append(ak[az].canvas.createElement(this._gridPadding,"jqplot-series-canvas",null,this));ak[az].canvas.setContext();ak[az].canvas._elem.data("seriesIndex",az)}this.target.append(this.eventCanvas.createElement(this._gridPadding,"jqplot-event-canvas",null,this));this.eventCanvas.setContext();this.eventCanvas._ctx.fillStyle="rgba(0,0,0,0)";this.eventCanvas._ctx.fillRect(0,0,this.eventCanvas._ctx.canvas.width,this.eventCanvas._ctx.canvas.height);this.bindCustomEvents();if(this.legend.preDraw){this.eventCanvas._elem.before(aF);this.legend.pack(at);if(this.legend._elem){this.drawSeries({legendInfo:{location:this.legend.location,placement:this.legend.placement,width:this.legend.getWidth(),height:this.legend.getHeight(),xoffset:this.legend.xoffset,yoffset:this.legend.yoffset}})}else{this.drawSeries()}}else{this.drawSeries();if(aD){H(ak[aD-1].canvas._elem).after(aF)}this.legend.pack(at)}for(var aB=0,ay=H.jqplot.eventListenerHooks.length;aB<ay;aB++){this.eventCanvas._elem.bind(H.jqplot.eventListenerHooks[aB][0],{plot:this},H.jqplot.eventListenerHooks[aB][1])}for(var aB=0,ay=this.eventListenerHooks.hooks.length;aB<ay;aB++){this.eventCanvas._elem.bind(this.eventListenerHooks.hooks[aB][0],{plot:this},this.eventListenerHooks.hooks[aB][1])}var aq=this.fillBetween;if(aq.fill&&aq.series1!==aq.series2&&aq.series1<aD&&aq.series2<aD&&ak[aq.series1]._type==="line"&&ak[aq.series2]._type==="line"){this.doFillBetweenLines()}for(var aB=0,ay=H.jqplot.postDrawHooks.length;aB<ay;aB++){H.jqplot.postDrawHooks[aB].call(this)}for(var aB=0,ay=this.postDrawHooks.hooks.length;aB<ay;aB++){this.postDrawHooks.hooks[aB].apply(this,this.postDrawHooks.args[aB])}if(this.target.is(":visible")){this._drawCount+=1}var ao,ap,aw,aj;for(aB=0,ay=aD;aB<ay;aB++){ao=ak[aB];ap=ao.renderer;aw=".jqplot-point-label.jqplot-series-"+aB;if(ap.animation&&ap.animation._supported&&ap.animation.show&&(this._drawCount<2||this.animateReplot)){aj=this.target.find(aw);aj.stop(true,true).hide();ao.canvas._elem.stop(true,true).hide();ao.shadowCanvas._elem.stop(true,true).hide();ao.canvas._elem.jqplotEffect("blind",{mode:"show",direction:ap.animation.direction},ap.animation.speed);ao.shadowCanvas._elem.jqplotEffect("blind",{mode:"show",direction:ap.animation.direction},ap.animation.speed);aj.fadeIn(ap.animation.speed*0.8)}}aj=null;this.target.trigger("jqplotPostDraw",[this])}};N.prototype.doFillBetweenLines=function(){var ah=this.fillBetween;var aq=ah.series1;var ao=ah.series2;var ap=(aq<ao)?aq:ao;var an=(ao>aq)?ao:aq;var al=this.series[ap];var ak=this.series[an];if(ak.renderer.smooth){var aj=ak.renderer._smoothedData.slice(0).reverse()}else{var aj=ak.gridData.slice(0).reverse()}if(al.renderer.smooth){var am=al.renderer._smoothedData.concat(aj)}else{var am=al.gridData.concat(aj)}var ai=(ah.color!==null)?ah.color:this.series[aq].fillColor;var ar=(ah.baseSeries!==null)?ah.baseSeries:ap;var ag=this.series[ar].renderer.shapeRenderer;var af={fillStyle:ai,fill:true,closePath:true};ag.draw(al.shadowCanvas._ctx,am,af)};this.bindCustomEvents=function(){this.eventCanvas._elem.bind("click",{plot:this},this.onClick);this.eventCanvas._elem.bind("dblclick",{plot:this},this.onDblClick);this.eventCanvas._elem.bind("mousedown",{plot:this},this.onMouseDown);this.eventCanvas._elem.bind("mousemove",{plot:this},this.onMouseMove);this.eventCanvas._elem.bind("mouseenter",{plot:this},this.onMouseEnter);this.eventCanvas._elem.bind("mouseleave",{plot:this},this.onMouseLeave);if(this.captureRightClick){this.eventCanvas._elem.bind("mouseup",{plot:this},this.onRightClick);this.eventCanvas._elem.get(0).oncontextmenu=function(){return false}}else{this.eventCanvas._elem.bind("mouseup",{plot:this},this.onMouseUp)}};function ac(ao){var am=ao.data.plot;var ai=am.eventCanvas._elem.offset();var al={x:ao.pageX-ai.left,y:ao.pageY-ai.top};var aj={xaxis:null,yaxis:null,x2axis:null,y2axis:null,y3axis:null,y4axis:null,y5axis:null,y6axis:null,y7axis:null,y8axis:null,y9axis:null,yMidAxis:null};var ak=["xaxis","yaxis","x2axis","y2axis","y3axis","y4axis","y5axis","y6axis","y7axis","y8axis","y9axis","yMidAxis"];var af=am.axes;var ag,ah;for(ag=11;ag>0;ag--){ah=ak[ag-1];if(af[ah].show){aj[ah]=af[ah].series_p2u(al[ah.charAt(0)])}}return{offsets:ai,gridPos:al,dataPos:aj}}function ae(af,ag){var ak=ag.series;var aP,aO,aN,aI,aJ,aD,aC,ap,an,at,au,aE;var aM,aQ,aK,al,aB,aG;var ah,aH;for(aN=ag.seriesStack.length-1;aN>=0;aN--){aP=ag.seriesStack[aN];aI=ak[aP];switch(aI.renderer.constructor){case H.jqplot.BarRenderer:case H.jqplot.PyramidRenderer:aD=af.x;aC=af.y;for(aO=0;aO<aI._barPoints.length;aO++){aB=aI._barPoints[aO];aK=aI.gridData[aO];if(aD>aB[0][0]&&aD<aB[2][0]&&aC>aB[2][1]&&aC<aB[0][1]){return{seriesIndex:aI.index,pointIndex:aO,gridData:aK,data:aI.data[aO],points:aI._barPoints[aO]}}}break;case H.jqplot.DonutRenderer:at=aI.startAngle/180*Math.PI;aD=af.x-aI._center[0];aC=af.y-aI._center[1];aJ=Math.sqrt(Math.pow(aD,2)+Math.pow(aC,2));if(aD>0&&-aC>=0){ap=2*Math.PI-Math.atan(-aC/aD)}else{if(aD>0&&-aC<0){ap=-Math.atan(-aC/aD)}else{if(aD<0){ap=Math.PI-Math.atan(-aC/aD)}else{if(aD==0&&-aC>0){ap=3*Math.PI/2}else{if(aD==0&&-aC<0){ap=Math.PI/2}else{if(aD==0&&aC==0){ap=0}}}}}}if(at){ap-=at;if(ap<0){ap+=2*Math.PI}else{if(ap>2*Math.PI){ap-=2*Math.PI}}}an=aI.sliceMargin/180*Math.PI;if(aJ<aI._radius&&aJ>aI._innerRadius){for(aO=0;aO<aI.gridData.length;aO++){au=(aO>0)?aI.gridData[aO-1][1]+an:an;aE=aI.gridData[aO][1];if(ap>au&&ap<aE){return{seriesIndex:aI.index,pointIndex:aO,gridData:aI.gridData[aO],data:aI.data[aO]}}}}break;case H.jqplot.PieRenderer:at=aI.startAngle/180*Math.PI;aD=af.x-aI._center[0];aC=af.y-aI._center[1];aJ=Math.sqrt(Math.pow(aD,2)+Math.pow(aC,2));if(aD>0&&-aC>=0){ap=2*Math.PI-Math.atan(-aC/aD)}else{if(aD>0&&-aC<0){ap=-Math.atan(-aC/aD)}else{if(aD<0){ap=Math.PI-Math.atan(-aC/aD)}else{if(aD==0&&-aC>0){ap=3*Math.PI/2}else{if(aD==0&&-aC<0){ap=Math.PI/2}else{if(aD==0&&aC==0){ap=0}}}}}}if(at){ap-=at;if(ap<0){ap+=2*Math.PI}else{if(ap>2*Math.PI){ap-=2*Math.PI}}}an=aI.sliceMargin/180*Math.PI;if(aJ<aI._radius){for(aO=0;aO<aI.gridData.length;aO++){au=(aO>0)?aI.gridData[aO-1][1]+an:an;aE=aI.gridData[aO][1];if(ap>au&&ap<aE){return{seriesIndex:aI.index,pointIndex:aO,gridData:aI.gridData[aO],data:aI.data[aO]}}}}break;case H.jqplot.BubbleRenderer:aD=af.x;aC=af.y;var az=null;if(aI.show){for(var aO=0;aO<aI.gridData.length;aO++){aK=aI.gridData[aO];aQ=Math.sqrt((aD-aK[0])*(aD-aK[0])+(aC-aK[1])*(aC-aK[1]));if(aQ<=aK[2]&&(aQ<=aM||aM==null)){aM=aQ;az={seriesIndex:aP,pointIndex:aO,gridData:aK,data:aI.data[aO]}}}if(az!=null){return az}}break;case H.jqplot.FunnelRenderer:aD=af.x;aC=af.y;var aF=aI._vertices,aj=aF[0],ai=aF[aF.length-1],am,ay,ar;function aL(aT,aV,aU){var aS=(aV[1]-aU[1])/(aV[0]-aU[0]);var aR=aV[1]-aS*aV[0];var aW=aT+aV[1];return[(aW-aR)/aS,aW]}am=aL(aC,aj[0],ai[3]);ay=aL(aC,aj[1],ai[2]);for(aO=0;aO<aF.length;aO++){ar=aF[aO];if(aC>=ar[0][1]&&aC<=ar[3][1]&&aD>=am[0]&&aD<=ay[0]){return{seriesIndex:aI.index,pointIndex:aO,gridData:null,data:aI.data[aO]}}}break;case H.jqplot.LineRenderer:aD=af.x;aC=af.y;aJ=aI.renderer;if(aI.show){if((aI.fill||(aI.renderer.bands.show&&aI.renderer.bands.fill))&&(!ag.plugins.highlighter||!ag.plugins.highlighter.show)){var aq=false;if(aD>aI._boundingBox[0][0]&&aD<aI._boundingBox[1][0]&&aC>aI._boundingBox[1][1]&&aC<aI._boundingBox[0][1]){var ax=aI._areaPoints.length;var aA;var aO=ax-1;for(var aA=0;aA<ax;aA++){var aw=[aI._areaPoints[aA][0],aI._areaPoints[aA][1]];var av=[aI._areaPoints[aO][0],aI._areaPoints[aO][1]];if(aw[1]<aC&&av[1]>=aC||av[1]<aC&&aw[1]>=aC){if(aw[0]+(aC-aw[1])/(av[1]-aw[1])*(av[0]-aw[0])<aD){aq=!aq}}aO=aA}}if(aq){return{seriesIndex:aP,pointIndex:null,gridData:aI.gridData,data:aI.data,points:aI._areaPoints}}break}else{aH=aI.markerRenderer.size/2+aI.neighborThreshold;ah=(aH>0)?aH:0;for(var aO=0;aO<aI.gridData.length;aO++){aK=aI.gridData[aO];if(aJ.constructor==H.jqplot.OHLCRenderer){if(aJ.candleStick){var ao=aI._yaxis.series_u2p;if(aD>=aK[0]-aJ._bodyWidth/2&&aD<=aK[0]+aJ._bodyWidth/2&&aC>=ao(aI.data[aO][2])&&aC<=ao(aI.data[aO][3])){return{seriesIndex:aP,pointIndex:aO,gridData:aK,data:aI.data[aO]}}}else{if(!aJ.hlc){var ao=aI._yaxis.series_u2p;if(aD>=aK[0]-aJ._tickLength&&aD<=aK[0]+aJ._tickLength&&aC>=ao(aI.data[aO][2])&&aC<=ao(aI.data[aO][3])){return{seriesIndex:aP,pointIndex:aO,gridData:aK,data:aI.data[aO]}}}else{var ao=aI._yaxis.series_u2p;if(aD>=aK[0]-aJ._tickLength&&aD<=aK[0]+aJ._tickLength&&aC>=ao(aI.data[aO][1])&&aC<=ao(aI.data[aO][2])){return{seriesIndex:aP,pointIndex:aO,gridData:aK,data:aI.data[aO]}}}}}else{if(aK[0]!=null&&aK[1]!=null){aQ=Math.sqrt((aD-aK[0])*(aD-aK[0])+(aC-aK[1])*(aC-aK[1]));if(aQ<=ah&&(aQ<=aM||aM==null)){aM=aQ;return{seriesIndex:aP,pointIndex:aO,gridData:aK,data:aI.data[aO]}}}}}}}break;default:aD=af.x;aC=af.y;aJ=aI.renderer;if(aI.show){aH=aI.markerRenderer.size/2+aI.neighborThreshold;ah=(aH>0)?aH:0;for(var aO=0;aO<aI.gridData.length;aO++){aK=aI.gridData[aO];if(aJ.constructor==H.jqplot.OHLCRenderer){if(aJ.candleStick){var ao=aI._yaxis.series_u2p;if(aD>=aK[0]-aJ._bodyWidth/2&&aD<=aK[0]+aJ._bodyWidth/2&&aC>=ao(aI.data[aO][2])&&aC<=ao(aI.data[aO][3])){return{seriesIndex:aP,pointIndex:aO,gridData:aK,data:aI.data[aO]}}}else{if(!aJ.hlc){var ao=aI._yaxis.series_u2p;if(aD>=aK[0]-aJ._tickLength&&aD<=aK[0]+aJ._tickLength&&aC>=ao(aI.data[aO][2])&&aC<=ao(aI.data[aO][3])){return{seriesIndex:aP,pointIndex:aO,gridData:aK,data:aI.data[aO]}}}else{var ao=aI._yaxis.series_u2p;if(aD>=aK[0]-aJ._tickLength&&aD<=aK[0]+aJ._tickLength&&aC>=ao(aI.data[aO][1])&&aC<=ao(aI.data[aO][2])){return{seriesIndex:aP,pointIndex:aO,gridData:aK,data:aI.data[aO]}}}}}else{aQ=Math.sqrt((aD-aK[0])*(aD-aK[0])+(aC-aK[1])*(aC-aK[1]));if(aQ<=ah&&(aQ<=aM||aM==null)){aM=aQ;return{seriesIndex:aP,pointIndex:aO,gridData:aK,data:aI.data[aO]}}}}}break}}return null}this.onClick=function(ah){var ag=ac(ah);var aj=ah.data.plot;var ai=ae(ag.gridPos,aj);var af=jQuery.Event("jqplotClick");af.pageX=ah.pageX;af.pageY=ah.pageY;H(this).trigger(af,[ag.gridPos,ag.dataPos,ai,aj])};this.onDblClick=function(ah){var ag=ac(ah);var aj=ah.data.plot;var ai=ae(ag.gridPos,aj);var af=jQuery.Event("jqplotDblClick");af.pageX=ah.pageX;af.pageY=ah.pageY;H(this).trigger(af,[ag.gridPos,ag.dataPos,ai,aj])};this.onMouseDown=function(ah){var ag=ac(ah);var aj=ah.data.plot;var ai=ae(ag.gridPos,aj);var af=jQuery.Event("jqplotMouseDown");af.pageX=ah.pageX;af.pageY=ah.pageY;H(this).trigger(af,[ag.gridPos,ag.dataPos,ai,aj])};this.onMouseUp=function(ah){var ag=ac(ah);var af=jQuery.Event("jqplotMouseUp");af.pageX=ah.pageX;af.pageY=ah.pageY;H(this).trigger(af,[ag.gridPos,ag.dataPos,null,ah.data.plot])};this.onRightClick=function(ah){var ag=ac(ah);var aj=ah.data.plot;var ai=ae(ag.gridPos,aj);if(aj.captureRightClick){if(ah.which==3){var af=jQuery.Event("jqplotRightClick");af.pageX=ah.pageX;af.pageY=ah.pageY;H(this).trigger(af,[ag.gridPos,ag.dataPos,ai,aj])}else{var af=jQuery.Event("jqplotMouseUp");af.pageX=ah.pageX;af.pageY=ah.pageY;H(this).trigger(af,[ag.gridPos,ag.dataPos,ai,aj])}}};this.onMouseMove=function(ah){var ag=ac(ah);var aj=ah.data.plot;var ai=ae(ag.gridPos,aj);var af=jQuery.Event("jqplotMouseMove");af.pageX=ah.pageX;af.pageY=ah.pageY;H(this).trigger(af,[ag.gridPos,ag.dataPos,ai,aj])};this.onMouseEnter=function(ah){var ag=ac(ah);var ai=ah.data.plot;var af=jQuery.Event("jqplotMouseEnter");af.pageX=ah.pageX;af.pageY=ah.pageY;af.relatedTarget=ah.relatedTarget;H(this).trigger(af,[ag.gridPos,ag.dataPos,null,ai])};this.onMouseLeave=function(ah){var ag=ac(ah);var ai=ah.data.plot;var af=jQuery.Event("jqplotMouseLeave");af.pageX=ah.pageX;af.pageY=ah.pageY;af.relatedTarget=ah.relatedTarget;H(this).trigger(af,[ag.gridPos,ag.dataPos,null,ai])};this.drawSeries=function(ah,af){var aj,ai,ag;af=(typeof(ah)==="number"&&af==null)?ah:af;ah=(typeof(ah)==="object")?ah:{};if(af!=r){ai=this.series[af];ag=ai.shadowCanvas._ctx;ag.clearRect(0,0,ag.canvas.width,ag.canvas.height);ai.drawShadow(ag,ah,this);ag=ai.canvas._ctx;ag.clearRect(0,0,ag.canvas.width,ag.canvas.height);ai.draw(ag,ah,this);if(ai.renderer.constructor==H.jqplot.BezierCurveRenderer){if(af<this.series.length-1){this.drawSeries(af+1)}}}else{for(aj=0;aj<this.series.length;aj++){ai=this.series[aj];ag=ai.shadowCanvas._ctx;ag.clearRect(0,0,ag.canvas.width,ag.canvas.height);ai.drawShadow(ag,ah,this);ag=ai.canvas._ctx;ag.clearRect(0,0,ag.canvas.width,ag.canvas.height);ai.draw(ag,ah,this)}}ah=af=aj=ai=ag=null};this.moveSeriesToFront=function(ag){ag=parseInt(ag,10);var aj=H.inArray(ag,this.seriesStack);if(aj==-1){return}if(aj==this.seriesStack.length-1){this.previousSeriesStack=this.seriesStack.slice(0);return}var af=this.seriesStack[this.seriesStack.length-1];var ai=this.series[ag].canvas._elem.detach();var ah=this.series[ag].shadowCanvas._elem.detach();this.series[af].shadowCanvas._elem.after(ah);this.series[af].canvas._elem.after(ai);this.previousSeriesStack=this.seriesStack.slice(0);this.seriesStack.splice(aj,1);this.seriesStack.push(ag)};this.moveSeriesToBack=function(ag){ag=parseInt(ag,10);var aj=H.inArray(ag,this.seriesStack);if(aj==0||aj==-1){return}var af=this.seriesStack[0];var ai=this.series[ag].canvas._elem.detach();var ah=this.series[ag].shadowCanvas._elem.detach();this.series[af].shadowCanvas._elem.before(ah);this.series[af].canvas._elem.before(ai);this.previousSeriesStack=this.seriesStack.slice(0);this.seriesStack.splice(aj,1);this.seriesStack.unshift(ag)};this.restorePreviousSeriesOrder=function(){var al,ak,aj,ai,ah,af,ag;if(this.seriesStack==this.previousSeriesStack){return}for(al=1;al<this.previousSeriesStack.length;al++){af=this.previousSeriesStack[al];ag=this.previousSeriesStack[al-1];aj=this.series[af].canvas._elem.detach();ai=this.series[af].shadowCanvas._elem.detach();this.series[ag].shadowCanvas._elem.after(ai);this.series[ag].canvas._elem.after(aj)}ah=this.seriesStack.slice(0);this.seriesStack=this.previousSeriesStack.slice(0);this.previousSeriesStack=ah};this.restoreOriginalSeriesOrder=function(){var aj,ai,af=[],ah,ag;for(aj=0;aj<this.series.length;aj++){af.push(aj)}if(this.seriesStack==af){return}this.previousSeriesStack=this.seriesStack.slice(0);this.seriesStack=af;for(aj=1;aj<this.seriesStack.length;aj++){ah=this.series[aj].canvas._elem.detach();ag=this.series[aj].shadowCanvas._elem.detach();this.series[aj-1].shadowCanvas._elem.after(ag);this.series[aj-1].canvas._elem.after(ah)}};this.activateTheme=function(af){this.themeEngine.activate(this,af)}}H.jqplot.computeHighlightColors=function(ac){var ae;if(jQuery.isArray(ac)){ae=[];for(var ag=0;ag<ac.length;ag++){var af=H.jqplot.getColorComponents(ac[ag]);var ab=[af[0],af[1],af[2]];var ah=ab[0]+ab[1]+ab[2];for(var ad=0;ad<3;ad++){ab[ad]=(ah>660)?ab[ad]*0.85:0.73*ab[ad]+90;ab[ad]=parseInt(ab[ad],10);(ab[ad]>255)?255:ab[ad]}ab[3]=0.3+0.35*af[3];ae.push("rgba("+ab[0]+","+ab[1]+","+ab[2]+","+ab[3]+")")}}else{var af=H.jqplot.getColorComponents(ac);var ab=[af[0],af[1],af[2]];var ah=ab[0]+ab[1]+ab[2];for(var ad=0;ad<3;ad++){ab[ad]=(ah>660)?ab[ad]*0.85:0.73*ab[ad]+90;ab[ad]=parseInt(ab[ad],10);(ab[ad]>255)?255:ab[ad]}ab[3]=0.3+0.35*af[3];ae="rgba("+ab[0]+","+ab[1]+","+ab[2]+","+ab[3]+")"}return ae};H.jqplot.ColorGenerator=function(ac){ac=ac||H.jqplot.config.defaultColors;var ab=0;this.next=function(){if(ab<ac.length){return ac[ab++]}else{ab=0;return ac[ab++]}};this.previous=function(){if(ab>0){return ac[ab--]}else{ab=ac.length-1;return ac[ab]}};this.get=function(ae){var ad=ae-ac.length*Math.floor(ae/ac.length);return ac[ad]};this.setColors=function(ad){ac=ad};this.reset=function(){ab=0};this.getIndex=function(){return ab};this.setIndex=function(ad){ab=ad}};H.jqplot.hex2rgb=function(ad,ab){ad=ad.replace("#","");if(ad.length==3){ad=ad.charAt(0)+ad.charAt(0)+ad.charAt(1)+ad.charAt(1)+ad.charAt(2)+ad.charAt(2)}var ac;ac="rgba("+parseInt(ad.slice(0,2),16)+", "+parseInt(ad.slice(2,4),16)+", "+parseInt(ad.slice(4,6),16);if(ab){ac+=", "+ab}ac+=")";return ac};H.jqplot.rgb2hex=function(ag){var ad=/rgba?\( *([0-9]{1,3}\.?[0-9]*%?) *, *([0-9]{1,3}\.?[0-9]*%?) *, *([0-9]{1,3}\.?[0-9]*%?) *(?:, *[0-9.]*)?\)/;var ab=ag.match(ad);var af="#";for(var ae=1;ae<4;ae++){var ac;if(ab[ae].search(/%/)!=-1){ac=parseInt(255*ab[ae]/100,10).toString(16);if(ac.length==1){ac="0"+ac}}else{ac=parseInt(ab[ae],10).toString(16);if(ac.length==1){ac="0"+ac}}af+=ac}return af};H.jqplot.normalize2rgb=function(ac,ab){if(ac.search(/^ *rgba?\(/)!=-1){return ac}else{if(ac.search(/^ *#?[0-9a-fA-F]?[0-9a-fA-F]/)!=-1){return H.jqplot.hex2rgb(ac,ab)}else{throw"invalid color spec"}}};H.jqplot.getColorComponents=function(ag){ag=H.jqplot.colorKeywordMap[ag]||ag;var ae=H.jqplot.normalize2rgb(ag);var ad=/rgba?\( *([0-9]{1,3}\.?[0-9]*%?) *, *([0-9]{1,3}\.?[0-9]*%?) *, *([0-9]{1,3}\.?[0-9]*%?) *,? *([0-9.]* *)?\)/;var ab=ae.match(ad);var ac=[];for(var af=1;af<4;af++){if(ab[af].search(/%/)!=-1){ac[af-1]=parseInt(255*ab[af]/100,10)}else{ac[af-1]=parseInt(ab[af],10)}}ac[3]=parseFloat(ab[4])?parseFloat(ab[4]):1;return ac};H.jqplot.colorKeywordMap={aliceblue:"rgb(240, 248, 255)",antiquewhite:"rgb(250, 235, 215)",aqua:"rgb( 0, 255, 255)",aquamarine:"rgb(127, 255, 212)",azure:"rgb(240, 255, 255)",beige:"rgb(245, 245, 220)",bisque:"rgb(255, 228, 196)",black:"rgb( 0, 0, 0)",blanchedalmond:"rgb(255, 235, 205)",blue:"rgb( 0, 0, 255)",blueviolet:"rgb(138, 43, 226)",brown:"rgb(165, 42, 42)",burlywood:"rgb(222, 184, 135)",cadetblue:"rgb( 95, 158, 160)",chartreuse:"rgb(127, 255, 0)",chocolate:"rgb(210, 105, 30)",coral:"rgb(255, 127, 80)",cornflowerblue:"rgb(100, 149, 237)",cornsilk:"rgb(255, 248, 220)",crimson:"rgb(220, 20, 60)",cyan:"rgb( 0, 255, 255)",darkblue:"rgb( 0, 0, 139)",darkcyan:"rgb( 0, 139, 139)",darkgoldenrod:"rgb(184, 134, 11)",darkgray:"rgb(169, 169, 169)",darkgreen:"rgb( 0, 100, 0)",darkgrey:"rgb(169, 169, 169)",darkkhaki:"rgb(189, 183, 107)",darkmagenta:"rgb(139, 0, 139)",darkolivegreen:"rgb( 85, 107, 47)",darkorange:"rgb(255, 140, 0)",darkorchid:"rgb(153, 50, 204)",darkred:"rgb(139, 0, 0)",darksalmon:"rgb(233, 150, 122)",darkseagreen:"rgb(143, 188, 143)",darkslateblue:"rgb( 72, 61, 139)",darkslategray:"rgb( 47, 79, 79)",darkslategrey:"rgb( 47, 79, 79)",darkturquoise:"rgb( 0, 206, 209)",darkviolet:"rgb(148, 0, 211)",deeppink:"rgb(255, 20, 147)",deepskyblue:"rgb( 0, 191, 255)",dimgray:"rgb(105, 105, 105)",dimgrey:"rgb(105, 105, 105)",dodgerblue:"rgb( 30, 144, 255)",firebrick:"rgb(178, 34, 34)",floralwhite:"rgb(255, 250, 240)",forestgreen:"rgb( 34, 139, 34)",fuchsia:"rgb(255, 0, 255)",gainsboro:"rgb(220, 220, 220)",ghostwhite:"rgb(248, 248, 255)",gold:"rgb(255, 215, 0)",goldenrod:"rgb(218, 165, 32)",gray:"rgb(128, 128, 128)",grey:"rgb(128, 128, 128)",green:"rgb( 0, 128, 0)",greenyellow:"rgb(173, 255, 47)",honeydew:"rgb(240, 255, 240)",hotpink:"rgb(255, 105, 180)",indianred:"rgb(205, 92, 92)",indigo:"rgb( 75, 0, 130)",ivory:"rgb(255, 255, 240)",khaki:"rgb(240, 230, 140)",lavender:"rgb(230, 230, 250)",lavenderblush:"rgb(255, 240, 245)",lawngreen:"rgb(124, 252, 0)",lemonchiffon:"rgb(255, 250, 205)",lightblue:"rgb(173, 216, 230)",lightcoral:"rgb(240, 128, 128)",lightcyan:"rgb(224, 255, 255)",lightgoldenrodyellow:"rgb(250, 250, 210)",lightgray:"rgb(211, 211, 211)",lightgreen:"rgb(144, 238, 144)",lightgrey:"rgb(211, 211, 211)",lightpink:"rgb(255, 182, 193)",lightsalmon:"rgb(255, 160, 122)",lightseagreen:"rgb( 32, 178, 170)",lightskyblue:"rgb(135, 206, 250)",lightslategray:"rgb(119, 136, 153)",lightslategrey:"rgb(119, 136, 153)",lightsteelblue:"rgb(176, 196, 222)",lightyellow:"rgb(255, 255, 224)",lime:"rgb( 0, 255, 0)",limegreen:"rgb( 50, 205, 50)",linen:"rgb(250, 240, 230)",magenta:"rgb(255, 0, 255)",maroon:"rgb(128, 0, 0)",mediumaquamarine:"rgb(102, 205, 170)",mediumblue:"rgb( 0, 0, 205)",mediumorchid:"rgb(186, 85, 211)",mediumpurple:"rgb(147, 112, 219)",mediumseagreen:"rgb( 60, 179, 113)",mediumslateblue:"rgb(123, 104, 238)",mediumspringgreen:"rgb( 0, 250, 154)",mediumturquoise:"rgb( 72, 209, 204)",mediumvioletred:"rgb(199, 21, 133)",midnightblue:"rgb( 25, 25, 112)",mintcream:"rgb(245, 255, 250)",mistyrose:"rgb(255, 228, 225)",moccasin:"rgb(255, 228, 181)",navajowhite:"rgb(255, 222, 173)",navy:"rgb( 0, 0, 128)",oldlace:"rgb(253, 245, 230)",olive:"rgb(128, 128, 0)",olivedrab:"rgb(107, 142, 35)",orange:"rgb(255, 165, 0)",orangered:"rgb(255, 69, 0)",orchid:"rgb(218, 112, 214)",palegoldenrod:"rgb(238, 232, 170)",palegreen:"rgb(152, 251, 152)",paleturquoise:"rgb(175, 238, 238)",palevioletred:"rgb(219, 112, 147)",papayawhip:"rgb(255, 239, 213)",peachpuff:"rgb(255, 218, 185)",peru:"rgb(205, 133, 63)",pink:"rgb(255, 192, 203)",plum:"rgb(221, 160, 221)",powderblue:"rgb(176, 224, 230)",purple:"rgb(128, 0, 128)",red:"rgb(255, 0, 0)",rosybrown:"rgb(188, 143, 143)",royalblue:"rgb( 65, 105, 225)",saddlebrown:"rgb(139, 69, 19)",salmon:"rgb(250, 128, 114)",sandybrown:"rgb(244, 164, 96)",seagreen:"rgb( 46, 139, 87)",seashell:"rgb(255, 245, 238)",sienna:"rgb(160, 82, 45)",silver:"rgb(192, 192, 192)",skyblue:"rgb(135, 206, 235)",slateblue:"rgb(106, 90, 205)",slategray:"rgb(112, 128, 144)",slategrey:"rgb(112, 128, 144)",snow:"rgb(255, 250, 250)",springgreen:"rgb( 0, 255, 127)",steelblue:"rgb( 70, 130, 180)",tan:"rgb(210, 180, 140)",teal:"rgb( 0, 128, 128)",thistle:"rgb(216, 191, 216)",tomato:"rgb(255, 99, 71)",turquoise:"rgb( 64, 224, 208)",violet:"rgb(238, 130, 238)",wheat:"rgb(245, 222, 179)",white:"rgb(255, 255, 255)",whitesmoke:"rgb(245, 245, 245)",yellow:"rgb(255, 255, 0)",yellowgreen:"rgb(154, 205, 50)"};H.jqplot.AxisLabelRenderer=function(ab){H.jqplot.ElemContainer.call(this);this.axis;this.show=true;this.label="";this.fontFamily=null;this.fontSize=null;this.textColor=null;this._elem;this.escapeHTML=false;H.extend(true,this,ab)};H.jqplot.AxisLabelRenderer.prototype=new H.jqplot.ElemContainer();H.jqplot.AxisLabelRenderer.prototype.constructor=H.jqplot.AxisLabelRenderer;H.jqplot.AxisLabelRenderer.prototype.init=function(ab){H.extend(true,this,ab)};H.jqplot.AxisLabelRenderer.prototype.draw=function(ab,ac){if(this._elem){this._elem.emptyForce();this._elem=null}this._elem=H('<div style="position:absolute;" class="jqplot-'+this.axis+'-label"></div>');if(Number(this.label)){this._elem.css("white-space","nowrap")}if(!this.escapeHTML){this._elem.html(this.label)}else{this._elem.text(this.label)}if(this.fontFamily){this._elem.css("font-family",this.fontFamily)}if(this.fontSize){this._elem.css("font-size",this.fontSize)}if(this.textColor){this._elem.css("color",this.textColor)}return this._elem};H.jqplot.AxisLabelRenderer.prototype.pack=function(){};H.jqplot.AxisTickRenderer=function(ab){H.jqplot.ElemContainer.call(this);this.mark="outside";this.axis;this.showMark=true;this.showGridline=true;this.isMinorTick=false;this.size=4;this.markSize=6;this.show=true;this.showLabel=true;this.label=null;this.value=null;this._styles={};this.formatter=H.jqplot.DefaultTickFormatter;this.prefix="";this.formatString="";this.fontFamily;this.fontSize;this.textColor;this.escapeHTML=false;this._elem;this._breakTick=false;H.extend(true,this,ab)};H.jqplot.AxisTickRenderer.prototype.init=function(ab){H.extend(true,this,ab)};H.jqplot.AxisTickRenderer.prototype=new H.jqplot.ElemContainer();H.jqplot.AxisTickRenderer.prototype.constructor=H.jqplot.AxisTickRenderer;H.jqplot.AxisTickRenderer.prototype.setTick=function(ab,ad,ac){this.value=ab;this.axis=ad;if(ac){this.isMinorTick=true}return this};H.jqplot.AxisTickRenderer.prototype.draw=function(){if(this.label===null){this.label=this.prefix+this.formatter(this.formatString,this.value)}var ac={position:"absolute"};if(Number(this.label)){ac.whitSpace="nowrap"}if(this._elem){this._elem.emptyForce();this._elem=null}this._elem=H(document.createElement("div"));this._elem.addClass("jqplot-"+this.axis+"-tick");if(!this.escapeHTML){this._elem.html(this.label)}else{this._elem.text(this.label)}this._elem.css(ac);for(var ab in this._styles){this._elem.css(ab,this._styles[ab])}if(this.fontFamily){this._elem.css("font-family",this.fontFamily)}if(this.fontSize){this._elem.css("font-size",this.fontSize)}if(this.textColor){this._elem.css("color",this.textColor)}if(this._breakTick){this._elem.addClass("jqplot-breakTick")}return this._elem};H.jqplot.DefaultTickFormatter=function(ab,ac){if(typeof ac=="number"){if(!ab){ab=H.jqplot.config.defaultTickFormatString}return H.jqplot.sprintf(ab,ac)}else{return String(ac)}};H.jqplot.AxisTickRenderer.prototype.pack=function(){};H.jqplot.CanvasGridRenderer=function(){this.shadowRenderer=new H.jqplot.ShadowRenderer()};H.jqplot.CanvasGridRenderer.prototype.init=function(ac){this._ctx;H.extend(true,this,ac);var ab={lineJoin:"miter",lineCap:"round",fill:false,isarc:false,angle:this.shadowAngle,offset:this.shadowOffset,alpha:this.shadowAlpha,depth:this.shadowDepth,lineWidth:this.shadowWidth,closePath:false,strokeStyle:this.shadowColor};this.renderer.shadowRenderer.init(ab)};H.jqplot.CanvasGridRenderer.prototype.createElement=function(ae){var ad;if(this._elem){if(H.jqplot.use_excanvas&&window.G_vmlCanvasManager.uninitElement!==r){ad=this._elem.get(0);window.G_vmlCanvasManager.uninitElement(ad);ad=null}this._elem.emptyForce();this._elem=null}ad=ae.canvasManager.getCanvas();var ab=this._plotDimensions.width;var ac=this._plotDimensions.height;ad.width=ab;ad.height=ac;this._elem=H(ad);this._elem.addClass("jqplot-grid-canvas");this._elem.css({position:"absolute",left:0,top:0});ad=ae.canvasManager.initCanvas(ad);this._top=this._offsets.top;this._bottom=ac-this._offsets.bottom;this._left=this._offsets.left;this._right=ab-this._offsets.right;this._width=this._right-this._left;this._height=this._bottom-this._top;ad=null;return this._elem};H.jqplot.CanvasGridRenderer.prototype.draw=function(){this._ctx=this._elem.get(0).getContext("2d");var am=this._ctx;var ap=this._axes;am.save();am.clearRect(0,0,this._plotDimensions.width,this._plotDimensions.height);am.fillStyle=this.backgroundColor||this.background;am.fillRect(this._left,this._top,this._width,this._height);am.save();am.lineJoin="miter";am.lineCap="butt";am.lineWidth=this.gridLineWidth;am.strokeStyle=this.gridLineColor;var at,ar,aj,ak;var ag=["xaxis","yaxis","x2axis","y2axis"];for(var aq=4;aq>0;aq--){var aw=ag[aq-1];var ab=ap[aw];var au=ab._ticks;var al=au.length;if(ab.show){if(ab.drawBaseline){var av={};if(ab.baselineWidth!==null){av.lineWidth=ab.baselineWidth}if(ab.baselineColor!==null){av.strokeStyle=ab.baselineColor}switch(aw){case"xaxis":ai(this._left,this._bottom,this._right,this._bottom,av);break;case"yaxis":ai(this._left,this._bottom,this._left,this._top,av);break;case"x2axis":ai(this._left,this._bottom,this._right,this._bottom,av);break;case"y2axis":ai(this._right,this._bottom,this._right,this._top,av);break}}for(var an=al;an>0;an--){var ah=au[an-1];if(ah.show){var ae=Math.round(ab.u2p(ah.value))+0.5;switch(aw){case"xaxis":if(ah.showGridline&&this.drawGridlines&&((!ah.isMinorTick&&ab.drawMajorGridlines)||(ah.isMinorTick&&ab.drawMinorGridlines))){ai(ae,this._top,ae,this._bottom)}if(ah.showMark&&ah.mark&&((!ah.isMinorTick&&ab.drawMajorTickMarks)||(ah.isMinorTick&&ab.drawMinorTickMarks))){aj=ah.markSize;ak=ah.mark;var ae=Math.round(ab.u2p(ah.value))+0.5;switch(ak){case"outside":at=this._bottom;ar=this._bottom+aj;break;case"inside":at=this._bottom-aj;ar=this._bottom;break;case"cross":at=this._bottom-aj;ar=this._bottom+aj;break;default:at=this._bottom;ar=this._bottom+aj;break}if(this.shadow){this.renderer.shadowRenderer.draw(am,[[ae,at],[ae,ar]],{lineCap:"butt",lineWidth:this.gridLineWidth,offset:this.gridLineWidth*0.75,depth:2,fill:false,closePath:false})}ai(ae,at,ae,ar)}break;case"yaxis":if(ah.showGridline&&this.drawGridlines&&((!ah.isMinorTick&&ab.drawMajorGridlines)||(ah.isMinorTick&&ab.drawMinorGridlines))){ai(this._right,ae,this._left,ae)}if(ah.showMark&&ah.mark&&((!ah.isMinorTick&&ab.drawMajorTickMarks)||(ah.isMinorTick&&ab.drawMinorTickMarks))){aj=ah.markSize;ak=ah.mark;var ae=Math.round(ab.u2p(ah.value))+0.5;switch(ak){case"outside":at=this._left-aj;ar=this._left;break;case"inside":at=this._left;ar=this._left+aj;break;case"cross":at=this._left-aj;ar=this._left+aj;break;default:at=this._left-aj;ar=this._left;break}if(this.shadow){this.renderer.shadowRenderer.draw(am,[[at,ae],[ar,ae]],{lineCap:"butt",lineWidth:this.gridLineWidth*1.5,offset:this.gridLineWidth*0.75,fill:false,closePath:false})}ai(at,ae,ar,ae,{strokeStyle:ab.borderColor})}break;case"x2axis":if(ah.showGridline&&this.drawGridlines&&((!ah.isMinorTick&&ab.drawMajorGridlines)||(ah.isMinorTick&&ab.drawMinorGridlines))){ai(ae,this._bottom,ae,this._top)}if(ah.showMark&&ah.mark&&((!ah.isMinorTick&&ab.drawMajorTickMarks)||(ah.isMinorTick&&ab.drawMinorTickMarks))){aj=ah.markSize;ak=ah.mark;var ae=Math.round(ab.u2p(ah.value))+0.5;switch(ak){case"outside":at=this._top-aj;ar=this._top;break;case"inside":at=this._top;ar=this._top+aj;break;case"cross":at=this._top-aj;ar=this._top+aj;break;default:at=this._top-aj;ar=this._top;break}if(this.shadow){this.renderer.shadowRenderer.draw(am,[[ae,at],[ae,ar]],{lineCap:"butt",lineWidth:this.gridLineWidth,offset:this.gridLineWidth*0.75,depth:2,fill:false,closePath:false})}ai(ae,at,ae,ar)}break;case"y2axis":if(ah.showGridline&&this.drawGridlines&&((!ah.isMinorTick&&ab.drawMajorGridlines)||(ah.isMinorTick&&ab.drawMinorGridlines))){ai(this._left,ae,this._right,ae)}if(ah.showMark&&ah.mark&&((!ah.isMinorTick&&ab.drawMajorTickMarks)||(ah.isMinorTick&&ab.drawMinorTickMarks))){aj=ah.markSize;ak=ah.mark;var ae=Math.round(ab.u2p(ah.value))+0.5;switch(ak){case"outside":at=this._right;ar=this._right+aj;break;case"inside":at=this._right-aj;ar=this._right;break;case"cross":at=this._right-aj;ar=this._right+aj;break;default:at=this._right;ar=this._right+aj;break}if(this.shadow){this.renderer.shadowRenderer.draw(am,[[at,ae],[ar,ae]],{lineCap:"butt",lineWidth:this.gridLineWidth*1.5,offset:this.gridLineWidth*0.75,fill:false,closePath:false})}ai(at,ae,ar,ae,{strokeStyle:ab.borderColor})}break;default:break}}}ah=null}ab=null;au=null}ag=["y3axis","y4axis","y5axis","y6axis","y7axis","y8axis","y9axis","yMidAxis"];for(var aq=7;aq>0;aq--){var ab=ap[ag[aq-1]];var au=ab._ticks;if(ab.show){var ac=au[ab.numberTicks-1];var af=au[0];var ad=ab.getLeft();var ao=[[ad,ac.getTop()+ac.getHeight()/2],[ad,af.getTop()+af.getHeight()/2+1]];if(this.shadow){this.renderer.shadowRenderer.draw(am,ao,{lineCap:"butt",fill:false,closePath:false})}ai(ao[0][0],ao[0][1],ao[1][0],ao[1][1],{lineCap:"butt",strokeStyle:ab.borderColor,lineWidth:ab.borderWidth});for(var an=au.length;an>0;an--){var ah=au[an-1];aj=ah.markSize;ak=ah.mark;var ae=Math.round(ab.u2p(ah.value))+0.5;if(ah.showMark&&ah.mark){switch(ak){case"outside":at=ad;ar=ad+aj;break;case"inside":at=ad-aj;ar=ad;break;case"cross":at=ad-aj;ar=ad+aj;break;default:at=ad;ar=ad+aj;break}ao=[[at,ae],[ar,ae]];if(this.shadow){this.renderer.shadowRenderer.draw(am,ao,{lineCap:"butt",lineWidth:this.gridLineWidth*1.5,offset:this.gridLineWidth*0.75,fill:false,closePath:false})}ai(at,ae,ar,ae,{strokeStyle:ab.borderColor})}ah=null}af=null}ab=null;au=null}am.restore();function ai(aB,aA,ay,ax,az){am.save();az=az||{};if(az.lineWidth==null||az.lineWidth!=0){H.extend(true,am,az);am.beginPath();am.moveTo(aB,aA);am.lineTo(ay,ax);am.stroke();am.restore()}}if(this.shadow){var ao=[[this._left,this._bottom],[this._right,this._bottom],[this._right,this._top]];this.renderer.shadowRenderer.draw(am,ao)}if(this.borderWidth!=0&&this.drawBorder){ai(this._left,this._top,this._right,this._top,{lineCap:"round",strokeStyle:ap.x2axis.borderColor,lineWidth:ap.x2axis.borderWidth});ai(this._right,this._top,this._right,this._bottom,{lineCap:"round",strokeStyle:ap.y2axis.borderColor,lineWidth:ap.y2axis.borderWidth});ai(this._right,this._bottom,this._left,this._bottom,{lineCap:"round",strokeStyle:ap.xaxis.borderColor,lineWidth:ap.xaxis.borderWidth});ai(this._left,this._bottom,this._left,this._top,{lineCap:"round",strokeStyle:ap.yaxis.borderColor,lineWidth:ap.yaxis.borderWidth})}am.restore();am=null;ap=null};H.jqplot.DivTitleRenderer=function(){};H.jqplot.DivTitleRenderer.prototype.init=function(ab){H.extend(true,this,ab)};H.jqplot.DivTitleRenderer.prototype.draw=function(){if(this._elem){this._elem.emptyForce();this._elem=null}var ae=this.renderer;var ad=document.createElement("div");this._elem=H(ad);this._elem.addClass("jqplot-title");if(!this.text){this.show=false;this._elem.height(0);this._elem.width(0)}else{if(this.text){var ab;if(this.color){ab=this.color}else{if(this.textColor){ab=this.textColor}}var ac={position:"absolute",top:"0px",left:"0px"};if(this._plotWidth){ac.width=this._plotWidth+"px"}if(this.fontSize){ac.fontSize=this.fontSize}if(typeof this.textAlign==="string"){ac.textAlign=this.textAlign}else{ac.textAlign="center"}if(ab){ac.color=ab}if(this.paddingBottom){ac.paddingBottom=this.paddingBottom}if(this.fontFamily){ac.fontFamily=this.fontFamily}this._elem.css(ac);if(this.escapeHtml){this._elem.text(this.text)}else{this._elem.html(this.text)}}}ad=null;return this._elem};H.jqplot.DivTitleRenderer.prototype.pack=function(){};var o=0.1;H.jqplot.LinePattern=function(ap,ak){var aj={dotted:[o,H.jqplot.config.dotGapLength],dashed:[H.jqplot.config.dashLength,H.jqplot.config.gapLength],solid:null};if(typeof ak==="string"){if(ak[0]==="."||ak[0]==="-"){var aq=ak;ak=[];for(var ai=0,af=aq.length;ai<af;ai++){if(aq[ai]==="."){ak.push(o)}else{if(aq[ai]==="-"){ak.push(H.jqplot.config.dashLength)}else{continue}}ak.push(H.jqplot.config.gapLength)}}else{ak=aj[ak]}}if(!(ak&&ak.length)){return ap}var ae=0;var al=ak[0];var an=0;var am=0;var ah=0;var ab=0;var ao=function(ar,at){ap.moveTo(ar,at);an=ar;am=at;ah=ar;ab=at};var ad=function(ar,ay){var aw=ap.lineWidth;var au=ar-an;var at=ay-am;var av=Math.sqrt(au*au+at*at);if((av>0)&&(aw>0)){au/=av;at/=av;while(true){var ax=aw*al;if(ax<av){an+=ax*au;am+=ax*at;if((ae&1)==0){ap.lineTo(an,am)}else{ap.moveTo(an,am)}av-=ax;ae++;if(ae>=ak.length){ae=0}al=ak[ae]}else{an=ar;am=ay;if((ae&1)==0){ap.lineTo(an,am)}else{ap.moveTo(an,am)}al-=av/aw;break}}}};var ac=function(){ap.beginPath()};var ag=function(){ad(ah,ab)};return{moveTo:ao,lineTo:ad,beginPath:ac,closePath:ag}};H.jqplot.LineRenderer=function(){this.shapeRenderer=new H.jqplot.ShapeRenderer();this.shadowRenderer=new H.jqplot.ShadowRenderer()};H.jqplot.LineRenderer.prototype.init=function(ac,ah){ac=ac||{};this._type="line";this.renderer.animation={show:false,direction:"left",speed:2500,_supported:true};this.renderer.smooth=false;this.renderer.tension=null;this.renderer.constrainSmoothing=true;this.renderer._smoothedData=[];this.renderer._smoothedPlotData=[];this.renderer._hiBandGridData=[];this.renderer._lowBandGridData=[];this.renderer._hiBandSmoothedData=[];this.renderer._lowBandSmoothedData=[];this.renderer.bandData=[];this.renderer.bands={show:false,hiData:[],lowData:[],color:this.color,showLines:false,fill:true,fillColor:null,_min:null,_max:null,interval:"3%"};var af={highlightMouseOver:ac.highlightMouseOver,highlightMouseDown:ac.highlightMouseDown,highlightColor:ac.highlightColor};delete (ac.highlightMouseOver);delete (ac.highlightMouseDown);delete (ac.highlightColor);H.extend(true,this.renderer,ac);this.renderer.options=ac;if(this.renderer.bandData.length>1&&(!ac.bands||ac.bands.show==null)){this.renderer.bands.show=true}else{if(ac.bands&&ac.bands.show==null&&ac.bands.interval!=null){this.renderer.bands.show=true}}if(this.fill){this.renderer.bands.show=false}if(this.renderer.bands.show){this.renderer.initBands.call(this,this.renderer.options,ah)}if(this._stack){this.renderer.smooth=false}var ag={lineJoin:this.lineJoin,lineCap:this.lineCap,fill:this.fill,isarc:false,strokeStyle:this.color,fillStyle:this.fillColor,lineWidth:this.lineWidth,linePattern:this.linePattern,closePath:this.fill};this.renderer.shapeRenderer.init(ag);var ad=ac.shadowOffset;if(ad==null){if(this.lineWidth>2.5){ad=1.25*(1+(Math.atan((this.lineWidth/2.5))/0.785398163-1)*0.6)}else{ad=1.25*Math.atan((this.lineWidth/2.5))/0.785398163}}var ab={lineJoin:this.lineJoin,lineCap:this.lineCap,fill:this.fill,isarc:false,angle:this.shadowAngle,offset:ad,alpha:this.shadowAlpha,depth:this.shadowDepth,lineWidth:this.lineWidth,linePattern:this.linePattern,closePath:this.fill};this.renderer.shadowRenderer.init(ab);this._areaPoints=[];this._boundingBox=[[],[]];if(!this.isTrendline&&this.fill||this.renderer.bands.show){this.highlightMouseOver=true;this.highlightMouseDown=false;this.highlightColor=null;if(af.highlightMouseDown&&af.highlightMouseOver==null){af.highlightMouseOver=false}H.extend(true,this,{highlightMouseOver:af.highlightMouseOver,highlightMouseDown:af.highlightMouseDown,highlightColor:af.highlightColor});if(!this.highlightColor){var ae=(this.renderer.bands.show)?this.renderer.bands.fillColor:this.fillColor;this.highlightColor=H.jqplot.computeHighlightColors(ae)}if(this.highlighter){this.highlighter.show=false}}if(!this.isTrendline&&ah){ah.plugins.lineRenderer={};ah.postInitHooks.addOnce(v);ah.postDrawHooks.addOnce(Z);ah.eventListenerHooks.addOnce("jqplotMouseMove",g);ah.eventListenerHooks.addOnce("jqplotMouseDown",d);ah.eventListenerHooks.addOnce("jqplotMouseUp",Y);ah.eventListenerHooks.addOnce("jqplotClick",f);ah.eventListenerHooks.addOnce("jqplotRightClick",p)}};H.jqplot.LineRenderer.prototype.initBands=function(ae,ao){var af=ae.bandData||[];var ah=this.renderer.bands;ah.hiData=[];ah.lowData=[];var av=this.data;ah._max=null;ah._min=null;if(af.length==2){if(H.isArray(af[0][0])){var ai;var ab=0,al=0;for(var ap=0,am=af[0].length;ap<am;ap++){ai=af[0][ap];if((ai[1]!=null&&ai[1]>ah._max)||ah._max==null){ah._max=ai[1]}if((ai[1]!=null&&ai[1]<ah._min)||ah._min==null){ah._min=ai[1]}}for(var ap=0,am=af[1].length;ap<am;ap++){ai=af[1][ap];if((ai[1]!=null&&ai[1]>ah._max)||ah._max==null){ah._max=ai[1];al=1}if((ai[1]!=null&&ai[1]<ah._min)||ah._min==null){ah._min=ai[1];ab=1}}if(al===ab){ah.show=false}ah.hiData=af[al];ah.lowData=af[ab]}else{if(af[0].length===av.length&&af[1].length===av.length){var ad=(af[0][0]>af[1][0])?0:1;var aw=(ad)?0:1;for(var ap=0,am=av.length;ap<am;ap++){ah.hiData.push([av[ap][0],af[ad][ap]]);ah.lowData.push([av[ap][0],af[aw][ap]])}}else{ah.show=false}}}else{if(af.length>2&&!H.isArray(af[0][0])){var ad=(af[0][0]>af[0][1])?0:1;var aw=(ad)?0:1;for(var ap=0,am=af.length;ap<am;ap++){ah.hiData.push([av[ap][0],af[ap][ad]]);ah.lowData.push([av[ap][0],af[ap][aw]])}}else{var ak=ah.interval;var au=null;var at=null;var ac=null;var an=null;if(H.isArray(ak)){au=ak[0];at=ak[1]}else{au=ak}if(isNaN(au)){if(au.charAt(au.length-1)==="%"){ac="multiply";au=parseFloat(au)/100+1}}else{au=parseFloat(au);ac="add"}if(at!==null&&isNaN(at)){if(at.charAt(at.length-1)==="%"){an="multiply";at=parseFloat(at)/100+1}}else{if(at!==null){at=parseFloat(at);an="add"}}if(au!==null){if(at===null){at=-au;an=ac;if(an==="multiply"){at+=2}}if(au<at){var aq=au;au=at;at=aq;aq=ac;ac=an;an=aq}for(var ap=0,am=av.length;ap<am;ap++){switch(ac){case"add":ah.hiData.push([av[ap][0],av[ap][1]+au]);break;case"multiply":ah.hiData.push([av[ap][0],av[ap][1]*au]);break}switch(an){case"add":ah.lowData.push([av[ap][0],av[ap][1]+at]);break;case"multiply":ah.lowData.push([av[ap][0],av[ap][1]*at]);break}}}else{ah.show=false}}}var ag=ah.hiData;var aj=ah.lowData;for(var ap=0,am=ag.length;ap<am;ap++){if((ag[ap][1]!=null&&ag[ap][1]>ah._max)||ah._max==null){ah._max=ag[ap][1]}}for(var ap=0,am=aj.length;ap<am;ap++){if((aj[ap][1]!=null&&aj[ap][1]<ah._min)||ah._min==null){ah._min=aj[ap][1]}}if(ah.fillColor===null){var ar=H.jqplot.getColorComponents(ah.color);ar[3]=ar[3]*0.5;ah.fillColor="rgba("+ar[0]+", "+ar[1]+", "+ar[2]+", "+ar[3]+")"}};function G(ac,ab){return(3.4182054+ab)*Math.pow(ac,-0.3534992)}function k(ad,ac){var ab=Math.sqrt(Math.pow((ac[0]-ad[0]),2)+Math.pow((ac[1]-ad[1]),2));return 5.7648*Math.log(ab)+7.4456}function w(ab){var ac=(Math.exp(2*ab)-1)/(Math.exp(2*ab)+1);return ac}function F(aD){var am=this.renderer.smooth;var ax=this.canvas.getWidth();var ah=this._xaxis.series_p2u;var aA=this._yaxis.series_p2u;var az=null;var ag=null;var at=aD.length/ax;var ad=[];var ar=[];if(!isNaN(parseFloat(am))){az=parseFloat(am)}else{az=G(at,0.5)}var ap=[];var ae=[];for(var ay=0,au=aD.length;ay<au;ay++){ap.push(aD[ay][1]);ae.push(aD[ay][0])}function ao(aE,aF){if(aE-aF==0){return Math.pow(10,10)}else{return aE-aF}}var aq,al,ak,aj;var ab=aD.length-1;for(var af=1,av=aD.length;af<av;af++){var ac=[];var an=[];for(var aw=0;aw<2;aw++){var ay=af-1+aw;if(ay==0||ay==ab){ac[aw]=Math.pow(10,10)}else{if(ap[ay+1]-ap[ay]==0||ap[ay]-ap[ay-1]==0){ac[aw]=0}else{if(((ae[ay+1]-ae[ay])/(ap[ay+1]-ap[ay])+(ae[ay]-ae[ay-1])/(ap[ay]-ap[ay-1]))==0){ac[aw]=0}else{if((ap[ay+1]-ap[ay])*(ap[ay]-ap[ay-1])<0){ac[aw]=0}else{ac[aw]=2/(ao(ae[ay+1],ae[ay])/(ap[ay+1]-ap[ay])+ao(ae[ay],ae[ay-1])/(ap[ay]-ap[ay-1]))}}}}}if(af==1){ac[0]=3/2*(ap[1]-ap[0])/ao(ae[1],ae[0])-ac[1]/2}else{if(af==ab){ac[1]=3/2*(ap[ab]-ap[ab-1])/ao(ae[ab],ae[ab-1])-ac[0]/2}}an[0]=-2*(ac[1]+2*ac[0])/ao(ae[af],ae[af-1])+6*(ap[af]-ap[af-1])/Math.pow(ao(ae[af],ae[af-1]),2);an[1]=2*(2*ac[1]+ac[0])/ao(ae[af],ae[af-1])-6*(ap[af]-ap[af-1])/Math.pow(ao(ae[af],ae[af-1]),2);aj=1/6*(an[1]-an[0])/ao(ae[af],ae[af-1]);ak=1/2*(ae[af]*an[0]-ae[af-1]*an[1])/ao(ae[af],ae[af-1]);al=(ap[af]-ap[af-1]-ak*(Math.pow(ae[af],2)-Math.pow(ae[af-1],2))-aj*(Math.pow(ae[af],3)-Math.pow(ae[af-1],3)))/ao(ae[af],ae[af-1]);aq=ap[af-1]-al*ae[af-1]-ak*Math.pow(ae[af-1],2)-aj*Math.pow(ae[af-1],3);var aC=(ae[af]-ae[af-1])/az;var aB,ai;for(var aw=0,au=az;aw<au;aw++){aB=[];ai=ae[af-1]+aw*aC;aB.push(ai);aB.push(aq+al*ai+ak*Math.pow(ai,2)+aj*Math.pow(ai,3));ad.push(aB);ar.push([ah(aB[0]),aA(aB[1])])}}ad.push(aD[ay]);ar.push([ah(aD[ay][0]),aA(aD[ay][1])]);return[ad,ar]}function B(aj){var ai=this.renderer.smooth;var aO=this.renderer.tension;var ab=this.canvas.getWidth();var aB=this._xaxis.series_p2u;var ak=this._yaxis.series_p2u;var aC=null;var aD=null;var aN=null;var aI=null;var aG=null;var am=null;var aL=null;var ag=null;var aE,aF,ax,aw,au,ar;var ae,ac,ao,an;var av,at,aH;var ap=[];var ad=[];var af=aj.length/ab;var aM,aq,az,aA,ay;var al=[];var ah=[];if(!isNaN(parseFloat(ai))){aC=parseFloat(ai)}else{aC=G(af,0.5)}if(!isNaN(parseFloat(aO))){aO=parseFloat(aO)}for(var aK=0,aJ=aj.length-1;aK<aJ;aK++){if(aO===null){am=Math.abs((aj[aK+1][1]-aj[aK][1])/(aj[aK+1][0]-aj[aK][0]));aM=0.3;aq=0.6;az=(aq-aM)/2;aA=2.5;ay=-1.4;ag=am/aA+ay;aI=az*w(ag)-az*w(ay)+aM;if(aK>0){aL=Math.abs((aj[aK][1]-aj[aK-1][1])/(aj[aK][0]-aj[aK-1][0]))}ag=aL/aA+ay;aG=az*w(ag)-az*w(ay)+aM;aN=(aI+aG)/2}else{aN=aO}for(aE=0;aE<aC;aE++){aF=aE/aC;ax=(1+2*aF)*Math.pow((1-aF),2);aw=aF*Math.pow((1-aF),2);au=Math.pow(aF,2)*(3-2*aF);ar=Math.pow(aF,2)*(aF-1);if(aj[aK-1]){ae=aN*(aj[aK+1][0]-aj[aK-1][0]);ac=aN*(aj[aK+1][1]-aj[aK-1][1])}else{ae=aN*(aj[aK+1][0]-aj[aK][0]);ac=aN*(aj[aK+1][1]-aj[aK][1])}if(aj[aK+2]){ao=aN*(aj[aK+2][0]-aj[aK][0]);an=aN*(aj[aK+2][1]-aj[aK][1])}else{ao=aN*(aj[aK+1][0]-aj[aK][0]);an=aN*(aj[aK+1][1]-aj[aK][1])}av=ax*aj[aK][0]+au*aj[aK+1][0]+aw*ae+ar*ao;at=ax*aj[aK][1]+au*aj[aK+1][1]+aw*ac+ar*an;aH=[av,at];al.push(aH);ah.push([aB(av),ak(at)])}}al.push(aj[aJ]);ah.push([aB(aj[aJ][0]),ak(aj[aJ][1])]);return[al,ah]}H.jqplot.LineRenderer.prototype.setGridData=function(aj){var af=this._xaxis.series_u2p;var ab=this._yaxis.series_u2p;var ag=this._plotData;var ak=this._prevPlotData;this.gridData=[];this._prevGridData=[];this.renderer._smoothedData=[];this.renderer._smoothedPlotData=[];this.renderer._hiBandGridData=[];this.renderer._lowBandGridData=[];this.renderer._hiBandSmoothedData=[];this.renderer._lowBandSmoothedData=[];var ae=this.renderer.bands;var ac=false;for(var ah=0,ad=this.data.length;ah<ad;ah++){if(ag[ah][0]!=null&&ag[ah][1]!=null){this.gridData.push([af.call(this._xaxis,ag[ah][0]),ab.call(this._yaxis,ag[ah][1])])}else{if(ag[ah][0]==null){ac=true;this.gridData.push([null,ab.call(this._yaxis,ag[ah][1])])}else{if(ag[ah][1]==null){ac=true;this.gridData.push([af.call(this._xaxis,ag[ah][0]),null])}}}if(ak[ah]!=null&&ak[ah][0]!=null&&ak[ah][1]!=null){this._prevGridData.push([af.call(this._xaxis,ak[ah][0]),ab.call(this._yaxis,ak[ah][1])])}else{if(ak[ah]!=null&&ak[ah][0]==null){this._prevGridData.push([null,ab.call(this._yaxis,ak[ah][1])])}else{if(ak[ah]!=null&&ak[ah][0]!=null&&ak[ah][1]==null){this._prevGridData.push([af.call(this._xaxis,ak[ah][0]),null])}}}}if(ac){this.renderer.smooth=false;if(this._type==="line"){ae.show=false}}if(this._type==="line"&&ae.show){for(var ah=0,ad=ae.hiData.length;ah<ad;ah++){this.renderer._hiBandGridData.push([af.call(this._xaxis,ae.hiData[ah][0]),ab.call(this._yaxis,ae.hiData[ah][1])])}for(var ah=0,ad=ae.lowData.length;ah<ad;ah++){this.renderer._lowBandGridData.push([af.call(this._xaxis,ae.lowData[ah][0]),ab.call(this._yaxis,ae.lowData[ah][1])])}}if(this._type==="line"&&this.renderer.smooth&&this.gridData.length>2){var ai;if(this.renderer.constrainSmoothing){ai=F.call(this,this.gridData);this.renderer._smoothedData=ai[0];this.renderer._smoothedPlotData=ai[1];if(ae.show){ai=F.call(this,this.renderer._hiBandGridData);this.renderer._hiBandSmoothedData=ai[0];ai=F.call(this,this.renderer._lowBandGridData);this.renderer._lowBandSmoothedData=ai[0]}ai=null}else{ai=B.call(this,this.gridData);this.renderer._smoothedData=ai[0];this.renderer._smoothedPlotData=ai[1];if(ae.show){ai=B.call(this,this.renderer._hiBandGridData);this.renderer._hiBandSmoothedData=ai[0];ai=B.call(this,this.renderer._lowBandGridData);this.renderer._lowBandSmoothedData=ai[0]}ai=null}}};H.jqplot.LineRenderer.prototype.makeGridData=function(ai,ak){var ag=this._xaxis.series_u2p;var ab=this._yaxis.series_u2p;var al=[];var ad=[];this.renderer._smoothedData=[];this.renderer._smoothedPlotData=[];this.renderer._hiBandGridData=[];this.renderer._lowBandGridData=[];this.renderer._hiBandSmoothedData=[];this.renderer._lowBandSmoothedData=[];var af=this.renderer.bands;var ac=false;for(var ah=0;ah<ai.length;ah++){if(ai[ah][0]!=null&&ai[ah][1]!=null){al.push([ag.call(this._xaxis,ai[ah][0]),ab.call(this._yaxis,ai[ah][1])])}else{if(ai[ah][0]==null){ac=true;al.push([null,ab.call(this._yaxis,ai[ah][1])])}else{if(ai[ah][1]==null){ac=true;al.push([ag.call(this._xaxis,ai[ah][0]),null])}}}}if(ac){this.renderer.smooth=false;if(this._type==="line"){af.show=false}}if(this._type==="line"&&af.show){for(var ah=0,ae=af.hiData.length;ah<ae;ah++){this.renderer._hiBandGridData.push([ag.call(this._xaxis,af.hiData[ah][0]),ab.call(this._yaxis,af.hiData[ah][1])])}for(var ah=0,ae=af.lowData.length;ah<ae;ah++){this.renderer._lowBandGridData.push([ag.call(this._xaxis,af.lowData[ah][0]),ab.call(this._yaxis,af.lowData[ah][1])])}}if(this._type==="line"&&this.renderer.smooth&&al.length>2){var aj;if(this.renderer.constrainSmoothing){aj=F.call(this,al);this.renderer._smoothedData=aj[0];this.renderer._smoothedPlotData=aj[1];if(af.show){aj=F.call(this,this.renderer._hiBandGridData);this.renderer._hiBandSmoothedData=aj[0];aj=F.call(this,this.renderer._lowBandGridData);this.renderer._lowBandSmoothedData=aj[0]}aj=null}else{aj=B.call(this,al);this.renderer._smoothedData=aj[0];this.renderer._smoothedPlotData=aj[1];if(af.show){aj=B.call(this,this.renderer._hiBandGridData);this.renderer._hiBandSmoothedData=aj[0];aj=B.call(this,this.renderer._lowBandGridData);this.renderer._lowBandSmoothedData=aj[0]}aj=null}}return al};H.jqplot.LineRenderer.prototype.draw=function(aq,aC,ac,av){var aw;var ak=H.extend(true,{},ac);var ae=(ak.shadow!=r)?ak.shadow:this.shadow;var aD=(ak.showLine!=r)?ak.showLine:this.showLine;var au=(ak.fill!=r)?ak.fill:this.fill;var ab=(ak.fillAndStroke!=r)?ak.fillAndStroke:this.fillAndStroke;var al,ar,ao,ay;aq.save();if(aC.length){if(aD){if(au){if(this.fillToZero){var az=this.negativeColor;if(!this.useNegativeColors){az=ak.fillStyle}var ai=false;var aj=ak.fillStyle;if(ab){var aB=aC.slice(0)}if(this.index==0||!this._stack){var ap=[];var aF=(this.renderer.smooth)?this.renderer._smoothedPlotData:this._plotData;this._areaPoints=[];var aA=this._yaxis.series_u2p(this.fillToValue);var ad=this._xaxis.series_u2p(this.fillToValue);ak.closePath=true;if(this.fillAxis=="y"){ap.push([aC[0][0],aA]);this._areaPoints.push([aC[0][0],aA]);for(var aw=0;aw<aC.length-1;aw++){ap.push(aC[aw]);this._areaPoints.push(aC[aw]);if(aF[aw][1]*aF[aw+1][1]<0){if(aF[aw][1]<0){ai=true;ak.fillStyle=az}else{ai=false;ak.fillStyle=aj}var ah=aC[aw][0]+(aC[aw+1][0]-aC[aw][0])*(aA-aC[aw][1])/(aC[aw+1][1]-aC[aw][1]);ap.push([ah,aA]);this._areaPoints.push([ah,aA]);if(ae){this.renderer.shadowRenderer.draw(aq,ap,ak)}this.renderer.shapeRenderer.draw(aq,ap,ak);ap=[[ah,aA]]}}if(aF[aC.length-1][1]<0){ai=true;ak.fillStyle=az}else{ai=false;ak.fillStyle=aj}ap.push(aC[aC.length-1]);this._areaPoints.push(aC[aC.length-1]);ap.push([aC[aC.length-1][0],aA]);this._areaPoints.push([aC[aC.length-1][0],aA])}if(ae){this.renderer.shadowRenderer.draw(aq,ap,ak)}this.renderer.shapeRenderer.draw(aq,ap,ak)}else{var an=this._prevGridData;for(var aw=an.length;aw>0;aw--){aC.push(an[aw-1])}if(ae){this.renderer.shadowRenderer.draw(aq,aC,ak)}this._areaPoints=aC;this.renderer.shapeRenderer.draw(aq,aC,ak)}}else{if(ab){var aB=aC.slice(0)}if(this.index==0||!this._stack){var af=aq.canvas.height;aC.unshift([aC[0][0],af]);var ax=aC.length;aC.push([aC[ax-1][0],af])}else{var an=this._prevGridData;for(var aw=an.length;aw>0;aw--){aC.push(an[aw-1])}}this._areaPoints=aC;if(ae){this.renderer.shadowRenderer.draw(aq,aC,ak)}this.renderer.shapeRenderer.draw(aq,aC,ak)}if(ab){var at=H.extend(true,{},ak,{fill:false,closePath:false});this.renderer.shapeRenderer.draw(aq,aB,at);if(this.markerRenderer.show){if(this.renderer.smooth){aB=this.gridData}for(aw=0;aw<aB.length;aw++){this.markerRenderer.draw(aB[aw][0],aB[aw][1],aq,ak.markerOptions)}}}}else{if(this.renderer.bands.show){var ag;var aE=H.extend(true,{},ak);if(this.renderer.bands.showLines){ag=(this.renderer.smooth)?this.renderer._hiBandSmoothedData:this.renderer._hiBandGridData;this.renderer.shapeRenderer.draw(aq,ag,ak);ag=(this.renderer.smooth)?this.renderer._lowBandSmoothedData:this.renderer._lowBandGridData;this.renderer.shapeRenderer.draw(aq,ag,aE)}if(this.renderer.bands.fill){if(this.renderer.smooth){ag=this.renderer._hiBandSmoothedData.concat(this.renderer._lowBandSmoothedData.reverse())}else{ag=this.renderer._hiBandGridData.concat(this.renderer._lowBandGridData.reverse())}this._areaPoints=ag;aE.closePath=true;aE.fill=true;aE.fillStyle=this.renderer.bands.fillColor;this.renderer.shapeRenderer.draw(aq,ag,aE)}}if(ae){this.renderer.shadowRenderer.draw(aq,aC,ak)}this.renderer.shapeRenderer.draw(aq,aC,ak)}}var al=ao=ar=ay=null;for(aw=0;aw<this._areaPoints.length;aw++){var am=this._areaPoints[aw];if(al>am[0]||al==null){al=am[0]}if(ay<am[1]||ay==null){ay=am[1]}if(ao<am[0]||ao==null){ao=am[0]}if(ar>am[1]||ar==null){ar=am[1]}}if(this.type==="line"&&this.renderer.bands.show){ay=this._yaxis.series_u2p(this.renderer.bands._min);ar=this._yaxis.series_u2p(this.renderer.bands._max)}this._boundingBox=[[al,ay],[ao,ar]];if(this.markerRenderer.show&&!au){if(this.renderer.smooth){aC=this.gridData}for(aw=0;aw<aC.length;aw++){if(aC[aw][0]!=null&&aC[aw][1]!=null){this.markerRenderer.draw(aC[aw][0],aC[aw][1],aq,ak.markerOptions)}}}}aq.restore()};H.jqplot.LineRenderer.prototype.drawShadow=function(ab,ad,ac){};function v(ae,ad,ab){for(var ac=0;ac<this.series.length;ac++){if(this.series[ac].renderer.constructor==H.jqplot.LineRenderer){if(this.series[ac].highlightMouseOver){this.series[ac].highlightMouseDown=false}}}}function Z(){if(this.plugins.lineRenderer&&this.plugins.lineRenderer.highlightCanvas){this.plugins.lineRenderer.highlightCanvas.resetCanvas();this.plugins.lineRenderer.highlightCanvas=null}this.plugins.lineRenderer.highlightedSeriesIndex=null;this.plugins.lineRenderer.highlightCanvas=new H.jqplot.GenericCanvas();this.eventCanvas._elem.before(this.plugins.lineRenderer.highlightCanvas.createElement(this._gridPadding,"jqplot-lineRenderer-highlight-canvas",this._plotDimensions,this));this.plugins.lineRenderer.highlightCanvas.setContext();this.eventCanvas._elem.bind("mouseleave",{plot:this},function(ab){V(ab.data.plot)})}function X(ah,ag,ae,ad){var ac=ah.series[ag];var ab=ah.plugins.lineRenderer.highlightCanvas;ab._ctx.clearRect(0,0,ab._ctx.canvas.width,ab._ctx.canvas.height);ac._highlightedPoint=ae;ah.plugins.lineRenderer.highlightedSeriesIndex=ag;var af={fillStyle:ac.highlightColor};if(ac.type==="line"&&ac.renderer.bands.show){af.fill=true;af.closePath=true}ac.renderer.shapeRenderer.draw(ab._ctx,ad,af);ab=null}function V(ad){var ab=ad.plugins.lineRenderer.highlightCanvas;ab._ctx.clearRect(0,0,ab._ctx.canvas.width,ab._ctx.canvas.height);for(var ac=0;ac<ad.series.length;ac++){ad.series[ac]._highlightedPoint=null}ad.plugins.lineRenderer.highlightedSeriesIndex=null;ad.target.trigger("jqplotDataUnhighlight");ab=null}function g(af,ae,ai,ah,ag){if(ah){var ad=[ah.seriesIndex,ah.pointIndex,ah.data];var ac=jQuery.Event("jqplotDataMouseOver");ac.pageX=af.pageX;ac.pageY=af.pageY;ag.target.trigger(ac,ad);if(ag.series[ad[0]].highlightMouseOver&&!(ad[0]==ag.plugins.lineRenderer.highlightedSeriesIndex)){var ab=jQuery.Event("jqplotDataHighlight");ab.pageX=af.pageX;ab.pageY=af.pageY;ag.target.trigger(ab,ad);X(ag,ah.seriesIndex,ah.pointIndex,ah.points)}}else{if(ah==null){V(ag)}}}function d(ae,ad,ah,ag,af){if(ag){var ac=[ag.seriesIndex,ag.pointIndex,ag.data];if(af.series[ac[0]].highlightMouseDown&&!(ac[0]==af.plugins.lineRenderer.highlightedSeriesIndex)){var ab=jQuery.Event("jqplotDataHighlight");ab.pageX=ae.pageX;ab.pageY=ae.pageY;af.target.trigger(ab,ac);X(af,ag.seriesIndex,ag.pointIndex,ag.points)}}else{if(ag==null){V(af)}}}function Y(ad,ac,ag,af,ae){var ab=ae.plugins.lineRenderer.highlightedSeriesIndex;if(ab!=null&&ae.series[ab].highlightMouseDown){V(ae)}}function f(ae,ad,ah,ag,af){if(ag){var ac=[ag.seriesIndex,ag.pointIndex,ag.data];var ab=jQuery.Event("jqplotDataClick");ab.pageX=ae.pageX;ab.pageY=ae.pageY;af.target.trigger(ab,ac)}}function p(af,ae,ai,ah,ag){if(ah){var ad=[ah.seriesIndex,ah.pointIndex,ah.data];var ab=ag.plugins.lineRenderer.highlightedSeriesIndex;if(ab!=null&&ag.series[ab].highlightMouseDown){V(ag)}var ac=jQuery.Event("jqplotDataRightClick");ac.pageX=af.pageX;ac.pageY=af.pageY;ag.target.trigger(ac,ad)}}H.jqplot.LinearAxisRenderer=function(){};H.jqplot.LinearAxisRenderer.prototype.init=function(ab){this.breakPoints=null;this.breakTickLabel="≈";this.drawBaseline=true;this.baselineWidth=null;this.baselineColor=null;this.forceTickAt0=false;this.forceTickAt100=false;this.tickInset=0;this.minorTicks=0;this.alignTicks=false;this._autoFormatString="";this._overrideFormatString=false;this._scalefact=1;H.extend(true,this,ab);if(this.breakPoints){if(!H.isArray(this.breakPoints)){this.breakPoints=null}else{if(this.breakPoints.length<2||this.breakPoints[1]<=this.breakPoints[0]){this.breakPoints=null}}}if(this.numberTicks!=null&&this.numberTicks<2){this.numberTicks=2}this.resetDataBounds()};H.jqplot.LinearAxisRenderer.prototype.draw=function(ab,ai){if(this.show){this.renderer.createTicks.call(this,ai);var ah=0;var ac;if(this._elem){this._elem.emptyForce();this._elem=null}this._elem=H(document.createElement("div"));this._elem.addClass("jqplot-axis jqplot-"+this.name);this._elem.css("position","absolute");if(this.name=="xaxis"||this.name=="x2axis"){this._elem.width(this._plotDimensions.width)}else{this._elem.height(this._plotDimensions.height)}this.labelOptions.axis=this.name;this._label=new this.labelRenderer(this.labelOptions);if(this._label.show){var ag=this._label.draw(ab,ai);ag.appendTo(this._elem);ag=null}var af=this._ticks;var ae;for(var ad=0;ad<af.length;ad++){ae=af[ad];if(ae.show&&ae.showLabel&&(!ae.isMinorTick||this.showMinorTicks)){this._elem.append(ae.draw(ab,ai))}}ae=null;af=null}return this._elem};H.jqplot.LinearAxisRenderer.prototype.reset=function(){this.min=this._options.min;this.max=this._options.max;this.tickInterval=this._options.tickInterval;this.numberTicks=this._options.numberTicks;this._autoFormatString="";if(this._overrideFormatString&&this.tickOptions&&this.tickOptions.formatString){this.tickOptions.formatString=""}};H.jqplot.LinearAxisRenderer.prototype.set=function(){var ai=0;var ad;var ac=0;var ah=0;var ab=(this._label==null)?false:this._label.show;if(this.show){var ag=this._ticks;var af;for(var ae=0;ae<ag.length;ae++){af=ag[ae];if(!af._breakTick&&af.show&&af.showLabel&&(!af.isMinorTick||this.showMinorTicks)){if(this.name=="xaxis"||this.name=="x2axis"){ad=af._elem.outerHeight(true)}else{ad=af._elem.outerWidth(true)}if(ad>ai){ai=ad}}}af=null;ag=null;if(ab){ac=this._label._elem.outerWidth(true);ah=this._label._elem.outerHeight(true)}if(this.name=="xaxis"){ai=ai+ah;this._elem.css({height:ai+"px",left:"0px",bottom:"0px"})}else{if(this.name=="x2axis"){ai=ai+ah;this._elem.css({height:ai+"px",left:"0px",top:"0px"})}else{if(this.name=="yaxis"){ai=ai+ac;this._elem.css({width:ai+"px",left:"0px",top:"0px"});if(ab&&this._label.constructor==H.jqplot.AxisLabelRenderer){this._label._elem.css("width",ac+"px")}}else{ai=ai+ac;this._elem.css({width:ai+"px",right:"0px",top:"0px"});if(ab&&this._label.constructor==H.jqplot.AxisLabelRenderer){this._label._elem.css("width",ac+"px")}}}}}};H.jqplot.LinearAxisRenderer.prototype.createTicks=function(ad){var aM=this._ticks;var aD=this.ticks;var at=this.name;var av=this._dataBounds;var ab=(this.name.charAt(0)==="x")?this._plotDimensions.width:this._plotDimensions.height;var ah;var aY,aB;var aj,ai;var aW,aT;var aA=this.min;var aX=this.max;var aP=this.numberTicks;var a2=this.tickInterval;var ag=30;this._scalefact=(Math.max(ab,ag+1)-ag)/300;if(aD.length){for(aT=0;aT<aD.length;aT++){var aH=aD[aT];var aN=new this.tickRenderer(this.tickOptions);if(H.isArray(aH)){aN.value=aH[0];if(this.breakPoints){if(aH[0]==this.breakPoints[0]){aN.label=this.breakTickLabel;aN._breakTick=true;aN.showGridline=false;aN.showMark=false}else{if(aH[0]>this.breakPoints[0]&&aH[0]<=this.breakPoints[1]){aN.show=false;aN.showGridline=false;aN.label=aH[1]}else{aN.label=aH[1]}}}else{aN.label=aH[1]}aN.setTick(aH[0],this.name);this._ticks.push(aN)}else{if(H.isPlainObject(aH)){H.extend(true,aN,aH);aN.axis=this.name;this._ticks.push(aN)}else{aN.value=aH;if(this.breakPoints){if(aH==this.breakPoints[0]){aN.label=this.breakTickLabel;aN._breakTick=true;aN.showGridline=false;aN.showMark=false}else{if(aH>this.breakPoints[0]&&aH<=this.breakPoints[1]){aN.show=false;aN.showGridline=false}}}aN.setTick(aH,this.name);this._ticks.push(aN)}}}this.numberTicks=aD.length;this.min=this._ticks[0].value;this.max=this._ticks[this.numberTicks-1].value;this.tickInterval=(this.max-this.min)/(this.numberTicks-1)}else{if(at=="xaxis"||at=="x2axis"){ab=this._plotDimensions.width}else{ab=this._plotDimensions.height}var aq=this.numberTicks;if(this.alignTicks){if(this.name==="x2axis"&&ad.axes.xaxis.show){aq=ad.axes.xaxis.numberTicks}else{if(this.name.charAt(0)==="y"&&this.name!=="yaxis"&&this.name!=="yMidAxis"&&ad.axes.yaxis.show){aq=ad.axes.yaxis.numberTicks}}}aY=((this.min!=null)?this.min:av.min);aB=((this.max!=null)?this.max:av.max);var ao=aB-aY;var aL,ar;var am;if(this.tickOptions==null||!this.tickOptions.formatString){this._overrideFormatString=true}if(this.min==null&&this.max==null&&this.tickInterval==null&&!this.autoscale){if(this.forceTickAt0){if(aY>0){aY=0}if(aB<0){aB=0}}if(this.forceTickAt100){if(aY>100){aY=100}if(aB<100){aB=100}}var aI=H.jqplot.LinearTickGenerator(aY,aB,this._scalefact,aq);var ap=aY+ao*(this.padMin-1);var aJ=aB-ao*(this.padMax-1);if(aY<ap||aB>aJ){ap=aY-ao*(this.padMin-1);aJ=aB+ao*(this.padMax-1);aI=H.jqplot.LinearTickGenerator(ap,aJ,this._scalefact,aq)}this.min=aI[0];this.max=aI[1];this.numberTicks=aI[2];this._autoFormatString=aI[3];this.tickInterval=aI[4]}else{if(aY==aB){var ac=0.05;if(aY>0){ac=Math.max(Math.log(aY)/Math.LN10,0.05)}aY-=ac;aB+=ac}if(this.autoscale&&this.min==null&&this.max==null){var ae,af,al;var aw=false;var aG=false;var au={min:null,max:null,average:null,stddev:null};for(var aT=0;aT<this._series.length;aT++){var aO=this._series[aT];var ax=(aO.fillAxis=="x")?aO._xaxis.name:aO._yaxis.name;if(this.name==ax){var aK=aO._plotValues[aO.fillAxis];var az=aK[0];var aU=aK[0];for(var aS=1;aS<aK.length;aS++){if(aK[aS]<az){az=aK[aS]}else{if(aK[aS]>aU){aU=aK[aS]}}}var an=(aU-az)/aU;if(aO.renderer.constructor==H.jqplot.BarRenderer){if(az>=0&&(aO.fillToZero||an>0.1)){aw=true}else{aw=false;if(aO.fill&&aO.fillToZero&&az<0&&aU>0){aG=true}else{aG=false}}}else{if(aO.fill){if(az>=0&&(aO.fillToZero||an>0.1)){aw=true}else{if(az<0&&aU>0&&aO.fillToZero){aw=false;aG=true}else{aw=false;aG=false}}}else{if(az<0){aw=false}}}}}if(aw){this.numberTicks=2+Math.ceil((ab-(this.tickSpacing-1))/this.tickSpacing);this.min=0;aA=0;af=aB/(this.numberTicks-1);am=Math.pow(10,Math.abs(Math.floor(Math.log(af)/Math.LN10)));if(af/am==parseInt(af/am,10)){af+=am}this.tickInterval=Math.ceil(af/am)*am;this.max=this.tickInterval*(this.numberTicks-1)}else{if(aG){this.numberTicks=2+Math.ceil((ab-(this.tickSpacing-1))/this.tickSpacing);var aC=Math.ceil(Math.abs(aY)/ao*(this.numberTicks-1));var a1=this.numberTicks-1-aC;af=Math.max(Math.abs(aY/aC),Math.abs(aB/a1));am=Math.pow(10,Math.abs(Math.floor(Math.log(af)/Math.LN10)));this.tickInterval=Math.ceil(af/am)*am;this.max=this.tickInterval*a1;this.min=-this.tickInterval*aC}else{if(this.numberTicks==null){if(this.tickInterval){this.numberTicks=3+Math.ceil(ao/this.tickInterval)}else{this.numberTicks=2+Math.ceil((ab-(this.tickSpacing-1))/this.tickSpacing)}}if(this.tickInterval==null){af=ao/(this.numberTicks-1);if(af<1){am=Math.pow(10,Math.abs(Math.floor(Math.log(af)/Math.LN10)))}else{am=1}this.tickInterval=Math.ceil(af*am*this.pad)/am}else{am=1/this.tickInterval}ae=this.tickInterval*(this.numberTicks-1);al=(ae-ao)/2;if(this.min==null){this.min=Math.floor(am*(aY-al))/am}if(this.max==null){this.max=this.min+ae}}}var ay=H.jqplot.getSignificantFigures(this.tickInterval);var aF;if(ay.digitsLeft>=ay.significantDigits){aF="%d"}else{var am=Math.max(0,5-ay.digitsLeft);am=Math.min(am,ay.digitsRight);aF="%."+am+"f"}this._autoFormatString=aF}else{aL=(this.min!=null)?this.min:aY-ao*(this.padMin-1);ar=(this.max!=null)?this.max:aB+ao*(this.padMax-1);ao=ar-aL;if(this.numberTicks==null){if(this.tickInterval!=null){this.numberTicks=Math.ceil((ar-aL)/this.tickInterval)+1}else{if(ab>100){this.numberTicks=parseInt(3+(ab-100)/75,10)}else{this.numberTicks=2}}}if(this.tickInterval==null){this.tickInterval=ao/(this.numberTicks-1)}if(this.max==null){ar=aL+this.tickInterval*(this.numberTicks-1)}if(this.min==null){aL=ar-this.tickInterval*(this.numberTicks-1)}var ay=H.jqplot.getSignificantFigures(this.tickInterval);var aF;if(ay.digitsLeft>=ay.significantDigits){aF="%d"}else{var am=Math.max(0,5-ay.digitsLeft);am=Math.min(am,ay.digitsRight);aF="%."+am+"f"}this._autoFormatString=aF;this.min=aL;this.max=ar}if(this.renderer.constructor==H.jqplot.LinearAxisRenderer&&this._autoFormatString==""){ao=this.max-this.min;var aZ=new this.tickRenderer(this.tickOptions);var aE=aZ.formatString||H.jqplot.config.defaultTickFormatString;var aE=aE.match(H.jqplot.sprintf.regex)[0];var aV=0;if(aE){if(aE.search(/[fFeEgGpP]/)>-1){var aR=aE.match(/\%\.(\d{0,})?[eEfFgGpP]/);if(aR){aV=parseInt(aR[1],10)}else{aV=6}}else{if(aE.search(/[di]/)>-1){aV=0}}var ak=Math.pow(10,-aV);if(this.tickInterval<ak){if(aP==null&&a2==null){this.tickInterval=ak;if(aX==null&&aA==null){this.min=Math.floor(this._dataBounds.min/ak)*ak;if(this.min==this._dataBounds.min){this.min=this._dataBounds.min-this.tickInterval}this.max=Math.ceil(this._dataBounds.max/ak)*ak;if(this.max==this._dataBounds.max){this.max=this._dataBounds.max+this.tickInterval}var aQ=(this.max-this.min)/this.tickInterval;aQ=aQ.toFixed(11);aQ=Math.ceil(aQ);this.numberTicks=aQ+1}else{if(aX==null){var aQ=(this._dataBounds.max-this.min)/this.tickInterval;aQ=aQ.toFixed(11);this.numberTicks=Math.ceil(aQ)+2;this.max=this.min+this.tickInterval*(this.numberTicks-1)}else{if(aA==null){var aQ=(this.max-this._dataBounds.min)/this.tickInterval;aQ=aQ.toFixed(11);this.numberTicks=Math.ceil(aQ)+2;this.min=this.max-this.tickInterval*(this.numberTicks-1)}else{this.numberTicks=Math.ceil((aX-aA)/this.tickInterval)+1;this.min=Math.floor(aA*Math.pow(10,aV))/Math.pow(10,aV);this.max=Math.ceil(aX*Math.pow(10,aV))/Math.pow(10,aV);this.numberTicks=Math.ceil((this.max-this.min)/this.tickInterval)+1}}}}}}}}if(this._overrideFormatString&&this._autoFormatString!=""){this.tickOptions=this.tickOptions||{};this.tickOptions.formatString=this._autoFormatString}var aN,a0;for(var aT=0;aT<this.numberTicks;aT++){aW=this.min+aT*this.tickInterval;aN=new this.tickRenderer(this.tickOptions);aN.setTick(aW,this.name);this._ticks.push(aN);if(aT<this.numberTicks-1){for(var aS=0;aS<this.minorTicks;aS++){aW+=this.tickInterval/(this.minorTicks+1);a0=H.extend(true,{},this.tickOptions,{name:this.name,value:aW,label:"",isMinorTick:true});aN=new this.tickRenderer(a0);this._ticks.push(aN)}}aN=null}}if(this.tickInset){this.min=this.min-this.tickInset*this.tickInterval;this.max=this.max+this.tickInset*this.tickInterval}aM=null};H.jqplot.LinearAxisRenderer.prototype.resetTickValues=function(ad){if(H.isArray(ad)&&ad.length==this._ticks.length){var ac;for(var ab=0;ab<ad.length;ab++){ac=this._ticks[ab];ac.value=ad[ab];ac.label=ac.formatter(ac.formatString,ad[ab]);ac.label=ac.prefix+ac.label;ac._elem.html(ac.label)}ac=null;this.min=H.jqplot.arrayMin(ad);this.max=H.jqplot.arrayMax(ad);this.pack()}};H.jqplot.LinearAxisRenderer.prototype.pack=function(ad,ac){ad=ad||{};ac=ac||this._offsets;var ar=this._ticks;var an=this.max;var am=this.min;var ai=ac.max;var ag=ac.min;var ak=(this._label==null)?false:this._label.show;for(var al in ad){this._elem.css(al,ad[al])}this._offsets=ac;var ae=ai-ag;var af=an-am;if(this.breakPoints){af=af-this.breakPoints[1]+this.breakPoints[0];this.p2u=function(au){return(au-ag)*af/ae+am};this.u2p=function(au){if(au>this.breakPoints[0]&&au<this.breakPoints[1]){au=this.breakPoints[0]}if(au<=this.breakPoints[0]){return(au-am)*ae/af+ag}else{return(au-this.breakPoints[1]+this.breakPoints[0]-am)*ae/af+ag}};if(this.name.charAt(0)=="x"){this.series_u2p=function(au){if(au>this.breakPoints[0]&&au<this.breakPoints[1]){au=this.breakPoints[0]}if(au<=this.breakPoints[0]){return(au-am)*ae/af}else{return(au-this.breakPoints[1]+this.breakPoints[0]-am)*ae/af}};this.series_p2u=function(au){return au*af/ae+am}}else{this.series_u2p=function(au){if(au>this.breakPoints[0]&&au<this.breakPoints[1]){au=this.breakPoints[0]}if(au>=this.breakPoints[1]){return(au-an)*ae/af}else{return(au+this.breakPoints[1]-this.breakPoints[0]-an)*ae/af}};this.series_p2u=function(au){return au*af/ae+an}}}else{this.p2u=function(au){return(au-ag)*af/ae+am};this.u2p=function(au){return(au-am)*ae/af+ag};if(this.name=="xaxis"||this.name=="x2axis"){this.series_u2p=function(au){return(au-am)*ae/af};this.series_p2u=function(au){return au*af/ae+am}}else{this.series_u2p=function(au){return(au-an)*ae/af};this.series_p2u=function(au){return au*af/ae+an}}}if(this.show){if(this.name=="xaxis"||this.name=="x2axis"){for(var ao=0;ao<ar.length;ao++){var aj=ar[ao];if(aj.show&&aj.showLabel){var ab;if(aj.constructor==H.jqplot.CanvasAxisTickRenderer&&aj.angle){var aq=(this.name=="xaxis")?1:-1;switch(aj.labelPosition){case"auto":if(aq*aj.angle<0){ab=-aj.getWidth()+aj._textRenderer.height*Math.sin(-aj._textRenderer.angle)/2}else{ab=-aj._textRenderer.height*Math.sin(aj._textRenderer.angle)/2}break;case"end":ab=-aj.getWidth()+aj._textRenderer.height*Math.sin(-aj._textRenderer.angle)/2;break;case"start":ab=-aj._textRenderer.height*Math.sin(aj._textRenderer.angle)/2;break;case"middle":ab=-aj.getWidth()/2+aj._textRenderer.height*Math.sin(-aj._textRenderer.angle)/2;break;default:ab=-aj.getWidth()/2+aj._textRenderer.height*Math.sin(-aj._textRenderer.angle)/2;break}}else{ab=-aj.getWidth()/2}var at=this.u2p(aj.value)+ab+"px";aj._elem.css("left",at);aj.pack()}}if(ak){var ah=this._label._elem.outerWidth(true);this._label._elem.css("left",ag+ae/2-ah/2+"px");if(this.name=="xaxis"){this._label._elem.css("bottom","0px")}else{this._label._elem.css("top","0px")}this._label.pack()}}else{for(var ao=0;ao<ar.length;ao++){var aj=ar[ao];if(aj.show&&aj.showLabel){var ab;if(aj.constructor==H.jqplot.CanvasAxisTickRenderer&&aj.angle){var aq=(this.name=="yaxis")?1:-1;switch(aj.labelPosition){case"auto":case"end":if(aq*aj.angle<0){ab=-aj._textRenderer.height*Math.cos(-aj._textRenderer.angle)/2}else{ab=-aj.getHeight()+aj._textRenderer.height*Math.cos(aj._textRenderer.angle)/2}break;case"start":if(aj.angle>0){ab=-aj._textRenderer.height*Math.cos(-aj._textRenderer.angle)/2}else{ab=-aj.getHeight()+aj._textRenderer.height*Math.cos(aj._textRenderer.angle)/2}break;case"middle":ab=-aj.getHeight()/2;break;default:ab=-aj.getHeight()/2;break}}else{ab=-aj.getHeight()/2}var at=this.u2p(aj.value)+ab+"px";aj._elem.css("top",at);aj.pack()}}if(ak){var ap=this._label._elem.outerHeight(true);this._label._elem.css("top",ai-ae/2-ap/2+"px");if(this.name=="yaxis"){this._label._elem.css("left","0px")}else{this._label._elem.css("right","0px")}this._label.pack()}}}ar=null};function h(ac){var ab;ac=Math.abs(ac);if(ac>=10){ab="%d"}else{if(ac>1){if(ac===parseInt(ac,10)){ab="%d"}else{ab="%.1f"}}else{var ad=-Math.floor(Math.log(ac)/Math.LN10);ab="%."+ad+"f"}}return ab}var a=[0.1,0.2,0.3,0.4,0.5,0.8,1,2,3,4,5];var b=function(ac){var ab=a.indexOf(ac);if(ab>0){return a[ab-1]}else{return a[a.length-1]/100}};var i=function(ac){var ab=a.indexOf(ac);if(ab<a.length-1){return a[ab+1]}else{return a[0]*100}};function c(af,an,am){var ak=Math.floor(am/2);var ac=Math.ceil(am*1.5);var ae=Number.MAX_VALUE;var ab=(an-af);var aq;var aj;var al;var ap;var ah;var ar=H.jqplot.getSignificantFigures;var ai;var ao;for(var ag=0,ad=ac-ak+1;ag<ad;ag++){ai=ak+ag;aq=ab/(ai-1);aj=ar(aq);aq=Math.abs(am-ai)+aj.digitsRight;if(aq<ae){ae=aq;al=ai;ao=aj.digitsRight}else{if(aq===ae){if(aj.digitsRight<ao){al=ai;ao=aj.digitsRight}}}}ap=Math.max(ao,Math.max(ar(af).digitsRight,ar(an).digitsRight));if(ap===0){ah="%d"}else{ah="%."+ap+"f"}aq=ab/(al-1);return[af,an,al,ah,aq]}function S(ac,af){af=af||7;var ae=ac/(af-1);var ad=Math.pow(10,Math.floor(Math.log(ae)/Math.LN10));var ag=ae/ad;var ab;if(ad<1){if(ag>5){ab=10*ad}else{if(ag>2){ab=5*ad}else{if(ag>1){ab=2*ad}else{ab=ad}}}}else{if(ag>5){ab=10*ad}else{if(ag>4){ab=5*ad}else{if(ag>3){ab=4*ad}else{if(ag>2){ab=3*ad}else{if(ag>1){ab=2*ad}else{ab=ad}}}}}}return ab}function M(ac,ab){ab=ab||1;var ae=Math.floor(Math.log(ac)/Math.LN10);var ag=Math.pow(10,ae);var af=ac/ag;var ad;af=af/ab;if(af<=0.38){ad=0.1}else{if(af<=1.6){ad=0.2}else{if(af<=4){ad=0.5}else{if(af<=8){ad=1}else{if(af<=16){ad=2}else{ad=5}}}}}return ad*ag}function t(ad,ac){var af=Math.floor(Math.log(ad)/Math.LN10);var ah=Math.pow(10,af);var ag=ad/ah;var ab;var ae;ag=ag/ac;if(ag<=0.38){ae=0.1}else{if(ag<=1.6){ae=0.2}else{if(ag<=4){ae=0.5}else{if(ag<=8){ae=1}else{if(ag<=16){ae=2}else{ae=5}}}}}ab=ae*ah;return[ab,ae,ah]}H.jqplot.LinearTickGenerator=function(ag,ah,ad,ae){if(ag===ah){ah=(ah)?0:1}ad=ad||1;if(ah<ag){var ai=ah;ah=ag;ag=ai}var ac=[];var aj=M(ah-ag,ad);if(ae==null){ac[0]=Math.floor(ag/aj)*aj;ac[1]=Math.ceil(ah/aj)*aj;ac[2]=Math.round((ac[1]-ac[0])/aj+1);ac[3]=h(aj);ac[4]=aj}else{var af=[];af[0]=Math.floor(ag/aj)*aj;af[1]=Math.ceil(ah/aj)*aj;af[2]=Math.round((af[1]-af[0])/aj+1);af[3]=h(aj);af[4]=aj;if(af[2]===ae){ac=af}else{var ab=S(af[1]-af[0],ae);ac[0]=af[0];ac[2]=ae;ac[4]=ab;ac[3]=h(ab);ac[1]=ac[0]+(ac[2]-1)*ac[4]}}return ac};H.jqplot.LinearTickGenerator.bestLinearInterval=M;H.jqplot.LinearTickGenerator.bestInterval=S;H.jqplot.LinearTickGenerator.bestLinearComponents=t;H.jqplot.LinearTickGenerator.bestConstrainedInterval=c;H.jqplot.MarkerRenderer=function(ab){this.show=true;this.style="filledCircle";this.lineWidth=2;this.size=9;this.color="#666666";this.shadow=true;this.shadowAngle=45;this.shadowOffset=1;this.shadowDepth=3;this.shadowAlpha="0.07";this.shadowRenderer=new H.jqplot.ShadowRenderer();this.shapeRenderer=new H.jqplot.ShapeRenderer();H.extend(true,this,ab)};H.jqplot.MarkerRenderer.prototype.init=function(ab){H.extend(true,this,ab);var ad={angle:this.shadowAngle,offset:this.shadowOffset,alpha:this.shadowAlpha,lineWidth:this.lineWidth,depth:this.shadowDepth,closePath:true};if(this.style.indexOf("filled")!=-1){ad.fill=true}if(this.style.indexOf("ircle")!=-1){ad.isarc=true;ad.closePath=false}this.shadowRenderer.init(ad);var ac={fill:false,isarc:false,strokeStyle:this.color,fillStyle:this.color,lineWidth:this.lineWidth,closePath:true};if(this.style.indexOf("filled")!=-1){ac.fill=true}if(this.style.indexOf("ircle")!=-1){ac.isarc=true;ac.closePath=false}this.shapeRenderer.init(ac)};H.jqplot.MarkerRenderer.prototype.drawDiamond=function(ad,ac,ag,af,ai){var ab=1.2;var aj=this.size/2/ab;var ah=this.size/2*ab;var ae=[[ad-aj,ac],[ad,ac+ah],[ad+aj,ac],[ad,ac-ah]];if(this.shadow){this.shadowRenderer.draw(ag,ae)}this.shapeRenderer.draw(ag,ae,ai)};H.jqplot.MarkerRenderer.prototype.drawPlus=function(ae,ad,ah,ag,ak){var ac=1;var al=this.size/2*ac;var ai=this.size/2*ac;var aj=[[ae,ad-ai],[ae,ad+ai]];var af=[[ae+al,ad],[ae-al,ad]];var ab=H.extend(true,{},this.options,{closePath:false});if(this.shadow){this.shadowRenderer.draw(ah,aj,{closePath:false});this.shadowRenderer.draw(ah,af,{closePath:false})}this.shapeRenderer.draw(ah,aj,ab);this.shapeRenderer.draw(ah,af,ab)};H.jqplot.MarkerRenderer.prototype.drawX=function(ae,ad,ah,ag,ak){var ac=1;var al=this.size/2*ac;var ai=this.size/2*ac;var ab=H.extend(true,{},this.options,{closePath:false});var aj=[[ae-al,ad-ai],[ae+al,ad+ai]];var af=[[ae-al,ad+ai],[ae+al,ad-ai]];if(this.shadow){this.shadowRenderer.draw(ah,aj,{closePath:false});this.shadowRenderer.draw(ah,af,{closePath:false})}this.shapeRenderer.draw(ah,aj,ab);this.shapeRenderer.draw(ah,af,ab)};H.jqplot.MarkerRenderer.prototype.drawDash=function(ad,ac,ag,af,ai){var ab=1;var aj=this.size/2*ab;var ah=this.size/2*ab;var ae=[[ad-aj,ac],[ad+aj,ac]];if(this.shadow){this.shadowRenderer.draw(ag,ae)}this.shapeRenderer.draw(ag,ae,ai)};H.jqplot.MarkerRenderer.prototype.drawLine=function(ag,af,ab,ae,ac){var ad=[ag,af];if(this.shadow){this.shadowRenderer.draw(ab,ad)}this.shapeRenderer.draw(ab,ad,ac)};H.jqplot.MarkerRenderer.prototype.drawSquare=function(ad,ac,ag,af,ai){var ab=1;var aj=this.size/2/ab;var ah=this.size/2*ab;var ae=[[ad-aj,ac-ah],[ad-aj,ac+ah],[ad+aj,ac+ah],[ad+aj,ac-ah]];if(this.shadow){this.shadowRenderer.draw(ag,ae)}this.shapeRenderer.draw(ag,ae,ai)};H.jqplot.MarkerRenderer.prototype.drawCircle=function(ac,ai,ae,ah,af){var ab=this.size/2;var ad=2*Math.PI;var ag=[ac,ai,ab,0,ad,true];if(this.shadow){this.shadowRenderer.draw(ae,ag)}this.shapeRenderer.draw(ae,ag,af)};H.jqplot.MarkerRenderer.prototype.draw=function(ab,ae,ac,ad){ad=ad||{};if(ad.show==null||ad.show!=false){if(ad.color&&!ad.fillStyle){ad.fillStyle=ad.color}if(ad.color&&!ad.strokeStyle){ad.strokeStyle=ad.color}switch(this.style){case"diamond":this.drawDiamond(ab,ae,ac,false,ad);break;case"filledDiamond":this.drawDiamond(ab,ae,ac,true,ad);break;case"circle":this.drawCircle(ab,ae,ac,false,ad);break;case"filledCircle":this.drawCircle(ab,ae,ac,true,ad);break;case"square":this.drawSquare(ab,ae,ac,false,ad);break;case"filledSquare":this.drawSquare(ab,ae,ac,true,ad);break;case"x":this.drawX(ab,ae,ac,true,ad);break;case"plus":this.drawPlus(ab,ae,ac,true,ad);break;case"dash":this.drawDash(ab,ae,ac,true,ad);break;case"line":this.drawLine(ab,ae,ac,false,ad);break;default:this.drawDiamond(ab,ae,ac,false,ad);break}}};H.jqplot.ShadowRenderer=function(ab){this.angle=45;this.offset=1;this.alpha=0.07;this.lineWidth=1.5;this.lineJoin="miter";this.lineCap="round";this.closePath=false;this.fill=false;this.depth=3;this.strokeStyle="rgba(0,0,0,0.1)";this.isarc=false;H.extend(true,this,ab)};H.jqplot.ShadowRenderer.prototype.init=function(ab){H.extend(true,this,ab)};H.jqplot.ShadowRenderer.prototype.draw=function(ao,am,aq){ao.save();var ab=(aq!=null)?aq:{};var an=(ab.fill!=null)?ab.fill:this.fill;var aj=(ab.fillRect!=null)?ab.fillRect:this.fillRect;var ai=(ab.closePath!=null)?ab.closePath:this.closePath;var af=(ab.offset!=null)?ab.offset:this.offset;var ad=(ab.alpha!=null)?ab.alpha:this.alpha;var ah=(ab.depth!=null)?ab.depth:this.depth;var ap=(ab.isarc!=null)?ab.isarc:this.isarc;var ak=(ab.linePattern!=null)?ab.linePattern:this.linePattern;ao.lineWidth=(ab.lineWidth!=null)?ab.lineWidth:this.lineWidth;ao.lineJoin=(ab.lineJoin!=null)?ab.lineJoin:this.lineJoin;ao.lineCap=(ab.lineCap!=null)?ab.lineCap:this.lineCap;ao.strokeStyle=ab.strokeStyle||this.strokeStyle||"rgba(0,0,0,"+ad+")";ao.fillStyle=ab.fillStyle||this.fillStyle||"rgba(0,0,0,"+ad+")";for(var ae=0;ae<ah;ae++){var al=H.jqplot.LinePattern(ao,ak);ao.translate(Math.cos(this.angle*Math.PI/180)*af,Math.sin(this.angle*Math.PI/180)*af);al.beginPath();if(ap){ao.arc(am[0],am[1],am[2],am[3],am[4],true)}else{if(aj){if(aj){ao.fillRect(am[0],am[1],am[2],am[3])}}else{if(am&&am.length){var ac=true;for(var ag=0;ag<am.length;ag++){if(am[ag][0]!=null&&am[ag][1]!=null){if(ac){al.moveTo(am[ag][0],am[ag][1]);ac=false}else{al.lineTo(am[ag][0],am[ag][1])}}else{ac=true}}}}}if(ai){al.closePath()}if(an){ao.fill()}else{ao.stroke()}}ao.restore()};H.jqplot.ShapeRenderer=function(ab){this.lineWidth=1.5;this.linePattern="solid";this.lineJoin="miter";this.lineCap="round";this.closePath=false;this.fill=false;this.isarc=false;this.fillRect=false;this.strokeRect=false;this.clearRect=false;this.strokeStyle="#999999";this.fillStyle="#999999";H.extend(true,this,ab)};H.jqplot.ShapeRenderer.prototype.init=function(ab){H.extend(true,this,ab)};H.jqplot.ShapeRenderer.prototype.draw=function(am,ak,ao){am.save();var ab=(ao!=null)?ao:{};var al=(ab.fill!=null)?ab.fill:this.fill;var ag=(ab.closePath!=null)?ab.closePath:this.closePath;var ah=(ab.fillRect!=null)?ab.fillRect:this.fillRect;var ae=(ab.strokeRect!=null)?ab.strokeRect:this.strokeRect;var ac=(ab.clearRect!=null)?ab.clearRect:this.clearRect;var an=(ab.isarc!=null)?ab.isarc:this.isarc;var ai=(ab.linePattern!=null)?ab.linePattern:this.linePattern;var aj=H.jqplot.LinePattern(am,ai);am.lineWidth=ab.lineWidth||this.lineWidth;am.lineJoin=ab.lineJoin||this.lineJoin;am.lineCap=ab.lineCap||this.lineCap;am.strokeStyle=(ab.strokeStyle||ab.color)||this.strokeStyle;am.fillStyle=ab.fillStyle||this.fillStyle;am.beginPath();if(an){am.arc(ak[0],ak[1],ak[2],ak[3],ak[4],true);if(ag){am.closePath()}if(al){am.fill()}else{am.stroke()}am.restore();return}else{if(ac){am.clearRect(ak[0],ak[1],ak[2],ak[3]);am.restore();return}else{if(ah||ae){if(ah){am.fillRect(ak[0],ak[1],ak[2],ak[3])}if(ae){am.strokeRect(ak[0],ak[1],ak[2],ak[3]);am.restore();return}}else{if(ak&&ak.length){var ad=true;for(var af=0;af<ak.length;af++){if(ak[af][0]!=null&&ak[af][1]!=null){if(ad){aj.moveTo(ak[af][0],ak[af][1]);ad=false}else{aj.lineTo(ak[af][0],ak[af][1])}}else{ad=true}}if(ag){aj.closePath()}if(al){am.fill()}else{am.stroke()}}}}}am.restore()};H.jqplot.TableLegendRenderer=function(){};H.jqplot.TableLegendRenderer.prototype.init=function(ab){H.extend(true,this,ab)};H.jqplot.TableLegendRenderer.prototype.addrow=function(ak,ae,ab,ai){var af=(ab)?this.rowSpacing+"px":"0px";var aj;var ad;var ac;var ah;var ag;ac=document.createElement("tr");aj=H(ac);aj.addClass("jqplot-table-legend");ac=null;if(ai){aj.prependTo(this._elem)}else{aj.appendTo(this._elem)}if(this.showSwatches){ad=H(document.createElement("td"));ad.addClass("jqplot-table-legend jqplot-table-legend-swatch");ad.css({textAlign:"center",paddingTop:af});ah=H(document.createElement("div"));ah.addClass("jqplot-table-legend-swatch-outline");ag=H(document.createElement("div"));ag.addClass("jqplot-table-legend-swatch");ag.css({backgroundColor:ae,borderColor:ae});aj.append(ad.append(ah.append(ag)))}if(this.showLabels){ad=H(document.createElement("td"));ad.addClass("jqplot-table-legend jqplot-table-legend-label");ad.css("paddingTop",af);aj.append(ad);if(this.escapeHtml){ad.text(ak)}else{ad.html(ak)}}ad=null;ah=null;ag=null;aj=null;ac=null};H.jqplot.TableLegendRenderer.prototype.draw=function(){if(this._elem){this._elem.emptyForce();this._elem=null}if(this.show){var ag=this._series;var ac=document.createElement("table");this._elem=H(ac);this._elem.addClass("jqplot-table-legend");var al={position:"absolute"};if(this.background){al.background=this.background}if(this.border){al.border=this.border}if(this.fontSize){al.fontSize=this.fontSize}if(this.fontFamily){al.fontFamily=this.fontFamily}if(this.textColor){al.textColor=this.textColor}if(this.marginTop!=null){al.marginTop=this.marginTop}if(this.marginBottom!=null){al.marginBottom=this.marginBottom}if(this.marginLeft!=null){al.marginLeft=this.marginLeft}if(this.marginRight!=null){al.marginRight=this.marginRight}var ab=false,ai=false,ak;for(var ah=0;ah<ag.length;ah++){ak=ag[ah];if(ak._stack||ak.renderer.constructor==H.jqplot.BezierCurveRenderer){ai=true}if(ak.show&&ak.showLabel){var af=this.labels[ah]||ak.label.toString();if(af){var ad=ak.color;if(ai&&ah<ag.length-1){ab=true}else{if(ai&&ah==ag.length-1){ab=false}}this.renderer.addrow.call(this,af,ad,ab,ai);ab=true}for(var ae=0;ae<H.jqplot.addLegendRowHooks.length;ae++){var aj=H.jqplot.addLegendRowHooks[ae].call(this,ak);if(aj){this.renderer.addrow.call(this,aj.label,aj.color,ab);ab=true}}af=null}}}return this._elem};H.jqplot.TableLegendRenderer.prototype.pack=function(ad){if(this.show){if(this.placement=="insideGrid"){switch(this.location){case"nw":var ac=ad.left;var ab=ad.top;this._elem.css("left",ac);this._elem.css("top",ab);break;case"n":var ac=(ad.left+(this._plotDimensions.width-ad.right))/2-this.getWidth()/2;var ab=ad.top;this._elem.css("left",ac);this._elem.css("top",ab);break;case"ne":var ac=ad.right;var ab=ad.top;this._elem.css({right:ac,top:ab});break;case"e":var ac=ad.right;var ab=(ad.top+(this._plotDimensions.height-ad.bottom))/2-this.getHeight()/2;this._elem.css({right:ac,top:ab});break;case"se":var ac=ad.right;var ab=ad.bottom;this._elem.css({right:ac,bottom:ab});break;case"s":var ac=(ad.left+(this._plotDimensions.width-ad.right))/2-this.getWidth()/2;var ab=ad.bottom;this._elem.css({left:ac,bottom:ab});break;case"sw":var ac=ad.left;var ab=ad.bottom;this._elem.css({left:ac,bottom:ab});break;case"w":var ac=ad.left;var ab=(ad.top+(this._plotDimensions.height-ad.bottom))/2-this.getHeight()/2;this._elem.css({left:ac,top:ab});break;default:var ac=ad.right;var ab=ad.bottom;this._elem.css({right:ac,bottom:ab});break}}else{if(this.placement=="outside"){switch(this.location){case"nw":var ac=this._plotDimensions.width-ad.left;var ab=ad.top;this._elem.css("right",ac);this._elem.css("top",ab);break;case"n":var ac=(ad.left+(this._plotDimensions.width-ad.right))/2-this.getWidth()/2;var ab=this._plotDimensions.height-ad.top;this._elem.css("left",ac);this._elem.css("bottom",ab);break;case"ne":var ac=this._plotDimensions.width-ad.right;var ab=ad.top;this._elem.css({left:ac,top:ab});break;case"e":var ac=this._plotDimensions.width-ad.right;var ab=(ad.top+(this._plotDimensions.height-ad.bottom))/2-this.getHeight()/2;this._elem.css({left:ac,top:ab});break;case"se":var ac=this._plotDimensions.width-ad.right;var ab=ad.bottom;this._elem.css({left:ac,bottom:ab});break;case"s":var ac=(ad.left+(this._plotDimensions.width-ad.right))/2-this.getWidth()/2;var ab=this._plotDimensions.height-ad.bottom;this._elem.css({left:ac,top:ab});break;case"sw":var ac=this._plotDimensions.width-ad.left;var ab=ad.bottom;this._elem.css({right:ac,bottom:ab});break;case"w":var ac=this._plotDimensions.width-ad.left;var ab=(ad.top+(this._plotDimensions.height-ad.bottom))/2-this.getHeight()/2;this._elem.css({right:ac,top:ab});break;default:var ac=ad.right;var ab=ad.bottom;this._elem.css({right:ac,bottom:ab});break}}else{switch(this.location){case"nw":this._elem.css({left:0,top:ad.top});break;case"n":var ac=(ad.left+(this._plotDimensions.width-ad.right))/2-this.getWidth()/2;this._elem.css({left:ac,top:ad.top});break;case"ne":this._elem.css({right:0,top:ad.top});break;case"e":var ab=(ad.top+(this._plotDimensions.height-ad.bottom))/2-this.getHeight()/2;this._elem.css({right:ad.right,top:ab});break;case"se":this._elem.css({right:ad.right,bottom:ad.bottom});break;case"s":var ac=(ad.left+(this._plotDimensions.width-ad.right))/2-this.getWidth()/2;this._elem.css({left:ac,bottom:ad.bottom});break;case"sw":this._elem.css({left:ad.left,bottom:ad.bottom});break;case"w":var ab=(ad.top+(this._plotDimensions.height-ad.bottom))/2-this.getHeight()/2;this._elem.css({left:ad.left,top:ab});break;default:this._elem.css({right:ad.right,bottom:ad.bottom});break}}}}};H.jqplot.ThemeEngine=function(){this.themes={};this.activeTheme=null};H.jqplot.ThemeEngine.prototype.init=function(){var ae=new H.jqplot.Theme({_name:"Default"});var ah,ac,ag;for(ah in ae.target){if(ah=="textColor"){ae.target[ah]=this.target.css("color")}else{ae.target[ah]=this.target.css(ah)}}if(this.title.show&&this.title._elem){for(ah in ae.title){if(ah=="textColor"){ae.title[ah]=this.title._elem.css("color")}else{ae.title[ah]=this.title._elem.css(ah)}}}for(ah in ae.grid){ae.grid[ah]=this.grid[ah]}if(ae.grid.backgroundColor==null&&this.grid.background!=null){ae.grid.backgroundColor=this.grid.background}if(this.legend.show&&this.legend._elem){for(ah in ae.legend){if(ah=="textColor"){ae.legend[ah]=this.legend._elem.css("color")}else{ae.legend[ah]=this.legend._elem.css(ah)}}}var ad;for(ac=0;ac<this.series.length;ac++){ad=this.series[ac];if(ad.renderer.constructor==H.jqplot.LineRenderer){ae.series.push(new m())}else{if(ad.renderer.constructor==H.jqplot.BarRenderer){ae.series.push(new P())}else{if(ad.renderer.constructor==H.jqplot.PieRenderer){ae.series.push(new e())}else{if(ad.renderer.constructor==H.jqplot.DonutRenderer){ae.series.push(new C())}else{if(ad.renderer.constructor==H.jqplot.FunnelRenderer){ae.series.push(new U())}else{if(ad.renderer.constructor==H.jqplot.MeterGaugeRenderer){ae.series.push(new z())}else{ae.series.push({})}}}}}}for(ah in ae.series[ac]){ae.series[ac][ah]=ad[ah]}}var ab,af;for(ah in this.axes){af=this.axes[ah];ab=ae.axes[ah]=new L();ab.borderColor=af.borderColor;ab.borderWidth=af.borderWidth;if(af._ticks&&af._ticks[0]){for(ag in ab.ticks){if(af._ticks[0].hasOwnProperty(ag)){ab.ticks[ag]=af._ticks[0][ag]}else{if(af._ticks[0]._elem){ab.ticks[ag]=af._ticks[0]._elem.css(ag)}}}}if(af._label&&af._label.show){for(ag in ab.label){if(af._label[ag]){ab.label[ag]=af._label[ag]}else{if(af._label._elem){if(ag=="textColor"){ab.label[ag]=af._label._elem.css("color")}else{ab.label[ag]=af._label._elem.css(ag)}}}}}}this.themeEngine._add(ae);this.themeEngine.activeTheme=this.themeEngine.themes[ae._name]};H.jqplot.ThemeEngine.prototype.get=function(ab){if(!ab){return this.activeTheme}else{return this.themes[ab]}};function K(ac,ab){return ac-ab}H.jqplot.ThemeEngine.prototype.getThemeNames=function(){var ab=[];for(var ac in this.themes){ab.push(ac)}return ab.sort(K)};H.jqplot.ThemeEngine.prototype.getThemes=function(){var ac=[];var ab=[];for(var ae in this.themes){ac.push(ae)}ac.sort(K);for(var ad=0;ad<ac.length;ad++){ab.push(this.themes[ac[ad]])}return ab};H.jqplot.ThemeEngine.prototype.activate=function(ao,au){var ab=false;if(!au&&this.activeTheme&&this.activeTheme._name){au=this.activeTheme._name}if(!this.themes.hasOwnProperty(au)){throw new Error("No theme of that name")}else{var ag=this.themes[au];this.activeTheme=ag;var at,am=false,al=false;var ac=["xaxis","x2axis","yaxis","y2axis"];for(ap=0;ap<ac.length;ap++){var ah=ac[ap];if(ag.axesStyles.borderColor!=null){ao.axes[ah].borderColor=ag.axesStyles.borderColor}if(ag.axesStyles.borderWidth!=null){ao.axes[ah].borderWidth=ag.axesStyles.borderWidth}}for(var ar in ao.axes){var ae=ao.axes[ar];if(ae.show){var ak=ag.axes[ar]||{};var ai=ag.axesStyles;var af=H.jqplot.extend(true,{},ak,ai);at=(ag.axesStyles.borderColor!=null)?ag.axesStyles.borderColor:af.borderColor;if(af.borderColor!=null){ae.borderColor=af.borderColor;ab=true}at=(ag.axesStyles.borderWidth!=null)?ag.axesStyles.borderWidth:af.borderWidth;if(af.borderWidth!=null){ae.borderWidth=af.borderWidth;ab=true}if(ae._ticks&&ae._ticks[0]){for(var ad in af.ticks){at=af.ticks[ad];if(at!=null){ae.tickOptions[ad]=at;ae._ticks=[];ab=true}}}if(ae._label&&ae._label.show){for(var ad in af.label){at=af.label[ad];if(at!=null){ae.labelOptions[ad]=at;ab=true}}}}}for(var an in ag.grid){if(ag.grid[an]!=null){ao.grid[an]=ag.grid[an]}}if(!ab){ao.grid.draw()}if(ao.legend.show){for(an in ag.legend){if(ag.legend[an]!=null){ao.legend[an]=ag.legend[an]}}}if(ao.title.show){for(an in ag.title){if(ag.title[an]!=null){ao.title[an]=ag.title[an]}}}var ap;for(ap=0;ap<ag.series.length;ap++){var aj={};var aq=false;for(an in ag.series[ap]){at=(ag.seriesStyles[an]!=null)?ag.seriesStyles[an]:ag.series[ap][an];if(at!=null){aj[an]=at;if(an=="color"){ao.series[ap].renderer.shapeRenderer.fillStyle=at;ao.series[ap].renderer.shapeRenderer.strokeStyle=at;ao.series[ap][an]=at}else{if((an=="lineWidth")||(an=="linePattern")){ao.series[ap].renderer.shapeRenderer[an]=at;ao.series[ap][an]=at}else{if(an=="markerOptions"){R(ao.series[ap].markerOptions,at);R(ao.series[ap].markerRenderer,at)}else{ao.series[ap][an]=at}}}ab=true}}}if(ab){ao.target.empty();ao.draw()}for(an in ag.target){if(ag.target[an]!=null){ao.target.css(an,ag.target[an])}}}};H.jqplot.ThemeEngine.prototype._add=function(ac,ab){if(ab){ac._name=ab}if(!ac._name){ac._name=Date.parse(new Date())}if(!this.themes.hasOwnProperty(ac._name)){this.themes[ac._name]=ac}else{throw new Error("jqplot.ThemeEngine Error: Theme already in use")}};H.jqplot.ThemeEngine.prototype.remove=function(ab){if(ab=="Default"){return false}return delete this.themes[ab]};H.jqplot.ThemeEngine.prototype.newTheme=function(ab,ad){if(typeof(ab)=="object"){ad=ad||ab;ab=null}if(ad&&ad._name){ab=ad._name}else{ab=ab||Date.parse(new Date())}var ac=this.copy(this.themes.Default._name,ab);H.jqplot.extend(ac,ad);return ac};function x(ad){if(ad==null||typeof(ad)!="object"){return ad}var ab=new ad.constructor();for(var ac in ad){ab[ac]=x(ad[ac])}return ab}H.jqplot.clone=x;function R(ad,ac){if(ac==null||typeof(ac)!="object"){return}for(var ab in ac){if(ab=="highlightColors"){ad[ab]=x(ac[ab])}if(ac[ab]!=null&&typeof(ac[ab])=="object"){if(!ad.hasOwnProperty(ab)){ad[ab]={}}R(ad[ab],ac[ab])}else{ad[ab]=ac[ab]}}}H.jqplot.merge=R;H.jqplot.extend=function(){var ag=arguments[0]||{},ae=1,af=arguments.length,ab=false,ad;if(typeof ag==="boolean"){ab=ag;ag=arguments[1]||{};ae=2}if(typeof ag!=="object"&&!toString.call(ag)==="[object Function]"){ag={}}for(;ae<af;ae++){if((ad=arguments[ae])!=null){for(var ac in ad){var ah=ag[ac],ai=ad[ac];if(ag===ai){continue}if(ab&&ai&&typeof ai==="object"&&!ai.nodeType){ag[ac]=H.jqplot.extend(ab,ah||(ai.length!=null?[]:{}),ai)}else{if(ai!==r){ag[ac]=ai}}}}}return ag};H.jqplot.ThemeEngine.prototype.rename=function(ac,ab){if(ac=="Default"||ab=="Default"){throw new Error("jqplot.ThemeEngine Error: Cannot rename from/to Default")}if(this.themes.hasOwnProperty(ab)){throw new Error("jqplot.ThemeEngine Error: New name already in use.")}else{if(this.themes.hasOwnProperty(ac)){var ad=this.copy(ac,ab);this.remove(ac);return ad}}throw new Error("jqplot.ThemeEngine Error: Old name or new name invalid")};H.jqplot.ThemeEngine.prototype.copy=function(ab,ad,af){if(ad=="Default"){throw new Error("jqplot.ThemeEngine Error: Cannot copy over Default theme")}if(!this.themes.hasOwnProperty(ab)){var ac="jqplot.ThemeEngine Error: Source name invalid";throw new Error(ac)}if(this.themes.hasOwnProperty(ad)){var ac="jqplot.ThemeEngine Error: Target name invalid";throw new Error(ac)}else{var ae=x(this.themes[ab]);ae._name=ad;H.jqplot.extend(true,ae,af);this._add(ae);return ae}};H.jqplot.Theme=function(ab,ac){if(typeof(ab)=="object"){ac=ac||ab;ab=null}ab=ab||Date.parse(new Date());this._name=ab;this.target={backgroundColor:null};this.legend={textColor:null,fontFamily:null,fontSize:null,border:null,background:null};this.title={textColor:null,fontFamily:null,fontSize:null,textAlign:null};this.seriesStyles={};this.series=[];this.grid={drawGridlines:null,gridLineColor:null,gridLineWidth:null,backgroundColor:null,borderColor:null,borderWidth:null,shadow:null};this.axesStyles={label:{},ticks:{}};this.axes={};if(typeof(ac)=="string"){this._name=ac}else{if(typeof(ac)=="object"){H.jqplot.extend(true,this,ac)}}};var L=function(){this.borderColor=null;this.borderWidth=null;this.ticks=new l();this.label=new q()};var l=function(){this.show=null;this.showGridline=null;this.showLabel=null;this.showMark=null;this.size=null;this.textColor=null;this.whiteSpace=null;this.fontSize=null;this.fontFamily=null};var q=function(){this.textColor=null;this.whiteSpace=null;this.fontSize=null;this.fontFamily=null;this.fontWeight=null};var m=function(){this.color=null;this.lineWidth=null;this.linePattern=null;this.shadow=null;this.fillColor=null;this.showMarker=null;this.markerOptions=new E()};var E=function(){this.show=null;this.style=null;this.lineWidth=null;this.size=null;this.color=null;this.shadow=null};var P=function(){this.color=null;this.seriesColors=null;this.lineWidth=null;this.shadow=null;this.barPadding=null;this.barMargin=null;this.barWidth=null;this.highlightColors=null};var e=function(){this.seriesColors=null;this.padding=null;this.sliceMargin=null;this.fill=null;this.shadow=null;this.startAngle=null;this.lineWidth=null;this.highlightColors=null};var C=function(){this.seriesColors=null;this.padding=null;this.sliceMargin=null;this.fill=null;this.shadow=null;this.startAngle=null;this.lineWidth=null;this.innerDiameter=null;this.thickness=null;this.ringMargin=null;this.highlightColors=null};var U=function(){this.color=null;this.lineWidth=null;this.shadow=null;this.padding=null;this.sectionMargin=null;this.seriesColors=null;this.highlightColors=null};var z=function(){this.padding=null;this.backgroundColor=null;this.ringColor=null;this.tickColor=null;this.ringWidth=null;this.intervalColors=null;this.intervalInnerRadius=null;this.intervalOuterRadius=null;this.hubRadius=null;this.needleThickness=null;this.needlePad=null};H.fn.jqplotChildText=function(){return H(this).contents().filter(function(){return this.nodeType==3}).text()};H.fn.jqplotGetComputedFontStyle=function(){var ae=window.getComputedStyle?window.getComputedStyle(this[0]):this[0].currentStyle;var ac=ae["font-style"]?["font-style","font-weight","font-size","font-family"]:["fontStyle","fontWeight","fontSize","fontFamily"];var af=[];for(var ad=0;ad<ac.length;++ad){var ab=String(ae[ac[ad]]);if(ab&&ab!="normal"){af.push(ab)}}return af.join(" ")};H.fn.jqplotToImageCanvas=function(ad){ad=ad||{};var ao=(ad.x_offset==null)?0:ad.x_offset;var aq=(ad.y_offset==null)?0:ad.y_offset;var af=(ad.backgroundColor==null)?"rgb(255,255,255)":ad.backgroundColor;if(H(this).width()==0||H(this).height()==0){return null}if(!H.jqplot.support_canvas){return null}var ah=document.createElement("canvas");var au=H(this).outerHeight(true);var am=H(this).outerWidth(true);var ag=H(this).offset();var ai=ag.left;var ak=ag.top;var an=0,al=0;var ar=["jqplot-table-legend","jqplot-xaxis-tick","jqplot-x2axis-tick","jqplot-yaxis-tick","jqplot-y2axis-tick","jqplot-y3axis-tick","jqplot-y4axis-tick","jqplot-y5axis-tick","jqplot-y6axis-tick","jqplot-y7axis-tick","jqplot-y8axis-tick","jqplot-y9axis-tick","jqplot-xaxis-label","jqplot-x2axis-label","jqplot-yaxis-label","jqplot-y2axis-label","jqplot-y3axis-label","jqplot-y4axis-label","jqplot-y5axis-label","jqplot-y6axis-label","jqplot-y7axis-label","jqplot-y8axis-label","jqplot-y9axis-label"];var aj,ab,ac,av;for(var at in ar){H(this).find("."+ar[at]).each(function(){aj=H(this).offset().top-ak;ab=H(this).offset().left-ai;av=ab+H(this).outerWidth(true)+an;ac=aj+H(this).outerHeight(true)+al;if(ab<-an){am=am-an-ab;an=-ab}if(aj<-al){au=au-al-aj;al=-aj}if(av>am){am=av}if(ac>au){au=ac}})}ah.width=am+Number(ao);ah.height=au+Number(aq);var ae=ah.getContext("2d");ae.save();ae.fillStyle=af;ae.fillRect(0,0,ah.width,ah.height);ae.restore();ae.translate(an,al);ae.textAlign="left";ae.textBaseline="top";function aw(ay){var az=parseInt(H(ay).css("line-height"),10);if(isNaN(az)){az=parseInt(H(ay).css("font-size"),10)*1.2}return az}function ax(az,ay,aM,aA,aI,aB){var aK=aw(az);var aE=H(az).innerWidth();var aF=H(az).innerHeight();var aH=aM.split(/\s+/);var aL=aH.length;var aJ="";var aG=[];var aO=aI;var aN=aA;for(var aD=0;aD<aL;aD++){aJ+=aH[aD];if(ay.measureText(aJ).width>aE){aG.push(aD);aJ=""}}if(aG.length===0){if(H(az).css("textAlign")==="center"){aN=aA+(aB-ay.measureText(aJ).width)/2-an}ay.fillText(aM,aN,aI)}else{aJ=aH.slice(0,aG[0]).join(" ");if(H(az).css("textAlign")==="center"){aN=aA+(aB-ay.measureText(aJ).width)/2-an}ay.fillText(aJ,aN,aO);aO+=aK;for(var aD=1,aC=aG.length;aD<aC;aD++){aJ=aH.slice(aG[aD-1],aG[aD]).join(" ");if(H(az).css("textAlign")==="center"){aN=aA+(aB-ay.measureText(aJ).width)/2-an}ay.fillText(aJ,aN,aO);aO+=aK}aJ=aH.slice(aG[aD-1],aH.length).join(" ");if(H(az).css("textAlign")==="center"){aN=aA+(aB-ay.measureText(aJ).width)/2-an}ay.fillText(aJ,aN,aO)}}function ap(aA,aD,ay){var aH=aA.tagName.toLowerCase();var az=H(aA).position();var aE=window.getComputedStyle?window.getComputedStyle(aA):aA.currentStyle;var aC=aD+az.left+parseInt(aE.marginLeft,10)+parseInt(aE.borderLeftWidth,10)+parseInt(aE.paddingLeft,10);var aF=ay+az.top+parseInt(aE.marginTop,10)+parseInt(aE.borderTopWidth,10)+parseInt(aE.paddingTop,10);var aG=ah.width;if((aH=="div"||aH=="span")&&!H(aA).hasClass("jqplot-highlighter-tooltip")){H(aA).children().each(function(){ap(this,aC,aF)});var aI=H(aA).jqplotChildText();if(aI){ae.font=H(aA).jqplotGetComputedFontStyle();ae.fillStyle=H(aA).css("color");ax(aA,ae,aI,aC,aF,aG)}}else{if(aH==="table"&&H(aA).hasClass("jqplot-table-legend")){ae.strokeStyle=H(aA).css("border-top-color");ae.fillStyle=H(aA).css("background-color");ae.fillRect(aC,aF,H(aA).innerWidth(),H(aA).innerHeight());if(parseInt(H(aA).css("border-top-width"),10)>0){ae.strokeRect(aC,aF,H(aA).innerWidth(),H(aA).innerHeight())}H(aA).find("div.jqplot-table-legend-swatch-outline").each(function(){var aO=H(this);ae.strokeStyle=aO.css("border-top-color");var aK=aC+aO.position().left;var aL=aF+aO.position().top;ae.strokeRect(aK,aL,aO.innerWidth(),aO.innerHeight());aK+=parseInt(aO.css("padding-left"),10);aL+=parseInt(aO.css("padding-top"),10);var aN=aO.innerHeight()-2*parseInt(aO.css("padding-top"),10);var aJ=aO.innerWidth()-2*parseInt(aO.css("padding-left"),10);var aM=aO.children("div.jqplot-table-legend-swatch");ae.fillStyle=aM.css("background-color");ae.fillRect(aK,aL,aJ,aN)});H(aA).find("td.jqplot-table-legend-label").each(function(){var aL=H(this);var aJ=aC+aL.position().left;var aK=aF+aL.position().top+parseInt(aL.css("padding-top"),10);ae.font=aL.jqplotGetComputedFontStyle();ae.fillStyle=aL.css("color");ae.fillText(aL.text(),aJ,aK)});var aB=null}else{if(aH=="canvas"){ae.drawImage(aA,aC,aF)}}}}H(this).children().each(function(){ap(this,ao,aq)});return ah};H.fn.jqplotToImageStr=function(ac){var ab=H(this).jqplotToImageCanvas(ac);if(ab){return ab.toDataURL("image/png")}else{return null}};H.fn.jqplotToImageElem=function(ab){var ac=document.createElement("img");var ad=H(this).jqplotToImageStr(ab);ac.src=ad;return ac};H.fn.jqplotToImageElemStr=function(ab){var ac="<img src="+H(this).jqplotToImageStr(ab)+" />";return ac};H.fn.jqplotSaveImage=function(){var ab=H(this).jqplotToImageStr({});if(ab){window.location.href=ab.replace("image/png","image/octet-stream")}};H.fn.jqplotViewImage=function(){var ac=H(this).jqplotToImageElemStr({});var ad=H(this).jqplotToImageStr({});if(ac){var ab=window.open("");ab.document.open("image/png");ab.document.write(ac);ab.document.close();ab=null}};var aa=function(){this.syntax=aa.config.syntax;this._type="jsDate";this.proxy=new Date();this.options={};this.locale=aa.regional.getLocale();this.formatString="";this.defaultCentury=aa.config.defaultCentury;switch(arguments.length){case 0:break;case 1:if(j(arguments[0])=="[object Object]"&&arguments[0]._type!="jsDate"){var ad=this.options=arguments[0];this.syntax=ad.syntax||this.syntax;this.defaultCentury=ad.defaultCentury||this.defaultCentury;this.proxy=aa.createDate(ad.date)}else{this.proxy=aa.createDate(arguments[0])}break;default:var ab=[];for(var ac=0;ac<arguments.length;ac++){ab.push(arguments[ac])}this.proxy=new Date();this.proxy.setFullYear.apply(this.proxy,ab.slice(0,3));if(ab.slice(3).length){this.proxy.setHours.apply(this.proxy,ab.slice(3))}break}};aa.config={defaultLocale:"en",syntax:"perl",defaultCentury:1900};aa.prototype.add=function(ad,ac){var ab=A[ac]||A.day;if(typeof ab=="number"){this.proxy.setTime(this.proxy.getTime()+(ab*ad))}else{ab.add(this,ad)}return this};aa.prototype.clone=function(){return new aa(this.proxy.getTime())};aa.prototype.getUtcOffset=function(){return this.proxy.getTimezoneOffset()*60000};aa.prototype.diff=function(ac,af,ab){ac=new aa(ac);if(ac===null){return null}var ad=A[af]||A.day;if(typeof ad=="number"){var ae=(this.proxy.getTime()-ac.proxy.getTime())/ad}else{var ae=ad.diff(this.proxy,ac.proxy)}return(ab?ae:Math[ae>0?"floor":"ceil"](ae))};aa.prototype.getAbbrDayName=function(){return aa.regional[this.locale]["dayNamesShort"][this.proxy.getDay()]};aa.prototype.getAbbrMonthName=function(){return aa.regional[this.locale]["monthNamesShort"][this.proxy.getMonth()]};aa.prototype.getAMPM=function(){return this.proxy.getHours()>=12?"PM":"AM"};aa.prototype.getAmPm=function(){return this.proxy.getHours()>=12?"pm":"am"};aa.prototype.getCentury=function(){return parseInt(this.proxy.getFullYear()/100,10)};aa.prototype.getDate=function(){return this.proxy.getDate()};aa.prototype.getDay=function(){return this.proxy.getDay()};aa.prototype.getDayOfWeek=function(){var ab=this.proxy.getDay();return ab===0?7:ab};aa.prototype.getDayOfYear=function(){var ac=this.proxy;var ab=ac-new Date(""+ac.getFullYear()+"/1/1 GMT");ab+=ac.getTimezoneOffset()*60000;ac=null;return parseInt(ab/60000/60/24,10)+1};aa.prototype.getDayName=function(){return aa.regional[this.locale]["dayNames"][this.proxy.getDay()]};aa.prototype.getFullWeekOfYear=function(){var ae=this.proxy;var ab=this.getDayOfYear();var ad=6-ae.getDay();var ac=parseInt((ab+ad)/7,10);return ac};aa.prototype.getFullYear=function(){return this.proxy.getFullYear()};aa.prototype.getGmtOffset=function(){var ab=this.proxy.getTimezoneOffset()/60;var ac=ab<0?"+":"-";ab=Math.abs(ab);return ac+J(Math.floor(ab),2)+":"+J((ab%1)*60,2)};aa.prototype.getHours=function(){return this.proxy.getHours()};aa.prototype.getHours12=function(){var ab=this.proxy.getHours();return ab>12?ab-12:(ab==0?12:ab)};aa.prototype.getIsoWeek=function(){var ae=this.proxy;var ad=ae.getWeekOfYear();var ab=(new Date(""+ae.getFullYear()+"/1/1")).getDay();var ac=ad+(ab>4||ab<=1?0:1);if(ac==53&&(new Date(""+ae.getFullYear()+"/12/31")).getDay()<4){ac=1}else{if(ac===0){ae=new aa(new Date(""+(ae.getFullYear()-1)+"/12/31"));ac=ae.getIsoWeek()}}ae=null;return ac};aa.prototype.getMilliseconds=function(){return this.proxy.getMilliseconds()};aa.prototype.getMinutes=function(){return this.proxy.getMinutes()};aa.prototype.getMonth=function(){return this.proxy.getMonth()};aa.prototype.getMonthName=function(){return aa.regional[this.locale]["monthNames"][this.proxy.getMonth()]};aa.prototype.getMonthNumber=function(){return this.proxy.getMonth()+1};aa.prototype.getSeconds=function(){return this.proxy.getSeconds()};aa.prototype.getShortYear=function(){return this.proxy.getYear()%100};aa.prototype.getTime=function(){return this.proxy.getTime()};aa.prototype.getTimezoneAbbr=function(){return this.proxy.toString().replace(/^.*\(([^)]+)\)$/,"$1")};aa.prototype.getTimezoneName=function(){var ab=/(?:\((.+)\)$| ([A-Z]{3}) )/.exec(this.toString());return ab[1]||ab[2]||"GMT"+this.getGmtOffset()};aa.prototype.getTimezoneOffset=function(){return this.proxy.getTimezoneOffset()};aa.prototype.getWeekOfYear=function(){var ab=this.getDayOfYear();var ad=7-this.getDayOfWeek();var ac=parseInt((ab+ad)/7,10);return ac};aa.prototype.getUnix=function(){return Math.round(this.proxy.getTime()/1000,0)};aa.prototype.getYear=function(){return this.proxy.getYear()};aa.prototype.next=function(ab){ab=ab||"day";return this.clone().add(1,ab)};aa.prototype.set=function(){switch(arguments.length){case 0:this.proxy=new Date();break;case 1:if(j(arguments[0])=="[object Object]"&&arguments[0]._type!="jsDate"){var ad=this.options=arguments[0];this.syntax=ad.syntax||this.syntax;this.defaultCentury=ad.defaultCentury||this.defaultCentury;this.proxy=aa.createDate(ad.date)}else{this.proxy=aa.createDate(arguments[0])}break;default:var ab=[];for(var ac=0;ac<arguments.length;ac++){ab.push(arguments[ac])}this.proxy=new Date();this.proxy.setFullYear.apply(this.proxy,ab.slice(0,3));if(ab.slice(3).length){this.proxy.setHours.apply(this.proxy,ab.slice(3))}break}return this};aa.prototype.setDate=function(ab){this.proxy.setDate(ab);return this};aa.prototype.setFullYear=function(){this.proxy.setFullYear.apply(this.proxy,arguments);return this};aa.prototype.setHours=function(){this.proxy.setHours.apply(this.proxy,arguments);return this};aa.prototype.setMilliseconds=function(ab){this.proxy.setMilliseconds(ab);return this};aa.prototype.setMinutes=function(){this.proxy.setMinutes.apply(this.proxy,arguments);return this};aa.prototype.setMonth=function(){this.proxy.setMonth.apply(this.proxy,arguments);return this};aa.prototype.setSeconds=function(){this.proxy.setSeconds.apply(this.proxy,arguments);return this};aa.prototype.setTime=function(ab){this.proxy.setTime(ab);return this};aa.prototype.setYear=function(){this.proxy.setYear.apply(this.proxy,arguments);return this};aa.prototype.strftime=function(ab){ab=ab||this.formatString||aa.regional[this.locale]["formatString"];return aa.strftime(this,ab,this.syntax)};aa.prototype.toString=function(){return this.proxy.toString()};aa.prototype.toYmdInt=function(){return(this.proxy.getFullYear()*10000)+(this.getMonthNumber()*100)+this.proxy.getDate()};aa.regional={en:{monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],formatString:"%Y-%m-%d %H:%M:%S"},fr:{monthNames:["Janvier","Février","Mars","Avril","Mai","Juin","Juillet","Août","Septembre","Octobre","Novembre","Décembre"],monthNamesShort:["Jan","Fév","Mar","Avr","Mai","Jun","Jul","Aoû","Sep","Oct","Nov","Déc"],dayNames:["Dimanche","Lundi","Mardi","Mercredi","Jeudi","Vendredi","Samedi"],dayNamesShort:["Dim","Lun","Mar","Mer","Jeu","Ven","Sam"],formatString:"%Y-%m-%d %H:%M:%S"},de:{monthNames:["Januar","Februar","März","April","Mai","Juni","Juli","August","September","Oktober","November","Dezember"],monthNamesShort:["Jan","Feb","Mär","Apr","Mai","Jun","Jul","Aug","Sep","Okt","Nov","Dez"],dayNames:["Sonntag","Montag","Dienstag","Mittwoch","Donnerstag","Freitag","Samstag"],dayNamesShort:["So","Mo","Di","Mi","Do","Fr","Sa"],formatString:"%Y-%m-%d %H:%M:%S"},es:{monthNames:["Enero","Febrero","Marzo","Abril","Mayo","Junio","Julio","Agosto","Septiembre","Octubre","Noviembre","Diciembre"],monthNamesShort:["Ene","Feb","Mar","Abr","May","Jun","Jul","Ago","Sep","Oct","Nov","Dic"],dayNames:["Domingo","Lunes","Martes","Miércoles","Jueves","Viernes","Sábado"],dayNamesShort:["Dom","Lun","Mar","Mié","Juv","Vie","Sáb"],formatString:"%Y-%m-%d %H:%M:%S"},ru:{monthNames:["Январь","Февраль","Март","Апрель","Май","Июнь","Июль","Август","Сентябрь","Октябрь","Ноябрь","Декабрь"],monthNamesShort:["Янв","Фев","Мар","Апр","Май","Июн","Июл","Авг","Сен","Окт","Ноя","Дек"],dayNames:["воскресенье","понедельник","вторник","среда","четверг","пятница","суббота"],dayNamesShort:["вск","пнд","втр","срд","чтв","птн","сбт"],formatString:"%Y-%m-%d %H:%M:%S"},ar:{monthNames:["كانون الثاني","شباط","آذار","نيسان","آذار","حزيران","تموز","آب","أيلول","تشرين الأول","تشرين الثاني","كانون الأول"],monthNamesShort:["1","2","3","4","5","6","7","8","9","10","11","12"],dayNames:["السبت","الأحد","الاثنين","الثلاثاء","الأربعاء","الخميس","الجمعة"],dayNamesShort:["سبت","أحد","اثنين","ثلاثاء","أربعاء","خميس","جمعة"],formatString:"%Y-%m-%d %H:%M:%S"},pt:{monthNames:["Janeiro","Fevereiro","Março","Abril","Maio","Junho","Julho","Agosto","Setembro","Outubro","Novembro","Dezembro"],monthNamesShort:["Jan","Fev","Mar","Abr","Mai","Jun","Jul","Ago","Set","Out","Nov","Dez"],dayNames:["Domingo","Segunda-feira","Terça-feira","Quarta-feira","Quinta-feira","Sexta-feira","Sábado"],dayNamesShort:["Dom","Seg","Ter","Qua","Qui","Sex","Sáb"],formatString:"%Y-%m-%d %H:%M:%S"},"pt-BR":{monthNames:["Janeiro","Fevereiro","Março","Abril","Maio","Junho","Julho","Agosto","Setembro","Outubro","Novembro","Dezembro"],monthNamesShort:["Jan","Fev","Mar","Abr","Mai","Jun","Jul","Ago","Set","Out","Nov","Dez"],dayNames:["Domingo","Segunda-feira","Terça-feira","Quarta-feira","Quinta-feira","Sexta-feira","Sábado"],dayNamesShort:["Dom","Seg","Ter","Qua","Qui","Sex","Sáb"],formatString:"%Y-%m-%d %H:%M:%S"}};aa.regional["en-US"]=aa.regional["en-GB"]=aa.regional.en;aa.regional.getLocale=function(){var ab=aa.config.defaultLocale;if(document&&document.getElementsByTagName("html")&&document.getElementsByTagName("html")[0].lang){ab=document.getElementsByTagName("html")[0].lang;if(!aa.regional.hasOwnProperty(ab)){ab=aa.config.defaultLocale}}return ab};var y=24*60*60*1000;var J=function(ab,ae){ab=String(ab);var ac=ae-ab.length;var ad=String(Math.pow(10,ac)).slice(1);return ad.concat(ab)};var A={millisecond:1,second:1000,minute:60*1000,hour:60*60*1000,day:y,week:7*y,month:{add:function(ad,ab){A.year.add(ad,Math[ab>0?"floor":"ceil"](ab/12));var ac=ad.getMonth()+(ab%12);if(ac==12){ac=0;ad.setYear(ad.getFullYear()+1)}else{if(ac==-1){ac=11;ad.setYear(ad.getFullYear()-1)}}ad.setMonth(ac)},diff:function(af,ad){var ab=af.getFullYear()-ad.getFullYear();var ac=af.getMonth()-ad.getMonth()+(ab*12);var ae=af.getDate()-ad.getDate();return ac+(ae/30)}},year:{add:function(ac,ab){ac.setYear(ac.getFullYear()+Math[ab>0?"floor":"ceil"](ab))},diff:function(ac,ab){return A.month.diff(ac,ab)/12}}};for(var T in A){if(T.substring(T.length-1)!="s"){A[T+"s"]=A[T]}}var D=function(af,ae,ac){if(aa.formats[ac]["shortcuts"][ae]){return aa.strftime(af,aa.formats[ac]["shortcuts"][ae],ac)}else{var ab=(aa.formats[ac]["codes"][ae]||"").split(".");var ad=af["get"+ab[0]]?af["get"+ab[0]]():"";if(ab[1]){ad=J(ad,ab[1])}return ad}};aa.strftime=function(ah,ae,ad,ai){var ac="perl";var ag=aa.regional.getLocale();if(ad&&aa.formats.hasOwnProperty(ad)){ac=ad}else{if(ad&&aa.regional.hasOwnProperty(ad)){ag=ad}}if(ai&&aa.formats.hasOwnProperty(ai)){ac=ai}else{if(ai&&aa.regional.hasOwnProperty(ai)){ag=ai}}if(j(ah)!="[object Object]"||ah._type!="jsDate"){ah=new aa(ah);ah.locale=ag}if(!ae){ae=ah.formatString||aa.regional[ag]["formatString"]}var ab=ae||"%Y-%m-%d",aj="",af;while(ab.length>0){if(af=ab.match(aa.formats[ac].codes.matcher)){aj+=ab.slice(0,af.index);aj+=(af[1]||"")+D(ah,af[2],ac);ab=ab.slice(af.index+af[0].length)}else{aj+=ab;ab=""}}return aj};aa.formats={ISO:"%Y-%m-%dT%H:%M:%S.%N%G",SQL:"%Y-%m-%d %H:%M:%S"};aa.formats.perl={codes:{matcher:/()%(#?(%|[a-z]))/i,Y:"FullYear",y:"ShortYear.2",m:"MonthNumber.2","#m":"MonthNumber",B:"MonthName",b:"AbbrMonthName",d:"Date.2","#d":"Date",e:"Date",A:"DayName",a:"AbbrDayName",w:"Day",H:"Hours.2","#H":"Hours",I:"Hours12.2","#I":"Hours12",p:"AMPM",M:"Minutes.2","#M":"Minutes",S:"Seconds.2","#S":"Seconds",s:"Unix",N:"Milliseconds.3","#N":"Milliseconds",O:"TimezoneOffset",Z:"TimezoneName",G:"GmtOffset"},shortcuts:{F:"%Y-%m-%d",T:"%H:%M:%S",X:"%H:%M:%S",x:"%m/%d/%y",D:"%m/%d/%y","#c":"%a %b %e %H:%M:%S %Y",v:"%e-%b-%Y",R:"%H:%M",r:"%I:%M:%S %p",t:"\t",n:"\n","%":"%"}};aa.formats.php={codes:{matcher:/()%((%|[a-z]))/i,a:"AbbrDayName",A:"DayName",d:"Date.2",e:"Date",j:"DayOfYear.3",u:"DayOfWeek",w:"Day",U:"FullWeekOfYear.2",V:"IsoWeek.2",W:"WeekOfYear.2",b:"AbbrMonthName",B:"MonthName",m:"MonthNumber.2",h:"AbbrMonthName",C:"Century.2",y:"ShortYear.2",Y:"FullYear",H:"Hours.2",I:"Hours12.2",l:"Hours12",p:"AMPM",P:"AmPm",M:"Minutes.2",S:"Seconds.2",s:"Unix",O:"TimezoneOffset",z:"GmtOffset",Z:"TimezoneAbbr"},shortcuts:{D:"%m/%d/%y",F:"%Y-%m-%d",T:"%H:%M:%S",X:"%H:%M:%S",x:"%m/%d/%y",R:"%H:%M",r:"%I:%M:%S %p",t:"\t",n:"\n","%":"%"}};aa.createDate=function(ad){if(ad==null){return new Date()}if(ad instanceof Date){return ad}if(typeof ad=="number"){return new Date(ad)}var ai=String(ad).replace(/^\s*(.+)\s*$/g,"$1");ai=ai.replace(/^([0-9]{1,4})-([0-9]{1,2})-([0-9]{1,4})/,"$1/$2/$3");ai=ai.replace(/^(3[01]|[0-2]?\d)[-\/]([a-z]{3,})[-\/](\d{4})/i,"$1 $2 $3");var ah=ai.match(/^(3[01]|[0-2]?\d)[-\/]([a-z]{3,})[-\/](\d{2})\D*/i);if(ah&&ah.length>3){var am=parseFloat(ah[3]);var ag=aa.config.defaultCentury+am;ag=String(ag);ai=ai.replace(/^(3[01]|[0-2]?\d)[-\/]([a-z]{3,})[-\/](\d{2})\D*/i,ah[1]+" "+ah[2]+" "+ag)}ah=ai.match(/^([0-9]{1,2})[-\/]([0-9]{1,2})[-\/]([0-9]{1,2})[^0-9]/);function al(aq,ap){var aw=parseFloat(ap[1]);var av=parseFloat(ap[2]);var au=parseFloat(ap[3]);var at=aa.config.defaultCentury;var ao,an,ax,ar;if(aw>31){an=au;ax=av;ao=at+aw}else{an=av;ax=aw;ao=at+au}ar=ax+"/"+an+"/"+ao;return aq.replace(/^([0-9]{1,2})[-\/]([0-9]{1,2})[-\/]([0-9]{1,2})/,ar)}if(ah&&ah.length>3){ai=al(ai,ah)}var ah=ai.match(/^([0-9]{1,2})[-\/]([0-9]{1,2})[-\/]([0-9]{1,2})$/);if(ah&&ah.length>3){ai=al(ai,ah)}var af=0;var ac=aa.matchers.length;var ak,ab,aj=ai,ae;while(af<ac){ab=Date.parse(aj);if(!isNaN(ab)){return new Date(ab)}ak=aa.matchers[af];if(typeof ak=="function"){ae=ak.call(aa,aj);if(ae instanceof Date){return ae}}else{aj=ai.replace(ak[0],ak[1])}af++}return NaN};aa.daysInMonth=function(ab,ac){if(ac==2){return new Date(ab,1,29).getDate()==29?29:28}return[r,31,r,31,30,31,30,31,31,30,31,30,31][ac]};aa.matchers=[[/(3[01]|[0-2]\d)\s*\.\s*(1[0-2]|0\d)\s*\.\s*([1-9]\d{3})/,"$2/$1/$3"],[/([1-9]\d{3})\s*-\s*(1[0-2]|0\d)\s*-\s*(3[01]|[0-2]\d)/,"$2/$3/$1"],function(ae){var ac=ae.match(/^(?:(.+)\s+)?([012]?\d)(?:\s*\:\s*(\d\d))?(?:\s*\:\s*(\d\d(\.\d*)?))?\s*(am|pm)?\s*$/i);if(ac){if(ac[1]){var ad=this.createDate(ac[1]);if(isNaN(ad)){return}}else{var ad=new Date();ad.setMilliseconds(0)}var ab=parseFloat(ac[2]);if(ac[6]){ab=ac[6].toLowerCase()=="am"?(ab==12?0:ab):(ab==12?12:ab+12)}ad.setHours(ab,parseInt(ac[3]||0,10),parseInt(ac[4]||0,10),((parseFloat(ac[5]||0))||0)*1000);return ad}else{return ae}},function(ae){var ac=ae.match(/^(?:(.+))[T|\s+]([012]\d)(?:\:(\d\d))(?:\:(\d\d))(?:\.\d+)([\+\-]\d\d\:\d\d)$/i);if(ac){if(ac[1]){var ad=this.createDate(ac[1]);if(isNaN(ad)){return}}else{var ad=new Date();ad.setMilliseconds(0)}var ab=parseFloat(ac[2]);ad.setHours(ab,parseInt(ac[3],10),parseInt(ac[4],10),parseFloat(ac[5])*1000);return ad}else{return ae}},function(af){var ad=af.match(/^([0-3]?\d)\s*[-\/.\s]{1}\s*([a-zA-Z]{3,9})\s*[-\/.\s]{1}\s*([0-3]?\d)$/);if(ad){var ae=new Date();var ag=aa.config.defaultCentury;var ai=parseFloat(ad[1]);var ah=parseFloat(ad[3]);var ac,ab,aj;if(ai>31){ab=ah;ac=ag+ai}else{ab=ai;ac=ag+ah}var aj=W(ad[2],aa.regional[aa.regional.getLocale()]["monthNamesShort"]);if(aj==-1){aj=W(ad[2],aa.regional[aa.regional.getLocale()]["monthNames"])}ae.setFullYear(ac,aj,ab);ae.setHours(0,0,0,0);return ae}else{return af}}];function W(ad,ae){if(ae.indexOf){return ae.indexOf(ad)}for(var ab=0,ac=ae.length;ab<ac;ab++){if(ae[ab]===ad){return ab}}return -1}function j(ab){if(ab===null){return"[object Null]"}return Object.prototype.toString.call(ab)}H.jsDate=aa;H.jqplot.sprintf=function(){function ah(an,aj,ak,am){var al=(an.length>=aj)?"":Array(1+aj-an.length>>>0).join(ak);return am?an+al:al+an}function ae(al){var ak=new String(al);for(var aj=10;aj>0;aj--){if(ak==(ak=ak.replace(/^(\d+)(\d{3})/,"$1"+H.jqplot.sprintf.thousandsSeparator+"$2"))){break}}return ak}function ad(ao,an,aq,al,am,ak){var ap=al-ao.length;if(ap>0){var aj=" ";if(ak){aj=" "}if(aq||!am){ao=ah(ao,al,aj,aq)}else{ao=ao.slice(0,an.length)+ah("",ap,"0",true)+ao.slice(an.length)}}return ao}function ai(ar,ak,ap,al,aj,ao,aq,an){var am=ar>>>0;ap=ap&&am&&{"2":"0b","8":"0","16":"0x"}[ak]||"";ar=ap+ah(am.toString(ak),ao||0,"0",false);return ad(ar,ap,al,aj,aq,an)}function ab(an,ao,al,aj,am,ak){if(aj!=null){an=an.slice(0,aj)}return ad(an,"",ao,al,am,ak)}var ac=arguments,af=0,ag=ac[af++];return ag.replace(H.jqplot.sprintf.regex,function(aF,aq,ar,av,aH,aC,ao){if(aF=="%%"){return"%"}var aw=false,at="",au=false,aE=false,ap=false,an=false;for(var aB=0;ar&&aB<ar.length;aB++){switch(ar.charAt(aB)){case" ":at=" ";break;case"+":at="+";break;case"-":aw=true;break;case"0":au=true;break;case"#":aE=true;break;case"&":ap=true;break;case"'":an=true;break}}if(!av){av=0}else{if(av=="*"){av=+ac[af++]}else{if(av.charAt(0)=="*"){av=+ac[av.slice(1,-1)]}else{av=+av}}}if(av<0){av=-av;aw=true}if(!isFinite(av)){throw new Error("$.jqplot.sprintf: (minimum-)width must be finite")}if(!aC){aC="fFeE".indexOf(ao)>-1?6:(ao=="d")?0:void (0)}else{if(aC=="*"){aC=+ac[af++]}else{if(aC.charAt(0)=="*"){aC=+ac[aC.slice(1,-1)]}else{aC=+aC}}}var ay=aq?ac[aq.slice(0,-1)]:ac[af++];switch(ao){case"s":if(ay==null){return""}return ab(String(ay),aw,av,aC,au,ap);case"c":return ab(String.fromCharCode(+ay),aw,av,aC,au,ap);case"b":return ai(ay,2,aE,aw,av,aC,au,ap);case"o":return ai(ay,8,aE,aw,av,aC,au,ap);case"x":return ai(ay,16,aE,aw,av,aC,au,ap);case"X":return ai(ay,16,aE,aw,av,aC,au,ap).toUpperCase();case"u":return ai(ay,10,aE,aw,av,aC,au,ap);case"i":var al=parseInt(+ay,10);if(isNaN(al)){return""}var aA=al<0?"-":at;var aD=an?ae(String(Math.abs(al))):String(Math.abs(al));ay=aA+ah(aD,aC,"0",false);return ad(ay,aA,aw,av,au,ap);case"d":var al=Math.round(+ay);if(isNaN(al)){return""}var aA=al<0?"-":at;var aD=an?ae(String(Math.abs(al))):String(Math.abs(al));ay=aA+ah(aD,aC,"0",false);return ad(ay,aA,aw,av,au,ap);case"e":case"E":case"f":case"F":case"g":case"G":var al=+ay;if(isNaN(al)){return""}var aA=al<0?"-":at;var am=["toExponential","toFixed","toPrecision"]["efg".indexOf(ao.toLowerCase())];var aG=["toString","toUpperCase"]["eEfFgG".indexOf(ao)%2];var aD=Math.abs(al)[am](aC);aD=an?ae(aD):aD;ay=aA+aD;return ad(ay,aA,aw,av,au,ap)[aG]();case"p":case"P":var al=+ay;if(isNaN(al)){return""}var aA=al<0?"-":at;var ax=String(Number(Math.abs(al)).toExponential()).split(/e|E/);var ak=(ax[0].indexOf(".")!=-1)?ax[0].length-1:ax[0].length;var az=(ax[1]<0)?-ax[1]-1:0;if(Math.abs(al)<1){if(ak+az<=aC){ay=aA+Math.abs(al).toPrecision(ak)}else{if(ak<=aC-1){ay=aA+Math.abs(al).toExponential(ak-1)}else{ay=aA+Math.abs(al).toExponential(aC-1)}}}else{var aj=(ak<=aC)?ak:aC;ay=aA+Math.abs(al).toPrecision(aj)}var aG=["toString","toUpperCase"]["pP".indexOf(ao)%2];return ad(ay,aA,aw,av,au,ap)[aG]();case"n":return"";default:return aF}})};H.jqplot.sprintf.thousandsSeparator=",";H.jqplot.sprintf.regex=/%%|%(\d+\$)?([-+#0&\' ]*)(\*\d+\$|\*|\d+)?(\.(\*\d+\$|\*|\d+))?([nAscboxXuidfegpEGP])/g;H.jqplot.getSignificantFigures=function(af){var ah=String(Number(Math.abs(af)).toExponential()).split(/e|E/);var ag=(ah[0].indexOf(".")!=-1)?ah[0].length-1:ah[0].length;var ac=(ah[1]<0)?-ah[1]-1:0;var ab=parseInt(ah[1],10);var ad=(ab+1>0)?ab+1:0;var ae=(ag<=ad)?0:ag-ab-1;return{significantDigits:ag,digitsLeft:ad,digitsRight:ae,zeros:ac,exponent:ab}};H.jqplot.getPrecision=function(ab){return H.jqplot.getSignificantFigures(ab).digitsRight}})(jQuery);var backCompat=$.uiBackCompat!==false;$.jqplot.effects={effect:{}};var dataSpace="jqplot.storage.";$.extend($.jqplot.effects,{version:"1.9pre",save:function(b,c){for(var a=0;a<c.length;a++){if(c[a]!==null){b.data(dataSpace+c[a],b[0].style[c[a]])}}},restore:function(b,c){for(var a=0;a<c.length;a++){if(c[a]!==null){b.css(c[a],b.data(dataSpace+c[a]))}}},setMode:function(a,b){if(b==="toggle"){b=a.is(":hidden")?"show":"hide"}return b},createWrapper:function(b){if(b.parent().is(".ui-effects-wrapper")){return b.parent()}var c={width:b.outerWidth(true),height:b.outerHeight(true),"float":b.css("float")},e=$("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}),a={width:b.width(),height:b.height()},d=document.activeElement;b.wrap(e);if(b[0]===d||$.contains(b[0],d)){$(d).focus()}e=b.parent();if(b.css("position")==="static"){e.css({position:"relative"});b.css({position:"relative"})}else{$.extend(c,{position:b.css("position"),zIndex:b.css("z-index")});$.each(["top","left","bottom","right"],function(f,g){c[g]=b.css(g);if(isNaN(parseInt(c[g],10))){c[g]="auto"}});b.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}b.css(a);return e.css(c).show()},removeWrapper:function(a){var b=document.activeElement;if(a.parent().is(".ui-effects-wrapper")){a.parent().replaceWith(a);if(a[0]===b||$.contains(a[0],b)){$(b).focus()}}return a}});function _normalizeArguments(b,a,c,d){if($.isPlainObject(b)){return b}b={effect:b};if(a===undefined){a={}}if($.isFunction(a)){d=a;c=null;a={}}if($.type(a)==="number"||$.fx.speeds[a]){d=c;c=a;a={}}if($.isFunction(c)){d=c;c=null}if(a){$.extend(b,a)}c=c||a.duration;b.duration=$.fx.off?0:typeof c==="number"?c:c in $.fx.speeds?$.fx.speeds[c]:$.fx.speeds._default;b.complete=d||a.complete;return b}function standardSpeed(a){if(!a||typeof a==="number"||$.fx.speeds[a]){return true}if(typeof a==="string"&&!$.jqplot.effects.effect[a]){if(backCompat&&$.jqplot.effects[a]){return false}return true}return false}$.fn.extend({jqplotEffect:function(i,j,b,h){var g=_normalizeArguments.apply(this,arguments),d=g.mode,e=g.queue,f=$.jqplot.effects.effect[g.effect],a=!f&&backCompat&&$.jqplot.effects[g.effect];if($.fx.off||!(f||a)){if(d){return this[d](g.duration,g.complete)}else{return this.each(function(){if(g.complete){g.complete.call(this)}})}}function c(m){var n=$(this),l=g.complete,o=g.mode;function k(){if($.isFunction(l)){l.call(n[0])}if($.isFunction(m)){m()}}if(n.is(":hidden")?o==="hide":o==="show"){k()}else{f.call(n[0],g,k)}}if(f){return e===false?this.each(c):this.queue(e||"fx",c)}else{return a.call(this,{options:g,duration:g.duration,callback:g.complete,mode:g.mode})}}});var rvertical=/up|down|vertical/,rpositivemotion=/up|left|vertical|horizontal/;$.jqplot.effects.effect.blind=function(c,h){var d=$(this),k=["position","top","bottom","left","right","height","width"],i=$.jqplot.effects.setMode(d,c.mode||"hide"),m=c.direction||"up",f=rvertical.test(m),e=f?"height":"width",j=f?"top":"left",p=rpositivemotion.test(m),g={},n=i==="show",b,a,l;if(d.parent().is(".ui-effects-wrapper")){$.jqplot.effects.save(d.parent(),k)}else{$.jqplot.effects.save(d,k)}d.show();l=parseInt(d.css("top"),10);b=$.jqplot.effects.createWrapper(d).css({overflow:"hidden"});a=f?b[e]()+l:b[e]();g[e]=n?String(a):"0";if(!p){d.css(f?"bottom":"right",0).css(f?"top":"left","").css({position:"absolute"});g[j]=n?"0":String(a)}if(n){b.css(e,0);if(!p){b.css(j,a)}}b.animate(g,{duration:c.duration,easing:c.easing,queue:false,complete:function(){if(i==="hide"){d.hide()}$.jqplot.effects.restore(d,k);$.jqplot.effects.removeWrapper(d);h()}})}; \ No newline at end of file diff --git a/www/protected/extensions/jqplot/jquery.js b/www/protected/extensions/jqplot/jquery.js new file mode 100644 index 0000000..11e6d06 --- /dev/null +++ b/www/protected/extensions/jqplot/jquery.js @@ -0,0 +1,9046 @@ +/*! + * jQuery JavaScript Library v1.6.4 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Mon Sep 12 18:54:48 2011 -0400 + */ +(function( window, undefined ) { + +// Use the correct document accordingly with window argument (sandbox) +var document = window.document, + navigator = window.navigator, + location = window.location; +var jQuery = (function() { + +// Define a local copy of jQuery +var jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context, rootjQuery ); + }, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // A central reference to the root jQuery(document) + rootjQuery, + + // A simple way to check for HTML strings or ID strings + // Prioritize #id over <tag> to avoid XSS via location.hash (#9521) + quickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, + + // Check if a string has a non-whitespace character in it + rnotwhite = /\S/, + + // Used for trimming whitespace + trimLeft = /^\s+/, + trimRight = /\s+$/, + + // Check for digits + rdigit = /\d/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, + rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + + // Useragent RegExp + rwebkit = /(webkit)[ \/]([\w.]+)/, + ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, + rmsie = /(msie) ([\w.]+)/, + rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, + + // Matches dashed string for camelizing + rdashAlpha = /-([a-z]|[0-9])/ig, + rmsPrefix = /^-ms-/, + + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return ( letter + "" ).toUpperCase(); + }, + + // Keep a UserAgent string for use with jQuery.browser + userAgent = navigator.userAgent, + + // For matching the engine and version of the browser + browserMatch, + + // The deferred used on DOM ready + readyList, + + // The ready event handler + DOMContentLoaded, + + // Save a reference to some core methods + toString = Object.prototype.toString, + hasOwn = Object.prototype.hasOwnProperty, + push = Array.prototype.push, + slice = Array.prototype.slice, + trim = String.prototype.trim, + indexOf = Array.prototype.indexOf, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), or $(undefined) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // The body element only exists once, optimize finding it + if ( selector === "body" && !context && document.body ) { + this.context = document; + this[0] = document.body; + this.selector = selector; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = quickExpr.exec( selector ); + } + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + context = context instanceof jQuery ? context[0] : context; + doc = (context ? context.ownerDocument || context : document); + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + ret = rsingleTag.exec( selector ); + + if ( ret ) { + if ( jQuery.isPlainObject( context ) ) { + selector = [ document.createElement( ret[1] ) ]; + jQuery.fn.attr.call( selector, context, true ); + + } else { + selector = [ doc.createElement( ret[1] ) ]; + } + + } else { + ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); + selector = (ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment).childNodes; + } + + return jQuery.merge( this, selector ); + + // HANDLE: $("#id") + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return (context || rootjQuery).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if (selector.selector !== undefined) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.6.4", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return slice.call( this, 0 ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = this.constructor(); + + if ( jQuery.isArray( elems ) ) { + push.apply( ret, elems ); + + } else { + jQuery.merge( ret, elems ); + } + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + (this.selector ? " " : "") + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Attach the listeners + jQuery.bindReady(); + + // Add the callback + readyList.done( fn ); + + return this; + }, + + eq: function( i ) { + return i === -1 ? + this.slice( i ) : + this.slice( i, +i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ), + "slice", slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + // Either a released hold or an DOMready/load event and not yet ready + if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger( "ready" ).unbind( "ready" ); + } + } + }, + + bindReady: function() { + if ( readyList ) { + return; + } + + readyList = jQuery._Deferred(); + + // Catch cases where $(document).ready() is called after the + // browser event has already occurred. + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + return setTimeout( jQuery.ready, 1 ); + } + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent( "onreadystatechange", DOMContentLoaded ); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var toplevel = false; + + try { + toplevel = window.frameElement == null; + } catch(e) {} + + if ( document.documentElement.doScroll && toplevel ) { + doScrollCheck(); + } + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + // A crude way of determining if an object is a window + isWindow: function( obj ) { + return obj && typeof obj === "object" && "setInterval" in obj; + }, + + isNaN: function( obj ) { + return obj == null || !rdigit.test( obj ) || isNaN( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + try { + // Not own constructor property must be Object + if ( obj.constructor && + !hasOwn.call(obj, "constructor") && + !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + } catch ( e ) { + // IE8,9 Will throw exceptions on certain host objects #9897 + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + for ( var name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw msg; + }, + + parseJSON: function( data ) { + if ( typeof data !== "string" || !data ) { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Attempt to parse using the native JSON parser first + if ( window.JSON && window.JSON.parse ) { + return window.JSON.parse( data ); + } + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test( data.replace( rvalidescape, "@" ) + .replace( rvalidtokens, "]" ) + .replace( rvalidbraces, "")) ) { + + return (new Function( "return " + data ))(); + + } + jQuery.error( "Invalid JSON: " + data ); + }, + + // Cross-browser xml parsing + parseXML: function( data ) { + var xml, tmp; + try { + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + } catch( e ) { + xml = undefined; + } + if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; + }, + + noop: function() {}, + + // Evaluates a script in a global context + // Workarounds based on findings by Jim Driscoll + // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context + globalEval: function( data ) { + if ( data && rnotwhite.test( data ) ) { + // We use execScript on Internet Explorer + // We use an anonymous function so that context is window + // rather than jQuery in Firefox + ( window.execScript || function( data ) { + window[ "eval" ].call( window, data ); + } )( data ); + } + }, + + // Convert dashed to camelCase; used by the css and data modules + // Microsoft forgot to hump their vendor prefix (#9572) + camelCase: function( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, + length = object.length, + isObj = length === undefined || jQuery.isFunction( object ); + + if ( args ) { + if ( isObj ) { + for ( name in object ) { + if ( callback.apply( object[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( object[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in object ) { + if ( callback.call( object[ name ], name, object[ name ] ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) { + break; + } + } + } + } + + return object; + }, + + // Use native String.trim function wherever possible + trim: trim ? + function( text ) { + return text == null ? + "" : + trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); + }, + + // results is for internal usage only + makeArray: function( array, results ) { + var ret = results || []; + + if ( array != null ) { + // The window, strings (and functions) also have 'length' + // The extra typeof function check is to prevent crashes + // in Safari 2 (See: #3039) + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + var type = jQuery.type( array ); + + if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { + push.call( ret, array ); + } else { + jQuery.merge( ret, array ); + } + } + + return ret; + }, + + inArray: function( elem, array ) { + if ( !array ) { + return -1; + } + + if ( indexOf ) { + return indexOf.call( array, elem ); + } + + for ( var i = 0, length = array.length; i < length; i++ ) { + if ( array[ i ] === elem ) { + return i; + } + } + + return -1; + }, + + merge: function( first, second ) { + var i = first.length, + j = 0; + + if ( typeof second.length === "number" ) { + for ( var l = second.length; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var ret = [], retVal; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var value, key, ret = [], + i = 0, + length = elems.length, + // jquery objects are treated as arrays + isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; + + // Go through the array, translating each of the items to their + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Go through every key on the object, + } else { + for ( key in elems ) { + value = callback( elems[ key ], key, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + } + + // Flatten any nested arrays + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + if ( typeof context === "string" ) { + var tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + var args = slice.call( arguments, 2 ), + proxy = function() { + return fn.apply( context, args.concat( slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + + return proxy; + }, + + // Mutifunctional method to get and set values to a collection + // The value/s can optionally be executed if it's a function + access: function( elems, key, value, exec, fn, pass ) { + var length = elems.length; + + // Setting many attributes + if ( typeof key === "object" ) { + for ( var k in key ) { + jQuery.access( elems, k, key[k], exec, fn, value ); + } + return elems; + } + + // Setting one attribute + if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = !pass && exec && jQuery.isFunction(value); + + for ( var i = 0; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + + return elems; + } + + // Getting an attribute + return length ? fn( elems[0], key ) : undefined; + }, + + now: function() { + return (new Date()).getTime(); + }, + + // Use of jQuery.browser is frowned upon. + // More details: http://docs.jquery.com/Utilities/jQuery.browser + uaMatch: function( ua ) { + ua = ua.toLowerCase(); + + var match = rwebkit.exec( ua ) || + ropera.exec( ua ) || + rmsie.exec( ua ) || + ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || + []; + + return { browser: match[1] || "", version: match[2] || "0" }; + }, + + sub: function() { + function jQuerySub( selector, context ) { + return new jQuerySub.fn.init( selector, context ); + } + jQuery.extend( true, jQuerySub, this ); + jQuerySub.superclass = this; + jQuerySub.fn = jQuerySub.prototype = this(); + jQuerySub.fn.constructor = jQuerySub; + jQuerySub.sub = this.sub; + jQuerySub.fn.init = function init( selector, context ) { + if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { + context = jQuerySub( context ); + } + + return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); + }; + jQuerySub.fn.init.prototype = jQuerySub.fn; + var rootjQuerySub = jQuerySub(document); + return jQuerySub; + }, + + browser: {} +}); + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +browserMatch = jQuery.uaMatch( userAgent ); +if ( browserMatch.browser ) { + jQuery.browser[ browserMatch.browser ] = true; + jQuery.browser.version = browserMatch.version; +} + +// Deprecated, use jQuery.browser.webkit instead +if ( jQuery.browser.webkit ) { + jQuery.browser.safari = true; +} + +// IE doesn't match non-breaking spaces with \s +if ( rnotwhite.test( "\xA0" ) ) { + trimLeft = /^[\s\xA0]+/; + trimRight = /[\s\xA0]+$/; +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); + +// Cleanup functions for the document ready method +if ( document.addEventListener ) { + DOMContentLoaded = function() { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + }; + +} else if ( document.attachEvent ) { + DOMContentLoaded = function() { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }; +} + +// The DOM ready check for Internet Explorer +function doScrollCheck() { + if ( jQuery.isReady ) { + return; + } + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch(e) { + setTimeout( doScrollCheck, 1 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); +} + +return jQuery; + +})(); + + +var // Promise methods + promiseMethods = "done fail isResolved isRejected promise then always pipe".split( " " ), + // Static reference to slice + sliceDeferred = [].slice; + +jQuery.extend({ + // Create a simple deferred (one callbacks list) + _Deferred: function() { + var // callbacks list + callbacks = [], + // stored [ context , args ] + fired, + // to avoid firing when already doing so + firing, + // flag to know if the deferred has been cancelled + cancelled, + // the deferred itself + deferred = { + + // done( f1, f2, ...) + done: function() { + if ( !cancelled ) { + var args = arguments, + i, + length, + elem, + type, + _fired; + if ( fired ) { + _fired = fired; + fired = 0; + } + for ( i = 0, length = args.length; i < length; i++ ) { + elem = args[ i ]; + type = jQuery.type( elem ); + if ( type === "array" ) { + deferred.done.apply( deferred, elem ); + } else if ( type === "function" ) { + callbacks.push( elem ); + } + } + if ( _fired ) { + deferred.resolveWith( _fired[ 0 ], _fired[ 1 ] ); + } + } + return this; + }, + + // resolve with given context and args + resolveWith: function( context, args ) { + if ( !cancelled && !fired && !firing ) { + // make sure args are available (#8421) + args = args || []; + firing = 1; + try { + while( callbacks[ 0 ] ) { + callbacks.shift().apply( context, args ); + } + } + finally { + fired = [ context, args ]; + firing = 0; + } + } + return this; + }, + + // resolve with this as context and given arguments + resolve: function() { + deferred.resolveWith( this, arguments ); + return this; + }, + + // Has this deferred been resolved? + isResolved: function() { + return !!( firing || fired ); + }, + + // Cancel + cancel: function() { + cancelled = 1; + callbacks = []; + return this; + } + }; + + return deferred; + }, + + // Full fledged deferred (two callbacks list) + Deferred: function( func ) { + var deferred = jQuery._Deferred(), + failDeferred = jQuery._Deferred(), + promise; + // Add errorDeferred methods, then and promise + jQuery.extend( deferred, { + then: function( doneCallbacks, failCallbacks ) { + deferred.done( doneCallbacks ).fail( failCallbacks ); + return this; + }, + always: function() { + return deferred.done.apply( deferred, arguments ).fail.apply( this, arguments ); + }, + fail: failDeferred.done, + rejectWith: failDeferred.resolveWith, + reject: failDeferred.resolve, + isRejected: failDeferred.isResolved, + pipe: function( fnDone, fnFail ) { + return jQuery.Deferred(function( newDefer ) { + jQuery.each( { + done: [ fnDone, "resolve" ], + fail: [ fnFail, "reject" ] + }, function( handler, data ) { + var fn = data[ 0 ], + action = data[ 1 ], + returned; + if ( jQuery.isFunction( fn ) ) { + deferred[ handler ](function() { + returned = fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise().then( newDefer.resolve, newDefer.reject ); + } else { + newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] ); + } + }); + } else { + deferred[ handler ]( newDefer[ action ] ); + } + }); + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + if ( obj == null ) { + if ( promise ) { + return promise; + } + promise = obj = {}; + } + var i = promiseMethods.length; + while( i-- ) { + obj[ promiseMethods[i] ] = deferred[ promiseMethods[i] ]; + } + return obj; + } + }); + // Make sure only one callback list will be used + deferred.done( failDeferred.cancel ).fail( deferred.cancel ); + // Unexpose cancel + delete deferred.cancel; + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + return deferred; + }, + + // Deferred helper + when: function( firstParam ) { + var args = arguments, + i = 0, + length = args.length, + count = length, + deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ? + firstParam : + jQuery.Deferred(); + function resolveFunc( i ) { + return function( value ) { + args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; + if ( !( --count ) ) { + // Strange bug in FF4: + // Values changed onto the arguments object sometimes end up as undefined values + // outside the $.when method. Cloning the object into a fresh array solves the issue + deferred.resolveWith( deferred, sliceDeferred.call( args, 0 ) ); + } + }; + } + if ( length > 1 ) { + for( ; i < length; i++ ) { + if ( args[ i ] && jQuery.isFunction( args[ i ].promise ) ) { + args[ i ].promise().then( resolveFunc(i), deferred.reject ); + } else { + --count; + } + } + if ( !count ) { + deferred.resolveWith( deferred, args ); + } + } else if ( deferred !== firstParam ) { + deferred.resolveWith( deferred, length ? [ firstParam ] : [] ); + } + return deferred.promise(); + } +}); + + + +jQuery.support = (function() { + + var div = document.createElement( "div" ), + documentElement = document.documentElement, + all, + a, + select, + opt, + input, + marginDiv, + support, + fragment, + body, + testElementParent, + testElement, + testElementStyle, + tds, + events, + eventName, + i, + isSupported; + + // Preliminary tests + div.setAttribute("className", "t"); + div.innerHTML = " <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>"; + + + all = div.getElementsByTagName( "*" ); + a = div.getElementsByTagName( "a" )[ 0 ]; + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return {}; + } + + // First batch of supports tests + select = document.createElement( "select" ); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName( "input" )[ 0 ]; + + support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: ( div.firstChild.nodeType === 3 ), + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName( "tbody" ).length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName( "link" ).length, + + // Get the style information from getAttribute + // (IE uses .cssText instead) + style: /top/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: ( a.getAttribute( "href" ) === "/a" ), + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.55$/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: ( input.value === "on" ), + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // Will be defined later + submitBubbles: true, + changeBubbles: true, + focusinBubbles: false, + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { + div.attachEvent( "onclick", function() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + support.noCloneEvent = false; + }); + div.cloneNode( true ).fireEvent( "onclick" ); + } + + // Check if a radio maintains it's value + // after being appended to the DOM + input = document.createElement("input"); + input.value = "t"; + input.setAttribute("type", "radio"); + support.radioValue = input.value === "t"; + + input.setAttribute("checked", "checked"); + div.appendChild( input ); + fragment = document.createDocumentFragment(); + fragment.appendChild( div.firstChild ); + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + div.innerHTML = ""; + + // Figure out if the W3C box model works as expected + div.style.width = div.style.paddingLeft = "1px"; + + body = document.getElementsByTagName( "body" )[ 0 ]; + // We use our own, invisible, body unless the body is already present + // in which case we use a div (#9239) + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + jQuery.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + support.boxModel = div.offsetWidth === 2; + + if ( "zoom" in div.style ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.style.display = "inline"; + div.style.zoom = 1; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 2 ); + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = ""; + div.innerHTML = "<div style='width:4px;'></div>"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 2 ); + } + + div.innerHTML = "<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>"; + tds = div.getElementsByTagName( "td" ); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE < 8 fail this test) + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + div.innerHTML = ""; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. For more + // info see bug #3333 + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + if ( document.defaultView && document.defaultView.getComputedStyle ) { + marginDiv = document.createElement( "div" ); + marginDiv.style.width = "0"; + marginDiv.style.marginRight = "0"; + div.appendChild( marginDiv ); + support.reliableMarginRight = + ( parseInt( ( document.defaultView.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0; + } + + // Remove the body element we added + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + // Technique from Juriy Zaytsev + // http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/ + // We only care about the case where non-standard event systems + // are used, namely in IE. Short-circuiting here helps us to + // avoid an eval call (in setAttribute) which can cause CSP + // to go haywire. See: https://developer.mozilla.org/en/Security/CSP + if ( div.attachEvent ) { + for( i in { + submit: 1, + change: 1, + focusin: 1 + } ) { + eventName = "on" + i; + isSupported = ( eventName in div ); + if ( !isSupported ) { + div.setAttribute( eventName, "return;" ); + isSupported = ( typeof div[ eventName ] === "function" ); + } + support[ i + "Bubbles" ] = isSupported; + } + } + + // Null connected elements to avoid leaks in IE + testElement = fragment = select = opt = body = marginDiv = div = input = null; + + return support; +})(); + +// Keep track of boxModel +jQuery.boxModel = jQuery.support.boxModel; + + + + +var rbrace = /^(?:\{.*\}|\[.*\])$/, + rmultiDash = /([A-Z])/g; + +jQuery.extend({ + cache: {}, + + // Please use with caution + uuid: 0, + + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; + + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, ret, + internalKey = jQuery.expando, + getByName = typeof name === "string", + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ jQuery.expando ] : elem[ jQuery.expando ] && jQuery.expando; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( (!id || (pvt && id && (cache[ id ] && !cache[ id ][ internalKey ]))) && getByName && data === undefined ) { + return; + } + + if ( !id ) { + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + elem[ jQuery.expando ] = id = ++jQuery.uuid; + } else { + id = jQuery.expando; + } + } + + if ( !cache[ id ] ) { + cache[ id ] = {}; + + // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery + // metadata on plain JS objects when the object is serialized using + // JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ][ internalKey ] = jQuery.extend(cache[ id ][ internalKey ], name); + } else { + cache[ id ] = jQuery.extend(cache[ id ], name); + } + } + + thisCache = cache[ id ]; + + // Internal jQuery data is stored in a separate object inside the object's data + // cache in order to avoid key collisions between internal data and user-defined + // data + if ( pvt ) { + if ( !thisCache[ internalKey ] ) { + thisCache[ internalKey ] = {}; + } + + thisCache = thisCache[ internalKey ]; + } + + if ( data !== undefined ) { + thisCache[ jQuery.camelCase( name ) ] = data; + } + + // TODO: This is a hack for 1.5 ONLY. It will be removed in 1.6. Users should + // not attempt to inspect the internal events object using jQuery.data, as this + // internal data object is undocumented and subject to change. + if ( name === "events" && !thisCache[name] ) { + return thisCache[ internalKey ] && thisCache[ internalKey ].events; + } + + // Check for both converted-to-camel and non-converted data property names + // If a data property was specified + if ( getByName ) { + + // First Try to find as-is property data + ret = thisCache[ name ]; + + // Test for null|undefined property data + if ( ret == null ) { + + // Try to find the camelCased property + ret = thisCache[ jQuery.camelCase( name ) ]; + } + } else { + ret = thisCache; + } + + return ret; + }, + + removeData: function( elem, name, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, + + // Reference to internal data cache key + internalKey = jQuery.expando, + + isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + + // See jQuery.data for more information + id = isNode ? elem[ jQuery.expando ] : jQuery.expando; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + + thisCache = pvt ? cache[ id ][ internalKey ] : cache[ id ]; + + if ( thisCache ) { + + // Support interoperable removal of hyphenated or camelcased keys + if ( !thisCache[ name ] ) { + name = jQuery.camelCase( name ); + } + + delete thisCache[ name ]; + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( !isEmptyDataObject(thisCache) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( pvt ) { + delete cache[ id ][ internalKey ]; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject(cache[ id ]) ) { + return; + } + } + + var internalCache = cache[ id ][ internalKey ]; + + // Browsers that fail expando deletion also refuse to delete expandos on + // the window, but it will allow it on all other JS objects; other browsers + // don't care + // Ensure that `cache` is not a window object #10080 + if ( jQuery.support.deleteExpando || !cache.setInterval ) { + delete cache[ id ]; + } else { + cache[ id ] = null; + } + + // We destroyed the entire user cache at once because it's faster than + // iterating through each key, but we need to continue to persist internal + // data if it existed + if ( internalCache ) { + cache[ id ] = {}; + // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery + // metadata on plain JS objects when the object is serialized using + // JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + + cache[ id ][ internalKey ] = internalCache; + + // Otherwise, we need to eliminate the expando on the node to avoid + // false lookups in the cache for entries that no longer exist + } else if ( isNode ) { + // IE does not allow us to delete expando properties from nodes, + // nor does it have a removeAttribute function on Document nodes; + // we must handle all of these cases + if ( jQuery.support.deleteExpando ) { + delete elem[ jQuery.expando ]; + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } else { + elem[ jQuery.expando ] = null; + } + } + }, + + // For internal use only. + _data: function( elem, name, data ) { + return jQuery.data( elem, name, data, true ); + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + if ( elem.nodeName ) { + var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; + + if ( match ) { + return !(match === true || elem.getAttribute("classid") !== match); + } + } + + return true; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var data = null; + + if ( typeof key === "undefined" ) { + if ( this.length ) { + data = jQuery.data( this[0] ); + + if ( this[0].nodeType === 1 ) { + var attr = this[0].attributes, name; + for ( var i = 0, l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = jQuery.camelCase( name.substring(5) ); + + dataAttr( this[0], name, data[ name ] ); + } + } + } + } + + return data; + + } else if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + var parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + // Try to fetch any internally stored data first + if ( data === undefined && this.length ) { + data = jQuery.data( this[0], key ); + data = dataAttr( this[0], key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + + } else { + return this.each(function() { + var $this = jQuery( this ), + args = [ parts[0], value ]; + + $this.triggerHandler( "setData" + parts[1] + "!", args ); + jQuery.data( this, key, value ); + $this.triggerHandler( "changeData" + parts[1] + "!", args ); + }); + } + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + + var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); + + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + !jQuery.isNaN( data ) ? parseFloat( data ) : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// TODO: This is a hack for 1.5 ONLY to allow objects with a single toJSON +// property to be considered empty objects; this property always exists in +// order to make sure JSON.stringify does not expose internal metadata +function isEmptyDataObject( obj ) { + for ( var name in obj ) { + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} + + + + +function handleQueueMarkDefer( elem, type, src ) { + var deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + defer = jQuery.data( elem, deferDataKey, undefined, true ); + if ( defer && + ( src === "queue" || !jQuery.data( elem, queueDataKey, undefined, true ) ) && + ( src === "mark" || !jQuery.data( elem, markDataKey, undefined, true ) ) ) { + // Give room for hard-coded callbacks to fire first + // and eventually mark/queue something else on the element + setTimeout( function() { + if ( !jQuery.data( elem, queueDataKey, undefined, true ) && + !jQuery.data( elem, markDataKey, undefined, true ) ) { + jQuery.removeData( elem, deferDataKey, true ); + defer.resolve(); + } + }, 0 ); + } +} + +jQuery.extend({ + + _mark: function( elem, type ) { + if ( elem ) { + type = (type || "fx") + "mark"; + jQuery.data( elem, type, (jQuery.data(elem,type,undefined,true) || 0) + 1, true ); + } + }, + + _unmark: function( force, elem, type ) { + if ( force !== true ) { + type = elem; + elem = force; + force = false; + } + if ( elem ) { + type = type || "fx"; + var key = type + "mark", + count = force ? 0 : ( (jQuery.data( elem, key, undefined, true) || 1 ) - 1 ); + if ( count ) { + jQuery.data( elem, key, count, true ); + } else { + jQuery.removeData( elem, key, true ); + handleQueueMarkDefer( elem, type, "mark" ); + } + } + }, + + queue: function( elem, type, data ) { + if ( elem ) { + type = (type || "fx") + "queue"; + var q = jQuery.data( elem, type, undefined, true ); + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !q || jQuery.isArray(data) ) { + q = jQuery.data( elem, type, jQuery.makeArray(data), true ); + } else { + q.push( data ); + } + } + return q || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + fn = queue.shift(), + defer; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + } + + if ( fn ) { + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift("inprogress"); + } + + fn.call(elem, function() { + jQuery.dequeue(elem, type); + }); + } + + if ( !queue.length ) { + jQuery.removeData( elem, type + "queue", true ); + handleQueueMarkDefer( elem, type, "queue" ); + } + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) { + return jQuery.queue( this[0], type ); + } + return this.each(function() { + var queue = jQuery.queue( this, type, data ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[time] || time : time; + type = type || "fx"; + + return this.queue( type, function() { + var elem = this; + setTimeout(function() { + jQuery.dequeue( elem, type ); + }, time ); + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, object ) { + if ( typeof type !== "string" ) { + object = type; + type = undefined; + } + type = type || "fx"; + var defer = jQuery.Deferred(), + elements = this, + i = elements.length, + count = 1, + deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + tmp; + function resolve() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + } + while( i-- ) { + if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) || + ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) || + jQuery.data( elements[ i ], markDataKey, undefined, true ) ) && + jQuery.data( elements[ i ], deferDataKey, jQuery._Deferred(), true ) )) { + count++; + tmp.done( resolve ); + } + } + resolve(); + return defer.promise(); + } +}); + + + + +var rclass = /[\n\t\r]/g, + rspace = /\s+/, + rreturn = /\r/g, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea)?$/i, + rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, + nodeHook, boolHook; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.attr ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.prop ); + }, + + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + var classNames, i, l, elem, + setClass, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).addClass( value.call(this, j, this.className) ); + }); + } + + if ( value && typeof value === "string" ) { + classNames = value.split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className && classNames.length === 1 ) { + elem.className = value; + + } else { + setClass = " " + elem.className + " "; + + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) { + setClass += classNames[ c ] + " "; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classNames, i, l, elem, className, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call(this, j, this.className) ); + }); + } + + if ( (value && typeof value === "string") || value === undefined ) { + classNames = (value || "").split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 && elem.className ) { + if ( value ) { + className = (" " + elem.className + " ").replace( rclass, " " ); + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + className = className.replace(" " + classNames[ c ] + " ", " "); + } + elem.className = jQuery.trim( className ); + + } else { + elem.className = ""; + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( rspace ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space seperated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " "; + for ( var i = 0, l = this.length; i < l; i++ ) { + if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var hooks, ret, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.nodeName.toLowerCase() ] || jQuery.valHooks[ elem.type ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } + + return undefined; + } + + var isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var self = jQuery(this), val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.nodeName.toLowerCase() ] || jQuery.valHooks[ this.type ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var value, + index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) { + var option = options[ i ]; + + // Don't return options that are disabled or in a disabled optgroup + if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && + (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + // Fixes Bug #2551 -- select.val() broken in IE after form.reset() + if ( one && !values.length && options.length ) { + return jQuery( options[ index ] ).val(); + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + attrFn: { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true + }, + + attrFix: { + // Always normalize to ensure hook usage + tabindex: "tabIndex" + }, + + attr: function( elem, name, value, pass ) { + var nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return undefined; + } + + if ( pass && name in jQuery.attrFn ) { + return jQuery( elem )[ name ]( value ); + } + + // Fallback to prop when attributes are not supported + if ( !("getAttribute" in elem) ) { + return jQuery.prop( elem, name, value ); + } + + var ret, hooks, + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // Normalize the name if needed + if ( notxml ) { + name = jQuery.attrFix[ name ] || name; + + hooks = jQuery.attrHooks[ name ]; + + if ( !hooks ) { + // Use boolHook for boolean attributes + if ( rboolean.test( name ) ) { + hooks = boolHook; + + // Use nodeHook if available( IE6/7 ) + } else if ( nodeHook ) { + hooks = nodeHook; + } + } + } + + if ( value !== undefined ) { + + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return undefined; + + } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + elem.setAttribute( name, "" + value ); + return value; + } + + } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + + ret = elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return ret === null ? + undefined : + ret; + } + }, + + removeAttr: function( elem, name ) { + var propName; + if ( elem.nodeType === 1 ) { + name = jQuery.attrFix[ name ] || name; + + jQuery.attr( elem, name, "" ); + elem.removeAttribute( name ); + + // Set corresponding property to false for boolean attributes + if ( rboolean.test( name ) && (propName = jQuery.propFix[ name ] || name) in elem ) { + elem[ propName ] = false; + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to it's default in case type is set after value + // This is for element creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + }, + // Use the value property for back compat + // Use the nodeHook for button elements in IE6/7 (#1954) + value: { + get: function( elem, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.get( elem, name ); + } + return name in elem ? + elem.value : + null; + }, + set: function( elem, value, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.set( elem, value, name ); + } + // Does not return so that setAttribute is also used + elem.value = value; + } + } + }, + + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + + prop: function( elem, name, value ) { + var nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return undefined; + } + + var ret, hooks, + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return (elem[ name ] = value); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabindex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + } +}); + +// Add the tabindex propHook to attrHooks for back-compat +jQuery.attrHooks.tabIndex = jQuery.propHooks.tabIndex; + +// Hook for boolean attributes +boolHook = { + get: function( elem, name ) { + // Align boolean attributes with corresponding properties + // Fall back to attribute presence where some booleans are not supported + var attrNode; + return jQuery.prop( elem, name ) === true || ( attrNode = elem.getAttributeNode( name ) ) && attrNode.nodeValue !== false ? + name.toLowerCase() : + undefined; + }, + set: function( elem, value, name ) { + var propName; + if ( value === false ) { + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + // value is true since we know at this point it's type boolean and not false + // Set boolean attributes to the same name and set the DOM property + propName = jQuery.propFix[ name ] || name; + if ( propName in elem ) { + // Only set the IDL specifically if it already exists on the element + elem[ propName ] = true; + } + + elem.setAttribute( name, name.toLowerCase() ); + } + return name; + } +}; + +// IE6/7 do not support getting/setting some attributes with get/setAttribute +if ( !jQuery.support.getSetAttribute ) { + + // Use this for any attribute in IE6/7 + // This fixes almost every IE6/7 issue + nodeHook = jQuery.valHooks.button = { + get: function( elem, name ) { + var ret; + ret = elem.getAttributeNode( name ); + // Return undefined if nodeValue is empty string + return ret && ret.nodeValue !== "" ? + ret.nodeValue : + undefined; + }, + set: function( elem, value, name ) { + // Set the existing or create a new attribute node + var ret = elem.getAttributeNode( name ); + if ( !ret ) { + ret = document.createAttribute( name ); + elem.setAttributeNode( ret ); + } + return (ret.nodeValue = value + ""); + } + }; + + // Set width and height to auto instead of 0 on empty string( Bug #8150 ) + // This is for removals + jQuery.each([ "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + set: function( elem, value ) { + if ( value === "" ) { + elem.setAttribute( name, "auto" ); + return value; + } + } + }); + }); +} + + +// Some attributes require a special call on IE +if ( !jQuery.support.hrefNormalized ) { + jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + get: function( elem ) { + var ret = elem.getAttribute( name, 2 ); + return ret === null ? undefined : ret; + } + }); + }); +} + +if ( !jQuery.support.style ) { + jQuery.attrHooks.style = { + get: function( elem ) { + // Return undefined in the case of empty string + // Normalize to lowercase since IE uppercases css property names + return elem.style.cssText.toLowerCase() || undefined; + }, + set: function( elem, value ) { + return (elem.style.cssText = "" + value); + } + }; +} + +// Safari mis-reports the default selected property of an option +// Accessing the parent's selectedIndex property fixes it +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + return null; + } + }); +} + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return (elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0); + } + } + }); +}); + + + + +var rnamespaces = /\.(.*)$/, + rformElems = /^(?:textarea|input|select)$/i, + rperiod = /\./g, + rspaces = / /g, + rescape = /[^\w\s.|`]/g, + fcleanup = function( nm ) { + return nm.replace(rescape, "\\$&"); + }; + +/* + * A number of helper functions used for managing events. + * Many of the ideas behind this code originated from + * Dean Edwards' addEvent library. + */ +jQuery.event = { + + // Bind an event to an element + // Original by Dean Edwards + add: function( elem, types, handler, data ) { + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + if ( handler === false ) { + handler = returnFalse; + } else if ( !handler ) { + // Fixes bug #7229. Fix recommended by jdalton + return; + } + + var handleObjIn, handleObj; + + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + } + + // Make sure that the function being executed has a unique ID + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure + var elemData = jQuery._data( elem ); + + // If no elemData is found then we must be trying to bind to one of the + // banned noData elements + if ( !elemData ) { + return; + } + + var events = elemData.events, + eventHandle = elemData.handle; + + if ( !events ) { + elemData.events = events = {}; + } + + if ( !eventHandle ) { + elemData.handle = eventHandle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.handle.apply( eventHandle.elem, arguments ) : + undefined; + }; + } + + // Add elem as a property of the handle function + // This is to prevent a memory leak with non-native events in IE. + eventHandle.elem = elem; + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = types.split(" "); + + var type, i = 0, namespaces; + + while ( (type = types[ i++ ]) ) { + handleObj = handleObjIn ? + jQuery.extend({}, handleObjIn) : + { handler: handler, data: data }; + + // Namespaced event handlers + if ( type.indexOf(".") > -1 ) { + namespaces = type.split("."); + type = namespaces.shift(); + handleObj.namespace = namespaces.slice(0).sort().join("."); + + } else { + namespaces = []; + handleObj.namespace = ""; + } + + handleObj.type = type; + if ( !handleObj.guid ) { + handleObj.guid = handler.guid; + } + + // Get the current list of functions bound to this event + var handlers = events[ type ], + special = jQuery.event.special[ type ] || {}; + + // Init the event handler queue + if ( !handlers ) { + handlers = events[ type ] = []; + + // Check for a special event handler + // Only use addEventListener/attachEvent if the special + // events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add the function to the element's handler list + handlers.push( handleObj ); + + // Keep track of which events have been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, pos ) { + // don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + if ( handler === false ) { + handler = returnFalse; + } + + var ret, type, fn, j, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType, + elemData = jQuery.hasData( elem ) && jQuery._data( elem ), + events = elemData && elemData.events; + + if ( !elemData || !events ) { + return; + } + + // types is actually an event object here + if ( types && types.type ) { + handler = types.handler; + types = types.type; + } + + // Unbind all events for the element + if ( !types || typeof types === "string" && types.charAt(0) === "." ) { + types = types || ""; + + for ( type in events ) { + jQuery.event.remove( elem, type + types ); + } + + return; + } + + // Handle multiple events separated by a space + // jQuery(...).unbind("mouseover mouseout", fn); + types = types.split(" "); + + while ( (type = types[ i++ ]) ) { + origType = type; + handleObj = null; + all = type.indexOf(".") < 0; + namespaces = []; + + if ( !all ) { + // Namespaced event handlers + namespaces = type.split("."); + type = namespaces.shift(); + + namespace = new RegExp("(^|\\.)" + + jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + eventType = events[ type ]; + + if ( !eventType ) { + continue; + } + + if ( !handler ) { + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( all || namespace.test( handleObj.namespace ) ) { + jQuery.event.remove( elem, origType, handleObj.handler, j ); + eventType.splice( j--, 1 ); + } + } + + continue; + } + + special = jQuery.event.special[ type ] || {}; + + for ( j = pos || 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( handler.guid === handleObj.guid ) { + // remove the given handler for the given type + if ( all || namespace.test( handleObj.namespace ) ) { + if ( pos == null ) { + eventType.splice( j--, 1 ); + } + + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + + if ( pos != null ) { + break; + } + } + } + + // remove generic event handler if no more handlers exist + if ( eventType.length === 0 || pos != null && eventType.length === 1 ) { + if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + ret = null; + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + var handle = elemData.handle; + if ( handle ) { + handle.elem = null; + } + + delete elemData.events; + delete elemData.handle; + + if ( jQuery.isEmptyObject( elemData ) ) { + jQuery.removeData( elem, undefined, true ); + } + } + }, + + // Events that are safe to short-circuit if no handlers are attached. + // Native DOM events should not be added, they may have inline handlers. + customEvent: { + "getData": true, + "setData": true, + "changeData": true + }, + + trigger: function( event, data, elem, onlyHandlers ) { + // Event object or event type + var type = event.type || event, + namespaces = [], + exclusive; + + if ( type.indexOf("!") >= 0 ) { + // Exclusive events trigger only for the exact event (no namespaces) + type = type.slice(0, -1); + exclusive = true; + } + + if ( type.indexOf(".") >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + + if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { + // No jQuery handlers for this event type, and it can't have inline handlers + return; + } + + // Caller can pass in an Event, Object, or just an event type string + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + new jQuery.Event( type, event ) : + // Just the event type (string) + new jQuery.Event( type ); + + event.type = type; + event.exclusive = exclusive; + event.namespace = namespaces.join("."); + event.namespace_re = new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)"); + + // triggerHandler() and global events don't bubble or run the default action + if ( onlyHandlers || !elem ) { + event.preventDefault(); + event.stopPropagation(); + } + + // Handle a global trigger + if ( !elem ) { + // TODO: Stop taunting the data cache; remove global events and always attach to document + jQuery.each( jQuery.cache, function() { + // internalKey variable is just used to make it easier to find + // and potentially change this stuff later; currently it just + // points to jQuery.expando + var internalKey = jQuery.expando, + internalCache = this[ internalKey ]; + if ( internalCache && internalCache.events && internalCache.events[ type ] ) { + jQuery.event.trigger( event, data, internalCache.handle.elem ); + } + }); + return; + } + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // Clean up the event in case it is being reused + event.result = undefined; + event.target = elem; + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data != null ? jQuery.makeArray( data ) : []; + data.unshift( event ); + + var cur = elem, + // IE doesn't like method names with a colon (#3533, #8272) + ontype = type.indexOf(":") < 0 ? "on" + type : ""; + + // Fire event on the current element, then bubble up the DOM tree + do { + var handle = jQuery._data( cur, "handle" ); + + event.currentTarget = cur; + if ( handle ) { + handle.apply( cur, data ); + } + + // Trigger an inline bound script + if ( ontype && jQuery.acceptData( cur ) && cur[ ontype ] && cur[ ontype ].apply( cur, data ) === false ) { + event.result = false; + event.preventDefault(); + } + + // Bubble up to document, then to window + cur = cur.parentNode || cur.ownerDocument || cur === event.target.ownerDocument && window; + } while ( cur && !event.isPropagationStopped() ); + + // If nobody prevented the default action, do it now + if ( !event.isDefaultPrevented() ) { + var old, + special = jQuery.event.special[ type ] || {}; + + if ( (!special._default || special._default.call( elem.ownerDocument, event ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Can't use an .isFunction)() check here because IE6/7 fails that test. + // IE<9 dies on focus to hidden element (#1486), may want to revisit a try/catch. + try { + if ( ontype && elem[ type ] ) { + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; + + if ( old ) { + elem[ ontype ] = null; + } + + jQuery.event.triggered = type; + elem[ type ](); + } + } catch ( ieError ) {} + + if ( old ) { + elem[ ontype ] = old; + } + + jQuery.event.triggered = undefined; + } + } + + return event.result; + }, + + handle: function( event ) { + event = jQuery.event.fix( event || window.event ); + // Snapshot the handlers list since a called handler may add/remove events. + var handlers = ((jQuery._data( this, "events" ) || {})[ event.type ] || []).slice(0), + run_all = !event.exclusive && !event.namespace, + args = Array.prototype.slice.call( arguments, 0 ); + + // Use the fix-ed Event rather than the (read-only) native event + args[0] = event; + event.currentTarget = this; + + for ( var j = 0, l = handlers.length; j < l; j++ ) { + var handleObj = handlers[ j ]; + + // Triggered event must 1) be non-exclusive and have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event. + if ( run_all || event.namespace_re.test( handleObj.namespace ) ) { + // Pass in a reference to the handler function itself + // So that we can later remove it + event.handler = handleObj.handler; + event.data = handleObj.data; + event.handleObj = handleObj; + + var ret = handleObj.handler.apply( this, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + return event.result; + }, + + props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // store a copy of the original event object + // and "clone" to set read-only properties + var originalEvent = event; + event = jQuery.Event( originalEvent ); + + for ( var i = this.props.length, prop; i; ) { + prop = this.props[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary + if ( !event.target ) { + // Fixes #1925 where srcElement might not be defined either + event.target = event.srcElement || document; + } + + // check if target is a textnode (safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && event.fromElement ) { + event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement; + } + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && event.clientX != null ) { + var eventDocument = event.target.ownerDocument || document, + doc = eventDocument.documentElement, + body = eventDocument.body; + + event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0); + event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0); + } + + // Add which for key events + if ( event.which == null && (event.charCode != null || event.keyCode != null) ) { + event.which = event.charCode != null ? event.charCode : event.keyCode; + } + + // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs) + if ( !event.metaKey && event.ctrlKey ) { + event.metaKey = event.ctrlKey; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && event.button !== undefined ) { + event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) )); + } + + return event; + }, + + // Deprecated, use jQuery.guid instead + guid: 1E8, + + // Deprecated, use jQuery.proxy instead + proxy: jQuery.proxy, + + special: { + ready: { + // Make sure the ready event is setup + setup: jQuery.bindReady, + teardown: jQuery.noop + }, + + live: { + add: function( handleObj ) { + jQuery.event.add( this, + liveConvert( handleObj.origType, handleObj.selector ), + jQuery.extend({}, handleObj, {handler: liveHandler, guid: handleObj.handler.guid}) ); + }, + + remove: function( handleObj ) { + jQuery.event.remove( this, liveConvert( handleObj.origType, handleObj.selector ), handleObj ); + } + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + } +}; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + if ( elem.detachEvent ) { + elem.detachEvent( "on" + type, handle ); + } + }; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !this.preventDefault ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = (src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault()) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // timeStamp is buggy for some events on Firefox(#3843) + // So we won't rely on the native value + this.timeStamp = jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Checks if an event happened on an element within another element +// Used in jQuery.event.special.mouseenter and mouseleave handlers +var withinElement = function( event ) { + + // Check if mouse(over|out) are still within the same parent element + var related = event.relatedTarget, + inside = false, + eventType = event.type; + + event.type = event.data; + + if ( related !== this ) { + + if ( related ) { + inside = jQuery.contains( this, related ); + } + + if ( !inside ) { + + jQuery.event.handle.apply( this, arguments ); + + event.type = eventType; + } + } +}, + +// In case of event delegation, we only need to rename the event.type, +// liveHandler will take care of the rest. +delegate = function( event ) { + event.type = event.data; + jQuery.event.handle.apply( this, arguments ); +}; + +// Create mouseenter and mouseleave events +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + setup: function( data ) { + jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig ); + }, + teardown: function( data ) { + jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement ); + } + }; +}); + +// submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function( data, namespaces ) { + if ( !jQuery.nodeName( this, "form" ) ) { + jQuery.event.add(this, "click.specialSubmit", function( e ) { + // Avoid triggering error on non-existent type attribute in IE VML (#7071) + var elem = e.target, + type = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.type : ""; + + if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) { + trigger( "submit", this, arguments ); + } + }); + + jQuery.event.add(this, "keypress.specialSubmit", function( e ) { + var elem = e.target, + type = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.type : ""; + + if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) { + trigger( "submit", this, arguments ); + } + }); + + } else { + return false; + } + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialSubmit" ); + } + }; + +} + +// change delegation, happens here so we have bind. +if ( !jQuery.support.changeBubbles ) { + + var changeFilters, + + getVal = function( elem ) { + var type = jQuery.nodeName( elem, "input" ) ? elem.type : "", + val = elem.value; + + if ( type === "radio" || type === "checkbox" ) { + val = elem.checked; + + } else if ( type === "select-multiple" ) { + val = elem.selectedIndex > -1 ? + jQuery.map( elem.options, function( elem ) { + return elem.selected; + }).join("-") : + ""; + + } else if ( jQuery.nodeName( elem, "select" ) ) { + val = elem.selectedIndex; + } + + return val; + }, + + testChange = function testChange( e ) { + var elem = e.target, data, val; + + if ( !rformElems.test( elem.nodeName ) || elem.readOnly ) { + return; + } + + data = jQuery._data( elem, "_change_data" ); + val = getVal(elem); + + // the current data will be also retrieved by beforeactivate + if ( e.type !== "focusout" || elem.type !== "radio" ) { + jQuery._data( elem, "_change_data", val ); + } + + if ( data === undefined || val === data ) { + return; + } + + if ( data != null || val ) { + e.type = "change"; + e.liveFired = undefined; + jQuery.event.trigger( e, arguments[1], elem ); + } + }; + + jQuery.event.special.change = { + filters: { + focusout: testChange, + + beforedeactivate: testChange, + + click: function( e ) { + var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : ""; + + if ( type === "radio" || type === "checkbox" || jQuery.nodeName( elem, "select" ) ) { + testChange.call( this, e ); + } + }, + + // Change has to be called before submit + // Keydown will be called before keypress, which is used in submit-event delegation + keydown: function( e ) { + var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : ""; + + if ( (e.keyCode === 13 && !jQuery.nodeName( elem, "textarea" ) ) || + (e.keyCode === 32 && (type === "checkbox" || type === "radio")) || + type === "select-multiple" ) { + testChange.call( this, e ); + } + }, + + // Beforeactivate happens also before the previous element is blurred + // with this event you can't trigger a change event, but you can store + // information + beforeactivate: function( e ) { + var elem = e.target; + jQuery._data( elem, "_change_data", getVal(elem) ); + } + }, + + setup: function( data, namespaces ) { + if ( this.type === "file" ) { + return false; + } + + for ( var type in changeFilters ) { + jQuery.event.add( this, type + ".specialChange", changeFilters[type] ); + } + + return rformElems.test( this.nodeName ); + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialChange" ); + + return rformElems.test( this.nodeName ); + } + }; + + changeFilters = jQuery.event.special.change.filters; + + // Handle when the input is .focus()'d + changeFilters.focus = changeFilters.beforeactivate; +} + +function trigger( type, elem, args ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + // Don't pass args or remember liveFired; they apply to the donor event. + var event = jQuery.extend( {}, args[ 0 ] ); + event.type = type; + event.originalEvent = {}; + event.liveFired = undefined; + jQuery.event.handle.call( elem, event ); + if ( event.isDefaultPrevented() ) { + args[ 0 ].preventDefault(); + } +} + +// Create "bubbling" focus and blur events +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + + function handler( donor ) { + // Donor event is always a native one; fix it and switch its type. + // Let focusin/out handler cancel the donor focus/blur event. + var e = jQuery.event.fix( donor ); + e.type = fix; + e.originalEvent = {}; + jQuery.event.trigger( e, null, e.target ); + if ( e.isDefaultPrevented() ) { + donor.preventDefault(); + } + } + }); +} + +jQuery.each(["bind", "one"], function( i, name ) { + jQuery.fn[ name ] = function( type, data, fn ) { + var handler; + + // Handle object literals + if ( typeof type === "object" ) { + for ( var key in type ) { + this[ name ](key, data, type[key], fn); + } + return this; + } + + if ( arguments.length === 2 || data === false ) { + fn = data; + data = undefined; + } + + if ( name === "one" ) { + handler = function( event ) { + jQuery( this ).unbind( event, handler ); + return fn.apply( this, arguments ); + }; + handler.guid = fn.guid || jQuery.guid++; + } else { + handler = fn; + } + + if ( type === "unload" && name !== "one" ) { + this.one( type, data, fn ); + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.add( this[i], type, handler, data ); + } + } + + return this; + }; +}); + +jQuery.fn.extend({ + unbind: function( type, fn ) { + // Handle object literals + if ( typeof type === "object" && !type.preventDefault ) { + for ( var key in type ) { + this.unbind(key, type[key]); + } + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.remove( this[i], type, fn ); + } + } + + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.live( types, data, fn, selector ); + }, + + undelegate: function( selector, types, fn ) { + if ( arguments.length === 0 ) { + return this.unbind( "live" ); + + } else { + return this.die( types, null, fn, selector ); + } + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + + triggerHandler: function( type, data ) { + if ( this[0] ) { + return jQuery.event.trigger( type, data, this[0], true ); + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + guid = fn.guid || jQuery.guid++, + i = 0, + toggler = function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + }; + + // link all the functions, so any of them can unbind this click handler + toggler.guid = guid; + while ( i < args.length ) { + args[ i++ ].guid = guid; + } + + return this.click( toggler ); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +var liveMap = { + focus: "focusin", + blur: "focusout", + mouseenter: "mouseover", + mouseleave: "mouseout" +}; + +jQuery.each(["live", "die"], function( i, name ) { + jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) { + var type, i = 0, match, namespaces, preType, + selector = origSelector || this.selector, + context = origSelector ? this : jQuery( this.context ); + + if ( typeof types === "object" && !types.preventDefault ) { + for ( var key in types ) { + context[ name ]( key, data, types[key], selector ); + } + + return this; + } + + if ( name === "die" && !types && + origSelector && origSelector.charAt(0) === "." ) { + + context.unbind( origSelector ); + + return this; + } + + if ( data === false || jQuery.isFunction( data ) ) { + fn = data || returnFalse; + data = undefined; + } + + types = (types || "").split(" "); + + while ( (type = types[ i++ ]) != null ) { + match = rnamespaces.exec( type ); + namespaces = ""; + + if ( match ) { + namespaces = match[0]; + type = type.replace( rnamespaces, "" ); + } + + if ( type === "hover" ) { + types.push( "mouseenter" + namespaces, "mouseleave" + namespaces ); + continue; + } + + preType = type; + + if ( liveMap[ type ] ) { + types.push( liveMap[ type ] + namespaces ); + type = type + namespaces; + + } else { + type = (liveMap[ type ] || type) + namespaces; + } + + if ( name === "live" ) { + // bind live handler + for ( var j = 0, l = context.length; j < l; j++ ) { + jQuery.event.add( context[j], "live." + liveConvert( type, selector ), + { data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } ); + } + + } else { + // unbind live handler + context.unbind( "live." + liveConvert( type, selector ), fn ); + } + } + + return this; + }; +}); + +function liveHandler( event ) { + var stop, maxLevel, related, match, handleObj, elem, j, i, l, data, close, namespace, ret, + elems = [], + selectors = [], + events = jQuery._data( this, "events" ); + + // Make sure we avoid non-left-click bubbling in Firefox (#3861) and disabled elements in IE (#6911) + if ( event.liveFired === this || !events || !events.live || event.target.disabled || event.button && event.type === "click" ) { + return; + } + + if ( event.namespace ) { + namespace = new RegExp("(^|\\.)" + event.namespace.split(".").join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + event.liveFired = this; + + var live = events.live.slice(0); + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) { + selectors.push( handleObj.selector ); + + } else { + live.splice( j--, 1 ); + } + } + + match = jQuery( event.target ).closest( selectors, event.currentTarget ); + + for ( i = 0, l = match.length; i < l; i++ ) { + close = match[i]; + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( close.selector === handleObj.selector && (!namespace || namespace.test( handleObj.namespace )) && !close.elem.disabled ) { + elem = close.elem; + related = null; + + // Those two events require additional checking + if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) { + event.type = handleObj.preType; + related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0]; + + // Make sure not to accidentally match a child element with the same selector + if ( related && jQuery.contains( elem, related ) ) { + related = elem; + } + } + + if ( !related || related !== elem ) { + elems.push({ elem: elem, handleObj: handleObj, level: close.level }); + } + } + } + } + + for ( i = 0, l = elems.length; i < l; i++ ) { + match = elems[i]; + + if ( maxLevel && match.level > maxLevel ) { + break; + } + + event.currentTarget = match.elem; + event.data = match.handleObj.data; + event.handleObj = match.handleObj; + + ret = match.handleObj.origHandler.apply( match.elem, arguments ); + + if ( ret === false || event.isPropagationStopped() ) { + maxLevel = match.level; + + if ( ret === false ) { + stop = false; + } + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + + return stop; +} + +function liveConvert( type, selector ) { + return (type && type !== "*" ? type + "." : "") + selector.replace(rperiod, "`").replace(rspaces, "&"); +} + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.bind( name, data, fn ) : + this.trigger( name ); + }; + + if ( jQuery.attrFn ) { + jQuery.attrFn[ name ] = true; + } +}); + + + +/*! + * Sizzle CSS Selector Engine + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, + done = 0, + toString = Object.prototype.toString, + hasDuplicate = false, + baseHasDuplicate = true, + rBackslash = /\\/g, + rNonWord = /\W/; + +// Here we check if the JavaScript engine is using some sort of +// optimization where it does not always call our comparision +// function. If that is the case, discard the hasDuplicate value. +// Thus far that includes Google Chrome. +[0, 0].sort(function() { + baseHasDuplicate = false; + return 0; +}); + +var Sizzle = function( selector, context, results, seed ) { + results = results || []; + context = context || document; + + var origContext = context; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var m, set, checkSet, extra, ret, cur, pop, i, + prune = true, + contextXML = Sizzle.isXML( context ), + parts = [], + soFar = selector; + + // Reset the position of the chunker regexp (start from head) + do { + chunker.exec( "" ); + m = chunker.exec( soFar ); + + if ( m ) { + soFar = m[3]; + + parts.push( m[1] ); + + if ( m[2] ) { + extra = m[3]; + break; + } + } + } while ( m ); + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context ); + + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) { + selector += parts.shift(); + } + + set = posProcess( selector, set ); + } + } + + } else { + // Take a shortcut and set the context if the root selector is an ID + // (but not if it'll be faster if the inner selector is an ID) + if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && + Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { + + ret = Sizzle.find( parts.shift(), context, contextXML ); + context = ret.expr ? + Sizzle.filter( ret.expr, ret.set )[0] : + ret.set[0]; + } + + if ( context ) { + ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); + + set = ret.expr ? + Sizzle.filter( ret.expr, ret.set ) : + ret.set; + + if ( parts.length > 0 ) { + checkSet = makeArray( set ); + + } else { + prune = false; + } + + while ( parts.length ) { + cur = parts.pop(); + pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, contextXML ); + } + + } else { + checkSet = parts = []; + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + Sizzle.error( cur || selector ); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + + } else if ( context && context.nodeType === 1 ) { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + + } else { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, origContext, results, seed ); + Sizzle.uniqueSort( results ); + } + + return results; +}; + +Sizzle.uniqueSort = function( results ) { + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[ i - 1 ] ) { + results.splice( i--, 1 ); + } + } + } + } + + return results; +}; + +Sizzle.matches = function( expr, set ) { + return Sizzle( expr, null, null, set ); +}; + +Sizzle.matchesSelector = function( node, expr ) { + return Sizzle( expr, null, null, [node] ).length > 0; +}; + +Sizzle.find = function( expr, context, isXML ) { + var set; + + if ( !expr ) { + return []; + } + + for ( var i = 0, l = Expr.order.length; i < l; i++ ) { + var match, + type = Expr.order[i]; + + if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { + var left = match[1]; + match.splice( 1, 1 ); + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace( rBackslash, "" ); + set = Expr.find[ type ]( match, context, isXML ); + + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = typeof context.getElementsByTagName !== "undefined" ? + context.getElementsByTagName( "*" ) : + []; + } + + return { set: set, expr: expr }; +}; + +Sizzle.filter = function( expr, set, inplace, not ) { + var match, anyFound, + old = expr, + result = [], + curLoop = set, + isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); + + while ( expr && set.length ) { + for ( var type in Expr.filter ) { + if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { + var found, item, + filter = Expr.filter[ type ], + left = match[1]; + + anyFound = false; + + match.splice(1,1); + + if ( left.substr( left.length - 1 ) === "\\" ) { + continue; + } + + if ( curLoop === result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( var i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + var pass = not ^ !!found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + + } else { + curLoop[i] = false; + } + + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + // Improper expression + if ( expr === old ) { + if ( anyFound == null ) { + Sizzle.error( expr ); + + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +Sizzle.error = function( msg ) { + throw "Syntax error, unrecognized expression: " + msg; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + + match: { + ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ + }, + + leftMatch: {}, + + attrMap: { + "class": "className", + "for": "htmlFor" + }, + + attrHandle: { + href: function( elem ) { + return elem.getAttribute( "href" ); + }, + type: function( elem ) { + return elem.getAttribute( "type" ); + } + }, + + relative: { + "+": function(checkSet, part){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !rNonWord.test( part ), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag ) { + part = part.toLowerCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + + ">": function( checkSet, part ) { + var elem, + isPartStr = typeof part === "string", + i = 0, + l = checkSet.length; + + if ( isPartStr && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; + } + } + + } else { + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + + "": function(checkSet, part, isXML){ + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); + }, + + "~": function( checkSet, part, isXML ) { + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); + } + }, + + find: { + ID: function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + }, + + NAME: function( match, context ) { + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], + results = context.getElementsByName( match[1] ); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + + TAG: function( match, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( match[1] ); + } + } + }, + preFilter: { + CLASS: function( match, curLoop, inplace, result, not, isXML ) { + match = " " + match[1].replace( rBackslash, "" ) + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) { + if ( !inplace ) { + result.push( elem ); + } + + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + + ID: function( match ) { + return match[1].replace( rBackslash, "" ); + }, + + TAG: function( match, curLoop ) { + return match[1].replace( rBackslash, "" ).toLowerCase(); + }, + + CHILD: function( match ) { + if ( match[1] === "nth" ) { + if ( !match[2] ) { + Sizzle.error( match[0] ); + } + + match[2] = match[2].replace(/^\+|\s*/g, ''); + + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec( + match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + else if ( match[2] ) { + Sizzle.error( match[0] ); + } + + // TODO: Move to normal caching system + match[0] = done++; + + return match; + }, + + ATTR: function( match, curLoop, inplace, result, not, isXML ) { + var name = match[1] = match[1].replace( rBackslash, "" ); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + // Handle if an un-quoted value was used + match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" ); + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + + PSEUDO: function( match, curLoop, inplace, result, not ) { + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + + if ( !inplace ) { + result.push.apply( result, ret ); + } + + return false; + } + + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + + POS: function( match ) { + match.unshift( true ); + + return match; + } + }, + + filters: { + enabled: function( elem ) { + return elem.disabled === false && elem.type !== "hidden"; + }, + + disabled: function( elem ) { + return elem.disabled === true; + }, + + checked: function( elem ) { + return elem.checked === true; + }, + + selected: function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + parent: function( elem ) { + return !!elem.firstChild; + }, + + empty: function( elem ) { + return !elem.firstChild; + }, + + has: function( elem, i, match ) { + return !!Sizzle( match[3], elem ).length; + }, + + header: function( elem ) { + return (/h\d/i).test( elem.nodeName ); + }, + + text: function( elem ) { + var attr = elem.getAttribute( "type" ), type = elem.type; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null ); + }, + + radio: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type; + }, + + checkbox: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type; + }, + + file: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "file" === elem.type; + }, + + password: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "password" === elem.type; + }, + + submit: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "submit" === elem.type; + }, + + image: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "image" === elem.type; + }, + + reset: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "reset" === elem.type; + }, + + button: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && "button" === elem.type || name === "button"; + }, + + input: function( elem ) { + return (/input|select|textarea|button/i).test( elem.nodeName ); + }, + + focus: function( elem ) { + return elem === elem.ownerDocument.activeElement; + } + }, + setFilters: { + first: function( elem, i ) { + return i === 0; + }, + + last: function( elem, i, match, array ) { + return i === array.length - 1; + }, + + even: function( elem, i ) { + return i % 2 === 0; + }, + + odd: function( elem, i ) { + return i % 2 === 1; + }, + + lt: function( elem, i, match ) { + return i < match[3] - 0; + }, + + gt: function( elem, i, match ) { + return i > match[3] - 0; + }, + + nth: function( elem, i, match ) { + return match[3] - 0 === i; + }, + + eq: function( elem, i, match ) { + return match[3] - 0 === i; + } + }, + filter: { + PSEUDO: function( elem, match, i, array ) { + var name = match[1], + filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || Sizzle.getText([ elem ]) || "").indexOf(match[3]) >= 0; + + } else if ( name === "not" ) { + var not = match[3]; + + for ( var j = 0, l = not.length; j < l; j++ ) { + if ( not[j] === elem ) { + return false; + } + } + + return true; + + } else { + Sizzle.error( name ); + } + }, + + CHILD: function( elem, match ) { + var type = match[1], + node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + + case "nth": + var first = match[2], + last = match[3]; + + if ( first === 1 && last === 0 ) { + return true; + } + + var doneName = match[0], + parent = elem.parentNode; + + if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) { + var count = 0; + + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + + parent.sizcache = doneName; + } + + var diff = elem.nodeIndex - last; + + if ( first === 0 ) { + return diff === 0; + + } else { + return ( diff % first === 0 && diff / first >= 0 ); + } + } + }, + + ID: function( elem, match ) { + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + + TAG: function( elem, match ) { + return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match; + }, + + CLASS: function( elem, match ) { + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + + ATTR: function( elem, match ) { + var name = match[1], + result = Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value !== check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + + POS: function( elem, match, i, array ) { + var name = match[2], + filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS, + fescape = function(all, num){ + return "\\" + (num - 0 + 1); + }; + +for ( var type in Expr.match ) { + Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); + Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); +} + +var makeArray = function( array, results ) { + array = Array.prototype.slice.call( array, 0 ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +// Also verifies that the returned array holds DOM nodes +// (which is not the case in the Blackberry browser) +try { + Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; + +// Provide a fallback method if it does not work +} catch( e ) { + makeArray = function( array, results ) { + var i = 0, + ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + + } else { + if ( typeof array.length === "number" ) { + for ( var l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + + } else { + for ( ; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +var sortOrder, siblingCheck; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { + return a.compareDocumentPosition ? -1 : 1; + } + + return a.compareDocumentPosition(b) & 4 ? -1 : 1; + }; + +} else { + sortOrder = function( a, b ) { + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // Fallback to using sourceIndex (in IE) if it's available on both nodes + } else if ( a.sourceIndex && b.sourceIndex ) { + return a.sourceIndex - b.sourceIndex; + } + + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // If the nodes are siblings (or identical) we can do a quick check + if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + + siblingCheck = function( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; + }; +} + +// Utility function for retreiving the text value of an array of DOM nodes +Sizzle.getText = function( elems ) { + var ret = "", elem; + + for ( var i = 0; elems[i]; i++ ) { + elem = elems[i]; + + // Get the text from text nodes and CDATA nodes + if ( elem.nodeType === 3 || elem.nodeType === 4 ) { + ret += elem.nodeValue; + + // Traverse everything else, except comment nodes + } else if ( elem.nodeType !== 8 ) { + ret += Sizzle.getText( elem.childNodes ); + } + } + + return ret; +}; + +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + var form = document.createElement("div"), + id = "script" + (new Date()).getTime(), + root = document.documentElement; + + form.innerHTML = "<a name='" + id + "'/>"; + + // Inject it into the root element, check its status, and remove it quickly + root.insertBefore( form, root.firstChild ); + + // The workaround has to do additional checks after a getElementById + // Which slows things down for other browsers (hence the branching) + if ( document.getElementById( id ) ) { + Expr.find.ID = function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + + return m ? + m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? + [m] : + undefined : + []; + } + }; + + Expr.filter.ID = function( elem, match ) { + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); + + // release memory in IE + root = form = null; +})(); + +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + // Make sure no comments are found + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function( match, context ) { + var results = context.getElementsByTagName( match[1] ); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + // Check to see if an attribute returns normalized href attributes + div.innerHTML = "<a href='#'></a>"; + + if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + div.firstChild.getAttribute("href") !== "#" ) { + + Expr.attrHandle.href = function( elem ) { + return elem.getAttribute( "href", 2 ); + }; + } + + // release memory in IE + div = null; +})(); + +if ( document.querySelectorAll ) { + (function(){ + var oldSizzle = Sizzle, + div = document.createElement("div"), + id = "__sizzle__"; + + div.innerHTML = "<p class='TEST'></p>"; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function( query, context, extra, seed ) { + context = context || document; + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && !Sizzle.isXML(context) ) { + // See if we find a selector to speed up + var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query ); + + if ( match && (context.nodeType === 1 || context.nodeType === 9) ) { + // Speed-up: Sizzle("TAG") + if ( match[1] ) { + return makeArray( context.getElementsByTagName( query ), extra ); + + // Speed-up: Sizzle(".CLASS") + } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) { + return makeArray( context.getElementsByClassName( match[2] ), extra ); + } + } + + if ( context.nodeType === 9 ) { + // Speed-up: Sizzle("body") + // The body element only exists once, optimize finding it + if ( query === "body" && context.body ) { + return makeArray( [ context.body ], extra ); + + // Speed-up: Sizzle("#ID") + } else if ( match && match[3] ) { + var elem = context.getElementById( match[3] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id === match[3] ) { + return makeArray( [ elem ], extra ); + } + + } else { + return makeArray( [], extra ); + } + } + + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(qsaError) {} + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + var oldContext = context, + old = context.getAttribute( "id" ), + nid = old || id, + hasParent = context.parentNode, + relativeHierarchySelector = /^\s*[+~]/.test( query ); + + if ( !old ) { + context.setAttribute( "id", nid ); + } else { + nid = nid.replace( /'/g, "\\$&" ); + } + if ( relativeHierarchySelector && hasParent ) { + context = context.parentNode; + } + + try { + if ( !relativeHierarchySelector || hasParent ) { + return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra ); + } + + } catch(pseudoError) { + } finally { + if ( !old ) { + oldContext.removeAttribute( "id" ); + } + } + } + } + + return oldSizzle(query, context, extra, seed); + }; + + for ( var prop in oldSizzle ) { + Sizzle[ prop ] = oldSizzle[ prop ]; + } + + // release memory in IE + div = null; + })(); +} + +(function(){ + var html = document.documentElement, + matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector; + + if ( matches ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9 fails this) + var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ), + pseudoWorks = false; + + try { + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( document.documentElement, "[test!='']:sizzle" ); + + } catch( pseudoError ) { + pseudoWorks = true; + } + + Sizzle.matchesSelector = function( node, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + + if ( !Sizzle.isXML( node ) ) { + try { + if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { + var ret = matches.call( node, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || !disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9, so check for that + node.document && node.document.nodeType !== 11 ) { + return ret; + } + } + } catch(e) {} + } + + return Sizzle(expr, null, null, [node]).length > 0; + }; + } +})(); + +(function(){ + var div = document.createElement("div"); + + div.innerHTML = "<div class='test e'></div><div class='test'></div>"; + + // Opera can't find a second classname (in 9.6) + // Also, make sure that getElementsByClassName actually exists + if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { + return; + } + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) { + return; + } + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function( match, context, isXML ) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; + + // release memory in IE + div = null; +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( elem.nodeName.toLowerCase() === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +if ( document.documentElement.contains ) { + Sizzle.contains = function( a, b ) { + return a !== b && (a.contains ? a.contains(b) : true); + }; + +} else if ( document.documentElement.compareDocumentPosition ) { + Sizzle.contains = function( a, b ) { + return !!(a.compareDocumentPosition(b) & 16); + }; + +} else { + Sizzle.contains = function() { + return false; + }; +} + +Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; + + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +var posProcess = function( selector, context ) { + var match, + tmpSet = [], + later = "", + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})(); + + +var runtil = /Until$/, + rparentsprev = /^(?:parents|prevUntil|prevAll)/, + // Note: This RegExp should be improved, or likely pulled from Sizzle + rmultiselector = /,/, + isSimple = /^.[^:#\[\.,]*$/, + slice = Array.prototype.slice, + POS = jQuery.expr.match.POS, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var self = this, + i, l; + + if ( typeof selector !== "string" ) { + return jQuery( selector ).filter(function() { + for ( i = 0, l = self.length; i < l; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }); + } + + var ret = this.pushStack( "", "find", selector ), + length, n, r; + + for ( i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( n = length; n < ret.length; n++ ) { + for ( r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var targets = jQuery( target ); + return this.filter(function() { + for ( var i = 0, l = targets.length; i < l; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && ( typeof selector === "string" ? + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var ret = [], i, l, cur = this[0]; + + // Array + if ( jQuery.isArray( selectors ) ) { + var match, selector, + matches = {}, + level = 1; + + if ( cur && selectors.length ) { + for ( i = 0, l = selectors.length; i < l; i++ ) { + selector = selectors[i]; + + if ( !matches[ selector ] ) { + matches[ selector ] = POS.test( selector ) ? + jQuery( selector, context || this.context ) : + selector; + } + } + + while ( cur && cur.ownerDocument && cur !== context ) { + for ( selector in matches ) { + match = matches[ selector ]; + + if ( match.jquery ? match.index( cur ) > -1 : jQuery( cur ).is( match ) ) { + ret.push({ selector: selector, elem: cur, level: level }); + } + } + + cur = cur.parentNode; + level++; + } + } + + return ret; + } + + // String + var pos = POS.test( selectors ) || typeof selectors !== "string" ? + jQuery( selectors, context || this.context ) : + 0; + + for ( i = 0, l = this.length; i < l; i++ ) { + cur = this[i]; + + while ( cur ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + + } else { + cur = cur.parentNode; + if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) { + break; + } + } + } + } + + ret = ret.length > 1 ? jQuery.unique( ret ) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; + } + + // index in selector + if ( typeof elem === "string" ) { + return jQuery.inArray( this[0], jQuery( elem ) ); + } + + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + andSelf: function() { + return this.add( this.prevObject ); + } +}); + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return jQuery.nth( elem, 2, "nextSibling" ); + }, + prev: function( elem ) { + return jQuery.nth( elem, 2, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( elem.parentNode.firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.makeArray( elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ), + // The variable 'args' was introduced in + // https://github.com/jquery/jquery/commit/52a0238 + // to work around a bug in Chrome 10 (Dev) and should be removed when the bug is fixed. + // http://code.google.com/p/v8/issues/detail?id=1050 + args = slice.call(arguments); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + + if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, args.join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + nth: function( cur, result, dir, elem ) { + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) { + if ( cur.nodeType === 1 && ++num === result ) { + break; + } + } + + return cur; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return (elem === qualifier) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return (jQuery.inArray( elem, qualifier ) >= 0) === keep; + }); +} + + + + +var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, + rtagName = /<([\w:]+)/, + rtbody = /<tbody/i, + rhtml = /<|&#?\w+;/, + rnocache = /<(?:script|object|embed|option|style)/i, + // checked="checked" or checked + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + rscriptType = /\/(java|ecma)script/i, + rcleanScript = /^\s*<!(?:\[CDATA\[|\-\-)/, + wrapMap = { + option: [ 1, "<select multiple='multiple'>", "</select>" ], + legend: [ 1, "<fieldset>", "</fieldset>" ], + thead: [ 1, "<table>", "</table>" ], + tr: [ 2, "<table><tbody>", "</tbody></table>" ], + td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ], + col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ], + area: [ 1, "<map>", "</map>" ], + _default: [ 0, "", "" ] + }; + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE can't serialize <link> and <script> tags normally +if ( !jQuery.support.htmlSerialize ) { + wrapMap._default = [ 1, "div<div>", "</div>" ]; +} + +jQuery.fn.extend({ + text: function( text ) { + if ( jQuery.isFunction(text) ) { + return this.each(function(i) { + var self = jQuery( this ); + + self.text( text.call(this, i, self.text()) ); + }); + } + + if ( typeof text !== "object" && text !== undefined ) { + return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) ); + } + + return jQuery.text( this ); + }, + + wrapAll: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapAll( html.call(this, i) ); + }); + } + + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); + + if ( this[0].parentNode ) { + wrap.insertBefore( this[0] ); + } + + wrap.map(function() { + var elem = this; + + while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { + elem = elem.firstChild; + } + + return elem; + }).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapInner( html.call(this, i) ); + }); + } + + return this.each(function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + }); + }, + + wrap: function( html ) { + return this.each(function() { + jQuery( this ).wrapAll( html ); + }); + }, + + unwrap: function() { + return this.parent().each(function() { + if ( !jQuery.nodeName( this, "body" ) ) { + jQuery( this ).replaceWith( this.childNodes ); + } + }).end(); + }, + + append: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.appendChild( elem ); + } + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.insertBefore( elem, this.firstChild ); + } + }); + }, + + before: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this ); + }); + } else if ( arguments.length ) { + var set = jQuery(arguments[0]); + set.push.apply( set, this.toArray() ); + return this.pushStack( set, "before", arguments ); + } + }, + + after: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + } else if ( arguments.length ) { + var set = this.pushStack( this, "after", arguments ); + set.push.apply( set, jQuery(arguments[0]).toArray() ); + return set; + } + }, + + // keepData is for internal use only--do not document + remove: function( selector, keepData ) { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { + if ( !keepData && elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + jQuery.cleanData( [ elem ] ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + } + } + + return this; + }, + + empty: function() { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + } + + // Remove any remaining nodes + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function () { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + }); + }, + + html: function( value ) { + if ( value === undefined ) { + return this[0] && this[0].nodeType === 1 ? + this[0].innerHTML.replace(rinlinejQuery, "") : + null; + + // See if we can take a shortcut and just use innerHTML + } else if ( typeof value === "string" && !rnocache.test( value ) && + (jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) && + !wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) { + + value = value.replace(rxhtmlTag, "<$1></$2>"); + + try { + for ( var i = 0, l = this.length; i < l; i++ ) { + // Remove element nodes and prevent memory leaks + if ( this[i].nodeType === 1 ) { + jQuery.cleanData( this[i].getElementsByTagName("*") ); + this[i].innerHTML = value; + } + } + + // If using innerHTML throws an exception, use the fallback method + } catch(e) { + this.empty().append( value ); + } + + } else if ( jQuery.isFunction( value ) ) { + this.each(function(i){ + var self = jQuery( this ); + + self.html( value.call(this, i, self.html()) ); + }); + + } else { + this.empty().append( value ); + } + + return this; + }, + + replaceWith: function( value ) { + if ( this[0] && this[0].parentNode ) { + // Make sure that the elements are removed from the DOM before they are inserted + // this can help fix replacing a parent with child elements + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this), old = self.html(); + self.replaceWith( value.call( this, i, old ) ); + }); + } + + if ( typeof value !== "string" ) { + value = jQuery( value ).detach(); + } + + return this.each(function() { + var next = this.nextSibling, + parent = this.parentNode; + + jQuery( this ).remove(); + + if ( next ) { + jQuery(next).before( value ); + } else { + jQuery(parent).append( value ); + } + }); + } else { + return this.length ? + this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) : + this; + } + }, + + detach: function( selector ) { + return this.remove( selector, true ); + }, + + domManip: function( args, table, callback ) { + var results, first, fragment, parent, + value = args[0], + scripts = []; + + // We can't cloneNode fragments that contain checked, in WebKit + if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) { + return this.each(function() { + jQuery(this).domManip( args, table, callback, true ); + }); + } + + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + args[0] = value.call(this, i, table ? self.html() : undefined); + self.domManip( args, table, callback ); + }); + } + + if ( this[0] ) { + parent = value && value.parentNode; + + // If we're in a fragment, just use that instead of building a new one + if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) { + results = { fragment: parent }; + + } else { + results = jQuery.buildFragment( args, this, scripts ); + } + + fragment = results.fragment; + + if ( fragment.childNodes.length === 1 ) { + first = fragment = fragment.firstChild; + } else { + first = fragment.firstChild; + } + + if ( first ) { + table = table && jQuery.nodeName( first, "tr" ); + + for ( var i = 0, l = this.length, lastIndex = l - 1; i < l; i++ ) { + callback.call( + table ? + root(this[i], first) : + this[i], + // Make sure that we do not leak memory by inadvertently discarding + // the original fragment (which might have attached data) instead of + // using it; in addition, use the original fragment object for the last + // item instead of first because it can end up being emptied incorrectly + // in certain situations (Bug #8070). + // Fragments from the fragment cache must always be cloned and never used + // in place. + results.cacheable || (l > 1 && i < lastIndex) ? + jQuery.clone( fragment, true, true ) : + fragment + ); + } + } + + if ( scripts.length ) { + jQuery.each( scripts, evalScript ); + } + } + + return this; + } +}); + +function root( elem, cur ) { + return jQuery.nodeName(elem, "table") ? + (elem.getElementsByTagName("tbody")[0] || + elem.appendChild(elem.ownerDocument.createElement("tbody"))) : + elem; +} + +function cloneCopyEvent( src, dest ) { + + if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) { + return; + } + + var internalKey = jQuery.expando, + oldData = jQuery.data( src ), + curData = jQuery.data( dest, oldData ); + + // Switch to use the internal data object, if it exists, for the next + // stage of data copying + if ( (oldData = oldData[ internalKey ]) ) { + var events = oldData.events; + curData = curData[ internalKey ] = jQuery.extend({}, oldData); + + if ( events ) { + delete curData.handle; + curData.events = {}; + + for ( var type in events ) { + for ( var i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type + ( events[ type ][ i ].namespace ? "." : "" ) + events[ type ][ i ].namespace, events[ type ][ i ], events[ type ][ i ].data ); + } + } + } + } +} + +function cloneFixAttributes( src, dest ) { + var nodeName; + + // We do not need to do anything for non-Elements + if ( dest.nodeType !== 1 ) { + return; + } + + // clearAttributes removes the attributes, which we don't want, + // but also removes the attachEvent events, which we *do* want + if ( dest.clearAttributes ) { + dest.clearAttributes(); + } + + // mergeAttributes, in contrast, only merges back on the + // original attributes, not the events + if ( dest.mergeAttributes ) { + dest.mergeAttributes( src ); + } + + nodeName = dest.nodeName.toLowerCase(); + + // IE6-8 fail to clone children inside object elements that use + // the proprietary classid attribute value (rather than the type + // attribute) to identify the type of content to display + if ( nodeName === "object" ) { + dest.outerHTML = src.outerHTML; + + } else if ( nodeName === "input" && (src.type === "checkbox" || src.type === "radio") ) { + // IE6-8 fails to persist the checked state of a cloned checkbox + // or radio button. Worse, IE6-7 fail to give the cloned element + // a checked appearance if the defaultChecked value isn't also set + if ( src.checked ) { + dest.defaultChecked = dest.checked = src.checked; + } + + // IE6-7 get confused and end up setting the value of a cloned + // checkbox/radio button to an empty string instead of "on" + if ( dest.value !== src.value ) { + dest.value = src.value; + } + + // IE6-8 fails to return the selected option to the default selected + // state when cloning options + } else if ( nodeName === "option" ) { + dest.selected = src.defaultSelected; + + // IE6-8 fails to set the defaultValue to the correct value when + // cloning other types of input fields + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } + + // Event data gets referenced instead of copied if the expando + // gets copied too + dest.removeAttribute( jQuery.expando ); +} + +jQuery.buildFragment = function( args, nodes, scripts ) { + var fragment, cacheable, cacheresults, doc; + + // nodes may contain either an explicit document object, + // a jQuery collection or context object. + // If nodes[0] contains a valid object to assign to doc + if ( nodes && nodes[0] ) { + doc = nodes[0].ownerDocument || nodes[0]; + } + + // Ensure that an attr object doesn't incorrectly stand in as a document object + // Chrome and Firefox seem to allow this to occur and will throw exception + // Fixes #8950 + if ( !doc.createDocumentFragment ) { + doc = document; + } + + // Only cache "small" (1/2 KB) HTML strings that are associated with the main document + // Cloning options loses the selected state, so don't cache them + // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment + // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache + if ( args.length === 1 && typeof args[0] === "string" && args[0].length < 512 && doc === document && + args[0].charAt(0) === "<" && !rnocache.test( args[0] ) && (jQuery.support.checkClone || !rchecked.test( args[0] )) ) { + + cacheable = true; + + cacheresults = jQuery.fragments[ args[0] ]; + if ( cacheresults && cacheresults !== 1 ) { + fragment = cacheresults; + } + } + + if ( !fragment ) { + fragment = doc.createDocumentFragment(); + jQuery.clean( args, doc, fragment, scripts ); + } + + if ( cacheable ) { + jQuery.fragments[ args[0] ] = cacheresults ? fragment : 1; + } + + return { fragment: fragment, cacheable: cacheable }; +}; + +jQuery.fragments = {}; + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var ret = [], + insert = jQuery( selector ), + parent = this.length === 1 && this[0].parentNode; + + if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) { + insert[ original ]( this[0] ); + return this; + + } else { + for ( var i = 0, l = insert.length; i < l; i++ ) { + var elems = (i > 0 ? this.clone(true) : this).get(); + jQuery( insert[i] )[ original ]( elems ); + ret = ret.concat( elems ); + } + + return this.pushStack( ret, name, insert.selector ); + } + }; +}); + +function getAll( elem ) { + if ( "getElementsByTagName" in elem ) { + return elem.getElementsByTagName( "*" ); + + } else if ( "querySelectorAll" in elem ) { + return elem.querySelectorAll( "*" ); + + } else { + return []; + } +} + +// Used in clean, fixes the defaultChecked property +function fixDefaultChecked( elem ) { + if ( elem.type === "checkbox" || elem.type === "radio" ) { + elem.defaultChecked = elem.checked; + } +} +// Finds all inputs and passes them to fixDefaultChecked +function findInputs( elem ) { + if ( jQuery.nodeName( elem, "input" ) ) { + fixDefaultChecked( elem ); + } else if ( "getElementsByTagName" in elem ) { + jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked ); + } +} + +jQuery.extend({ + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var clone = elem.cloneNode(true), + srcElements, + destElements, + i; + + if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) && + (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) { + // IE copies events bound via attachEvent when using cloneNode. + // Calling detachEvent on the clone will also remove the events + // from the original. In order to get around this, we use some + // proprietary methods to clear the events. Thanks to MooTools + // guys for this hotness. + + cloneFixAttributes( elem, clone ); + + // Using Sizzle here is crazy slow, so we use getElementsByTagName + // instead + srcElements = getAll( elem ); + destElements = getAll( clone ); + + // Weird iteration because IE will replace the length property + // with an element if you are cloning the body and one of the + // elements on the page has a name or id of "length" + for ( i = 0; srcElements[i]; ++i ) { + // Ensure that the destination node is not null; Fixes #9587 + if ( destElements[i] ) { + cloneFixAttributes( srcElements[i], destElements[i] ); + } + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + cloneCopyEvent( elem, clone ); + + if ( deepDataAndEvents ) { + srcElements = getAll( elem ); + destElements = getAll( clone ); + + for ( i = 0; srcElements[i]; ++i ) { + cloneCopyEvent( srcElements[i], destElements[i] ); + } + } + } + + srcElements = destElements = null; + + // Return the cloned set + return clone; + }, + + clean: function( elems, context, fragment, scripts ) { + var checkScriptType; + + context = context || document; + + // !context.createElement fails in IE with an error but returns typeof 'object' + if ( typeof context.createElement === "undefined" ) { + context = context.ownerDocument || context[0] && context[0].ownerDocument || document; + } + + var ret = [], j; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( typeof elem === "number" ) { + elem += ""; + } + + if ( !elem ) { + continue; + } + + // Convert html string into DOM nodes + if ( typeof elem === "string" ) { + if ( !rhtml.test( elem ) ) { + elem = context.createTextNode( elem ); + } else { + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(rxhtmlTag, "<$1></$2>"); + + // Trim whitespace, otherwise indexOf won't work as expected + var tag = (rtagName.exec( elem ) || ["", ""])[1].toLowerCase(), + wrap = wrapMap[ tag ] || wrapMap._default, + depth = wrap[0], + div = context.createElement("div"); + + // Go to html and back, then peel off extra wrappers + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( depth-- ) { + div = div.lastChild; + } + + // Remove IE's autoinserted <tbody> from table fragments + if ( !jQuery.support.tbody ) { + + // String was a <table>, *may* have spurious <tbody> + var hasBody = rtbody.test(elem), + tbody = tag === "table" && !hasBody ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare <thead> or <tfoot> + wrap[1] === "<table>" && !hasBody ? + div.childNodes : + []; + + for ( j = tbody.length - 1; j >= 0 ; --j ) { + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + } + } + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { + div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); + } + + elem = div.childNodes; + } + } + + // Resets defaultChecked for any radios and checkboxes + // about to be appended to the DOM in IE 6/7 (#8060) + var len; + if ( !jQuery.support.appendChecked ) { + if ( elem[0] && typeof (len = elem.length) === "number" ) { + for ( j = 0; j < len; j++ ) { + findInputs( elem[j] ); + } + } else { + findInputs( elem ); + } + } + + if ( elem.nodeType ) { + ret.push( elem ); + } else { + ret = jQuery.merge( ret, elem ); + } + } + + if ( fragment ) { + checkScriptType = function( elem ) { + return !elem.type || rscriptType.test( elem.type ); + }; + for ( i = 0; ret[i]; i++ ) { + if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) { + scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] ); + + } else { + if ( ret[i].nodeType === 1 ) { + var jsTags = jQuery.grep( ret[i].getElementsByTagName( "script" ), checkScriptType ); + + ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) ); + } + fragment.appendChild( ret[i] ); + } + } + } + + return ret; + }, + + cleanData: function( elems ) { + var data, id, cache = jQuery.cache, internalKey = jQuery.expando, special = jQuery.event.special, + deleteExpando = jQuery.support.deleteExpando; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) { + continue; + } + + id = elem[ jQuery.expando ]; + + if ( id ) { + data = cache[ id ] && cache[ id ][ internalKey ]; + + if ( data && data.events ) { + for ( var type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + + // Null the DOM reference to avoid IE6/7/8 leak (#7054) + if ( data.handle ) { + data.handle.elem = null; + } + } + + if ( deleteExpando ) { + delete elem[ jQuery.expando ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } + + delete cache[ id ]; + } + } + } +}); + +function evalScript( i, elem ) { + if ( elem.src ) { + jQuery.ajax({ + url: elem.src, + async: false, + dataType: "script" + }); + } else { + jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "/*$0*/" ) ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } +} + + + + +var ralpha = /alpha\([^)]*\)/i, + ropacity = /opacity=([^)]*)/, + // fixed for IE9, see #8346 + rupper = /([A-Z]|^ms)/g, + rnumpx = /^-?\d+(?:px)?$/i, + rnum = /^-?\d/, + rrelNum = /^([\-+])=([\-+.\de]+)/, + + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssWidth = [ "Left", "Right" ], + cssHeight = [ "Top", "Bottom" ], + curCSS, + + getComputedStyle, + currentStyle; + +jQuery.fn.css = function( name, value ) { + // Setting 'undefined' is a no-op + if ( arguments.length === 2 && value === undefined ) { + return this; + } + + return jQuery.access( this, name, value, true, function( elem, name, value ) { + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }); +}; + +jQuery.extend({ + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity", "opacity" ); + return ret === "" ? "1" : ret; + + } else { + return elem.style.opacity; + } + } + } + }, + + // Exclude the following css properties to add px + cssNumber: { + "fillOpacity": true, + "fontWeight": true, + "lineHeight": true, + "opacity": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: { + // normalize float css property + "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" + }, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, origName = jQuery.camelCase( name ), + style = elem.style, hooks = jQuery.cssHooks[ origName ]; + + name = jQuery.cssProps[ origName ] || origName; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // convert relative number strings (+= or -=) to relative numbers. #7345 + if ( type === "string" && (ret = rrelNum.exec( value )) ) { + value = ( +( ret[1] + 1) * +ret[2] ) + parseFloat( jQuery.css( elem, name ) ); + // Fixes bug #9237 + type = "number"; + } + + // Make sure that NaN and null values aren't set. See: #7116 + if ( value == null || type === "number" && isNaN( value ) ) { + return; + } + + // If a number was passed in, add 'px' to the (except for certain CSS properties) + if ( type === "number" && !jQuery.cssNumber[ origName ] ) { + value += "px"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) { + // Wrapped to prevent IE from throwing errors when 'invalid' values are provided + // Fixes bug #5509 + try { + style[ name ] = value; + } catch(e) {} + } + + } else { + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra ) { + var ret, hooks; + + // Make sure that we're working with the right name + name = jQuery.camelCase( name ); + hooks = jQuery.cssHooks[ name ]; + name = jQuery.cssProps[ name ] || name; + + // cssFloat needs a special treatment + if ( name === "cssFloat" ) { + name = "float"; + } + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) { + return ret; + + // Otherwise, if a way to get the computed value exists, use that + } else if ( curCSS ) { + return curCSS( elem, name ); + } + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var old = {}; + + // Remember the old values, and insert the new ones + for ( var name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + } +}); + +// DEPRECATED, Use jQuery.css() instead +jQuery.curCSS = jQuery.css; + +jQuery.each(["height", "width"], function( i, name ) { + jQuery.cssHooks[ name ] = { + get: function( elem, computed, extra ) { + var val; + + if ( computed ) { + if ( elem.offsetWidth !== 0 ) { + return getWH( elem, name, extra ); + } else { + jQuery.swap( elem, cssShow, function() { + val = getWH( elem, name, extra ); + }); + } + + return val; + } + }, + + set: function( elem, value ) { + if ( rnumpx.test( value ) ) { + // ignore negative width and height values #1599 + value = parseFloat( value ); + + if ( value >= 0 ) { + return value + "px"; + } + + } else { + return value; + } + } + }; +}); + +if ( !jQuery.support.opacity ) { + jQuery.cssHooks.opacity = { + get: function( elem, computed ) { + // IE uses filters for opacity + return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ? + ( parseFloat( RegExp.$1 ) / 100 ) + "" : + computed ? "1" : ""; + }, + + set: function( elem, value ) { + var style = elem.style, + currentStyle = elem.currentStyle, + opacity = jQuery.isNaN( value ) ? "" : "alpha(opacity=" + value * 100 + ")", + filter = currentStyle && currentStyle.filter || style.filter || ""; + + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + style.zoom = 1; + + // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652 + if ( value >= 1 && jQuery.trim( filter.replace( ralpha, "" ) ) === "" ) { + + // Setting style.filter to null, "" & " " still leave "filter:" in the cssText + // if "filter:" is present at all, clearType is disabled, we want to avoid this + // style.removeAttribute is IE Only, but so apparently is this code path... + style.removeAttribute( "filter" ); + + // if there there is no filter style applied in a css rule, we are done + if ( currentStyle && !currentStyle.filter ) { + return; + } + } + + // otherwise, set new filter values + style.filter = ralpha.test( filter ) ? + filter.replace( ralpha, opacity ) : + filter + " " + opacity; + } + }; +} + +jQuery(function() { + // This hook cannot be added until DOM ready because the support test + // for it is not run until after DOM ready + if ( !jQuery.support.reliableMarginRight ) { + jQuery.cssHooks.marginRight = { + get: function( elem, computed ) { + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + // Work around by temporarily setting element display to inline-block + var ret; + jQuery.swap( elem, { "display": "inline-block" }, function() { + if ( computed ) { + ret = curCSS( elem, "margin-right", "marginRight" ); + } else { + ret = elem.style.marginRight; + } + }); + return ret; + } + }; + } +}); + +if ( document.defaultView && document.defaultView.getComputedStyle ) { + getComputedStyle = function( elem, name ) { + var ret, defaultView, computedStyle; + + name = name.replace( rupper, "-$1" ).toLowerCase(); + + if ( !(defaultView = elem.ownerDocument.defaultView) ) { + return undefined; + } + + if ( (computedStyle = defaultView.getComputedStyle( elem, null )) ) { + ret = computedStyle.getPropertyValue( name ); + if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) { + ret = jQuery.style( elem, name ); + } + } + + return ret; + }; +} + +if ( document.documentElement.currentStyle ) { + currentStyle = function( elem, name ) { + var left, + ret = elem.currentStyle && elem.currentStyle[ name ], + rsLeft = elem.runtimeStyle && elem.runtimeStyle[ name ], + style = elem.style; + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + if ( !rnumpx.test( ret ) && rnum.test( ret ) ) { + // Remember the original values + left = style.left; + + // Put in the new values to get a computed value out + if ( rsLeft ) { + elem.runtimeStyle.left = elem.currentStyle.left; + } + style.left = name === "fontSize" ? "1em" : (ret || 0); + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + if ( rsLeft ) { + elem.runtimeStyle.left = rsLeft; + } + } + + return ret === "" ? "auto" : ret; + }; +} + +curCSS = getComputedStyle || currentStyle; + +function getWH( elem, name, extra ) { + + // Start with offset property + var val = name === "width" ? elem.offsetWidth : elem.offsetHeight, + which = name === "width" ? cssWidth : cssHeight; + + if ( val > 0 ) { + if ( extra !== "border" ) { + jQuery.each( which, function() { + if ( !extra ) { + val -= parseFloat( jQuery.css( elem, "padding" + this ) ) || 0; + } + if ( extra === "margin" ) { + val += parseFloat( jQuery.css( elem, extra + this ) ) || 0; + } else { + val -= parseFloat( jQuery.css( elem, "border" + this + "Width" ) ) || 0; + } + }); + } + + return val + "px"; + } + + // Fall back to computed then uncomputed css if necessary + val = curCSS( elem, name, name ); + if ( val < 0 || val == null ) { + val = elem.style[ name ] || 0; + } + // Normalize "", auto, and prepare for extra + val = parseFloat( val ) || 0; + + // Add padding, border, margin + if ( extra ) { + jQuery.each( which, function() { + val += parseFloat( jQuery.css( elem, "padding" + this ) ) || 0; + if ( extra !== "padding" ) { + val += parseFloat( jQuery.css( elem, "border" + this + "Width" ) ) || 0; + } + if ( extra === "margin" ) { + val += parseFloat( jQuery.css( elem, extra + this ) ) || 0; + } + }); + } + + return val + "px"; +} + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.hidden = function( elem ) { + var width = elem.offsetWidth, + height = elem.offsetHeight; + + return (width === 0 && height === 0) || (!jQuery.support.reliableHiddenOffsets && (elem.style.display || jQuery.css( elem, "display" )) === "none"); + }; + + jQuery.expr.filters.visible = function( elem ) { + return !jQuery.expr.filters.hidden( elem ); + }; +} + + + + +var r20 = /%20/g, + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rhash = /#.*$/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL + rinput = /^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + rquery = /\?/, + rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, + rselectTextarea = /^(?:select|textarea)/i, + rspacesAjax = /\s+/, + rts = /([?&])_=[^&]*/, + rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/, + + // Keep a copy of the old load method + _load = jQuery.fn.load, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Document location + ajaxLocation, + + // Document location segments + ajaxLocParts, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = ["*/"] + ["*"]; + +// #8138, IE may throw an exception when accessing +// a field from window.location if document.domain has been set +try { + ajaxLocation = location.href; +} catch( e ) { + // Use the href attribute of an A element + // since IE will modify it given document.location + ajaxLocation = document.createElement( "a" ); + ajaxLocation.href = ""; + ajaxLocation = ajaxLocation.href; +} + +// Segment location into parts +ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || []; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + if ( jQuery.isFunction( func ) ) { + var dataTypes = dataTypeExpression.toLowerCase().split( rspacesAjax ), + i = 0, + length = dataTypes.length, + dataType, + list, + placeBefore; + + // For each dataType in the dataTypeExpression + for(; i < length; i++ ) { + dataType = dataTypes[ i ]; + // We control if we're asked to add before + // any existing element + placeBefore = /^\+/.test( dataType ); + if ( placeBefore ) { + dataType = dataType.substr( 1 ) || "*"; + } + list = structure[ dataType ] = structure[ dataType ] || []; + // then we add to the structure accordingly + list[ placeBefore ? "unshift" : "push" ]( func ); + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR, + dataType /* internal */, inspected /* internal */ ) { + + dataType = dataType || options.dataTypes[ 0 ]; + inspected = inspected || {}; + + inspected[ dataType ] = true; + + var list = structure[ dataType ], + i = 0, + length = list ? list.length : 0, + executeOnly = ( structure === prefilters ), + selection; + + for(; i < length && ( executeOnly || !selection ); i++ ) { + selection = list[ i ]( options, originalOptions, jqXHR ); + // If we got redirected to another dataType + // we try there if executing only and not done already + if ( typeof selection === "string" ) { + if ( !executeOnly || inspected[ selection ] ) { + selection = undefined; + } else { + options.dataTypes.unshift( selection ); + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, selection, inspected ); + } + } + } + // If we're only executing or nothing was selected + // we try the catchall dataType if not done already + if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) { + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, "*", inspected ); + } + // unnecessary when only executing (prefilters) + // but it'll be ignored by the caller in that case + return selection; +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + for( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } +} + +jQuery.fn.extend({ + load: function( url, params, callback ) { + if ( typeof url !== "string" && _load ) { + return _load.apply( this, arguments ); + + // Don't do a request if no elements are being requested + } else if ( !this.length ) { + return this; + } + + var off = url.indexOf( " " ); + if ( off >= 0 ) { + var selector = url.slice( off, url.length ); + url = url.slice( 0, off ); + } + + // Default to a GET request + var type = "GET"; + + // If the second parameter was provided + if ( params ) { + // If it's a function + if ( jQuery.isFunction( params ) ) { + // We assume that it's the callback + callback = params; + params = undefined; + + // Otherwise, build a param string + } else if ( typeof params === "object" ) { + params = jQuery.param( params, jQuery.ajaxSettings.traditional ); + type = "POST"; + } + } + + var self = this; + + // Request the remote document + jQuery.ajax({ + url: url, + type: type, + dataType: "html", + data: params, + // Complete callback (responseText is used internally) + complete: function( jqXHR, status, responseText ) { + // Store the response as specified by the jqXHR object + responseText = jqXHR.responseText; + // If successful, inject the HTML into all the matched elements + if ( jqXHR.isResolved() ) { + // #4825: Get the actual response in case + // a dataFilter is present in ajaxSettings + jqXHR.done(function( r ) { + responseText = r; + }); + // See if a selector was specified + self.html( selector ? + // Create a dummy div to hold the results + jQuery("<div>") + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append(responseText.replace(rscript, "")) + + // Locate the specified elements + .find(selector) : + + // If not, just inject the full result + responseText ); + } + + if ( callback ) { + self.each( callback, [ responseText, status, jqXHR ] ); + } + } + }); + + return this; + }, + + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + + serializeArray: function() { + return this.map(function(){ + return this.elements ? jQuery.makeArray( this.elements ) : this; + }) + .filter(function(){ + return this.name && !this.disabled && + ( this.checked || rselectTextarea.test( this.nodeName ) || + rinput.test( this.type ) ); + }) + .map(function( i, elem ){ + var val = jQuery( this ).val(); + + return val == null ? + null : + jQuery.isArray( val ) ? + jQuery.map( val, function( val, i ){ + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }) : + { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }).get(); + } +}); + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){ + jQuery.fn[ o ] = function( f ){ + return this.bind( o, f ); + }; +}); + +jQuery.each( [ "get", "post" ], function( i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + // shift arguments if data argument was omitted + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + return jQuery.ajax({ + type: method, + url: url, + data: data, + success: callback, + dataType: type + }); + }; +}); + +jQuery.extend({ + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + if ( settings ) { + // Building a settings object + ajaxExtend( target, jQuery.ajaxSettings ); + } else { + // Extending ajaxSettings + settings = target; + target = jQuery.ajaxSettings; + } + ajaxExtend( target, settings ); + return target; + }, + + ajaxSettings: { + url: ajaxLocation, + isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ), + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded", + processData: true, + async: true, + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + traditional: false, + headers: {}, + */ + + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + text: "text/plain", + json: "application/json, text/javascript", + "*": allTypes + }, + + contents: { + xml: /xml/, + html: /html/, + json: /json/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText" + }, + + // List of data converters + // 1) key format is "source_type destination_type" (a single space in-between) + // 2) the catchall symbol "*" can be used for source_type + converters: { + + // Convert anything to text + "* text": window.String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": jQuery.parseJSON, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + context: true, + url: true + } + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + // Callbacks context + callbackContext = s.context || s, + // Context for global events + // It's the callbackContext if one was provided in the options + // and if it's a DOM node or a jQuery collection + globalEventContext = callbackContext !== s && + ( callbackContext.nodeType || callbackContext instanceof jQuery ) ? + jQuery( callbackContext ) : jQuery.event, + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery._Deferred(), + // Status-dependent callbacks + statusCode = s.statusCode || {}, + // ifModified key + ifModifiedKey, + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + // Response headers + responseHeadersString, + responseHeaders, + // transport + transport, + // timeout handle + timeoutTimer, + // Cross-domain detection vars + parts, + // The jqXHR state + state = 0, + // To know if global events are to be dispatched + fireGlobals, + // Loop variable + i, + // Fake xhr + jqXHR = { + + readyState: 0, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( !state ) { + var lname = name.toLowerCase(); + name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Raw string + getAllResponseHeaders: function() { + return state === 2 ? responseHeadersString : null; + }, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( state === 2 ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[1].toLowerCase() ] = match[ 2 ]; + } + } + match = responseHeaders[ key.toLowerCase() ]; + } + return match === undefined ? null : match; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( !state ) { + s.mimeType = type; + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + statusText = statusText || "abort"; + if ( transport ) { + transport.abort( statusText ); + } + done( 0, statusText ); + return this; + } + }; + + // Callback for when everything is done + // It is defined here because jslint complains if it is declared + // at the end of the function (which would be more logical and readable) + function done( status, nativeStatusText, responses, headers ) { + + // Called once + if ( state === 2 ) { + return; + } + + // State is "done" now + state = 2; + + // Clear timeout if it exists + if ( timeoutTimer ) { + clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + var isSuccess, + success, + error, + statusText = nativeStatusText, + response = responses ? ajaxHandleResponses( s, jqXHR, responses ) : undefined, + lastModified, + etag; + + // If successful, handle type chaining + if ( status >= 200 && status < 300 || status === 304 ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + + if ( ( lastModified = jqXHR.getResponseHeader( "Last-Modified" ) ) ) { + jQuery.lastModified[ ifModifiedKey ] = lastModified; + } + if ( ( etag = jqXHR.getResponseHeader( "Etag" ) ) ) { + jQuery.etag[ ifModifiedKey ] = etag; + } + } + + // If not modified + if ( status === 304 ) { + + statusText = "notmodified"; + isSuccess = true; + + // If we have data + } else { + + try { + success = ajaxConvert( s, response ); + statusText = "success"; + isSuccess = true; + } catch(e) { + // We have a parsererror + statusText = "parsererror"; + error = e; + } + } + } else { + // We extract error from statusText + // then normalize statusText and status for non-aborts + error = statusText; + if( !statusText || status ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = "" + ( nativeStatusText || statusText ); + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ), + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.resolveWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + // Attach deferreds + deferred.promise( jqXHR ); + jqXHR.success = jqXHR.done; + jqXHR.error = jqXHR.fail; + jqXHR.complete = completeDeferred.done; + + // Status-dependent callbacks + jqXHR.statusCode = function( map ) { + if ( map ) { + var tmp; + if ( state < 2 ) { + for( tmp in map ) { + statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ]; + } + } else { + tmp = map[ jqXHR.status ]; + jqXHR.then( tmp, tmp ); + } + } + return this; + }; + + // Remove hash character (#7531: and string promotion) + // Add protocol if not provided (#5866: IE7 issue with protocol-less urls) + // We also use the url parameter if available + s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" ); + + // Extract dataTypes list + s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( rspacesAjax ); + + // Determine if a cross-domain request is in order + if ( s.crossDomain == null ) { + parts = rurl.exec( s.url.toLowerCase() ); + s.crossDomain = !!( parts && + ( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] || + ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) != + ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) ) + ); + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefiler, stop there + if ( state === 2 ) { + return false; + } + + // We can fire global events as of now if asked to + fireGlobals = s.global; + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // If data is available, append data to url + if ( s.data ) { + s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data; + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Get ifModifiedKey before adding the anti-cache parameter + ifModifiedKey = s.url; + + // Add anti-cache in url if needed + if ( s.cache === false ) { + + var ts = jQuery.now(), + // try replacing _= if it is there + ret = s.url.replace( rts, "$1_=" + ts ); + + // if nothing was replaced, add timestamp to the end + s.url = ret + ( (ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + ifModifiedKey = ifModifiedKey || s.url; + if ( jQuery.lastModified[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] ); + } + if ( jQuery.etag[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] ); + } + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ? + s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) { + // Abort if not done already + jqXHR.abort(); + return false; + + } + + // Install callbacks on deferreds + for ( i in { success: 1, error: 1, complete: 1 } ) { + jqXHR[ i ]( s[ i ] ); + } + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = setTimeout( function(){ + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + state = 1; + transport.send( requestHeaders, done ); + } catch (e) { + // Propagate exception as error if not done + if ( state < 2 ) { + done( -1, e ); + // Simply rethrow otherwise + } else { + jQuery.error( e ); + } + } + } + + return jqXHR; + }, + + // Serialize an array of form elements or a set of + // key/values into a query string + param: function( a, traditional ) { + var s = [], + add = function( key, value ) { + // If value is a function, invoke it and return its value + value = jQuery.isFunction( value ) ? value() : value; + s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value ); + }; + + // Set traditional to true for jQuery <= 1.3.2 behavior. + if ( traditional === undefined ) { + traditional = jQuery.ajaxSettings.traditional; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + }); + + } else { + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( var prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ).replace( r20, "+" ); + } +}); + +function buildParams( prefix, obj, traditional, add ) { + if ( jQuery.isArray( obj ) ) { + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + // If array item is non-scalar (array or object), encode its + // numeric index to resolve deserialization ambiguity issues. + // Note that rack (as of 1.0.0) can't currently deserialize + // nested arrays properly, and attempting to do so may cause + // a server error. Possible fixes are to modify rack's + // deserialization algorithm or to provide an option or flag + // to force array serialization to be shallow. + buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v, traditional, add ); + } + }); + + } else if ( !traditional && obj != null && typeof obj === "object" ) { + // Serialize object item. + for ( var name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + // Serialize scalar item. + add( prefix, obj ); + } +} + +// This is still on the jQuery object... for now +// Want to move this to jQuery.ajax some day +jQuery.extend({ + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {} + +}); + +/* Handles responses to an ajax request: + * - sets all responseXXX fields accordingly + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var contents = s.contents, + dataTypes = s.dataTypes, + responseFields = s.responseFields, + ct, + type, + finalDataType, + firstDataType; + + // Fill responseXXX fields + for( type in responseFields ) { + if ( type in responses ) { + jqXHR[ responseFields[type] ] = responses[ type ]; + } + } + + // Remove auto dataType and get content-type in the process + while( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "content-type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +// Chain conversions given the request and the original response +function ajaxConvert( s, response ) { + + // Apply the dataFilter if provided + if ( s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + var dataTypes = s.dataTypes, + converters = {}, + i, + key, + length = dataTypes.length, + tmp, + // Current and previous dataTypes + current = dataTypes[ 0 ], + prev, + // Conversion expression + conversion, + // Conversion function + conv, + // Conversion functions (transitive conversion) + conv1, + conv2; + + // For each dataType in the chain + for( i = 1; i < length; i++ ) { + + // Create converters map + // with lowercased keys + if ( i === 1 ) { + for( key in s.converters ) { + if( typeof key === "string" ) { + converters[ key.toLowerCase() ] = s.converters[ key ]; + } + } + } + + // Get the dataTypes + prev = current; + current = dataTypes[ i ]; + + // If current is auto dataType, update it to prev + if( current === "*" ) { + current = prev; + // If no auto and dataTypes are actually different + } else if ( prev !== "*" && prev !== current ) { + + // Get the converter + conversion = prev + " " + current; + conv = converters[ conversion ] || converters[ "* " + current ]; + + // If there is no direct converter, search transitively + if ( !conv ) { + conv2 = undefined; + for( conv1 in converters ) { + tmp = conv1.split( " " ); + if ( tmp[ 0 ] === prev || tmp[ 0 ] === "*" ) { + conv2 = converters[ tmp[1] + " " + current ]; + if ( conv2 ) { + conv1 = converters[ conv1 ]; + if ( conv1 === true ) { + conv = conv2; + } else if ( conv2 === true ) { + conv = conv1; + } + break; + } + } + } + } + // If we found no converter, dispatch an error + if ( !( conv || conv2 ) ) { + jQuery.error( "No conversion from " + conversion.replace(" "," to ") ); + } + // If found converter is not an equivalence + if ( conv !== true ) { + // Convert with 1 or 2 converters accordingly + response = conv ? conv( response ) : conv2( conv1(response) ); + } + } + } + return response; +} + + + + +var jsc = jQuery.now(), + jsre = /(\=)\?(&|$)|\?\?/i; + +// Default jsonp settings +jQuery.ajaxSetup({ + jsonp: "callback", + jsonpCallback: function() { + return jQuery.expando + "_" + ( jsc++ ); + } +}); + +// Detect, normalize options and install callbacks for jsonp requests +jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { + + var inspectData = s.contentType === "application/x-www-form-urlencoded" && + ( typeof s.data === "string" ); + + if ( s.dataTypes[ 0 ] === "jsonp" || + s.jsonp !== false && ( jsre.test( s.url ) || + inspectData && jsre.test( s.data ) ) ) { + + var responseContainer, + jsonpCallback = s.jsonpCallback = + jQuery.isFunction( s.jsonpCallback ) ? s.jsonpCallback() : s.jsonpCallback, + previous = window[ jsonpCallback ], + url = s.url, + data = s.data, + replace = "$1" + jsonpCallback + "$2"; + + if ( s.jsonp !== false ) { + url = url.replace( jsre, replace ); + if ( s.url === url ) { + if ( inspectData ) { + data = data.replace( jsre, replace ); + } + if ( s.data === data ) { + // Add callback manually + url += (/\?/.test( url ) ? "&" : "?") + s.jsonp + "=" + jsonpCallback; + } + } + } + + s.url = url; + s.data = data; + + // Install callback + window[ jsonpCallback ] = function( response ) { + responseContainer = [ response ]; + }; + + // Clean-up function + jqXHR.always(function() { + // Set callback back to previous value + window[ jsonpCallback ] = previous; + // Call if it was a function and we have a response + if ( responseContainer && jQuery.isFunction( previous ) ) { + window[ jsonpCallback ]( responseContainer[ 0 ] ); + } + }); + + // Use data converter to retrieve json after script execution + s.converters["script json"] = function() { + if ( !responseContainer ) { + jQuery.error( jsonpCallback + " was not called" ); + } + return responseContainer[ 0 ]; + }; + + // force json dataType + s.dataTypes[ 0 ] = "json"; + + // Delegate to script + return "script"; + } +}); + + + + +// Install script dataType +jQuery.ajaxSetup({ + accepts: { + script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /javascript|ecmascript/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +}); + +// Handle cache's special case and global +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + s.global = false; + } +}); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function(s) { + + // This transport only deals with cross domain requests + if ( s.crossDomain ) { + + var script, + head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement; + + return { + + send: function( _, callback ) { + + script = document.createElement( "script" ); + + script.async = "async"; + + if ( s.scriptCharset ) { + script.charset = s.scriptCharset; + } + + script.src = s.url; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function( _, isAbort ) { + + if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) { + + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; + + // Remove the script + if ( head && script.parentNode ) { + head.removeChild( script ); + } + + // Dereference the script + script = undefined; + + // Callback if not abort + if ( !isAbort ) { + callback( 200, "success" ); + } + } + }; + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709 and #4378). + head.insertBefore( script, head.firstChild ); + }, + + abort: function() { + if ( script ) { + script.onload( 0, 1 ); + } + } + }; + } +}); + + + + +var // #5280: Internet Explorer will keep connections alive if we don't abort on unload + xhrOnUnloadAbort = window.ActiveXObject ? function() { + // Abort all pending requests + for ( var key in xhrCallbacks ) { + xhrCallbacks[ key ]( 0, 1 ); + } + } : false, + xhrId = 0, + xhrCallbacks; + +// Functions to create xhrs +function createStandardXHR() { + try { + return new window.XMLHttpRequest(); + } catch( e ) {} +} + +function createActiveXHR() { + try { + return new window.ActiveXObject( "Microsoft.XMLHTTP" ); + } catch( e ) {} +} + +// Create the request object +// (This is still attached to ajaxSettings for backward compatibility) +jQuery.ajaxSettings.xhr = window.ActiveXObject ? + /* Microsoft failed to properly + * implement the XMLHttpRequest in IE7 (can't request local files), + * so we use the ActiveXObject when it is available + * Additionally XMLHttpRequest can be disabled in IE7/IE8 so + * we need a fallback. + */ + function() { + return !this.isLocal && createStandardXHR() || createActiveXHR(); + } : + // For all other browsers, use the standard XMLHttpRequest object + createStandardXHR; + +// Determine support properties +(function( xhr ) { + jQuery.extend( jQuery.support, { + ajax: !!xhr, + cors: !!xhr && ( "withCredentials" in xhr ) + }); +})( jQuery.ajaxSettings.xhr() ); + +// Create transport if the browser can provide an xhr +if ( jQuery.support.ajax ) { + + jQuery.ajaxTransport(function( s ) { + // Cross domain only allowed if supported through XMLHttpRequest + if ( !s.crossDomain || jQuery.support.cors ) { + + var callback; + + return { + send: function( headers, complete ) { + + // Get a new xhr + var xhr = s.xhr(), + handle, + i; + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if ( s.username ) { + xhr.open( s.type, s.url, s.async, s.username, s.password ); + } else { + xhr.open( s.type, s.url, s.async ); + } + + // Apply custom fields if provided + if ( s.xhrFields ) { + for ( i in s.xhrFields ) { + xhr[ i ] = s.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( s.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( s.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !s.crossDomain && !headers["X-Requested-With"] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + } catch( _ ) {} + + // Do send the request + // This may raise an exception which is actually + // handled in jQuery.ajax (so no try/catch here) + xhr.send( ( s.hasContent && s.data ) || null ); + + // Listener + callback = function( _, isAbort ) { + + var status, + statusText, + responseHeaders, + responses, + xml; + + // Firefox throws exceptions when accessing properties + // of an xhr when a network error occured + // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE) + try { + + // Was never called and is aborted or complete + if ( callback && ( isAbort || xhr.readyState === 4 ) ) { + + // Only called once + callback = undefined; + + // Do not keep as active anymore + if ( handle ) { + xhr.onreadystatechange = jQuery.noop; + if ( xhrOnUnloadAbort ) { + delete xhrCallbacks[ handle ]; + } + } + + // If it's an abort + if ( isAbort ) { + // Abort it manually if needed + if ( xhr.readyState !== 4 ) { + xhr.abort(); + } + } else { + status = xhr.status; + responseHeaders = xhr.getAllResponseHeaders(); + responses = {}; + xml = xhr.responseXML; + + // Construct response list + if ( xml && xml.documentElement /* #4958 */ ) { + responses.xml = xml; + } + responses.text = xhr.responseText; + + // Firefox throws an exception when accessing + // statusText for faulty cross-domain requests + try { + statusText = xhr.statusText; + } catch( e ) { + // We normalize with Webkit giving an empty statusText + statusText = ""; + } + + // Filter status for non standard behaviors + + // If the request is local and we have data: assume a success + // (success with no data won't get notified, that's the best we + // can do given current implementations) + if ( !status && s.isLocal && !s.crossDomain ) { + status = responses.text ? 200 : 404; + // IE - #1450: sometimes returns 1223 when it should be 204 + } else if ( status === 1223 ) { + status = 204; + } + } + } + } catch( firefoxAccessException ) { + if ( !isAbort ) { + complete( -1, firefoxAccessException ); + } + } + + // Call complete if needed + if ( responses ) { + complete( status, statusText, responses, responseHeaders ); + } + }; + + // if we're in sync mode or it's in cache + // and has been retrieved directly (IE6 & IE7) + // we need to manually fire the callback + if ( !s.async || xhr.readyState === 4 ) { + callback(); + } else { + handle = ++xhrId; + if ( xhrOnUnloadAbort ) { + // Create the active xhrs callbacks list if needed + // and attach the unload handler + if ( !xhrCallbacks ) { + xhrCallbacks = {}; + jQuery( window ).unload( xhrOnUnloadAbort ); + } + // Add to list of active xhrs callbacks + xhrCallbacks[ handle ] = callback; + } + xhr.onreadystatechange = callback; + } + }, + + abort: function() { + if ( callback ) { + callback(0,1); + } + } + }; + } + }); +} + + + + +var elemdisplay = {}, + iframe, iframeDoc, + rfxtypes = /^(?:toggle|show|hide)$/, + rfxnum = /^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i, + timerId, + fxAttrs = [ + // height animations + [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ], + // width animations + [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ], + // opacity animations + [ "opacity" ] + ], + fxNow; + +jQuery.fn.extend({ + show: function( speed, easing, callback ) { + var elem, display; + + if ( speed || speed === 0 ) { + return this.animate( genFx("show", 3), speed, easing, callback); + + } else { + for ( var i = 0, j = this.length; i < j; i++ ) { + elem = this[i]; + + if ( elem.style ) { + display = elem.style.display; + + // Reset the inline display of this element to learn if it is + // being hidden by cascaded rules or not + if ( !jQuery._data(elem, "olddisplay") && display === "none" ) { + display = elem.style.display = ""; + } + + // Set elements which have been overridden with display: none + // in a stylesheet to whatever the default browser style is + // for such an element + if ( display === "" && jQuery.css( elem, "display" ) === "none" ) { + jQuery._data(elem, "olddisplay", defaultDisplay(elem.nodeName)); + } + } + } + + // Set the display of most of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + elem = this[i]; + + if ( elem.style ) { + display = elem.style.display; + + if ( display === "" || display === "none" ) { + elem.style.display = jQuery._data(elem, "olddisplay") || ""; + } + } + } + + return this; + } + }, + + hide: function( speed, easing, callback ) { + if ( speed || speed === 0 ) { + return this.animate( genFx("hide", 3), speed, easing, callback); + + } else { + for ( var i = 0, j = this.length; i < j; i++ ) { + if ( this[i].style ) { + var display = jQuery.css( this[i], "display" ); + + if ( display !== "none" && !jQuery._data( this[i], "olddisplay" ) ) { + jQuery._data( this[i], "olddisplay", display ); + } + } + } + + // Set the display of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + if ( this[i].style ) { + this[i].style.display = "none"; + } + } + + return this; + } + }, + + // Save the old toggle function + _toggle: jQuery.fn.toggle, + + toggle: function( fn, fn2, callback ) { + var bool = typeof fn === "boolean"; + + if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) { + this._toggle.apply( this, arguments ); + + } else if ( fn == null || bool ) { + this.each(function() { + var state = bool ? fn : jQuery(this).is(":hidden"); + jQuery(this)[ state ? "show" : "hide" ](); + }); + + } else { + this.animate(genFx("toggle", 3), fn, fn2, callback); + } + + return this; + }, + + fadeTo: function( speed, to, easing, callback ) { + return this.filter(":hidden").css("opacity", 0).show().end() + .animate({opacity: to}, speed, easing, callback); + }, + + animate: function( prop, speed, easing, callback ) { + var optall = jQuery.speed(speed, easing, callback); + + if ( jQuery.isEmptyObject( prop ) ) { + return this.each( optall.complete, [ false ] ); + } + + // Do not change referenced properties as per-property easing will be lost + prop = jQuery.extend( {}, prop ); + + return this[ optall.queue === false ? "each" : "queue" ](function() { + // XXX 'this' does not always have a nodeName when running the + // test suite + + if ( optall.queue === false ) { + jQuery._mark( this ); + } + + var opt = jQuery.extend( {}, optall ), + isElement = this.nodeType === 1, + hidden = isElement && jQuery(this).is(":hidden"), + name, val, p, + display, e, + parts, start, end, unit; + + // will store per property easing and be used to determine when an animation is complete + opt.animatedProperties = {}; + + for ( p in prop ) { + + // property name normalization + name = jQuery.camelCase( p ); + if ( p !== name ) { + prop[ name ] = prop[ p ]; + delete prop[ p ]; + } + + val = prop[ name ]; + + // easing resolution: per property > opt.specialEasing > opt.easing > 'swing' (default) + if ( jQuery.isArray( val ) ) { + opt.animatedProperties[ name ] = val[ 1 ]; + val = prop[ name ] = val[ 0 ]; + } else { + opt.animatedProperties[ name ] = opt.specialEasing && opt.specialEasing[ name ] || opt.easing || 'swing'; + } + + if ( val === "hide" && hidden || val === "show" && !hidden ) { + return opt.complete.call( this ); + } + + if ( isElement && ( name === "height" || name === "width" ) ) { + // Make sure that nothing sneaks out + // Record all 3 overflow attributes because IE does not + // change the overflow attribute when overflowX and + // overflowY are set to the same value + opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ]; + + // Set display property to inline-block for height/width + // animations on inline elements that are having width/height + // animated + if ( jQuery.css( this, "display" ) === "inline" && + jQuery.css( this, "float" ) === "none" ) { + if ( !jQuery.support.inlineBlockNeedsLayout ) { + this.style.display = "inline-block"; + + } else { + display = defaultDisplay( this.nodeName ); + + // inline-level elements accept inline-block; + // block-level elements need to be inline with layout + if ( display === "inline" ) { + this.style.display = "inline-block"; + + } else { + this.style.display = "inline"; + this.style.zoom = 1; + } + } + } + } + } + + if ( opt.overflow != null ) { + this.style.overflow = "hidden"; + } + + for ( p in prop ) { + e = new jQuery.fx( this, opt, p ); + val = prop[ p ]; + + if ( rfxtypes.test(val) ) { + e[ val === "toggle" ? hidden ? "show" : "hide" : val ](); + + } else { + parts = rfxnum.exec( val ); + start = e.cur(); + + if ( parts ) { + end = parseFloat( parts[2] ); + unit = parts[3] || ( jQuery.cssNumber[ p ] ? "" : "px" ); + + // We need to compute starting value + if ( unit !== "px" ) { + jQuery.style( this, p, (end || 1) + unit); + start = ((end || 1) / e.cur()) * start; + jQuery.style( this, p, start + unit); + } + + // If a +=/-= token was provided, we're doing a relative animation + if ( parts[1] ) { + end = ( (parts[ 1 ] === "-=" ? -1 : 1) * end ) + start; + } + + e.custom( start, end, unit ); + + } else { + e.custom( start, val, "" ); + } + } + } + + // For JS strict compliance + return true; + }); + }, + + stop: function( clearQueue, gotoEnd ) { + if ( clearQueue ) { + this.queue([]); + } + + this.each(function() { + var timers = jQuery.timers, + i = timers.length; + // clear marker counters if we know they won't be + if ( !gotoEnd ) { + jQuery._unmark( true, this ); + } + while ( i-- ) { + if ( timers[i].elem === this ) { + if (gotoEnd) { + // force the next step to be the last + timers[i](true); + } + + timers.splice(i, 1); + } + } + }); + + // start the next in the queue if the last step wasn't forced + if ( !gotoEnd ) { + this.dequeue(); + } + + return this; + } + +}); + +// Animations created synchronously will run synchronously +function createFxNow() { + setTimeout( clearFxNow, 0 ); + return ( fxNow = jQuery.now() ); +} + +function clearFxNow() { + fxNow = undefined; +} + +// Generate parameters to create a standard animation +function genFx( type, num ) { + var obj = {}; + + jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function() { + obj[ this ] = type; + }); + + return obj; +} + +// Generate shortcuts for custom animations +jQuery.each({ + slideDown: genFx("show", 1), + slideUp: genFx("hide", 1), + slideToggle: genFx("toggle", 1), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +}); + +jQuery.extend({ + speed: function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction(easing) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[opt.duration] : jQuery.fx.speeds._default; + + // Queueing + opt.old = opt.complete; + opt.complete = function( noUnmark ) { + if ( jQuery.isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue !== false ) { + jQuery.dequeue( this ); + } else if ( noUnmark !== false ) { + jQuery._unmark( this ); + } + }; + + return opt; + }, + + easing: { + linear: function( p, n, firstNum, diff ) { + return firstNum + diff * p; + }, + swing: function( p, n, firstNum, diff ) { + return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum; + } + }, + + timers: [], + + fx: function( elem, options, prop ) { + this.options = options; + this.elem = elem; + this.prop = prop; + + options.orig = options.orig || {}; + } + +}); + +jQuery.fx.prototype = { + // Simple function for setting a style value + update: function() { + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + (jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this ); + }, + + // Get the current size + cur: function() { + if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) ) { + return this.elem[ this.prop ]; + } + + var parsed, + r = jQuery.css( this.elem, this.prop ); + // Empty strings, null, undefined and "auto" are converted to 0, + // complex values such as "rotate(1rad)" are returned as is, + // simple values such as "10px" are parsed to Float. + return isNaN( parsed = parseFloat( r ) ) ? !r || r === "auto" ? 0 : r : parsed; + }, + + // Start an animation from one number to another + custom: function( from, to, unit ) { + var self = this, + fx = jQuery.fx; + + this.startTime = fxNow || createFxNow(); + this.start = from; + this.end = to; + this.unit = unit || this.unit || ( jQuery.cssNumber[ this.prop ] ? "" : "px" ); + this.now = this.start; + this.pos = this.state = 0; + + function t( gotoEnd ) { + return self.step(gotoEnd); + } + + t.elem = this.elem; + + if ( t() && jQuery.timers.push(t) && !timerId ) { + timerId = setInterval( fx.tick, fx.interval ); + } + }, + + // Simple 'show' function + show: function() { + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.style( this.elem, this.prop ); + this.options.show = true; + + // Begin the animation + // Make sure that we start at a small width/height to avoid any + // flash of content + this.custom(this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur()); + + // Start by showing the element + jQuery( this.elem ).show(); + }, + + // Simple 'hide' function + hide: function() { + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.style( this.elem, this.prop ); + this.options.hide = true; + + // Begin the animation + this.custom(this.cur(), 0); + }, + + // Each step of an animation + step: function( gotoEnd ) { + var t = fxNow || createFxNow(), + done = true, + elem = this.elem, + options = this.options, + i, n; + + if ( gotoEnd || t >= options.duration + this.startTime ) { + this.now = this.end; + this.pos = this.state = 1; + this.update(); + + options.animatedProperties[ this.prop ] = true; + + for ( i in options.animatedProperties ) { + if ( options.animatedProperties[i] !== true ) { + done = false; + } + } + + if ( done ) { + // Reset the overflow + if ( options.overflow != null && !jQuery.support.shrinkWrapBlocks ) { + + jQuery.each( [ "", "X", "Y" ], function (index, value) { + elem.style[ "overflow" + value ] = options.overflow[index]; + }); + } + + // Hide the element if the "hide" operation was done + if ( options.hide ) { + jQuery(elem).hide(); + } + + // Reset the properties, if the item has been hidden or shown + if ( options.hide || options.show ) { + for ( var p in options.animatedProperties ) { + jQuery.style( elem, p, options.orig[p] ); + } + } + + // Execute the complete function + options.complete.call( elem ); + } + + return false; + + } else { + // classical easing cannot be used with an Infinity duration + if ( options.duration == Infinity ) { + this.now = t; + } else { + n = t - this.startTime; + this.state = n / options.duration; + + // Perform the easing function, defaults to swing + this.pos = jQuery.easing[ options.animatedProperties[ this.prop ] ]( this.state, n, 0, 1, options.duration ); + this.now = this.start + ((this.end - this.start) * this.pos); + } + // Perform the next step of the animation + this.update(); + } + + return true; + } +}; + +jQuery.extend( jQuery.fx, { + tick: function() { + for ( var timers = jQuery.timers, i = 0 ; i < timers.length ; ++i ) { + if ( !timers[i]() ) { + timers.splice(i--, 1); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + }, + + interval: 13, + + stop: function() { + clearInterval( timerId ); + timerId = null; + }, + + speeds: { + slow: 600, + fast: 200, + // Default speed + _default: 400 + }, + + step: { + opacity: function( fx ) { + jQuery.style( fx.elem, "opacity", fx.now ); + }, + + _default: function( fx ) { + if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) { + fx.elem.style[ fx.prop ] = (fx.prop === "width" || fx.prop === "height" ? Math.max(0, fx.now) : fx.now) + fx.unit; + } else { + fx.elem[ fx.prop ] = fx.now; + } + } + } +}); + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.animated = function( elem ) { + return jQuery.grep(jQuery.timers, function( fn ) { + return elem === fn.elem; + }).length; + }; +} + +// Try to restore the default display value of an element +function defaultDisplay( nodeName ) { + + if ( !elemdisplay[ nodeName ] ) { + + var body = document.body, + elem = jQuery( "<" + nodeName + ">" ).appendTo( body ), + display = elem.css( "display" ); + + elem.remove(); + + // If the simple way fails, + // get element's real default display by attaching it to a temp iframe + if ( display === "none" || display === "" ) { + // No iframe to use yet, so create it + if ( !iframe ) { + iframe = document.createElement( "iframe" ); + iframe.frameBorder = iframe.width = iframe.height = 0; + } + + body.appendChild( iframe ); + + // Create a cacheable copy of the iframe document on first call. + // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML + // document to it; WebKit & Firefox won't allow reusing the iframe document. + if ( !iframeDoc || !iframe.createElement ) { + iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document; + iframeDoc.write( ( document.compatMode === "CSS1Compat" ? "<!doctype html>" : "" ) + "<html><body>" ); + iframeDoc.close(); + } + + elem = iframeDoc.createElement( nodeName ); + + iframeDoc.body.appendChild( elem ); + + display = jQuery.css( elem, "display" ); + + body.removeChild( iframe ); + } + + // Store the correct default display + elemdisplay[ nodeName ] = display; + } + + return elemdisplay[ nodeName ]; +} + + + + +var rtable = /^t(?:able|d|h)$/i, + rroot = /^(?:body|html)$/i; + +if ( "getBoundingClientRect" in document.documentElement ) { + jQuery.fn.offset = function( options ) { + var elem = this[0], box; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + try { + box = elem.getBoundingClientRect(); + } catch(e) {} + + var doc = elem.ownerDocument, + docElem = doc.documentElement; + + // Make sure we're not dealing with a disconnected DOM node + if ( !box || !jQuery.contains( docElem, elem ) ) { + return box ? { top: box.top, left: box.left } : { top: 0, left: 0 }; + } + + var body = doc.body, + win = getWindow(doc), + clientTop = docElem.clientTop || body.clientTop || 0, + clientLeft = docElem.clientLeft || body.clientLeft || 0, + scrollTop = win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop, + scrollLeft = win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft, + top = box.top + scrollTop - clientTop, + left = box.left + scrollLeft - clientLeft; + + return { top: top, left: left }; + }; + +} else { + jQuery.fn.offset = function( options ) { + var elem = this[0]; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + jQuery.offset.initialize(); + + var computedStyle, + offsetParent = elem.offsetParent, + prevOffsetParent = elem, + doc = elem.ownerDocument, + docElem = doc.documentElement, + body = doc.body, + defaultView = doc.defaultView, + prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle, + top = elem.offsetTop, + left = elem.offsetLeft; + + while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) { + if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) { + break; + } + + computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle; + top -= elem.scrollTop; + left -= elem.scrollLeft; + + if ( elem === offsetParent ) { + top += elem.offsetTop; + left += elem.offsetLeft; + + if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevOffsetParent = offsetParent; + offsetParent = elem.offsetParent; + } + + if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevComputedStyle = computedStyle; + } + + if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) { + top += body.offsetTop; + left += body.offsetLeft; + } + + if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) { + top += Math.max( docElem.scrollTop, body.scrollTop ); + left += Math.max( docElem.scrollLeft, body.scrollLeft ); + } + + return { top: top, left: left }; + }; +} + +jQuery.offset = { + initialize: function() { + var body = document.body, container = document.createElement("div"), innerDiv, checkDiv, table, td, bodyMarginTop = parseFloat( jQuery.css(body, "marginTop") ) || 0, + html = "<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>"; + + jQuery.extend( container.style, { position: "absolute", top: 0, left: 0, margin: 0, border: 0, width: "1px", height: "1px", visibility: "hidden" } ); + + container.innerHTML = html; + body.insertBefore( container, body.firstChild ); + innerDiv = container.firstChild; + checkDiv = innerDiv.firstChild; + td = innerDiv.nextSibling.firstChild.firstChild; + + this.doesNotAddBorder = (checkDiv.offsetTop !== 5); + this.doesAddBorderForTableAndCells = (td.offsetTop === 5); + + checkDiv.style.position = "fixed"; + checkDiv.style.top = "20px"; + + // safari subtracts parent border width here which is 5px + this.supportsFixedPosition = (checkDiv.offsetTop === 20 || checkDiv.offsetTop === 15); + checkDiv.style.position = checkDiv.style.top = ""; + + innerDiv.style.overflow = "hidden"; + innerDiv.style.position = "relative"; + + this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5); + + this.doesNotIncludeMarginInBodyOffset = (body.offsetTop !== bodyMarginTop); + + body.removeChild( container ); + jQuery.offset.initialize = jQuery.noop; + }, + + bodyOffset: function( body ) { + var top = body.offsetTop, + left = body.offsetLeft; + + jQuery.offset.initialize(); + + if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) { + top += parseFloat( jQuery.css(body, "marginTop") ) || 0; + left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; + } + + return { top: top, left: left }; + }, + + setOffset: function( elem, options, i ) { + var position = jQuery.css( elem, "position" ); + + // set position first, in-case top/left are set even on static elem + if ( position === "static" ) { + elem.style.position = "relative"; + } + + var curElem = jQuery( elem ), + curOffset = curElem.offset(), + curCSSTop = jQuery.css( elem, "top" ), + curCSSLeft = jQuery.css( elem, "left" ), + calculatePosition = (position === "absolute" || position === "fixed") && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1, + props = {}, curPosition = {}, curTop, curLeft; + + // need to be able to calculate position if either top or left is auto and position is either absolute or fixed + if ( calculatePosition ) { + curPosition = curElem.position(); + curTop = curPosition.top; + curLeft = curPosition.left; + } else { + curTop = parseFloat( curCSSTop ) || 0; + curLeft = parseFloat( curCSSLeft ) || 0; + } + + if ( jQuery.isFunction( options ) ) { + options = options.call( elem, i, curOffset ); + } + + if (options.top != null) { + props.top = (options.top - curOffset.top) + curTop; + } + if (options.left != null) { + props.left = (options.left - curOffset.left) + curLeft; + } + + if ( "using" in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + } +}; + + +jQuery.fn.extend({ + position: function() { + if ( !this[0] ) { + return null; + } + + var elem = this[0], + + // Get *real* offsetParent + offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; + offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; + + // Add offsetParent borders + parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; + parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; + + // Subtract the two offsets + return { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + }, + + offsetParent: function() { + return this.map(function() { + var offsetParent = this.offsetParent || document.body; + while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { + offsetParent = offsetParent.offsetParent; + } + return offsetParent; + }); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( ["Left", "Top"], function( i, name ) { + var method = "scroll" + name; + + jQuery.fn[ method ] = function( val ) { + var elem, win; + + if ( val === undefined ) { + elem = this[ 0 ]; + + if ( !elem ) { + return null; + } + + win = getWindow( elem ); + + // Return the scroll offset + return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] : + jQuery.support.boxModel && win.document.documentElement[ method ] || + win.document.body[ method ] : + elem[ method ]; + } + + // Set the scroll offset + return this.each(function() { + win = getWindow( this ); + + if ( win ) { + win.scrollTo( + !i ? val : jQuery( win ).scrollLeft(), + i ? val : jQuery( win ).scrollTop() + ); + + } else { + this[ method ] = val; + } + }); + }; +}); + +function getWindow( elem ) { + return jQuery.isWindow( elem ) ? + elem : + elem.nodeType === 9 ? + elem.defaultView || elem.parentWindow : + false; +} + + + + +// Create width, height, innerHeight, innerWidth, outerHeight and outerWidth methods +jQuery.each([ "Height", "Width" ], function( i, name ) { + + var type = name.toLowerCase(); + + // innerHeight and innerWidth + jQuery.fn[ "inner" + name ] = function() { + var elem = this[0]; + return elem && elem.style ? + parseFloat( jQuery.css( elem, type, "padding" ) ) : + null; + }; + + // outerHeight and outerWidth + jQuery.fn[ "outer" + name ] = function( margin ) { + var elem = this[0]; + return elem && elem.style ? + parseFloat( jQuery.css( elem, type, margin ? "margin" : "border" ) ) : + null; + }; + + jQuery.fn[ type ] = function( size ) { + // Get window width or height + var elem = this[0]; + if ( !elem ) { + return size == null ? null : this; + } + + if ( jQuery.isFunction( size ) ) { + return this.each(function( i ) { + var self = jQuery( this ); + self[ type ]( size.call( this, i, self[ type ]() ) ); + }); + } + + if ( jQuery.isWindow( elem ) ) { + // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode + // 3rd condition allows Nokia support, as it supports the docElem prop but not CSS1Compat + var docElemProp = elem.document.documentElement[ "client" + name ], + body = elem.document.body; + return elem.document.compatMode === "CSS1Compat" && docElemProp || + body && body[ "client" + name ] || docElemProp; + + // Get document width or height + } else if ( elem.nodeType === 9 ) { + // Either scroll[Width/Height] or offset[Width/Height], whichever is greater + return Math.max( + elem.documentElement["client" + name], + elem.body["scroll" + name], elem.documentElement["scroll" + name], + elem.body["offset" + name], elem.documentElement["offset" + name] + ); + + // Get or set width or height on the element + } else if ( size === undefined ) { + var orig = jQuery.css( elem, type ), + ret = parseFloat( orig ); + + return jQuery.isNaN( ret ) ? orig : ret; + + // Set the width or height on the element (default to pixels if value is unitless) + } else { + return this.css( type, typeof size === "string" ? size : size + "px" ); + } + }; + +}); + + +// Expose jQuery to the global object +window.jQuery = window.$ = jQuery; +})(window); diff --git a/www/protected/extensions/jqplot/jquery.min.js b/www/protected/extensions/jqplot/jquery.min.js new file mode 100644 index 0000000..628ed9b --- /dev/null +++ b/www/protected/extensions/jqplot/jquery.min.js @@ -0,0 +1,4 @@ +/*! jQuery v1.6.4 http://jquery.com/ | http://jquery.org/license */ +(function(a,b){function cu(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cr(a){if(!cg[a]){var b=c.body,d=f("<"+a+">").appendTo(b),e=d.css("display");d.remove();if(e==="none"||e===""){ch||(ch=c.createElement("iframe"),ch.frameBorder=ch.width=ch.height=0),b.appendChild(ch);if(!ci||!ch.createElement)ci=(ch.contentWindow||ch.contentDocument).document,ci.write((c.compatMode==="CSS1Compat"?"<!doctype html>":"")+"<html><body>"),ci.close();d=ci.createElement(a),ci.body.appendChild(d),e=f.css(d,"display"),b.removeChild(ch)}cg[a]=e}return cg[a]}function cq(a,b){var c={};f.each(cm.concat.apply([],cm.slice(0,b)),function(){c[this]=a});return c}function cp(){cn=b}function co(){setTimeout(cp,0);return cn=f.now()}function cf(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ce(){try{return new a.XMLHttpRequest}catch(b){}}function b$(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h=="string"&&(e[h.toLowerCase()]=a.converters[h]);l=k,k=d[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=e[m]||e["* "+k];if(!n){p=b;for(o in e){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=e[j[1]+" "+k];if(p){o=e[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&f.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function bZ(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function bY(a,b,c,d){if(f.isArray(b))f.each(b,function(b,e){c||bA.test(a)?d(a,e):bY(a+"["+(typeof e=="object"||f.isArray(e)?b:"")+"]",e,c,d)});else if(!c&&b!=null&&typeof b=="object")for(var e in b)bY(a+"["+e+"]",b[e],c,d);else d(a,b)}function bX(a,c){var d,e,g=f.ajaxSettings.flatOptions||{};for(d in c)c[d]!==b&&((g[d]?a:e||(e={}))[d]=c[d]);e&&f.extend(!0,a,e)}function bW(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bP,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l=="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=bW(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=bW(a,c,d,e,"*",g));return l}function bV(a){return function(b,c){typeof b!="string"&&(c=b,b="*");if(f.isFunction(c)){var d=b.toLowerCase().split(bL),e=0,g=d.length,h,i,j;for(;e<g;e++)h=d[e],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function by(a,b,c){var d=b==="width"?a.offsetWidth:a.offsetHeight,e=b==="width"?bt:bu;if(d>0){c!=="border"&&f.each(e,function(){c||(d-=parseFloat(f.css(a,"padding"+this))||0),c==="margin"?d+=parseFloat(f.css(a,c+this))||0:d-=parseFloat(f.css(a,"border"+this+"Width"))||0});return d+"px"}d=bv(a,b,b);if(d<0||d==null)d=a.style[b]||0;d=parseFloat(d)||0,c&&f.each(e,function(){d+=parseFloat(f.css(a,"padding"+this))||0,c!=="padding"&&(d+=parseFloat(f.css(a,"border"+this+"Width"))||0),c==="margin"&&(d+=parseFloat(f.css(a,c+this))||0)});return d+"px"}function bl(a,b){b.src?f.ajax({url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(bd,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)}function bk(a){f.nodeName(a,"input")?bj(a):"getElementsByTagName"in a&&f.grep(a.getElementsByTagName("input"),bj)}function bj(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bi(a){return"getElementsByTagName"in a?a.getElementsByTagName("*"):"querySelectorAll"in a?a.querySelectorAll("*"):[]}function bh(a,b){var c;if(b.nodeType===1){b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase();if(c==="object")b.outerHTML=a.outerHTML;else if(c!=="input"||a.type!=="checkbox"&&a.type!=="radio"){if(c==="option")b.selected=a.defaultSelected;else if(c==="input"||c==="textarea")b.defaultValue=a.defaultValue}else a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value);b.removeAttribute(f.expando)}}function bg(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c=f.expando,d=f.data(a),e=f.data(b,d);if(d=d[c]){var g=d.events;e=e[c]=f.extend({},d);if(g){delete e.handle,e.events={};for(var h in g)for(var i=0,j=g[h].length;i<j;i++)f.event.add(b,h+(g[h][i].namespace?".":"")+g[h][i].namespace,g[h][i],g[h][i].data)}}}}function bf(a,b){return f.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function V(a,b,c){b=b||0;if(f.isFunction(b))return f.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return f.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=f.grep(a,function(a){return a.nodeType===1});if(Q.test(b))return f.filter(b,d,!c);b=f.filter(b,d)}return f.grep(a,function(a,d){return f.inArray(a,b)>=0===c})}function U(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function M(a,b){return(a&&a!=="*"?a+".":"")+b.replace(y,"`").replace(z,"&")}function L(a){var b,c,d,e,g,h,i,j,k,l,m,n,o,p=[],q=[],r=f._data(this,"events");if(!(a.liveFired===this||!r||!r.live||a.target.disabled||a.button&&a.type==="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var s=r.live.slice(0);for(i=0;i<s.length;i++)g=s[i],g.origType.replace(w,"")===a.type?q.push(g.selector):s.splice(i--,1);e=f(a.target).closest(q,a.currentTarget);for(j=0,k=e.length;j<k;j++){m=e[j];for(i=0;i<s.length;i++){g=s[i];if(m.selector===g.selector&&(!n||n.test(g.namespace))&&!m.elem.disabled){h=m.elem,d=null;if(g.preType==="mouseenter"||g.preType==="mouseleave")a.type=g.preType,d=f(a.relatedTarget).closest(g.selector)[0],d&&f.contains(h,d)&&(d=h);(!d||d!==h)&&p.push({elem:h,handleObj:g,level:m.level})}}}for(j=0,k=p.length;j<k;j++){e=p[j];if(c&&e.level>c)break;a.currentTarget=e.elem,a.data=e.handleObj.data,a.handleObj=e.handleObj,o=e.handleObj.origHandler.apply(e.elem,arguments);if(o===!1||a.isPropagationStopped()){c=e.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function J(a,c,d){var e=f.extend({},d[0]);e.type=a,e.originalEvent={},e.liveFired=b,f.event.handle.call(c,e),e.isDefaultPrevented()&&d[0].preventDefault()}function D(){return!0}function C(){return!1}function m(a,c,d){var e=c+"defer",g=c+"queue",h=c+"mark",i=f.data(a,e,b,!0);i&&(d==="queue"||!f.data(a,g,b,!0))&&(d==="mark"||!f.data(a,h,b,!0))&&setTimeout(function(){!f.data(a,g,b,!0)&&!f.data(a,h,b,!0)&&(f.removeData(a,e,!0),i.resolve())},0)}function l(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function k(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(j,"-$1").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNaN(d)?i.test(d)?f.parseJSON(d):d:parseFloat(d)}catch(g){}f.data(a,c,d)}else d=b}return d}var c=a.document,d=a.navigator,e=a.location,f=function(){function K(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(K,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/\d/,n=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,o=/^[\],:{}\s]*$/,p=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,q=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,r=/(?:^|:|,)(?:\s*\[)+/g,s=/(webkit)[ \/]([\w.]+)/,t=/(opera)(?:.*version)?[ \/]([\w.]+)/,u=/(msie) ([\w.]+)/,v=/(mozilla)(?:.*? rv:([\w.]+))?/,w=/-([a-z]|[0-9])/ig,x=/^-ms-/,y=function(a,b){return(b+"").toUpperCase()},z=d.userAgent,A,B,C,D=Object.prototype.toString,E=Object.prototype.hasOwnProperty,F=Array.prototype.push,G=Array.prototype.slice,H=String.prototype.trim,I=Array.prototype.indexOf,J={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=n.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.6.4",length:0,size:function(){return this.length},toArray:function(){return G.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?F.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),B.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(G.apply(this,arguments),"slice",G.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:F,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){d=i[c],f=a[c];if(i===f)continue;l&&f&&(e.isPlainObject(f)||(g=e.isArray(f)))?(g?(g=!1,h=d&&e.isArray(d)?d:[]):h=d&&e.isPlainObject(d)?d:{},i[c]=e.extend(l,h,f)):f!==b&&(i[c]=f)}return i},e.extend({noConflict:function(b){a.$===e&&(a.$=g),b&&a.jQuery===e&&(a.jQuery=f);return e},isReady:!1,readyWait:1,holdReady:function(a){a?e.readyWait++:e.ready(!0)},ready:function(a){if(a===!0&&!--e.readyWait||a!==!0&&!e.isReady){if(!c.body)return setTimeout(e.ready,1);e.isReady=!0;if(a!==!0&&--e.readyWait>0)return;B.resolveWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!B){B=e._Deferred();if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",C,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",C),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&K()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNaN:function(a){return a==null||!m.test(a)||isNaN(a)},type:function(a){return a==null?String(a):J[D.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;try{if(a.constructor&&!E.call(a,"constructor")&&!E.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(c){return!1}var d;for(d in a);return d===b||E.call(a,d)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(o.test(b.replace(p,"@").replace(q,"]").replace(r,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(c){var d,f;try{a.DOMParser?(f=new DOMParser,d=f.parseFromString(c,"text/xml")):(d=new ActiveXObject("Microsoft.XMLDOM"),d.async="false",d.loadXML(c))}catch(g){d=b}(!d||!d.documentElement||d.getElementsByTagName("parsererror").length)&&e.error("Invalid XML: "+c);return d},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(x,"ms-").replace(w,y)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g<h;)if(c.apply(a[g++],d)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(;g<h;)if(c.call(a[g],g,a[g++])===!1)break;return a},trim:H?function(a){return a==null?"":H.call(a)}:function(a){return a==null?"":(a+"").replace(k,"").replace(l,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var d=e.type(a);a.length==null||d==="string"||d==="function"||d==="regexp"||e.isWindow(a)?F.call(c,a):e.merge(c,a)}return c},inArray:function(a,b){if(!b)return-1;if(I)return I.call(b,a);for(var c=0,d=b.length;c<d;c++)if(b[c]===a)return c;return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length=="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,c,d){var f,g,h=[],i=0,j=a.length,k=a instanceof e||j!==b&&typeof j=="number"&&(j>0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i<j;i++)f=c(a[i],i,d),f!=null&&(h[h.length]=f);else for(g in a)f=c(a[g],g,d),f!=null&&(h[h.length]=f);return h.concat.apply([],h)},guid:1,proxy:function(a,c){if(typeof c=="string"){var d=a[c];c=a,a=d}if(!e.isFunction(a))return b;var f=G.call(arguments,2),g=function(){return a.apply(c,f.concat(G.call(arguments)))};g.guid=a.guid=a.guid||g.guid||e.guid++;return g},access:function(a,c,d,f,g,h){var i=a.length;if(typeof c=="object"){for(var j in c)e.access(a,j,c[j],f,g,d);return a}if(d!==b){f=!h&&f&&e.isFunction(d);for(var k=0;k<i;k++)g(a[k],c,f?d.call(a[k],k,g(a[k],c)):d,h);return a}return i?g(a[0],c):b},now:function(){return(new Date).getTime()},uaMatch:function(a){a=a.toLowerCase();var b=s.exec(a)||t.exec(a)||u.exec(a)||a.indexOf("compatible")<0&&v.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}e.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function(d,f){f&&f instanceof e&&!(f instanceof a)&&(f=a(f));return e.fn.init.call(this,d,f,b)},a.fn.init.prototype=a.fn;var b=a(c);return a},browser:{}}),e.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){J["[object "+b+"]"]=b.toLowerCase()}),A=e.uaMatch(z),A.browser&&(e.browser[A.browser]=!0,e.browser.version=A.version),e.browser.webkit&&(e.browser.safari=!0),j.test(" ")&&(k=/^[\s\xA0]+/,l=/[\s\xA0]+$/),h=e(c),c.addEventListener?C=function(){c.removeEventListener("DOMContentLoaded",C,!1),e.ready()}:c.attachEvent&&(C=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",C),e.ready())});return e}(),g="done fail isResolved isRejected promise then always pipe".split(" "),h=[].slice;f.extend({_Deferred:function(){var a=[],b,c,d,e={done:function(){if(!d){var c=arguments,g,h,i,j,k;b&&(k=b,b=0);for(g=0,h=c.length;g<h;g++)i=c[g],j=f.type(i),j==="array"?e.done.apply(e,i):j==="function"&&a.push(i);k&&e.resolveWith(k[0],k[1])}return this},resolveWith:function(e,f){if(!d&&!b&&!c){f=f||[],c=1;try{while(a[0])a.shift().apply(e,f)}finally{b=[e,f],c=0}}return this},resolve:function(){e.resolveWith(this,arguments);return this},isResolved:function(){return!!c||!!b},cancel:function(){d=1,a=[];return this}};return e},Deferred:function(a){var b=f._Deferred(),c=f._Deferred(),d;f.extend(b,{then:function(a,c){b.done(a).fail(c);return this},always:function(){return b.done.apply(b,arguments).fail.apply(this,arguments)},fail:c.done,rejectWith:c.resolveWith,reject:c.resolve,isRejected:c.isResolved,pipe:function(a,c){return f.Deferred(function(d){f.each({done:[a,"resolve"],fail:[c,"reject"]},function(a,c){var e=c[0],g=c[1],h;f.isFunction(e)?b[a](function(){h=e.apply(this,arguments),h&&f.isFunction(h.promise)?h.promise().then(d.resolve,d.reject):d[g+"With"](this===b?d:this,[h])}):b[a](d[g])})}).promise()},promise:function(a){if(a==null){if(d)return d;d=a={}}var c=g.length;while(c--)a[g[c]]=b[g[c]];return a}}),b.done(c.cancel).fail(b.cancel),delete b.cancel,a&&a.call(b,b);return b},when:function(a){function i(a){return function(c){b[a]=arguments.length>1?h.call(arguments,0):c,--e||g.resolveWith(g,h.call(b,0))}}var b=arguments,c=0,d=b.length,e=d,g=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred();if(d>1){for(;c<d;c++)b[c]&&f.isFunction(b[c].promise)?b[c].promise().then(i(c),g.reject):--e;e||g.resolveWith(g,b)}else g!==a&&g.resolveWith(g,d?[a]:[]);return g.promise()}}),f.support=function(){var a=c.createElement("div"),b=c.documentElement,d,e,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u;a.setAttribute("className","t"),a.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>",d=a.getElementsByTagName("*"),e=a.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=a.getElementsByTagName("input")[0],k={leadingWhitespace:a.firstChild.nodeType===3,tbody:!a.getElementsByTagName("tbody").length,htmlSerialize:!!a.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55$/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,getSetAttribute:a.className!=="t",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},i.checked=!0,k.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,k.optDisabled=!h.disabled;try{delete a.test}catch(v){k.deleteExpando=!1}!a.addEventListener&&a.attachEvent&&a.fireEvent&&(a.attachEvent("onclick",function(){k.noCloneEvent=!1}),a.cloneNode(!0).fireEvent("onclick")),i=c.createElement("input"),i.value="t",i.setAttribute("type","radio"),k.radioValue=i.value==="t",i.setAttribute("checked","checked"),a.appendChild(i),l=c.createDocumentFragment(),l.appendChild(a.firstChild),k.checkClone=l.cloneNode(!0).cloneNode(!0).lastChild.checked,a.innerHTML="",a.style.width=a.style.paddingLeft="1px",m=c.getElementsByTagName("body")[0],o=c.createElement(m?"div":"body"),p={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"},m&&f.extend(p,{position:"absolute",left:"-1000px",top:"-1000px"});for(t in p)o.style[t]=p[t];o.appendChild(a),n=m||b,n.insertBefore(o,n.firstChild),k.appendChecked=i.checked,k.boxModel=a.offsetWidth===2,"zoom"in a.style&&(a.style.display="inline",a.style.zoom=1,k.inlineBlockNeedsLayout=a.offsetWidth===2,a.style.display="",a.innerHTML="<div style='width:4px;'></div>",k.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>",q=a.getElementsByTagName("td"),u=q[0].offsetHeight===0,q[0].style.display="",q[1].style.display="none",k.reliableHiddenOffsets=u&&q[0].offsetHeight===0,a.innerHTML="",c.defaultView&&c.defaultView.getComputedStyle&&(j=c.createElement("div"),j.style.width="0",j.style.marginRight="0",a.appendChild(j),k.reliableMarginRight=(parseInt((c.defaultView.getComputedStyle(j,null)||{marginRight:0}).marginRight,10)||0)===0),o.innerHTML="",n.removeChild(o);if(a.attachEvent)for(t in{submit:1,change:1,focusin:1})s="on"+t,u=s in a,u||(a.setAttribute(s,"return;"),u=typeof a[s]=="function"),k[t+"Bubbles"]=u;o=l=g=h=m=j=a=i=null;return k}(),f.boxModel=f.support.boxModel;var i=/^(?:\{.*\}|\[.*\])$/,j=/([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!l(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g,h,i=f.expando,j=typeof c=="string",k=a.nodeType,l=k?f.cache:a,m=k?a[f.expando]:a[f.expando]&&f.expando;if((!m||e&&m&&l[m]&&!l[m][i])&&j&&d===b)return;m||(k?a[f.expando]=m=++f.uuid:m=f.expando),l[m]||(l[m]={},k||(l[m].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?l[m][i]=f.extend(l[m][i],c):l[m]=f.extend(l[m],c);g=l[m],e&&(g[i]||(g[i]={}),g=g[i]),d!==b&&(g[f.camelCase(c)]=d);if(c==="events"&&!g[c])return g[i]&&g[i].events;j?(h=g[c],h==null&&(h=g[f.camelCase(c)])):h=g;return h}},removeData:function(a,b,c){if(!!f.acceptData(a)){var d,e=f.expando,g=a.nodeType,h=g?f.cache:a,i=g?a[f.expando]:f.expando;if(!h[i])return;if(b){d=c?h[i][e]:h[i];if(d){d[b]||(b=f.camelCase(b)),delete d[b];if(!l(d))return}}if(c){delete h[i][e];if(!l(h[i]))return}var j=h[i][e];f.support.deleteExpando||!h.setInterval?delete h[i]:h[i]=null,j?(h[i]={},g||(h[i].toJSON=f.noop),h[i][e]=j):g&&(f.support.deleteExpando?delete a[f.expando]:a.removeAttribute?a.removeAttribute(f.expando):a[f.expando]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d=null;if(typeof a=="undefined"){if(this.length){d=f.data(this[0]);if(this[0].nodeType===1){var e=this[0].attributes,g;for(var h=0,i=e.length;h<i;h++)g=e[h].name,g.indexOf("data-")===0&&(g=f.camelCase(g.substring(5)),k(this[0],g,d[g]))}}return d}if(typeof a=="object")return this.each(function(){f.data(this,a)});var j=a.split(".");j[1]=j[1]?"."+j[1]:"";if(c===b){d=this.triggerHandler("getData"+j[1]+"!",[j[0]]),d===b&&this.length&&(d=f.data(this[0],a),d=k(this[0],a,d));return d===b&&j[1]?this.data(j[0]):d}return this.each(function(){var b=f(this),d=[j[0],c];b.triggerHandler("setData"+j[1]+"!",d),f.data(this,a,c),b.triggerHandler("changeData"+j[1]+"!",d)})},removeData:function(a){return this.each(function(){f.removeData(this,a)})}}),f.extend({_mark:function(a,c){a&&(c=(c||"fx")+"mark",f.data(a,c,(f.data(a,c,b,!0)||0)+1,!0))},_unmark:function(a,c,d){a!==!0&&(d=c,c=a,a=!1);if(c){d=d||"fx";var e=d+"mark",g=a?0:(f.data(c,e,b,!0)||1)-1;g?f.data(c,e,g,!0):(f.removeData(c,e,!0),m(c,d,"mark"))}},queue:function(a,c,d){if(a){c=(c||"fx")+"queue";var e=f.data(a,c,b,!0);d&&(!e||f.isArray(d)?e=f.data(a,c,f.makeArray(d),!0):e.push(d));return e||[]}},dequeue:function(a,b){b=b||"fx";var c=f.queue(a,b),d=c.shift(),e;d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),d.call(a,function(){f.dequeue(a,b)})),c.length||(f.removeData(a,b+"queue",!0),m(a,b,"queue"))}}),f.fn.extend({queue:function(a,c){typeof a!="string"&&(c=a,a="fx");if(c===b)return f.queue(this[0],a);return this.each(function(){var b=f.queue(this,a,c);a==="fx"&&b[0]!=="inprogress"&&f.dequeue(this,a)})},dequeue:function(a){return this.each(function(){f.dequeue(this,a)})},delay:function(a,b){a=f.fx?f.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(){var c=this;setTimeout(function(){f.dequeue(c,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,c){function m(){--h||d.resolveWith(e,[e])}typeof a!="string"&&(c=a,a=b),a=a||"fx";var d=f.Deferred(),e=this,g=e.length,h=1,i=a+"defer",j=a+"queue",k=a+"mark",l;while(g--)if(l=f.data(e[g],i,b,!0)||(f.data(e[g],j,b,!0)||f.data(e[g],k,b,!0))&&f.data(e[g],i,f._Deferred(),!0))h++,l.done(m);m();return d.promise()}});var n=/[\n\t\r]/g,o=/\s+/,p=/\r/g,q=/^(?:button|input)$/i,r=/^(?:button|input|object|select|textarea)$/i,s=/^a(?:rea)?$/i,t=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,u,v;f.fn.extend({attr:function(a,b){return f.access(this,a,b,!0,f.attr)},removeAttr:function(a){return this.each(function(){f.removeAttr(this,a)})},prop:function(a,b){return f.access(this,a,b,!0,f.prop)},removeProp:function(a){a=f.propFix[a]||a;return this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){var b,c,d,e,g,h,i;if(f.isFunction(a))return this.each(function(b){f(this).addClass(a.call(this,b,this.className))});if(a&&typeof a=="string"){b=a.split(o);for(c=0,d=this.length;c<d;c++){e=this[c];if(e.nodeType===1)if(!e.className&&b.length===1)e.className=a;else{g=" "+e.className+" ";for(h=0,i=b.length;h<i;h++)~g.indexOf(" "+b[h]+" ")||(g+=b[h]+" ");e.className=f.trim(g)}}}return this},removeClass:function(a){var c,d,e,g,h,i,j;if(f.isFunction(a))return this.each(function(b){f(this).removeClass(a.call(this,b,this.className))});if(a&&typeof a=="string"||a===b){c=(a||"").split(o);for(d=0,e=this.length;d<e;d++){g=this[d];if(g.nodeType===1&&g.className)if(a){h=(" "+g.className+" ").replace(n," ");for(i=0,j=c.length;i<j;i++)h=h.replace(" "+c[i]+" "," ");g.className=f.trim(h)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";if(f.isFunction(a))return this.each(function(c){f(this).toggleClass(a.call(this,c,this.className,b),b)});return this.each(function(){if(c==="string"){var e,g=0,h=f(this),i=b,j=a.split(o);while(e=j[g++])i=d?i:!h.hasClass(e),h[i?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&f._data(this,"__className__",this.className),this.className=this.className||a===!1?"":f._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ";for(var c=0,d=this.length;c<d;c++)if(this[c].nodeType===1&&(" "+this[c].className+" ").replace(n," ").indexOf(b)>-1)return!0;return!1},val:function(a){var c,d,e=this[0];if(!arguments.length){if(e){c=f.valHooks[e.nodeName.toLowerCase()]||f.valHooks[e.type];if(c&&"get"in c&&(d=c.get(e,"value"))!==b)return d;d=e.value;return typeof d=="string"?d.replace(p,""):d==null?"":d}return b}var g=f.isFunction(a);return this.each(function(d){var e=f(this),h;if(this.nodeType===1){g?h=a.call(this,d,e.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c=a.selectedIndex,d=[],e=a.options,g=a.type==="select-one";if(c<0)return null;for(var h=g?c:0,i=g?c+1:e.length;h<i;h++){var j=e[h];if(j.selected&&(f.support.optDisabled?!j.disabled:j.getAttribute("disabled")===null)&&(!j.parentNode.disabled||!f.nodeName(j.parentNode,"optgroup"))){b=f(j).val();if(g)return b;d.push(b)}}if(g&&!d.length&&e.length)return f(e[c]).val();return d},set:function(a,b){var c=f.makeArray(b);f(a).find("option").each(function(){this.selected=f.inArray(f(this).val(),c)>=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attrFix:{tabindex:"tabIndex"},attr:function(a,c,d,e){var g=a.nodeType;if(!a||g===3||g===8||g===2)return b;if(e&&c in f.attrFn)return f(a)[c](d);if(!("getAttribute"in a))return f.prop(a,c,d);var h,i,j=g!==1||!f.isXMLDoc(a);j&&(c=f.attrFix[c]||c,i=f.attrHooks[c],i||(t.test(c)?i=v:u&&(i=u)));if(d!==b){if(d===null){f.removeAttr(a,c);return b}if(i&&"set"in i&&j&&(h=i.set(a,d,c))!==b)return h;a.setAttribute(c,""+d);return d}if(i&&"get"in i&&j&&(h=i.get(a,c))!==null)return h;h=a.getAttribute(c);return h===null?b:h},removeAttr:function(a,b){var c;a.nodeType===1&&(b=f.attrFix[b]||b,f.attr(a,b,""),a.removeAttribute(b),t.test(b)&&(c=f.propFix[b]||b)in a&&(a[c]=!1))},attrHooks:{type:{set:function(a,b){if(q.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},value:{get:function(a,b){if(u&&f.nodeName(a,"button"))return u.get(a,b);return b in a?a.value:null},set:function(a,b,c){if(u&&f.nodeName(a,"button"))return u.set(a,b,c);a.value=b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e=a.nodeType;if(!a||e===3||e===8||e===2)return b;var g,h,i=e!==1||!f.isXMLDoc(a);i&&(c=f.propFix[c]||c,h=f.propHooks[c]);return d!==b?h&&"set"in h&&(g=h.set(a,d,c))!==b?g:a[c]=d:h&&"get"in h&&(g=h.get(a,c))!==null?g:a[c]},propHooks:{tabIndex:{get:function(a){var c=a.getAttributeNode("tabindex");return c&&c.specified?parseInt(c.value,10):r.test(a.nodeName)||s.test(a.nodeName)&&a.href?0:b}}}}),f.attrHooks.tabIndex=f.propHooks.tabIndex,v={get:function(a,c){var d;return f.prop(a,c)===!0||(d=a.getAttributeNode(c))&&d.nodeValue!==!1?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=!0),a.setAttribute(c,c.toLowerCase()));return c}},f.support.getSetAttribute||(u=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&d.nodeValue!==""?d.nodeValue:b},set:function(a,b,d){var e=a.getAttributeNode(d);e||(e=c.createAttribute(d),a.setAttributeNode(e));return e.nodeValue=b+""}},f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})})),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex);return null}})),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var w=/\.(.*)$/,x=/^(?:textarea|input|select)$/i,y=/\./g,z=/ /g,A=/[^\w\s.|`]/g,B=function(a){return a.replace(A,"\\$&")};f.event={add:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){if(d===!1)d=C;else if(!d)return;var g,h;d.handler&&(g=d,d=g.handler),d.guid||(d.guid=f.guid++);var i=f._data(a);if(!i)return;var j=i.events,k=i.handle;j||(i.events=j={}),k||(i.handle=k=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.handle.apply(k.elem,arguments):b}),k.elem=a,c=c.split(" ");var l,m=0,n;while(l=c[m++]){h=g?f.extend({},g):{handler:d,data:e},l.indexOf(".")>-1?(n=l.split("."),l=n.shift(),h.namespace=n.slice(0).sort().join(".")):(n=[],h.namespace=""),h.type=l,h.guid||(h.guid=d.guid);var o=j[l],p=f.event.special[l]||{};if(!o){o=j[l]=[];if(!p.setup||p.setup.call(a,e,n,k)===!1)a.addEventListener?a.addEventListener(l,k,!1):a.attachEvent&&a.attachEvent("on"+l,k)}p.add&&(p.add.call(a,h),h.handler.guid||(h.handler.guid=d.guid)),o.push(h),f.event.global[l]=!0}a=null}},global:{},remove:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){d===!1&&(d=C);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=f.hasData(a)&&f._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(d=c.handler,c=c.type);if(!c||typeof c=="string"&&c.charAt(0)==="."){c=c||"";for(h in t)f.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+f.map(m.slice(0).sort(),B).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!d){for(j=0;j<p.length;j++){q=p[j];if(l||n.test(q.namespace))f.event.remove(a,r,q.handler,j),p.splice(j--,1)}continue}o=f.event.special[h]||{};for(j=e||0;j<p.length;j++){q=p[j];if(d.guid===q.guid){if(l||n.test(q.namespace))e==null&&p.splice(j--,1),o.remove&&o.remove.call(a,q);if(e!=null)break}}if(p.length===0||e!=null&&p.length===1)(!o.teardown||o.teardown.call(a,m)===!1)&&f.removeEvent(a,h,s.handle),g=null,delete +t[h]}if(f.isEmptyObject(t)){var u=s.handle;u&&(u.elem=null),delete s.events,delete s.handle,f.isEmptyObject(s)&&f.removeData(a,b,!0)}}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(c,d,e,g){var h=c.type||c,i=[],j;h.indexOf("!")>=0&&(h=h.slice(0,-1),j=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i.shift(),i.sort());if(!!e&&!f.event.customEvent[h]||!!f.event.global[h]){c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.exclusive=j,c.namespace=i.join("."),c.namespace_re=new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)");if(g||!e)c.preventDefault(),c.stopPropagation();if(!e){f.each(f.cache,function(){var a=f.expando,b=this[a];b&&b.events&&b.events[h]&&f.event.trigger(c,d,b.handle.elem)});return}if(e.nodeType===3||e.nodeType===8)return;c.result=b,c.target=e,d=d!=null?f.makeArray(d):[],d.unshift(c);var k=e,l=h.indexOf(":")<0?"on"+h:"";do{var m=f._data(k,"handle");c.currentTarget=k,m&&m.apply(k,d),l&&f.acceptData(k)&&k[l]&&k[l].apply(k,d)===!1&&(c.result=!1,c.preventDefault()),k=k.parentNode||k.ownerDocument||k===c.target.ownerDocument&&a}while(k&&!c.isPropagationStopped());if(!c.isDefaultPrevented()){var n,o=f.event.special[h]||{};if((!o._default||o._default.call(e.ownerDocument,c)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)){try{l&&e[h]&&(n=e[l],n&&(e[l]=null),f.event.triggered=h,e[h]())}catch(p){}n&&(e[l]=n),f.event.triggered=b}}return c.result}},handle:function(c){c=f.event.fix(c||a.event);var d=((f._data(this,"events")||{})[c.type]||[]).slice(0),e=!c.exclusive&&!c.namespace,g=Array.prototype.slice.call(arguments,0);g[0]=c,c.currentTarget=this;for(var h=0,i=d.length;h<i;h++){var j=d[h];if(e||c.namespace_re.test(j.namespace)){c.handler=j.handler,c.data=j.data,c.handleObj=j;var k=j.handler.apply(this,g);k!==b&&(c.result=k,k===!1&&(c.preventDefault(),c.stopPropagation()));if(c.isImmediatePropagationStopped())break}}return c.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(a){if(a[f.expando])return a;var d=a;a=f.Event(d);for(var e=this.props.length,g;e;)g=this.props[--e],a[g]=d[g];a.target||(a.target=a.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),!a.relatedTarget&&a.fromElement&&(a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement);if(a.pageX==null&&a.clientX!=null){var h=a.target.ownerDocument||c,i=h.documentElement,j=h.body;a.pageX=a.clientX+(i&&i.scrollLeft||j&&j.scrollLeft||0)-(i&&i.clientLeft||j&&j.clientLeft||0),a.pageY=a.clientY+(i&&i.scrollTop||j&&j.scrollTop||0)-(i&&i.clientTop||j&&j.clientTop||0)}a.which==null&&(a.charCode!=null||a.keyCode!=null)&&(a.which=a.charCode!=null?a.charCode:a.keyCode),!a.metaKey&&a.ctrlKey&&(a.metaKey=a.ctrlKey),!a.which&&a.button!==b&&(a.which=a.button&1?1:a.button&2?3:a.button&4?2:0);return a},guid:1e8,proxy:f.proxy,special:{ready:{setup:f.bindReady,teardown:f.noop},live:{add:function(a){f.event.add(this,M(a.origType,a.selector),f.extend({},a,{handler:L,guid:a.handler.guid}))},remove:function(a){f.event.remove(this,M(a.origType,a.selector),a)}},beforeunload:{setup:function(a,b,c){f.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}}},f.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},f.Event=function(a,b){if(!this.preventDefault)return new f.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?D:C):this.type=a,b&&f.extend(this,b),this.timeStamp=f.now(),this[f.expando]=!0},f.Event.prototype={preventDefault:function(){this.isDefaultPrevented=D;var a=this.originalEvent;!a||(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=D;var a=this.originalEvent;!a||(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=D,this.stopPropagation()},isDefaultPrevented:C,isPropagationStopped:C,isImmediatePropagationStopped:C};var E=function(a){var b=a.relatedTarget,c=!1,d=a.type;a.type=a.data,b!==this&&(b&&(c=f.contains(this,b)),c||(f.event.handle.apply(this,arguments),a.type=d))},F=function(a){a.type=a.data,f.event.handle.apply(this,arguments)};f.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){f.event.special[a]={setup:function(c){f.event.add(this,b,c&&c.selector?F:E,a)},teardown:function(a){f.event.remove(this,b,a&&a.selector?F:E)}}}),f.support.submitBubbles||(f.event.special.submit={setup:function(a,b){if(!f.nodeName(this,"form"))f.event.add(this,"click.specialSubmit",function(a){var b=a.target,c=f.nodeName(b,"input")||f.nodeName(b,"button")?b.type:"";(c==="submit"||c==="image")&&f(b).closest("form").length&&J("submit",this,arguments)}),f.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,c=f.nodeName(b,"input")||f.nodeName(b,"button")?b.type:"";(c==="text"||c==="password")&&f(b).closest("form").length&&a.keyCode===13&&J("submit",this,arguments)});else return!1},teardown:function(a){f.event.remove(this,".specialSubmit")}});if(!f.support.changeBubbles){var G,H=function(a){var b=f.nodeName(a,"input")?a.type:"",c=a.value;b==="radio"||b==="checkbox"?c=a.checked:b==="select-multiple"?c=a.selectedIndex>-1?f.map(a.options,function(a){return a.selected}).join("-"):"":f.nodeName(a,"select")&&(c=a.selectedIndex);return c},I=function(c){var d=c.target,e,g;if(!!x.test(d.nodeName)&&!d.readOnly){e=f._data(d,"_change_data"),g=H(d),(c.type!=="focusout"||d.type!=="radio")&&f._data(d,"_change_data",g);if(e===b||g===e)return;if(e!=null||g)c.type="change",c.liveFired=b,f.event.trigger(c,arguments[1],d)}};f.event.special.change={filters:{focusout:I,beforedeactivate:I,click:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(c==="radio"||c==="checkbox"||f.nodeName(b,"select"))&&I.call(this,a)},keydown:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(a.keyCode===13&&!f.nodeName(b,"textarea")||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&I.call(this,a)},beforeactivate:function(a){var b=a.target;f._data(b,"_change_data",H(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in G)f.event.add(this,c+".specialChange",G[c]);return x.test(this.nodeName)},teardown:function(a){f.event.remove(this,".specialChange");return x.test(this.nodeName)}},G=f.event.special.change.filters,G.focus=G.beforeactivate}f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){function e(a){var c=f.event.fix(a);c.type=b,c.originalEvent={},f.event.trigger(c,null,c.target),c.isDefaultPrevented()&&a.preventDefault()}var d=0;f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.each(["bind","one"],function(a,c){f.fn[c]=function(a,d,e){var g;if(typeof a=="object"){for(var h in a)this[c](h,d,a[h],e);return this}if(arguments.length===2||d===!1)e=d,d=b;c==="one"?(g=function(a){f(this).unbind(a,g);return e.apply(this,arguments)},g.guid=e.guid||f.guid++):g=e;if(a==="unload"&&c!=="one")this.one(a,d,e);else for(var i=0,j=this.length;i<j;i++)f.event.add(this[i],a,g,d);return this}}),f.fn.extend({unbind:function(a,b){if(typeof a=="object"&&!a.preventDefault)for(var c in a)this.unbind(c,a[c]);else for(var d=0,e=this.length;d<e;d++)f.event.remove(this[d],a,b);return this},delegate:function(a,b,c,d){return this.live(b,c,d,a)},undelegate:function(a,b,c){return arguments.length===0?this.unbind("live"):this.die(b,null,c,a)},trigger:function(a,b){return this.each(function(){f.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0])return f.event.trigger(a,b,this[0],!0)},toggle:function(a){var b=arguments,c=a.guid||f.guid++,d=0,e=function(c){var e=(f.data(this,"lastToggle"+a.guid)||0)%d;f.data(this,"lastToggle"+a.guid,e+1),c.preventDefault();return b[e].apply(this,arguments)||!1};e.guid=c;while(d<b.length)b[d++].guid=c;return this.click(e)},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var K={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};f.each(["live","die"],function(a,c){f.fn[c]=function(a,d,e,g){var h,i=0,j,k,l,m=g||this.selector,n=g?this:f(this.context);if(typeof a=="object"&&!a.preventDefault){for(var o in a)n[c](o,d,a[o],m);return this}if(c==="die"&&!a&&g&&g.charAt(0)==="."){n.unbind(g);return this}if(d===!1||f.isFunction(d))e=d||C,d=b;a=(a||"").split(" ");while((h=a[i++])!=null){j=w.exec(h),k="",j&&(k=j[0],h=h.replace(w,""));if(h==="hover"){a.push("mouseenter"+k,"mouseleave"+k);continue}l=h,K[h]?(a.push(K[h]+k),h=h+k):h=(K[h]||h)+k;if(c==="live")for(var p=0,q=n.length;p<q;p++)f.event.add(n[p],"live."+M(h,m),{data:d,selector:m,handler:e,origType:h,origHandler:e,preType:l});else n.unbind("live."+M(h,m),e)}return this}}),f.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),function(a,b){f.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.bind(b,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}if(i.nodeType===1){f||(i.sizcache=c,i.sizset=g);if(typeof b!="string"){if(i===b){j=!0;break}}else if(k.filter(b,[i]).length>0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}i.nodeType===1&&!f&&(i.sizcache=c,i.sizset=g);if(i.nodeName.toLowerCase()===b){j=i;break}i=i[a]}d[g]=j}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d=0,e=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,f,g){f=f||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return f;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(e.call(n)==="[object Array]")if(!u)f.push.apply(f,n);else if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&f.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&f.push(j[t]);else p(n,f);o&&(k(o,h,f,g),k.uniqueSort(f));return f};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},k.matches=function(a,b){return k(a,null,null,b)},k.matchesSelector=function(a,b){return k(b,null,null,[a]).length>0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e<f;e++){var g,h=l.order[e];if(g=l.leftMatch[h].exec(a)){var j=g[1];g.splice(1,1);if(j.substr(j.length-1)!=="\\"){g[1]=(g[1]||"").replace(i,""),d=l.find[h](g,b,c);if(d!=null){a=a.replace(l.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},k.filter=function(a,c,d,e){var f,g,h=a,i=[],j=c,m=c&&c[0]&&k.isXML(c[0]);while(a&&c.length){for(var n in l.filter)if((f=l.leftMatch[n].exec(a))!=null&&f[2]){var o,p,q=l.filter[n],r=f[1];g=!1,f.splice(1,1);if(r.substr(r.length-1)==="\\")continue;j===i&&(i=[]);if(l.preFilter[n]){f=l.preFilter[n](f,j,d,i,e,m);if(!f)g=o=!0;else if(f===!0)continue}if(f)for(var s=0;(p=j[s])!=null;s++)if(p){o=q(p,f,s,j);var t=e^!!o;d&&o!=null?t?g=!0:j[s]=!1:t&&(i.push(p),g=!0)}if(o!==b){d||(j=i),a=a.replace(l.match[n],"");if(!g)return[];break}}if(a===h)if(g==null)k.error(a);else break;h=a}return j},k.error=function(a){throw"Syntax error, unrecognized expression: "+a};var l=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b=="string",d=c&&!j.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1);a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&k.filter(b,a,!0)},">":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&k.filter(b,a,!0)}},"":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("parentNode",b,f,a,e,c)},"~":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("previousSibling",b,f,a,e,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(i,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=d++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}k.error(e)},CHILD:function(a,b){var c=b[1],d=a;switch(c){case"only":case"first":while(d=d.previousSibling)if(d.nodeType===1)return!1;if(c==="first")return!0;d=a;case"last":while(d=d.nextSibling)if(d.nodeType===1)return!1;return!0;case"nth":var e=b[2],f=b[3];if(e===1&&f===0)return!0;var g=b[0],h=a.parentNode;if(h&&(h.sizcache!==g||!a.nodeIndex)){var i=0;for(d=h.firstChild;d;d=d.nextSibling)d.nodeType===1&&(d.nodeIndex=++i);h.sizcache=g}var j=a.nodeIndex-f;return e===0?j===0:j%e===0&&j/e>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^\(]*\))/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(e.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var f=a.length;c<f;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var r,s;c.documentElement.compareDocumentPosition?r=function(a,b){if(a===b){g=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(r=function(a,b){if(a===b){g=!0;return 0}if(a.sourceIndex&&b.sourceIndex)return a.sourceIndex-b.sourceIndex;var c,d,e=[],f=[],h=a.parentNode,i=b.parentNode,j=h;if(h===i)return s(a,b);if(!h)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return s(e[k],f[k]);return k===c?s(a,f[k],-1):s(e[k],b,1)},s=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),k.getText=function(a){var b="",c;for(var d=0;a[d];d++)c=a[d],c.nodeType===3||c.nodeType===4?b+=c.nodeValue:c.nodeType!==8&&(b+=k.getText(c.childNodes));return b},function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(l.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},l.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(l.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(l.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=k,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(e||!l.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return k(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g<h;g++)k(a,f[g],d);return k.filter(e,d)};f.find=k,f.expr=k.selectors,f.expr[":"]=f.expr.filters,f.unique=k.uniqueSort,f.text=k.getText,f.isXMLDoc=k.isXML,f.contains=k.contains}();var N=/Until$/,O=/^(?:parents|prevUntil|prevAll)/,P=/,/,Q=/^.[^:#\[\.,]*$/,R=Array.prototype.slice,S=f.expr.match.POS,T={children:!0,contents:!0,next:!0,prev:!0};f.fn.extend({find:function(a){var b=this,c,d;if(typeof a!="string")return f(a).filter(function(){for(c=0,d=b.length;c<d;c++)if(f.contains(b[c],this))return!0});var e=this.pushStack("","find",a),g,h,i;for(c=0,d=this.length;c<d;c++){g=e.length,f.find(a,this[c],e);if(c>0)for(h=g;h<e.length;h++)for(i=0;i<g;i++)if(e[i]===e[h]){e.splice(h--,1);break}}return e},has:function(a){var b=f(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(f.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(V(this,a,!1),"not",a)},filter:function(a){return this.pushStack(V(this,a,!0),"filter",a)},is:function(a){return!!a&&(typeof a=="string"?f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(d=0,e=a.length;d<e;d++)i=a[d],j[i]||(j[i]=S.test(i)?f(i,b||this.context):i);while(g&&g.ownerDocument&&g!==b){for(i in j)h=j[i],(h.jquery?h.index(g)>-1:f(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=S.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d<e;d++){g=this[d];while(g){if(l?l.index(g)>-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a)return this[0]&&this[0].parentNode?this.prevAll().length:-1;if(typeof a=="string")return f.inArray(this[0],f(a));return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(U(c[0])||U(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c),g=R.call(arguments);N.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!T[a]?f.unique(e):e,(this.length>1||P.test(d))&&O.test(a)&&(e=e.reverse());return this.pushStack(e,a,g.join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var W=/ jQuery\d+="(?:\d+|null)"/g,X=/^\s+/,Y=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,Z=/<([\w:]+)/,$=/<tbody/i,_=/<|&#?\w+;/,ba=/<(?:script|object|embed|option|style)/i,bb=/checked\s*(?:[^=]|=\s*.checked.)/i,bc=/\/(java|ecma)script/i,bd=/^\s*<!(?:\[CDATA\[|\-\-)/,be={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};be.optgroup=be.option,be.tbody=be.tfoot=be.colgroup=be.caption=be.thead,be.th=be.td,f.support.htmlSerialize||(be._default=[1,"div<div>","</div>"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){f(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(W,""):null;if(typeof a=="string"&&!ba.test(a)&&(f.support.leadingWhitespace||!X.test(a))&&!be[(Z.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Y,"<$1></$2>");try{for(var c=0,d=this.length;c<d;c++)this[c].nodeType===1&&(f.cleanData(this[c].getElementsByTagName("*")),this[c].innerHTML=a)}catch(e){this.empty().append(a)}}else f.isFunction(a)?this.each(function(b){var c=f(this);c.html(a.call(this,b,c.html()))}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(f.isFunction(a))return this.each(function(b){var c=f(this),d=c.html();c.replaceWith(a.call(this,b,d))});typeof a!="string"&&(a=f(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;f(this).remove(),b?f(b).before(a):f(c).append(a)})}return this.length?this.pushStack(f(f.isFunction(a)?a():a),"replaceWith",a):this},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,d){var e,g,h,i,j=a[0],k=[];if(!f.support.checkClone&&arguments.length===3&&typeof j=="string"&&bb.test(j))return this.each(function(){f(this).domManip(a,c,d,!0)});if(f.isFunction(j))return this.each(function(e){var g=f(this);a[0]=j.call(this,e,c?g.html():b),g.domManip(a,c,d)});if(this[0]){i=j&&j.parentNode,f.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?e={fragment:i}:e=f.buildFragment(a,this,k),h=e.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&f.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)d.call(c?bf(this[l],g):this[l],e.cacheable||m>1&&l<n?f.clone(h,!0,!0):h)}k.length&&f.each(k,bl)}return this}}),f.buildFragment=function(a,b,d){var e,g,h,i;b&&b[0]&&(i=b[0].ownerDocument||b[0]),i.createDocumentFragment||(i=c),a.length===1&&typeof a[0]=="string"&&a[0].length<512&&i===c&&a[0].charAt(0)==="<"&&!ba.test(a[0])&&(f.support.checkClone||!bb.test(a[0]))&&(g=!0,h=f.fragments[a[0]],h&&h!==1&&(e=h)),e||(e=i.createDocumentFragment(),f.clean +(a,i,e,d)),g&&(f.fragments[a[0]]=h?e:1);return{fragment:e,cacheable:g}},f.fragments={},f.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){f.fn[a]=function(c){var d=[],e=f(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&e.length===1){e[b](this[0]);return this}for(var h=0,i=e.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d=a.cloneNode(!0),e,g,h;if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bh(a,d),e=bi(a),g=bi(d);for(h=0;e[h];++h)g[h]&&bh(e[h],g[h])}if(b){bg(a,d);if(c){e=bi(a),g=bi(d);for(h=0;e[h];++h)bg(e[h],g[h])}}e=g=null;return d},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!_.test(k))k=b.createTextNode(k);else{k=k.replace(Y,"<$1></$2>");var l=(Z.exec(k)||["",""])[1].toLowerCase(),m=be[l]||be._default,n=m[0],o=b.createElement("div");o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=$.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]==="<table>"&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&X.test(k)&&o.insertBefore(b.createTextNode(X.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i<r;i++)bk(k[i]);else bk(k);k.nodeType?h.push(k):h=f.merge(h,k)}if(d){g=function(a){return!a.type||bc.test(a.type)};for(j=0;h[j];j++)if(e&&f.nodeName(h[j],"script")&&(!h[j].type||h[j].type.toLowerCase()==="text/javascript"))e.push(h[j].parentNode?h[j].parentNode.removeChild(h[j]):h[j]);else{if(h[j].nodeType===1){var s=f.grep(h[j].getElementsByTagName("script"),g);h.splice.apply(h,[j+1,0].concat(s))}d.appendChild(h[j])}}return h},cleanData:function(a){var b,c,d=f.cache,e=f.expando,g=f.event.special,h=f.support.deleteExpando;for(var i=0,j;(j=a[i])!=null;i++){if(j.nodeName&&f.noData[j.nodeName.toLowerCase()])continue;c=j[f.expando];if(c){b=d[c]&&d[c][e];if(b&&b.events){for(var k in b.events)g[k]?f.event.remove(j,k):f.removeEvent(j,k,b.handle);b.handle&&(b.handle.elem=null)}h?delete j[f.expando]:j.removeAttribute&&j.removeAttribute(f.expando),delete d[c]}}}});var bm=/alpha\([^)]*\)/i,bn=/opacity=([^)]*)/,bo=/([A-Z]|^ms)/g,bp=/^-?\d+(?:px)?$/i,bq=/^-?\d/,br=/^([\-+])=([\-+.\de]+)/,bs={position:"absolute",visibility:"hidden",display:"block"},bt=["Left","Right"],bu=["Top","Bottom"],bv,bw,bx;f.fn.css=function(a,c){if(arguments.length===2&&c===b)return this;return f.access(this,a,c,!0,function(a,c,d){return d!==b?f.style(a,c,d):f.css(a,c)})},f.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bv(a,"opacity","opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":f.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!!a&&a.nodeType!==3&&a.nodeType!==8&&!!a.style){var g,h,i=f.camelCase(c),j=a.style,k=f.cssHooks[i];c=f.cssProps[i]||i;if(d===b){if(k&&"get"in k&&(g=k.get(a,!1,e))!==b)return g;return j[c]}h=typeof d,h==="string"&&(g=br.exec(d))&&(d=+(g[1]+1)*+g[2]+parseFloat(f.css(a,c)),h="number");if(d==null||h==="number"&&isNaN(d))return;h==="number"&&!f.cssNumber[i]&&(d+="px");if(!k||!("set"in k)||(d=k.set(a,d))!==b)try{j[c]=d}catch(l){}}},css:function(a,c,d){var e,g;c=f.camelCase(c),g=f.cssHooks[c],c=f.cssProps[c]||c,c==="cssFloat"&&(c="float");if(g&&"get"in g&&(e=g.get(a,!0,d))!==b)return e;if(bv)return bv(a,c)},swap:function(a,b,c){var d={};for(var e in b)d[e]=a.style[e],a.style[e]=b[e];c.call(a);for(e in b)a.style[e]=d[e]}}),f.curCSS=f.css,f.each(["height","width"],function(a,b){f.cssHooks[b]={get:function(a,c,d){var e;if(c){if(a.offsetWidth!==0)return by(a,b,d);f.swap(a,bs,function(){e=by(a,b,d)});return e}},set:function(a,b){if(!bp.test(b))return b;b=parseFloat(b);if(b>=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return bn.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle,e=f.isNaN(b)?"":"alpha(opacity="+b*100+")",g=d&&d.filter||c.filter||"";c.zoom=1;if(b>=1&&f.trim(g.replace(bm,""))===""){c.removeAttribute("filter");if(d&&!d.filter)return}c.filter=bm.test(g)?g.replace(bm,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bv(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(bw=function(a,c){var d,e,g;c=c.replace(bo,"-$1").toLowerCase();if(!(e=a.ownerDocument.defaultView))return b;if(g=e.getComputedStyle(a,null))d=g.getPropertyValue(c),d===""&&!f.contains(a.ownerDocument.documentElement,a)&&(d=f.style(a,c));return d}),c.documentElement.currentStyle&&(bx=function(a,b){var c,d=a.currentStyle&&a.currentStyle[b],e=a.runtimeStyle&&a.runtimeStyle[b],f=a.style;!bp.test(d)&&bq.test(d)&&(c=f.left,e&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":d||0,d=f.pixelLeft+"px",f.left=c,e&&(a.runtimeStyle.left=e));return d===""?"auto":d}),bv=bw||bx,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bz=/%20/g,bA=/\[\]$/,bB=/\r?\n/g,bC=/#.*$/,bD=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bE=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bF=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,bG=/^(?:GET|HEAD)$/,bH=/^\/\//,bI=/\?/,bJ=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bK=/^(?:select|textarea)/i,bL=/\s+/,bM=/([?&])_=[^&]*/,bN=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bO=f.fn.load,bP={},bQ={},bR,bS,bT=["*/"]+["*"];try{bR=e.href}catch(bU){bR=c.createElement("a"),bR.href="",bR=bR.href}bS=bN.exec(bR.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bO)return bO.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("<div>").append(c.replace(bJ,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bK.test(this.nodeName)||bE.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bB,"\r\n")}}):{name:b.name,value:c.replace(bB,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.bind(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?bX(a,f.ajaxSettings):(b=a,a=f.ajaxSettings),bX(a,b);return a},ajaxSettings:{url:bR,isLocal:bF.test(bS[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":bT},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML},flatOptions:{context:!0,url:!0}},ajaxPrefilter:bV(bP),ajaxTransport:bV(bQ),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a>0?4:0;var o,r,u,w=c,x=l?bZ(d,v,l):b,y,z;if(a>=200&&a<300||a===304){if(d.ifModified){if(y=v.getResponseHeader("Last-Modified"))f.lastModified[k]=y;if(z=v.getResponseHeader("Etag"))f.etag[k]=z}if(a===304)w="notmodified",o=!0;else try{r=b$(d,x),w="success",o=!0}catch(A){w="parsererror",u=A}}else{u=w;if(!w||a)w="error",a<0&&(a=0)}v.status=a,v.statusText=""+(c||w),o?h.resolveWith(e,[r,w,v]):h.rejectWith(e,[v,w,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.resolveWith(e,[v,w]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f._Deferred(),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bD.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.done,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bC,"").replace(bH,bS[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bL),d.crossDomain==null&&(r=bN.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bS[1]&&r[2]==bS[2]&&(r[3]||(r[1]==="http:"?80:443))==(bS[3]||(bS[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),bW(bP,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bG.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bI.test(d.url)?"&":"?")+d.data,delete d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bM,"$1_="+x);d.url=y+(y===d.url?(bI.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", "+bT+"; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=bW(bQ,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){s<2?w(-1,z):f.error(z)}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)bY(g,a[g],c,e);return d.join("&").replace(bz,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var b_=f.now(),ca=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+b_++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(ca.test(b.url)||e&&ca.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(ca,l),b.url===j&&(e&&(k=k.replace(ca,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var cb=a.ActiveXObject?function(){for(var a in cd)cd[a](0,1)}:!1,cc=0,cd;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ce()||cf()}:ce,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,cb&&delete cd[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cc,cb&&(cd||(cd={},f(a).unload(cb)),cd[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var cg={},ch,ci,cj=/^(?:toggle|show|hide)$/,ck=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,cl,cm=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cn;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cq("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)d=this[g],d.style&&(e=d.style.display,!f._data(d,"olddisplay")&&e==="none"&&(e=d.style.display=""),e===""&&f.css(d,"display")==="none"&&f._data(d,"olddisplay",cr(d.nodeName)));for(g=0;g<h;g++){d=this[g];if(d.style){e=d.style.display;if(e===""||e==="none")d.style.display=f._data(d,"olddisplay")||""}}return this},hide:function(a,b,c){if(a||a===0)return this.animate(cq("hide",3),a,b,c);for(var d=0,e=this.length;d<e;d++)if(this[d].style){var g=f.css(this[d],"display");g!=="none"&&!f._data(this[d],"olddisplay")&&f._data(this[d],"olddisplay",g)}for(d=0;d<e;d++)this[d].style&&(this[d].style.display="none");return this},_toggle:f.fn.toggle,toggle:function(a,b,c){var d=typeof a=="boolean";f.isFunction(a)&&f.isFunction(b)?this._toggle.apply(this,arguments):a==null||d?this.each(function(){var b=d?a:f(this).is(":hidden");f(this)[b?"show":"hide"]()}):this.animate(cq("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){var e=f.speed(b,c,d);if(f.isEmptyObject(a))return this.each(e.complete,[!1]);a=f.extend({},a);return this[e.queue===!1?"each":"queue"](function(){e.queue===!1&&f._mark(this);var b=f.extend({},e),c=this.nodeType===1,d=c&&f(this).is(":hidden"),g,h,i,j,k,l,m,n,o;b.animatedProperties={};for(i in a){g=f.camelCase(i),i!==g&&(a[g]=a[i],delete a[i]),h=a[g],f.isArray(h)?(b.animatedProperties[g]=h[1],h=a[g]=h[0]):b.animatedProperties[g]=b.specialEasing&&b.specialEasing[g]||b.easing||"swing";if(h==="hide"&&d||h==="show"&&!d)return b.complete.call(this);c&&(g==="height"||g==="width")&&(b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY],f.css(this,"display")==="inline"&&f.css(this,"float")==="none"&&(f.support.inlineBlockNeedsLayout?(j=cr(this.nodeName),j==="inline"?this.style.display="inline-block":(this.style.display="inline",this.style.zoom=1)):this.style.display="inline-block"))}b.overflow!=null&&(this.style.overflow="hidden");for(i in a)k=new f.fx(this,b,i),h=a[i],cj.test(h)?k[h==="toggle"?d?"show":"hide":h]():(l=ck.exec(h),m=k.cur(),l?(n=parseFloat(l[2]),o=l[3]||(f.cssNumber[i]?"":"px"),o!=="px"&&(f.style(this,i,(n||1)+o),m=(n||1)/k.cur()*m,f.style(this,i,m+o)),l[1]&&(n=(l[1]==="-="?-1:1)*n+m),k.custom(m,n,o)):k.custom(m,h,""));return!0})},stop:function(a,b){a&&this.queue([]),this.each(function(){var a=f.timers,c=a.length;b||f._unmark(!0,this);while(c--)a[c].elem===this&&(b&&a[c](!0),a.splice(c,1))}),b||this.dequeue();return this}}),f.each({slideDown:cq("show",1),slideUp:cq("hide",1),slideToggle:cq("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){f.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),f.extend({speed:function(a,b,c){var d=a&&typeof a=="object"?f.extend({},a):{complete:c||!c&&b||f.isFunction(a)&&a,duration:a,easing:c&&b||b&&!f.isFunction(b)&&b};d.duration=f.fx.off?0:typeof d.duration=="number"?d.duration:d.duration in f.fx.speeds?f.fx.speeds[d.duration]:f.fx.speeds._default,d.old=d.complete,d.complete=function(a){f.isFunction(d.old)&&d.old.call(this),d.queue!==!1?f.dequeue(this):a!==!1&&f._unmark(this)};return d},easing:{linear:function(a,b,c,d){return c+d*a},swing:function(a,b,c,d){return(-Math.cos(a*Math.PI)/2+.5)*d+c}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig=b.orig||{}}}),f.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(f.fx.step[this.prop]||f.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=f.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,b,c){function g(a){return d.step(a)}var d=this,e=f.fx;this.startTime=cn||co(),this.start=a,this.end=b,this.unit=c||this.unit||(f.cssNumber[this.prop]?"":"px"),this.now=this.start,this.pos=this.state=0,g.elem=this.elem,g()&&f.timers.push(g)&&!cl&&(cl=setInterval(e.tick,e.interval))},show:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.show=!0,this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),f(this.elem).show()},hide:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b=cn||co(),c=!0,d=this.elem,e=this.options,g,h;if(a||b>=e.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),e.animatedProperties[this.prop]=!0;for(g in e.animatedProperties)e.animatedProperties[g]!==!0&&(c=!1);if(c){e.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){d.style["overflow"+b]=e.overflow[a]}),e.hide&&f(d).hide();if(e.hide||e.show)for(var i in e.animatedProperties)f.style(d,i,e.orig[i]);e.complete.call(d)}return!1}e.duration==Infinity?this.now=b:(h=b-this.startTime,this.state=h/e.duration,this.pos=f.easing[e.animatedProperties[this.prop]](this.state,h,0,1,e.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){for(var a=f.timers,b=0;b<a.length;++b)a[b]()||a.splice(b--,1);a.length||f.fx.stop()},interval:13,stop:function(){clearInterval(cl),cl=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){f.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit:a.elem[a.prop]=a.now}}}),f.expr&&f.expr.filters&&(f.expr.filters.animated=function(a){return f.grep(f.timers,function(b){return a===b.elem}).length});var cs=/^t(?:able|d|h)$/i,ct=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?f.fn.offset=function(a){var b=this[0],c;if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);try{c=b.getBoundingClientRect()}catch(d){}var e=b.ownerDocument,g=e.documentElement;if(!c||!f.contains(g,b))return c?{top:c.top,left:c.left}:{top:0,left:0};var h=e.body,i=cu(e),j=g.clientTop||h.clientTop||0,k=g.clientLeft||h.clientLeft||0,l=i.pageYOffset||f.support.boxModel&&g.scrollTop||h.scrollTop,m=i.pageXOffset||f.support.boxModel&&g.scrollLeft||h.scrollLeft,n=c.top+l-j,o=c.left+m-k;return{top:n,left:o}}:f.fn.offset=function(a){var b=this[0];if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);f.offset.initialize();var c,d=b.offsetParent,e=b,g=b.ownerDocument,h=g.documentElement,i=g.body,j=g.defaultView,k=j?j.getComputedStyle(b,null):b.currentStyle,l=b.offsetTop,m=b.offsetLeft;while((b=b.parentNode)&&b!==i&&b!==h){if(f.offset.supportsFixedPosition&&k.position==="fixed")break;c=j?j.getComputedStyle(b,null):b.currentStyle,l-=b.scrollTop,m-=b.scrollLeft,b===d&&(l+=b.offsetTop,m+=b.offsetLeft,f.offset.doesNotAddBorder&&(!f.offset.doesAddBorderForTableAndCells||!cs.test(b.nodeName))&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),e=d,d=b.offsetParent),f.offset.subtractsBorderForOverflowNotVisible&&c.overflow!=="visible"&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),k=c}if(k.position==="relative"||k.position==="static")l+=i.offsetTop,m+=i.offsetLeft;f.offset.supportsFixedPosition&&k.position==="fixed"&&(l+=Math.max(h.scrollTop,i.scrollTop),m+=Math.max(h.scrollLeft,i.scrollLeft));return{top:l,left:m}},f.offset={initialize:function(){var a=c.body,b=c.createElement("div"),d,e,g,h,i=parseFloat(f.css(a,"marginTop"))||0,j="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";f.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"}),b.innerHTML=j,a.insertBefore(b,a.firstChild),d=b.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,this.doesNotAddBorder=e.offsetTop!==5,this.doesAddBorderForTableAndCells=h.offsetTop===5,e.style.position="fixed",e.style.top="20px",this.supportsFixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",this.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i,a.removeChild(b),f.offset.initialize=f.noop},bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.offset.initialize(),f.offset.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=ct.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!ct.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cu(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cu(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){var a=this[0];return a&&a.style?parseFloat(f.css(a,d,"padding")):null},f.fn["outer"+c]=function(a){var b=this[0];return b&&b.style?parseFloat(f.css(b,d,a?"margin":"border")):null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c],h=e.document.body;return e.document.compatMode==="CSS1Compat"&&g||h&&h["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var i=f.css(e,d),j=parseFloat(i);return f.isNaN(j)?i:j}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f})(window); \ No newline at end of file diff --git a/www/protected/extensions/jqplot/plugins/jqplot.barRenderer.js b/www/protected/extensions/jqplot/plugins/jqplot.barRenderer.js new file mode 100644 index 0000000..53f2ccc --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.barRenderer.js @@ -0,0 +1,747 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + */ +(function($) { + + // Class: $.jqplot.BarRenderer + // A plugin renderer for jqPlot to draw a bar plot. + // Draws series as a line. + + $.jqplot.BarRenderer = function(){ + $.jqplot.LineRenderer.call(this); + }; + + $.jqplot.BarRenderer.prototype = new $.jqplot.LineRenderer(); + $.jqplot.BarRenderer.prototype.constructor = $.jqplot.BarRenderer; + + // called with scope of series. + $.jqplot.BarRenderer.prototype.init = function(options, plot) { + // Group: Properties + // + // prop: barPadding + // Number of pixels between adjacent bars at the same axis value. + this.barPadding = 8; + // prop: barMargin + // Number of pixels between groups of bars at adjacent axis values. + this.barMargin = 10; + // prop: barDirection + // 'vertical' = up and down bars, 'horizontal' = side to side bars + this.barDirection = 'vertical'; + // prop: barWidth + // Width of the bar in pixels (auto by devaul). null = calculated automatically. + this.barWidth = null; + // prop: shadowOffset + // offset of the shadow from the slice and offset of + // each succesive stroke of the shadow from the last. + this.shadowOffset = 2; + // prop: shadowDepth + // number of strokes to apply to the shadow, + // each stroke offset shadowOffset from the last. + this.shadowDepth = 5; + // prop: shadowAlpha + // transparency of the shadow (0 = transparent, 1 = opaque) + this.shadowAlpha = 0.08; + // prop: waterfall + // true to enable waterfall plot. + this.waterfall = false; + // prop: groups + // group bars into this many groups + this.groups = 1; + // prop: varyBarColor + // true to color each bar of a series separately rather than + // have every bar of a given series the same color. + // If used for non-stacked multiple series bar plots, user should + // specify a separate 'seriesColors' array for each series. + // Otherwise, each series will set their bars to the same color array. + // This option has no Effect for stacked bar charts and is disabled. + this.varyBarColor = false; + // prop: highlightMouseOver + // True to highlight slice when moused over. + // This must be false to enable highlightMouseDown to highlight when clicking on a slice. + this.highlightMouseOver = true; + // prop: highlightMouseDown + // True to highlight when a mouse button is pressed over a slice. + // This will be disabled if highlightMouseOver is true. + this.highlightMouseDown = false; + // prop: highlightColors + // an array of colors to use when highlighting a bar. + this.highlightColors = []; + // prop: transposedData + // NOT IMPLEMENTED YET. True if this is a horizontal bar plot and + // x and y values are "transposed". Tranposed, or "swapped", data is + // required prior to rev. 894 builds of jqPlot with horizontal bars. + // Allows backward compatability of bar renderer horizontal bars with + // old style data sets. + this.transposedData = true; + this.renderer.animation = { + show: false, + direction: 'down', + speed: 3000, + _supported: true + }; + this._type = 'bar'; + + // if user has passed in highlightMouseDown option and not set highlightMouseOver, disable highlightMouseOver + if (options.highlightMouseDown && options.highlightMouseOver == null) { + options.highlightMouseOver = false; + } + + ////// + // This is probably wrong here. + // After going back and forth on wether renderer should be the thing + // or extend the thing, it seems that it it best if it is a property + // on the thing. This should be something that is commonized + // among series renderers in the future. + ////// + $.extend(true, this, options); + + // really should probably do this + $.extend(true, this.renderer, options); + // fill is still needed to properly draw the legend. + // bars have to be filled. + this.fill = true; + + // if horizontal bar and animating, reset the default direction + if (this.barDirection === 'horizontal' && this.rendererOptions.animation && this.rendererOptions.animation.direction == null) { + this.renderer.animation.direction = 'left'; + } + + if (this.waterfall) { + this.fillToZero = false; + this.disableStack = true; + } + + if (this.barDirection == 'vertical' ) { + this._primaryAxis = '_xaxis'; + this._stackAxis = 'y'; + this.fillAxis = 'y'; + } + else { + this._primaryAxis = '_yaxis'; + this._stackAxis = 'x'; + this.fillAxis = 'x'; + } + // index of the currenty highlighted point, if any + this._highlightedPoint = null; + // total number of values for all bar series, total number of bar series, and position of this series + this._plotSeriesInfo = null; + // Array of actual data colors used for each data point. + this._dataColors = []; + this._barPoints = []; + + // set the shape renderer options + var opts = {lineJoin:'miter', lineCap:'round', fill:true, isarc:false, strokeStyle:this.color, fillStyle:this.color, closePath:this.fill}; + this.renderer.shapeRenderer.init(opts); + // set the shadow renderer options + var sopts = {lineJoin:'miter', lineCap:'round', fill:true, isarc:false, angle:this.shadowAngle, offset:this.shadowOffset, alpha:this.shadowAlpha, depth:this.shadowDepth, closePath:this.fill}; + this.renderer.shadowRenderer.init(sopts); + + plot.postInitHooks.addOnce(postInit); + plot.postDrawHooks.addOnce(postPlotDraw); + plot.eventListenerHooks.addOnce('jqplotMouseMove', handleMove); + plot.eventListenerHooks.addOnce('jqplotMouseDown', handleMouseDown); + plot.eventListenerHooks.addOnce('jqplotMouseUp', handleMouseUp); + plot.eventListenerHooks.addOnce('jqplotClick', handleClick); + plot.eventListenerHooks.addOnce('jqplotRightClick', handleRightClick); + }; + + // called with scope of series + function barPreInit(target, data, seriesDefaults, options) { + if (this.rendererOptions.barDirection == 'horizontal') { + this._stackAxis = 'x'; + this._primaryAxis = '_yaxis'; + } + if (this.rendererOptions.waterfall == true) { + this._data = $.extend(true, [], this.data); + var sum = 0; + var pos = (!this.rendererOptions.barDirection || this.rendererOptions.barDirection === 'vertical' || this.transposedData === false) ? 1 : 0; + for(var i=0; i<this.data.length; i++) { + sum += this.data[i][pos]; + if (i>0) { + this.data[i][pos] += this.data[i-1][pos]; + } + } + this.data[this.data.length] = (pos == 1) ? [this.data.length+1, sum] : [sum, this.data.length+1]; + this._data[this._data.length] = (pos == 1) ? [this._data.length+1, sum] : [sum, this._data.length+1]; + } + if (this.rendererOptions.groups > 1) { + this.breakOnNull = true; + var l = this.data.length; + var skip = parseInt(l/this.rendererOptions.groups, 10); + var count = 0; + for (var i=skip; i<l; i+=skip) { + this.data.splice(i+count, 0, [null, null]); + count++; + } + for (i=0; i<this.data.length; i++) { + if (this._primaryAxis == '_xaxis') { + this.data[i][0] = i+1; + } + else { + this.data[i][1] = i+1; + } + } + } + } + + $.jqplot.preSeriesInitHooks.push(barPreInit); + + // needs to be called with scope of series, not renderer. + $.jqplot.BarRenderer.prototype.calcSeriesNumbers = function() { + var nvals = 0; + var nseries = 0; + var paxis = this[this._primaryAxis]; + var s, series, pos; + // loop through all series on this axis + for (var i=0; i < paxis._series.length; i++) { + series = paxis._series[i]; + if (series === this) { + pos = i; + } + // is the series rendered as a bar? + if (series.renderer.constructor == $.jqplot.BarRenderer) { + // gridData may not be computed yet, use data length insted + nvals += series.data.length; + nseries += 1; + } + } + // return total number of values for all bar series, total number of bar series, and position of this series + return [nvals, nseries, pos]; + }; + + $.jqplot.BarRenderer.prototype.setBarWidth = function() { + // need to know how many data values we have on the approprate axis and figure it out. + var i; + var nvals = 0; + var nseries = 0; + var paxis = this[this._primaryAxis]; + var s, series, pos; + var temp = this._plotSeriesInfo = this.renderer.calcSeriesNumbers.call(this); + nvals = temp[0]; + nseries = temp[1]; + var nticks = paxis.numberTicks; + var nbins = (nticks-1)/2; + // so, now we have total number of axis values. + if (paxis.name == 'xaxis' || paxis.name == 'x2axis') { + if (this._stack) { + this.barWidth = (paxis._offsets.max - paxis._offsets.min) / nvals * nseries - this.barMargin; + } + else { + this.barWidth = ((paxis._offsets.max - paxis._offsets.min)/nbins - this.barPadding * (nseries-1) - this.barMargin*2)/nseries; + // this.barWidth = (paxis._offsets.max - paxis._offsets.min) / nvals - this.barPadding - this.barMargin/nseries; + } + } + else { + if (this._stack) { + this.barWidth = (paxis._offsets.min - paxis._offsets.max) / nvals * nseries - this.barMargin; + } + else { + this.barWidth = ((paxis._offsets.min - paxis._offsets.max)/nbins - this.barPadding * (nseries-1) - this.barMargin*2)/nseries; + // this.barWidth = (paxis._offsets.min - paxis._offsets.max) / nvals - this.barPadding - this.barMargin/nseries; + } + } + return [nvals, nseries]; + }; + + function computeHighlightColors (colors) { + var ret = []; + for (var i=0; i<colors.length; i++){ + var rgba = $.jqplot.getColorComponents(colors[i]); + var newrgb = [rgba[0], rgba[1], rgba[2]]; + var sum = newrgb[0] + newrgb[1] + newrgb[2]; + for (var j=0; j<3; j++) { + // when darkening, lowest color component can be is 60. + newrgb[j] = (sum > 570) ? newrgb[j] * 0.8 : newrgb[j] + 0.3 * (255 - newrgb[j]); + newrgb[j] = parseInt(newrgb[j], 10); + } + ret.push('rgb('+newrgb[0]+','+newrgb[1]+','+newrgb[2]+')'); + } + return ret; + } + + $.jqplot.BarRenderer.prototype.draw = function(ctx, gridData, options) { + var i; + // Ughhh, have to make a copy of options b/c it may be modified later. + var opts = $.extend({}, options); + var shadow = (opts.shadow != undefined) ? opts.shadow : this.shadow; + var showLine = (opts.showLine != undefined) ? opts.showLine : this.showLine; + var fill = (opts.fill != undefined) ? opts.fill : this.fill; + var xaxis = this.xaxis; + var yaxis = this.yaxis; + var xp = this._xaxis.series_u2p; + var yp = this._yaxis.series_u2p; + var pointx, pointy; + // clear out data colors. + this._dataColors = []; + this._barPoints = []; + + if (this.barWidth == null) { + this.renderer.setBarWidth.call(this); + } + + var temp = this._plotSeriesInfo = this.renderer.calcSeriesNumbers.call(this); + var nvals = temp[0]; + var nseries = temp[1]; + var pos = temp[2]; + var points = []; + + if (this._stack) { + this._barNudge = 0; + } + else { + this._barNudge = (-Math.abs(nseries/2 - 0.5) + pos) * (this.barWidth + this.barPadding); + } + if (showLine) { + var negativeColors = new $.jqplot.ColorGenerator(this.negativeSeriesColors); + var positiveColors = new $.jqplot.ColorGenerator(this.seriesColors); + var negativeColor = negativeColors.get(this.index); + if (! this.useNegativeColors) { + negativeColor = opts.fillStyle; + } + var positiveColor = opts.fillStyle; + var base; + var xstart; + var ystart; + + if (this.barDirection == 'vertical') { + for (var i=0; i<gridData.length; i++) { + if (this.data[i][1] == null) { + continue; + } + points = []; + base = gridData[i][0] + this._barNudge; + ystart; + + // stacked + if (this._stack && this._prevGridData.length) { + ystart = this._prevGridData[i][1]; + } + // not stacked and first series in stack + else { + if (this.fillToZero) { + ystart = this._yaxis.series_u2p(0); + } + else if (this.waterfall && i > 0 && i < this.gridData.length-1) { + ystart = this.gridData[i-1][1]; + } + else if (this.waterfall && i == 0 && i < this.gridData.length-1) { + if (this._yaxis.min <= 0 && this._yaxis.max >= 0) { + ystart = this._yaxis.series_u2p(0); + } + else if (this._yaxis.min > 0) { + ystart = ctx.canvas.height; + } + else { + ystart = 0; + } + } + else if (this.waterfall && i == this.gridData.length - 1) { + if (this._yaxis.min <= 0 && this._yaxis.max >= 0) { + ystart = this._yaxis.series_u2p(0); + } + else if (this._yaxis.min > 0) { + ystart = ctx.canvas.height; + } + else { + ystart = 0; + } + } + else { + ystart = ctx.canvas.height; + } + } + if ((this.fillToZero && this._plotData[i][1] < 0) || (this.waterfall && this._data[i][1] < 0)) { + if (this.varyBarColor && !this._stack) { + if (this.useNegativeColors) { + opts.fillStyle = negativeColors.next(); + } + else { + opts.fillStyle = positiveColors.next(); + } + } + else { + opts.fillStyle = negativeColor; + } + } + else { + if (this.varyBarColor && !this._stack) { + opts.fillStyle = positiveColors.next(); + } + else { + opts.fillStyle = positiveColor; + } + } + + if (!this.fillToZero || this._plotData[i][1] >= 0) { + points.push([base-this.barWidth/2, ystart]); + points.push([base-this.barWidth/2, gridData[i][1]]); + points.push([base+this.barWidth/2, gridData[i][1]]); + points.push([base+this.barWidth/2, ystart]); + } + // for negative bars make sure points are always ordered clockwise + else { + points.push([base-this.barWidth/2, gridData[i][1]]); + points.push([base-this.barWidth/2, ystart]); + points.push([base+this.barWidth/2, ystart]); + points.push([base+this.barWidth/2, gridData[i][1]]); + } + this._barPoints.push(points); + // now draw the shadows if not stacked. + // for stacked plots, they are predrawn by drawShadow + if (shadow && !this._stack) { + var sopts = $.extend(true, {}, opts); + // need to get rid of fillStyle on shadow. + delete sopts.fillStyle; + this.renderer.shadowRenderer.draw(ctx, points, sopts); + } + var clr = opts.fillStyle || this.color; + this._dataColors.push(clr); + this.renderer.shapeRenderer.draw(ctx, points, opts); + } + } + + else if (this.barDirection == 'horizontal'){ + for (var i=0; i<gridData.length; i++) { + if (this.data[i][0] == null) { + continue; + } + points = []; + base = gridData[i][1] - this._barNudge; + xstart; + + if (this._stack && this._prevGridData.length) { + xstart = this._prevGridData[i][0]; + } + // not stacked and first series in stack + else { + if (this.fillToZero) { + xstart = this._xaxis.series_u2p(0); + } + else if (this.waterfall && i > 0 && i < this.gridData.length-1) { + xstart = this.gridData[i-1][1]; + } + else if (this.waterfall && i == 0 && i < this.gridData.length-1) { + if (this._xaxis.min <= 0 && this._xaxis.max >= 0) { + xstart = this._xaxis.series_u2p(0); + } + else if (this._xaxis.min > 0) { + xstart = 0; + } + else { + xstart = ctx.canvas.width; + } + } + else if (this.waterfall && i == this.gridData.length - 1) { + if (this._xaxis.min <= 0 && this._xaxis.max >= 0) { + xstart = this._xaxis.series_u2p(0); + } + else if (this._xaxis.min > 0) { + xstart = 0; + } + else { + xstart = ctx.canvas.width; + } + } + else { + xstart = 0; + } + } + if ((this.fillToZero && this._plotData[i][1] < 0) || (this.waterfall && this._data[i][1] < 0)) { + if (this.varyBarColor && !this._stack) { + if (this.useNegativeColors) { + opts.fillStyle = negativeColors.next(); + } + else { + opts.fillStyle = positiveColors.next(); + } + } + } + else { + if (this.varyBarColor && !this._stack) { + opts.fillStyle = positiveColors.next(); + } + else { + opts.fillStyle = positiveColor; + } + } + + + if (!this.fillToZero || this._plotData[i][0] >= 0) { + points.push([xstart, base + this.barWidth / 2]); + points.push([xstart, base - this.barWidth / 2]); + points.push([gridData[i][0], base - this.barWidth / 2]); + points.push([gridData[i][0], base + this.barWidth / 2]); + } + else { + points.push([gridData[i][0], base + this.barWidth / 2]); + points.push([gridData[i][0], base - this.barWidth / 2]); + points.push([xstart, base - this.barWidth / 2]); + points.push([xstart, base + this.barWidth / 2]); + } + + this._barPoints.push(points); + // now draw the shadows if not stacked. + // for stacked plots, they are predrawn by drawShadow + if (shadow && !this._stack) { + var sopts = $.extend(true, {}, opts); + delete sopts.fillStyle; + this.renderer.shadowRenderer.draw(ctx, points, sopts); + } + var clr = opts.fillStyle || this.color; + this._dataColors.push(clr); + this.renderer.shapeRenderer.draw(ctx, points, opts); + } + } + } + + if (this.highlightColors.length == 0) { + this.highlightColors = $.jqplot.computeHighlightColors(this._dataColors); + } + + else if (typeof(this.highlightColors) == 'string') { + var temp = this.highlightColors; + this.highlightColors = []; + for (var i=0; i<this._dataColors.length; i++) { + this.highlightColors.push(temp); + } + } + + }; + + + // for stacked plots, shadows will be pre drawn by drawShadow. + $.jqplot.BarRenderer.prototype.drawShadow = function(ctx, gridData, options) { + var i; + var opts = (options != undefined) ? options : {}; + var shadow = (opts.shadow != undefined) ? opts.shadow : this.shadow; + var showLine = (opts.showLine != undefined) ? opts.showLine : this.showLine; + var fill = (opts.fill != undefined) ? opts.fill : this.fill; + var xaxis = this.xaxis; + var yaxis = this.yaxis; + var xp = this._xaxis.series_u2p; + var yp = this._yaxis.series_u2p; + var pointx, points, pointy, nvals, nseries, pos; + + if (this._stack && this.shadow) { + if (this.barWidth == null) { + this.renderer.setBarWidth.call(this); + } + + var temp = this._plotSeriesInfo = this.renderer.calcSeriesNumbers.call(this); + nvals = temp[0]; + nseries = temp[1]; + pos = temp[2]; + + if (this._stack) { + this._barNudge = 0; + } + else { + this._barNudge = (-Math.abs(nseries/2 - 0.5) + pos) * (this.barWidth + this.barPadding); + } + if (showLine) { + + if (this.barDirection == 'vertical') { + for (var i=0; i<gridData.length; i++) { + if (this.data[i][1] == null) { + continue; + } + points = []; + var base = gridData[i][0] + this._barNudge; + var ystart; + + if (this._stack && this._prevGridData.length) { + ystart = this._prevGridData[i][1]; + } + else { + if (this.fillToZero) { + ystart = this._yaxis.series_u2p(0); + } + else { + ystart = ctx.canvas.height; + } + } + + points.push([base-this.barWidth/2, ystart]); + points.push([base-this.barWidth/2, gridData[i][1]]); + points.push([base+this.barWidth/2, gridData[i][1]]); + points.push([base+this.barWidth/2, ystart]); + this.renderer.shadowRenderer.draw(ctx, points, opts); + } + } + + else if (this.barDirection == 'horizontal'){ + for (var i=0; i<gridData.length; i++) { + if (this.data[i][0] == null) { + continue; + } + points = []; + var base = gridData[i][1] - this._barNudge; + var xstart; + + if (this._stack && this._prevGridData.length) { + xstart = this._prevGridData[i][0]; + } + else { + xstart = 0; + } + + points.push([xstart, base+this.barWidth/2]); + points.push([gridData[i][0], base+this.barWidth/2]); + points.push([gridData[i][0], base-this.barWidth/2]); + points.push([xstart, base-this.barWidth/2]); + this.renderer.shadowRenderer.draw(ctx, points, opts); + } + } + } + + } + }; + + function postInit(target, data, options) { + for (var i=0; i<this.series.length; i++) { + if (this.series[i].renderer.constructor == $.jqplot.BarRenderer) { + // don't allow mouseover and mousedown at same time. + if (this.series[i].highlightMouseOver) { + this.series[i].highlightMouseDown = false; + } + } + } + } + + // called within context of plot + // create a canvas which we can draw on. + // insert it before the eventCanvas, so eventCanvas will still capture events. + function postPlotDraw() { + // Memory Leaks patch + if (this.plugins.barRenderer && this.plugins.barRenderer.highlightCanvas) { + + this.plugins.barRenderer.highlightCanvas.resetCanvas(); + this.plugins.barRenderer.highlightCanvas = null; + } + + this.plugins.barRenderer = {highlightedSeriesIndex:null}; + this.plugins.barRenderer.highlightCanvas = new $.jqplot.GenericCanvas(); + + this.eventCanvas._elem.before(this.plugins.barRenderer.highlightCanvas.createElement(this._gridPadding, 'jqplot-barRenderer-highlight-canvas', this._plotDimensions, this)); + this.plugins.barRenderer.highlightCanvas.setContext(); + this.eventCanvas._elem.bind('mouseleave', {plot:this}, function (ev) { unhighlight(ev.data.plot); }); + } + + function highlight (plot, sidx, pidx, points) { + var s = plot.series[sidx]; + var canvas = plot.plugins.barRenderer.highlightCanvas; + canvas._ctx.clearRect(0,0,canvas._ctx.canvas.width, canvas._ctx.canvas.height); + s._highlightedPoint = pidx; + plot.plugins.barRenderer.highlightedSeriesIndex = sidx; + var opts = {fillStyle: s.highlightColors[pidx]}; + s.renderer.shapeRenderer.draw(canvas._ctx, points, opts); + canvas = null; + } + + function unhighlight (plot) { + var canvas = plot.plugins.barRenderer.highlightCanvas; + canvas._ctx.clearRect(0,0, canvas._ctx.canvas.width, canvas._ctx.canvas.height); + for (var i=0; i<plot.series.length; i++) { + plot.series[i]._highlightedPoint = null; + } + plot.plugins.barRenderer.highlightedSeriesIndex = null; + plot.target.trigger('jqplotDataUnhighlight'); + canvas = null; + } + + + function handleMove(ev, gridpos, datapos, neighbor, plot) { + if (neighbor) { + var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data]; + var evt1 = jQuery.Event('jqplotDataMouseOver'); + evt1.pageX = ev.pageX; + evt1.pageY = ev.pageY; + plot.target.trigger(evt1, ins); + if (plot.series[ins[0]].highlightMouseOver && !(ins[0] == plot.plugins.barRenderer.highlightedSeriesIndex && ins[1] == plot.series[ins[0]]._highlightedPoint)) { + var evt = jQuery.Event('jqplotDataHighlight'); + evt.pageX = ev.pageX; + evt.pageY = ev.pageY; + plot.target.trigger(evt, ins); + highlight (plot, neighbor.seriesIndex, neighbor.pointIndex, neighbor.points); + } + } + else if (neighbor == null) { + unhighlight (plot); + } + } + + function handleMouseDown(ev, gridpos, datapos, neighbor, plot) { + if (neighbor) { + var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data]; + if (plot.series[ins[0]].highlightMouseDown && !(ins[0] == plot.plugins.barRenderer.highlightedSeriesIndex && ins[1] == plot.series[ins[0]]._highlightedPoint)) { + var evt = jQuery.Event('jqplotDataHighlight'); + evt.pageX = ev.pageX; + evt.pageY = ev.pageY; + plot.target.trigger(evt, ins); + highlight (plot, neighbor.seriesIndex, neighbor.pointIndex, neighbor.points); + } + } + else if (neighbor == null) { + unhighlight (plot); + } + } + + function handleMouseUp(ev, gridpos, datapos, neighbor, plot) { + var idx = plot.plugins.barRenderer.highlightedSeriesIndex; + if (idx != null && plot.series[idx].highlightMouseDown) { + unhighlight(plot); + } + } + + function handleClick(ev, gridpos, datapos, neighbor, plot) { + if (neighbor) { + var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data]; + var evt = jQuery.Event('jqplotDataClick'); + evt.pageX = ev.pageX; + evt.pageY = ev.pageY; + plot.target.trigger(evt, ins); + } + } + + function handleRightClick(ev, gridpos, datapos, neighbor, plot) { + if (neighbor) { + var ins = [neighbor.seriesIndex, neighbor.pointIndex, neighbor.data]; + var idx = plot.plugins.barRenderer.highlightedSeriesIndex; + if (idx != null && plot.series[idx].highlightMouseDown) { + unhighlight(plot); + } + var evt = jQuery.Event('jqplotDataRightClick'); + evt.pageX = ev.pageX; + evt.pageY = ev.pageY; + plot.target.trigger(evt, ins); + } + } + + +})(jQuery); \ No newline at end of file diff --git a/www/protected/extensions/jqplot/plugins/jqplot.barRenderer.min.js b/www/protected/extensions/jqplot/plugins/jqplot.barRenderer.min.js new file mode 100644 index 0000000..c406b64 --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.barRenderer.min.js @@ -0,0 +1,57 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + * included jsDate library by Chris Leonello: + * + * Copyright (c) 2010-2011 Chris Leonello + * + * jsDate is currently available for use in all personal or commercial projects + * under both the MIT and GPL version 2.0 licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * jsDate borrows many concepts and ideas from the Date Instance + * Methods by Ken Snyder along with some parts of Ken's actual code. + * + * Ken's origianl Date Instance Methods and copyright notice: + * + * Ken Snyder (ken d snyder at gmail dot com) + * 2008-09-10 + * version 2.0.2 (http://kendsnyder.com/sandbox/date/) + * Creative Commons Attribution License 3.0 (http://creativecommons.org/licenses/by/3.0/) + * + * jqplotToImage function based on Larry Siden's export-jqplot-to-png.js. + * Larry has generously given permission to adapt his code for inclusion + * into jqPlot. + * + * Larry's original code can be found here: + * + * https://github.com/lsiden/export-jqplot-to-png + * + * + */ +(function(d){d.jqplot.BarRenderer=function(){d.jqplot.LineRenderer.call(this)};d.jqplot.BarRenderer.prototype=new d.jqplot.LineRenderer();d.jqplot.BarRenderer.prototype.constructor=d.jqplot.BarRenderer;d.jqplot.BarRenderer.prototype.init=function(n,p){this.barPadding=8;this.barMargin=10;this.barDirection="vertical";this.barWidth=null;this.shadowOffset=2;this.shadowDepth=5;this.shadowAlpha=0.08;this.waterfall=false;this.groups=1;this.varyBarColor=false;this.highlightMouseOver=true;this.highlightMouseDown=false;this.highlightColors=[];this.transposedData=true;this.renderer.animation={show:false,direction:"down",speed:3000,_supported:true};this._type="bar";if(n.highlightMouseDown&&n.highlightMouseOver==null){n.highlightMouseOver=false}d.extend(true,this,n);d.extend(true,this.renderer,n);this.fill=true;if(this.barDirection==="horizontal"&&this.rendererOptions.animation&&this.rendererOptions.animation.direction==null){this.renderer.animation.direction="left"}if(this.waterfall){this.fillToZero=false;this.disableStack=true}if(this.barDirection=="vertical"){this._primaryAxis="_xaxis";this._stackAxis="y";this.fillAxis="y"}else{this._primaryAxis="_yaxis";this._stackAxis="x";this.fillAxis="x"}this._highlightedPoint=null;this._plotSeriesInfo=null;this._dataColors=[];this._barPoints=[];var o={lineJoin:"miter",lineCap:"round",fill:true,isarc:false,strokeStyle:this.color,fillStyle:this.color,closePath:this.fill};this.renderer.shapeRenderer.init(o);var m={lineJoin:"miter",lineCap:"round",fill:true,isarc:false,angle:this.shadowAngle,offset:this.shadowOffset,alpha:this.shadowAlpha,depth:this.shadowDepth,closePath:this.fill};this.renderer.shadowRenderer.init(m);p.postInitHooks.addOnce(h);p.postDrawHooks.addOnce(i);p.eventListenerHooks.addOnce("jqplotMouseMove",b);p.eventListenerHooks.addOnce("jqplotMouseDown",a);p.eventListenerHooks.addOnce("jqplotMouseUp",k);p.eventListenerHooks.addOnce("jqplotClick",e);p.eventListenerHooks.addOnce("jqplotRightClick",l)};function g(s,o,n,v){if(this.rendererOptions.barDirection=="horizontal"){this._stackAxis="x";this._primaryAxis="_yaxis"}if(this.rendererOptions.waterfall==true){this._data=d.extend(true,[],this.data);var r=0;var t=(!this.rendererOptions.barDirection||this.rendererOptions.barDirection==="vertical"||this.transposedData===false)?1:0;for(var p=0;p<this.data.length;p++){r+=this.data[p][t];if(p>0){this.data[p][t]+=this.data[p-1][t]}}this.data[this.data.length]=(t==1)?[this.data.length+1,r]:[r,this.data.length+1];this._data[this._data.length]=(t==1)?[this._data.length+1,r]:[r,this._data.length+1]}if(this.rendererOptions.groups>1){this.breakOnNull=true;var m=this.data.length;var u=parseInt(m/this.rendererOptions.groups,10);var q=0;for(var p=u;p<m;p+=u){this.data.splice(p+q,0,[null,null]);q++}for(p=0;p<this.data.length;p++){if(this._primaryAxis=="_xaxis"){this.data[p][0]=p+1}else{this.data[p][1]=p+1}}}}d.jqplot.preSeriesInitHooks.push(g);d.jqplot.BarRenderer.prototype.calcSeriesNumbers=function(){var q=0;var r=0;var p=this[this._primaryAxis];var o,n,t;for(var m=0;m<p._series.length;m++){n=p._series[m];if(n===this){t=m}if(n.renderer.constructor==d.jqplot.BarRenderer){q+=n.data.length;r+=1}}return[q,r,t]};d.jqplot.BarRenderer.prototype.setBarWidth=function(){var p;var m=0;var n=0;var r=this[this._primaryAxis];var w,q,u;var v=this._plotSeriesInfo=this.renderer.calcSeriesNumbers.call(this);m=v[0];n=v[1];var t=r.numberTicks;var o=(t-1)/2;if(r.name=="xaxis"||r.name=="x2axis"){if(this._stack){this.barWidth=(r._offsets.max-r._offsets.min)/m*n-this.barMargin}else{this.barWidth=((r._offsets.max-r._offsets.min)/o-this.barPadding*(n-1)-this.barMargin*2)/n}}else{if(this._stack){this.barWidth=(r._offsets.min-r._offsets.max)/m*n-this.barMargin}else{this.barWidth=((r._offsets.min-r._offsets.max)/o-this.barPadding*(n-1)-this.barMargin*2)/n}}return[m,n]};function f(n){var p=[];for(var r=0;r<n.length;r++){var q=d.jqplot.getColorComponents(n[r]);var m=[q[0],q[1],q[2]];var s=m[0]+m[1]+m[2];for(var o=0;o<3;o++){m[o]=(s>570)?m[o]*0.8:m[o]+0.3*(255-m[o]);m[o]=parseInt(m[o],10)}p.push("rgb("+m[0]+","+m[1]+","+m[2]+")")}return p}d.jqplot.BarRenderer.prototype.draw=function(D,J,p){var G;var z=d.extend({},p);var u=(z.shadow!=undefined)?z.shadow:this.shadow;var M=(z.showLine!=undefined)?z.showLine:this.showLine;var E=(z.fill!=undefined)?z.fill:this.fill;var o=this.xaxis;var H=this.yaxis;var x=this._xaxis.series_u2p;var I=this._yaxis.series_u2p;var C,B;this._dataColors=[];this._barPoints=[];if(this.barWidth==null){this.renderer.setBarWidth.call(this)}var L=this._plotSeriesInfo=this.renderer.calcSeriesNumbers.call(this);var w=L[0];var v=L[1];var r=L[2];var F=[];if(this._stack){this._barNudge=0}else{this._barNudge=(-Math.abs(v/2-0.5)+r)*(this.barWidth+this.barPadding)}if(M){var t=new d.jqplot.ColorGenerator(this.negativeSeriesColors);var A=new d.jqplot.ColorGenerator(this.seriesColors);var K=t.get(this.index);if(!this.useNegativeColors){K=z.fillStyle}var s=z.fillStyle;var q;var N;var n;if(this.barDirection=="vertical"){for(var G=0;G<J.length;G++){if(this.data[G][1]==null){continue}F=[];q=J[G][0]+this._barNudge;n;if(this._stack&&this._prevGridData.length){n=this._prevGridData[G][1]}else{if(this.fillToZero){n=this._yaxis.series_u2p(0)}else{if(this.waterfall&&G>0&&G<this.gridData.length-1){n=this.gridData[G-1][1]}else{if(this.waterfall&&G==0&&G<this.gridData.length-1){if(this._yaxis.min<=0&&this._yaxis.max>=0){n=this._yaxis.series_u2p(0)}else{if(this._yaxis.min>0){n=D.canvas.height}else{n=0}}}else{if(this.waterfall&&G==this.gridData.length-1){if(this._yaxis.min<=0&&this._yaxis.max>=0){n=this._yaxis.series_u2p(0)}else{if(this._yaxis.min>0){n=D.canvas.height}else{n=0}}}else{n=D.canvas.height}}}}}if((this.fillToZero&&this._plotData[G][1]<0)||(this.waterfall&&this._data[G][1]<0)){if(this.varyBarColor&&!this._stack){if(this.useNegativeColors){z.fillStyle=t.next()}else{z.fillStyle=A.next()}}else{z.fillStyle=K}}else{if(this.varyBarColor&&!this._stack){z.fillStyle=A.next()}else{z.fillStyle=s}}if(!this.fillToZero||this._plotData[G][1]>=0){F.push([q-this.barWidth/2,n]);F.push([q-this.barWidth/2,J[G][1]]);F.push([q+this.barWidth/2,J[G][1]]);F.push([q+this.barWidth/2,n])}else{F.push([q-this.barWidth/2,J[G][1]]);F.push([q-this.barWidth/2,n]);F.push([q+this.barWidth/2,n]);F.push([q+this.barWidth/2,J[G][1]])}this._barPoints.push(F);if(u&&!this._stack){var y=d.extend(true,{},z);delete y.fillStyle;this.renderer.shadowRenderer.draw(D,F,y)}var m=z.fillStyle||this.color;this._dataColors.push(m);this.renderer.shapeRenderer.draw(D,F,z)}}else{if(this.barDirection=="horizontal"){for(var G=0;G<J.length;G++){if(this.data[G][0]==null){continue}F=[];q=J[G][1]-this._barNudge;N;if(this._stack&&this._prevGridData.length){N=this._prevGridData[G][0]}else{if(this.fillToZero){N=this._xaxis.series_u2p(0)}else{if(this.waterfall&&G>0&&G<this.gridData.length-1){N=this.gridData[G-1][1]}else{if(this.waterfall&&G==0&&G<this.gridData.length-1){if(this._xaxis.min<=0&&this._xaxis.max>=0){N=this._xaxis.series_u2p(0)}else{if(this._xaxis.min>0){N=0}else{N=D.canvas.width}}}else{if(this.waterfall&&G==this.gridData.length-1){if(this._xaxis.min<=0&&this._xaxis.max>=0){N=this._xaxis.series_u2p(0)}else{if(this._xaxis.min>0){N=0}else{N=D.canvas.width}}}else{N=0}}}}}if((this.fillToZero&&this._plotData[G][1]<0)||(this.waterfall&&this._data[G][1]<0)){if(this.varyBarColor&&!this._stack){if(this.useNegativeColors){z.fillStyle=t.next()}else{z.fillStyle=A.next()}}}else{if(this.varyBarColor&&!this._stack){z.fillStyle=A.next()}else{z.fillStyle=s}}if(!this.fillToZero||this._plotData[G][0]>=0){F.push([N,q+this.barWidth/2]);F.push([N,q-this.barWidth/2]);F.push([J[G][0],q-this.barWidth/2]);F.push([J[G][0],q+this.barWidth/2])}else{F.push([J[G][0],q+this.barWidth/2]);F.push([J[G][0],q-this.barWidth/2]);F.push([N,q-this.barWidth/2]);F.push([N,q+this.barWidth/2])}this._barPoints.push(F);if(u&&!this._stack){var y=d.extend(true,{},z);delete y.fillStyle;this.renderer.shadowRenderer.draw(D,F,y)}var m=z.fillStyle||this.color;this._dataColors.push(m);this.renderer.shapeRenderer.draw(D,F,z)}}}}if(this.highlightColors.length==0){this.highlightColors=d.jqplot.computeHighlightColors(this._dataColors)}else{if(typeof(this.highlightColors)=="string"){var L=this.highlightColors;this.highlightColors=[];for(var G=0;G<this._dataColors.length;G++){this.highlightColors.push(L)}}}};d.jqplot.BarRenderer.prototype.drawShadow=function(y,E,o){var B;var v=(o!=undefined)?o:{};var r=(v.shadow!=undefined)?v.shadow:this.shadow;var G=(v.showLine!=undefined)?v.showLine:this.showLine;var z=(v.fill!=undefined)?v.fill:this.fill;var n=this.xaxis;var C=this.yaxis;var u=this._xaxis.series_u2p;var D=this._yaxis.series_u2p;var x,A,w,t,s,q;if(this._stack&&this.shadow){if(this.barWidth==null){this.renderer.setBarWidth.call(this)}var F=this._plotSeriesInfo=this.renderer.calcSeriesNumbers.call(this);t=F[0];s=F[1];q=F[2];if(this._stack){this._barNudge=0}else{this._barNudge=(-Math.abs(s/2-0.5)+q)*(this.barWidth+this.barPadding)}if(G){if(this.barDirection=="vertical"){for(var B=0;B<E.length;B++){if(this.data[B][1]==null){continue}A=[];var p=E[B][0]+this._barNudge;var m;if(this._stack&&this._prevGridData.length){m=this._prevGridData[B][1]}else{if(this.fillToZero){m=this._yaxis.series_u2p(0)}else{m=y.canvas.height}}A.push([p-this.barWidth/2,m]);A.push([p-this.barWidth/2,E[B][1]]);A.push([p+this.barWidth/2,E[B][1]]);A.push([p+this.barWidth/2,m]);this.renderer.shadowRenderer.draw(y,A,v)}}else{if(this.barDirection=="horizontal"){for(var B=0;B<E.length;B++){if(this.data[B][0]==null){continue}A=[];var p=E[B][1]-this._barNudge;var H;if(this._stack&&this._prevGridData.length){H=this._prevGridData[B][0]}else{H=0}A.push([H,p+this.barWidth/2]);A.push([E[B][0],p+this.barWidth/2]);A.push([E[B][0],p-this.barWidth/2]);A.push([H,p-this.barWidth/2]);this.renderer.shadowRenderer.draw(y,A,v)}}}}}};function h(p,o,m){for(var n=0;n<this.series.length;n++){if(this.series[n].renderer.constructor==d.jqplot.BarRenderer){if(this.series[n].highlightMouseOver){this.series[n].highlightMouseDown=false}}}}function i(){if(this.plugins.barRenderer&&this.plugins.barRenderer.highlightCanvas){this.plugins.barRenderer.highlightCanvas.resetCanvas();this.plugins.barRenderer.highlightCanvas=null}this.plugins.barRenderer={highlightedSeriesIndex:null};this.plugins.barRenderer.highlightCanvas=new d.jqplot.GenericCanvas();this.eventCanvas._elem.before(this.plugins.barRenderer.highlightCanvas.createElement(this._gridPadding,"jqplot-barRenderer-highlight-canvas",this._plotDimensions,this));this.plugins.barRenderer.highlightCanvas.setContext();this.eventCanvas._elem.bind("mouseleave",{plot:this},function(m){j(m.data.plot)})}function c(t,r,p,o){var n=t.series[r];var m=t.plugins.barRenderer.highlightCanvas;m._ctx.clearRect(0,0,m._ctx.canvas.width,m._ctx.canvas.height);n._highlightedPoint=p;t.plugins.barRenderer.highlightedSeriesIndex=r;var q={fillStyle:n.highlightColors[p]};n.renderer.shapeRenderer.draw(m._ctx,o,q);m=null}function j(o){var m=o.plugins.barRenderer.highlightCanvas;m._ctx.clearRect(0,0,m._ctx.canvas.width,m._ctx.canvas.height);for(var n=0;n<o.series.length;n++){o.series[n]._highlightedPoint=null}o.plugins.barRenderer.highlightedSeriesIndex=null;o.target.trigger("jqplotDataUnhighlight");m=null}function b(q,p,t,s,r){if(s){var o=[s.seriesIndex,s.pointIndex,s.data];var n=jQuery.Event("jqplotDataMouseOver");n.pageX=q.pageX;n.pageY=q.pageY;r.target.trigger(n,o);if(r.series[o[0]].highlightMouseOver&&!(o[0]==r.plugins.barRenderer.highlightedSeriesIndex&&o[1]==r.series[o[0]]._highlightedPoint)){var m=jQuery.Event("jqplotDataHighlight");m.pageX=q.pageX;m.pageY=q.pageY;r.target.trigger(m,o);c(r,s.seriesIndex,s.pointIndex,s.points)}}else{if(s==null){j(r)}}}function a(p,o,s,r,q){if(r){var n=[r.seriesIndex,r.pointIndex,r.data];if(q.series[n[0]].highlightMouseDown&&!(n[0]==q.plugins.barRenderer.highlightedSeriesIndex&&n[1]==q.series[n[0]]._highlightedPoint)){var m=jQuery.Event("jqplotDataHighlight");m.pageX=p.pageX;m.pageY=p.pageY;q.target.trigger(m,n);c(q,r.seriesIndex,r.pointIndex,r.points)}}else{if(r==null){j(q)}}}function k(o,n,r,q,p){var m=p.plugins.barRenderer.highlightedSeriesIndex;if(m!=null&&p.series[m].highlightMouseDown){j(p)}}function e(p,o,s,r,q){if(r){var n=[r.seriesIndex,r.pointIndex,r.data];var m=jQuery.Event("jqplotDataClick");m.pageX=p.pageX;m.pageY=p.pageY;q.target.trigger(m,n)}}function l(q,p,t,s,r){if(s){var o=[s.seriesIndex,s.pointIndex,s.data];var m=r.plugins.barRenderer.highlightedSeriesIndex;if(m!=null&&r.series[m].highlightMouseDown){j(r)}var n=jQuery.Event("jqplotDataRightClick");n.pageX=q.pageX;n.pageY=q.pageY;r.target.trigger(n,o)}}})(jQuery); \ No newline at end of file diff --git a/www/protected/extensions/jqplot/plugins/jqplot.canvasAxisLabelRenderer.js b/www/protected/extensions/jqplot/plugins/jqplot.canvasAxisLabelRenderer.js new file mode 100644 index 0000000..462f47e --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.canvasAxisLabelRenderer.js @@ -0,0 +1,202 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + */ +(function($) { + /** + * Class: $.jqplot.CanvasAxisLabelRenderer + * Renderer to draw axis labels with a canvas element to support advanced + * featrues such as rotated text. This renderer uses a separate rendering engine + * to draw the text on the canvas. Two modes of rendering the text are available. + * If the browser has native font support for canvas fonts (currently Mozila 3.5 + * and Safari 4), you can enable text rendering with the canvas fillText method. + * You do so by setting the "enableFontSupport" option to true. + * + * Browsers lacking native font support will have the text drawn on the canvas + * using the Hershey font metrics. Even if the "enableFontSupport" option is true + * non-supporting browsers will still render with the Hershey font. + * + */ + $.jqplot.CanvasAxisLabelRenderer = function(options) { + // Group: Properties + + // prop: angle + // angle of text, measured clockwise from x axis. + this.angle = 0; + // name of the axis associated with this tick + this.axis; + // prop: show + // wether or not to show the tick (mark and label). + this.show = true; + // prop: showLabel + // wether or not to show the label. + this.showLabel = true; + // prop: label + // label for the axis. + this.label = ''; + // prop: fontFamily + // CSS spec for the font-family css attribute. + // Applies only to browsers supporting native font rendering in the + // canvas tag. Currently Mozilla 3.5 and Safari 4. + this.fontFamily = '"Trebuchet MS", Arial, Helvetica, sans-serif'; + // prop: fontSize + // CSS spec for font size. + this.fontSize = '11pt'; + // prop: fontWeight + // CSS spec for fontWeight: normal, bold, bolder, lighter or a number 100 - 900 + this.fontWeight = 'normal'; + // prop: fontStretch + // Multiplier to condense or expand font width. + // Applies only to browsers which don't support canvas native font rendering. + this.fontStretch = 1.0; + // prop: textColor + // css spec for the color attribute. + this.textColor = '#666666'; + // prop: enableFontSupport + // true to turn on native canvas font support in Mozilla 3.5+ and Safari 4+. + // If true, label will be drawn with canvas tag native support for fonts. + // If false, label will be drawn with Hershey font metrics. + this.enableFontSupport = true; + // prop: pt2px + // Point to pixel scaling factor, used for computing height of bounding box + // around a label. The labels text renderer has a default setting of 1.4, which + // should be suitable for most fonts. Leave as null to use default. If tops of + // letters appear clipped, increase this. If bounding box seems too big, decrease. + // This is an issue only with the native font renderering capabilities of Mozilla + // 3.5 and Safari 4 since they do not provide a method to determine the font height. + this.pt2px = null; + + this._elem; + this._ctx; + this._plotWidth; + this._plotHeight; + this._plotDimensions = {height:null, width:null}; + + $.extend(true, this, options); + + if (options.angle == null && this.axis != 'xaxis' && this.axis != 'x2axis') { + this.angle = -90; + } + + var ropts = {fontSize:this.fontSize, fontWeight:this.fontWeight, fontStretch:this.fontStretch, fillStyle:this.textColor, angle:this.getAngleRad(), fontFamily:this.fontFamily}; + if (this.pt2px) { + ropts.pt2px = this.pt2px; + } + + if (this.enableFontSupport) { + if ($.jqplot.support_canvas_text()) { + this._textRenderer = new $.jqplot.CanvasFontRenderer(ropts); + } + + else { + this._textRenderer = new $.jqplot.CanvasTextRenderer(ropts); + } + } + else { + this._textRenderer = new $.jqplot.CanvasTextRenderer(ropts); + } + }; + + $.jqplot.CanvasAxisLabelRenderer.prototype.init = function(options) { + $.extend(true, this, options); + this._textRenderer.init({fontSize:this.fontSize, fontWeight:this.fontWeight, fontStretch:this.fontStretch, fillStyle:this.textColor, angle:this.getAngleRad(), fontFamily:this.fontFamily}); + }; + + // return width along the x axis + // will check first to see if an element exists. + // if not, will return the computed text box width. + $.jqplot.CanvasAxisLabelRenderer.prototype.getWidth = function(ctx) { + if (this._elem) { + return this._elem.outerWidth(true); + } + else { + var tr = this._textRenderer; + var l = tr.getWidth(ctx); + var h = tr.getHeight(ctx); + var w = Math.abs(Math.sin(tr.angle)*h) + Math.abs(Math.cos(tr.angle)*l); + return w; + } + }; + + // return height along the y axis. + $.jqplot.CanvasAxisLabelRenderer.prototype.getHeight = function(ctx) { + if (this._elem) { + return this._elem.outerHeight(true); + } + else { + var tr = this._textRenderer; + var l = tr.getWidth(ctx); + var h = tr.getHeight(ctx); + var w = Math.abs(Math.cos(tr.angle)*h) + Math.abs(Math.sin(tr.angle)*l); + return w; + } + }; + + $.jqplot.CanvasAxisLabelRenderer.prototype.getAngleRad = function() { + var a = this.angle * Math.PI/180; + return a; + }; + + $.jqplot.CanvasAxisLabelRenderer.prototype.draw = function(ctx, plot) { + // Memory Leaks patch + if (this._elem) { + if ($.jqplot.use_excanvas && window.G_vmlCanvasManager.uninitElement !== undefined) { + window.G_vmlCanvasManager.uninitElement(this._elem.get(0)); + } + + this._elem.emptyForce(); + this._elem = null; + } + + // create a canvas here, but can't draw on it untill it is appended + // to dom for IE compatability. + var elem = plot.canvasManager.getCanvas(); + + this._textRenderer.setText(this.label, ctx); + var w = this.getWidth(ctx); + var h = this.getHeight(ctx); + elem.width = w; + elem.height = h; + elem.style.width = w; + elem.style.height = h; + + elem = plot.canvasManager.initCanvas(elem); + + this._elem = $(elem); + this._elem.css({ position: 'absolute'}); + this._elem.addClass('jqplot-'+this.axis+'-label'); + + elem = null; + return this._elem; + }; + + $.jqplot.CanvasAxisLabelRenderer.prototype.pack = function() { + this._textRenderer.draw(this._elem.get(0).getContext("2d"), this.label); + }; + +})(jQuery); \ No newline at end of file diff --git a/www/protected/extensions/jqplot/plugins/jqplot.canvasAxisLabelRenderer.min.js b/www/protected/extensions/jqplot/plugins/jqplot.canvasAxisLabelRenderer.min.js new file mode 100644 index 0000000..6d229d7 --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.canvasAxisLabelRenderer.min.js @@ -0,0 +1,57 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + * included jsDate library by Chris Leonello: + * + * Copyright (c) 2010-2011 Chris Leonello + * + * jsDate is currently available for use in all personal or commercial projects + * under both the MIT and GPL version 2.0 licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * jsDate borrows many concepts and ideas from the Date Instance + * Methods by Ken Snyder along with some parts of Ken's actual code. + * + * Ken's origianl Date Instance Methods and copyright notice: + * + * Ken Snyder (ken d snyder at gmail dot com) + * 2008-09-10 + * version 2.0.2 (http://kendsnyder.com/sandbox/date/) + * Creative Commons Attribution License 3.0 (http://creativecommons.org/licenses/by/3.0/) + * + * jqplotToImage function based on Larry Siden's export-jqplot-to-png.js. + * Larry has generously given permission to adapt his code for inclusion + * into jqPlot. + * + * Larry's original code can be found here: + * + * https://github.com/lsiden/export-jqplot-to-png + * + * + */ +(function(a){a.jqplot.CanvasAxisLabelRenderer=function(b){this.angle=0;this.axis;this.show=true;this.showLabel=true;this.label="";this.fontFamily='"Trebuchet MS", Arial, Helvetica, sans-serif';this.fontSize="11pt";this.fontWeight="normal";this.fontStretch=1;this.textColor="#666666";this.enableFontSupport=true;this.pt2px=null;this._elem;this._ctx;this._plotWidth;this._plotHeight;this._plotDimensions={height:null,width:null};a.extend(true,this,b);if(b.angle==null&&this.axis!="xaxis"&&this.axis!="x2axis"){this.angle=-90}var c={fontSize:this.fontSize,fontWeight:this.fontWeight,fontStretch:this.fontStretch,fillStyle:this.textColor,angle:this.getAngleRad(),fontFamily:this.fontFamily};if(this.pt2px){c.pt2px=this.pt2px}if(this.enableFontSupport){if(a.jqplot.support_canvas_text()){this._textRenderer=new a.jqplot.CanvasFontRenderer(c)}else{this._textRenderer=new a.jqplot.CanvasTextRenderer(c)}}else{this._textRenderer=new a.jqplot.CanvasTextRenderer(c)}};a.jqplot.CanvasAxisLabelRenderer.prototype.init=function(b){a.extend(true,this,b);this._textRenderer.init({fontSize:this.fontSize,fontWeight:this.fontWeight,fontStretch:this.fontStretch,fillStyle:this.textColor,angle:this.getAngleRad(),fontFamily:this.fontFamily})};a.jqplot.CanvasAxisLabelRenderer.prototype.getWidth=function(d){if(this._elem){return this._elem.outerWidth(true)}else{var f=this._textRenderer;var c=f.getWidth(d);var e=f.getHeight(d);var b=Math.abs(Math.sin(f.angle)*e)+Math.abs(Math.cos(f.angle)*c);return b}};a.jqplot.CanvasAxisLabelRenderer.prototype.getHeight=function(d){if(this._elem){return this._elem.outerHeight(true)}else{var f=this._textRenderer;var c=f.getWidth(d);var e=f.getHeight(d);var b=Math.abs(Math.cos(f.angle)*e)+Math.abs(Math.sin(f.angle)*c);return b}};a.jqplot.CanvasAxisLabelRenderer.prototype.getAngleRad=function(){var b=this.angle*Math.PI/180;return b};a.jqplot.CanvasAxisLabelRenderer.prototype.draw=function(c,f){if(this._elem){if(a.jqplot.use_excanvas&&window.G_vmlCanvasManager.uninitElement!==undefined){window.G_vmlCanvasManager.uninitElement(this._elem.get(0))}this._elem.emptyForce();this._elem=null}var e=f.canvasManager.getCanvas();this._textRenderer.setText(this.label,c);var b=this.getWidth(c);var d=this.getHeight(c);e.width=b;e.height=d;e.style.width=b;e.style.height=d;e=f.canvasManager.initCanvas(e);this._elem=a(e);this._elem.css({position:"absolute"});this._elem.addClass("jqplot-"+this.axis+"-label");e=null;return this._elem};a.jqplot.CanvasAxisLabelRenderer.prototype.pack=function(){this._textRenderer.draw(this._elem.get(0).getContext("2d"),this.label)}})(jQuery); \ No newline at end of file diff --git a/www/protected/extensions/jqplot/plugins/jqplot.canvasAxisTickRenderer.js b/www/protected/extensions/jqplot/plugins/jqplot.canvasAxisTickRenderer.js new file mode 100644 index 0000000..4723426 --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.canvasAxisTickRenderer.js @@ -0,0 +1,242 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + */ +(function($) { + /** + * Class: $.jqplot.CanvasAxisTickRenderer + * Renderer to draw axis ticks with a canvas element to support advanced + * featrues such as rotated text. This renderer uses a separate rendering engine + * to draw the text on the canvas. Two modes of rendering the text are available. + * If the browser has native font support for canvas fonts (currently Mozila 3.5 + * and Safari 4), you can enable text rendering with the canvas fillText method. + * You do so by setting the "enableFontSupport" option to true. + * + * Browsers lacking native font support will have the text drawn on the canvas + * using the Hershey font metrics. Even if the "enableFontSupport" option is true + * non-supporting browsers will still render with the Hershey font. + */ + $.jqplot.CanvasAxisTickRenderer = function(options) { + // Group: Properties + + // prop: mark + // tick mark on the axis. One of 'inside', 'outside', 'cross', '' or null. + this.mark = 'outside'; + // prop: showMark + // wether or not to show the mark on the axis. + this.showMark = true; + // prop: showGridline + // wether or not to draw the gridline on the grid at this tick. + this.showGridline = true; + // prop: isMinorTick + // if this is a minor tick. + this.isMinorTick = false; + // prop: angle + // angle of text, measured clockwise from x axis. + this.angle = 0; + // prop: markSize + // Length of the tick marks in pixels. For 'cross' style, length + // will be stoked above and below axis, so total length will be twice this. + this.markSize = 4; + // prop: show + // wether or not to show the tick (mark and label). + this.show = true; + // prop: showLabel + // wether or not to show the label. + this.showLabel = true; + // prop: labelPosition + // 'auto', 'start', 'middle' or 'end'. + // Whether tick label should be positioned so the start, middle, or end + // of the tick mark. + this.labelPosition = 'auto'; + this.label = ''; + this.value = null; + this._styles = {}; + // prop: formatter + // A class of a formatter for the tick text. + // The default $.jqplot.DefaultTickFormatter uses sprintf. + this.formatter = $.jqplot.DefaultTickFormatter; + // prop: formatString + // string passed to the formatter. + this.formatString = ''; + // prop: prefix + // String to prepend to the tick label. + // Prefix is prepended to the formatted tick label. + this.prefix = ''; + // prop: fontFamily + // css spec for the font-family css attribute. + this.fontFamily = '"Trebuchet MS", Arial, Helvetica, sans-serif'; + // prop: fontSize + // CSS spec for font size. + this.fontSize = '10pt'; + // prop: fontWeight + // CSS spec for fontWeight + this.fontWeight = 'normal'; + // prop: fontStretch + // Multiplier to condense or expand font width. + // Applies only to browsers which don't support canvas native font rendering. + this.fontStretch = 1.0; + // prop: textColor + // css spec for the color attribute. + this.textColor = '#666666'; + // prop: enableFontSupport + // true to turn on native canvas font support in Mozilla 3.5+ and Safari 4+. + // If true, tick label will be drawn with canvas tag native support for fonts. + // If false, tick label will be drawn with Hershey font metrics. + this.enableFontSupport = true; + // prop: pt2px + // Point to pixel scaling factor, used for computing height of bounding box + // around a label. The labels text renderer has a default setting of 1.4, which + // should be suitable for most fonts. Leave as null to use default. If tops of + // letters appear clipped, increase this. If bounding box seems too big, decrease. + // This is an issue only with the native font renderering capabilities of Mozilla + // 3.5 and Safari 4 since they do not provide a method to determine the font height. + this.pt2px = null; + + this._elem; + this._ctx; + this._plotWidth; + this._plotHeight; + this._plotDimensions = {height:null, width:null}; + + $.extend(true, this, options); + + var ropts = {fontSize:this.fontSize, fontWeight:this.fontWeight, fontStretch:this.fontStretch, fillStyle:this.textColor, angle:this.getAngleRad(), fontFamily:this.fontFamily}; + if (this.pt2px) { + ropts.pt2px = this.pt2px; + } + + if (this.enableFontSupport) { + if ($.jqplot.support_canvas_text()) { + this._textRenderer = new $.jqplot.CanvasFontRenderer(ropts); + } + + else { + this._textRenderer = new $.jqplot.CanvasTextRenderer(ropts); + } + } + else { + this._textRenderer = new $.jqplot.CanvasTextRenderer(ropts); + } + }; + + $.jqplot.CanvasAxisTickRenderer.prototype.init = function(options) { + $.extend(true, this, options); + this._textRenderer.init({fontSize:this.fontSize, fontWeight:this.fontWeight, fontStretch:this.fontStretch, fillStyle:this.textColor, angle:this.getAngleRad(), fontFamily:this.fontFamily}); + }; + + // return width along the x axis + // will check first to see if an element exists. + // if not, will return the computed text box width. + $.jqplot.CanvasAxisTickRenderer.prototype.getWidth = function(ctx) { + if (this._elem) { + return this._elem.outerWidth(true); + } + else { + var tr = this._textRenderer; + var l = tr.getWidth(ctx); + var h = tr.getHeight(ctx); + var w = Math.abs(Math.sin(tr.angle)*h) + Math.abs(Math.cos(tr.angle)*l); + return w; + } + }; + + // return height along the y axis. + $.jqplot.CanvasAxisTickRenderer.prototype.getHeight = function(ctx) { + if (this._elem) { + return this._elem.outerHeight(true); + } + else { + var tr = this._textRenderer; + var l = tr.getWidth(ctx); + var h = tr.getHeight(ctx); + var w = Math.abs(Math.cos(tr.angle)*h) + Math.abs(Math.sin(tr.angle)*l); + return w; + } + }; + + $.jqplot.CanvasAxisTickRenderer.prototype.getAngleRad = function() { + var a = this.angle * Math.PI/180; + return a; + }; + + + $.jqplot.CanvasAxisTickRenderer.prototype.setTick = function(value, axisName, isMinor) { + this.value = value; + if (isMinor) { + this.isMinorTick = true; + } + return this; + }; + + $.jqplot.CanvasAxisTickRenderer.prototype.draw = function(ctx, plot) { + if (!this.label) { + this.label = this.prefix + this.formatter(this.formatString, this.value); + } + + // Memory Leaks patch + if (this._elem) { + if ($.jqplot.use_excanvas && window.G_vmlCanvasManager.uninitElement !== undefined) { + window.G_vmlCanvasManager.uninitElement(this._elem.get(0)); + } + + this._elem.emptyForce(); + this._elem = null; + } + + // create a canvas here, but can't draw on it untill it is appended + // to dom for IE compatability. + + var elem = plot.canvasManager.getCanvas(); + + this._textRenderer.setText(this.label, ctx); + var w = this.getWidth(ctx); + var h = this.getHeight(ctx); + // canvases seem to need to have width and heigh attributes directly set. + elem.width = w; + elem.height = h; + elem.style.width = w; + elem.style.height = h; + elem.style.textAlign = 'left'; + elem.style.position = 'absolute'; + + elem = plot.canvasManager.initCanvas(elem); + + this._elem = $(elem); + this._elem.css(this._styles); + this._elem.addClass('jqplot-'+this.axis+'-tick'); + + elem = null; + return this._elem; + }; + + $.jqplot.CanvasAxisTickRenderer.prototype.pack = function() { + this._textRenderer.draw(this._elem.get(0).getContext("2d"), this.label); + }; + +})(jQuery); \ No newline at end of file diff --git a/www/protected/extensions/jqplot/plugins/jqplot.canvasAxisTickRenderer.min.js b/www/protected/extensions/jqplot/plugins/jqplot.canvasAxisTickRenderer.min.js new file mode 100644 index 0000000..66d0219 --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.canvasAxisTickRenderer.min.js @@ -0,0 +1,57 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + * included jsDate library by Chris Leonello: + * + * Copyright (c) 2010-2011 Chris Leonello + * + * jsDate is currently available for use in all personal or commercial projects + * under both the MIT and GPL version 2.0 licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * jsDate borrows many concepts and ideas from the Date Instance + * Methods by Ken Snyder along with some parts of Ken's actual code. + * + * Ken's origianl Date Instance Methods and copyright notice: + * + * Ken Snyder (ken d snyder at gmail dot com) + * 2008-09-10 + * version 2.0.2 (http://kendsnyder.com/sandbox/date/) + * Creative Commons Attribution License 3.0 (http://creativecommons.org/licenses/by/3.0/) + * + * jqplotToImage function based on Larry Siden's export-jqplot-to-png.js. + * Larry has generously given permission to adapt his code for inclusion + * into jqPlot. + * + * Larry's original code can be found here: + * + * https://github.com/lsiden/export-jqplot-to-png + * + * + */ +(function(a){a.jqplot.CanvasAxisTickRenderer=function(b){this.mark="outside";this.showMark=true;this.showGridline=true;this.isMinorTick=false;this.angle=0;this.markSize=4;this.show=true;this.showLabel=true;this.labelPosition="auto";this.label="";this.value=null;this._styles={};this.formatter=a.jqplot.DefaultTickFormatter;this.formatString="";this.prefix="";this.fontFamily='"Trebuchet MS", Arial, Helvetica, sans-serif';this.fontSize="10pt";this.fontWeight="normal";this.fontStretch=1;this.textColor="#666666";this.enableFontSupport=true;this.pt2px=null;this._elem;this._ctx;this._plotWidth;this._plotHeight;this._plotDimensions={height:null,width:null};a.extend(true,this,b);var c={fontSize:this.fontSize,fontWeight:this.fontWeight,fontStretch:this.fontStretch,fillStyle:this.textColor,angle:this.getAngleRad(),fontFamily:this.fontFamily};if(this.pt2px){c.pt2px=this.pt2px}if(this.enableFontSupport){if(a.jqplot.support_canvas_text()){this._textRenderer=new a.jqplot.CanvasFontRenderer(c)}else{this._textRenderer=new a.jqplot.CanvasTextRenderer(c)}}else{this._textRenderer=new a.jqplot.CanvasTextRenderer(c)}};a.jqplot.CanvasAxisTickRenderer.prototype.init=function(b){a.extend(true,this,b);this._textRenderer.init({fontSize:this.fontSize,fontWeight:this.fontWeight,fontStretch:this.fontStretch,fillStyle:this.textColor,angle:this.getAngleRad(),fontFamily:this.fontFamily})};a.jqplot.CanvasAxisTickRenderer.prototype.getWidth=function(d){if(this._elem){return this._elem.outerWidth(true)}else{var f=this._textRenderer;var c=f.getWidth(d);var e=f.getHeight(d);var b=Math.abs(Math.sin(f.angle)*e)+Math.abs(Math.cos(f.angle)*c);return b}};a.jqplot.CanvasAxisTickRenderer.prototype.getHeight=function(d){if(this._elem){return this._elem.outerHeight(true)}else{var f=this._textRenderer;var c=f.getWidth(d);var e=f.getHeight(d);var b=Math.abs(Math.cos(f.angle)*e)+Math.abs(Math.sin(f.angle)*c);return b}};a.jqplot.CanvasAxisTickRenderer.prototype.getAngleRad=function(){var b=this.angle*Math.PI/180;return b};a.jqplot.CanvasAxisTickRenderer.prototype.setTick=function(b,d,c){this.value=b;if(c){this.isMinorTick=true}return this};a.jqplot.CanvasAxisTickRenderer.prototype.draw=function(c,f){if(!this.label){this.label=this.prefix+this.formatter(this.formatString,this.value)}if(this._elem){if(a.jqplot.use_excanvas&&window.G_vmlCanvasManager.uninitElement!==undefined){window.G_vmlCanvasManager.uninitElement(this._elem.get(0))}this._elem.emptyForce();this._elem=null}var e=f.canvasManager.getCanvas();this._textRenderer.setText(this.label,c);var b=this.getWidth(c);var d=this.getHeight(c);e.width=b;e.height=d;e.style.width=b;e.style.height=d;e.style.textAlign="left";e.style.position="absolute";e=f.canvasManager.initCanvas(e);this._elem=a(e);this._elem.css(this._styles);this._elem.addClass("jqplot-"+this.axis+"-tick");e=null;return this._elem};a.jqplot.CanvasAxisTickRenderer.prototype.pack=function(){this._textRenderer.draw(this._elem.get(0).getContext("2d"),this.label)}})(jQuery); \ No newline at end of file diff --git a/www/protected/extensions/jqplot/plugins/jqplot.canvasTextRenderer.js b/www/protected/extensions/jqplot/plugins/jqplot.canvasTextRenderer.js new file mode 100644 index 0000000..9e90c8c --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.canvasTextRenderer.js @@ -0,0 +1,448 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + * included jsDate library by Chris Leonello: + * + * Copyright (c) 2010-2011 Chris Leonello + * + * jsDate is currently available for use in all personal or commercial projects + * under both the MIT and GPL version 2.0 licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * jsDate borrows many concepts and ideas from the Date Instance + * Methods by Ken Snyder along with some parts of Ken's actual code. + * + * Ken's origianl Date Instance Methods and copyright notice: + * + * Ken Snyder (ken d snyder at gmail dot com) + * 2008-09-10 + * version 2.0.2 (http://kendsnyder.com/sandbox/date/) + * Creative Commons Attribution License 3.0 (http://creativecommons.org/licenses/by/3.0/) + * + * jqplotToImage function based on Larry Siden's export-jqplot-to-png.js. + * Larry has generously given permission to adapt his code for inclusion + * into jqPlot. + * + * Larry's original code can be found here: + * + * https://github.com/lsiden/export-jqplot-to-png + * + * + */ + +(function($) { + // This code is a modified version of the canvastext.js code, copyright below: + // + // This code is released to the public domain by Jim Studt, 2007. + // He may keep some sort of up to date copy at http://www.federated.com/~jim/canvastext/ + // + $.jqplot.CanvasTextRenderer = function(options){ + this.fontStyle = 'normal'; // normal, italic, oblique [not implemented] + this.fontVariant = 'normal'; // normal, small caps [not implemented] + this.fontWeight = 'normal'; // normal, bold, bolder, lighter, 100 - 900 + this.fontSize = '10px'; + this.fontFamily = 'sans-serif'; + this.fontStretch = 1.0; + this.fillStyle = '#666666'; + this.angle = 0; + this.textAlign = 'start'; + this.textBaseline = 'alphabetic'; + this.text; + this.width; + this.height; + this.pt2px = 1.28; + + $.extend(true, this, options); + this.normalizedFontSize = this.normalizeFontSize(this.fontSize); + this.setHeight(); + }; + + $.jqplot.CanvasTextRenderer.prototype.init = function(options) { + $.extend(true, this, options); + this.normalizedFontSize = this.normalizeFontSize(this.fontSize); + this.setHeight(); + }; + + // convert css spec into point size + // returns float + $.jqplot.CanvasTextRenderer.prototype.normalizeFontSize = function(sz) { + sz = String(sz); + var n = parseFloat(sz); + if (sz.indexOf('px') > -1) { + return n/this.pt2px; + } + else if (sz.indexOf('pt') > -1) { + return n; + } + else if (sz.indexOf('em') > -1) { + return n*12; + } + else if (sz.indexOf('%') > -1) { + return n*12/100; + } + // default to pixels; + else { + return n/this.pt2px; + } + }; + + + $.jqplot.CanvasTextRenderer.prototype.fontWeight2Float = function(w) { + // w = normal | bold | bolder | lighter | 100 | 200 | 300 | 400 | 500 | 600 | 700 | 800 | 900 + // return values adjusted for Hershey font. + if (Number(w)) { + return w/400; + } + else { + switch (w) { + case 'normal': + return 1; + break; + case 'bold': + return 1.75; + break; + case 'bolder': + return 2.25; + break; + case 'lighter': + return 0.75; + break; + default: + return 1; + break; + } + } + }; + + $.jqplot.CanvasTextRenderer.prototype.getText = function() { + return this.text; + }; + + $.jqplot.CanvasTextRenderer.prototype.setText = function(t, ctx) { + this.text = t; + this.setWidth(ctx); + return this; + }; + + $.jqplot.CanvasTextRenderer.prototype.getWidth = function(ctx) { + return this.width; + }; + + $.jqplot.CanvasTextRenderer.prototype.setWidth = function(ctx, w) { + if (!w) { + this.width = this.measure(ctx, this.text); + } + else { + this.width = w; + } + return this; + }; + + // return height in pixels. + $.jqplot.CanvasTextRenderer.prototype.getHeight = function(ctx) { + return this.height; + }; + + // w - height in pt + // set heigh in px + $.jqplot.CanvasTextRenderer.prototype.setHeight = function(w) { + if (!w) { + //height = this.fontSize /0.75; + this.height = this.normalizedFontSize * this.pt2px; + } + else { + this.height = w; + } + return this; + }; + + $.jqplot.CanvasTextRenderer.prototype.letter = function (ch) + { + return this.letters[ch]; + }; + + $.jqplot.CanvasTextRenderer.prototype.ascent = function() + { + return this.normalizedFontSize; + }; + + $.jqplot.CanvasTextRenderer.prototype.descent = function() + { + return 7.0*this.normalizedFontSize/25.0; + }; + + $.jqplot.CanvasTextRenderer.prototype.measure = function(ctx, str) + { + var total = 0; + var len = str.length; + + for (var i = 0; i < len; i++) { + var c = this.letter(str.charAt(i)); + if (c) { + total += c.width * this.normalizedFontSize / 25.0 * this.fontStretch; + } + } + return total; + }; + + $.jqplot.CanvasTextRenderer.prototype.draw = function(ctx,str) + { + var x = 0; + // leave room at bottom for descenders. + var y = this.height*0.72; + var total = 0; + var len = str.length; + var mag = this.normalizedFontSize / 25.0; + + ctx.save(); + var tx, ty; + + // 1st quadrant + if ((-Math.PI/2 <= this.angle && this.angle <= 0) || (Math.PI*3/2 <= this.angle && this.angle <= Math.PI*2)) { + tx = 0; + ty = -Math.sin(this.angle) * this.width; + } + // 4th quadrant + else if ((0 < this.angle && this.angle <= Math.PI/2) || (-Math.PI*2 <= this.angle && this.angle <= -Math.PI*3/2)) { + tx = Math.sin(this.angle) * this.height; + ty = 0; + } + // 2nd quadrant + else if ((-Math.PI < this.angle && this.angle < -Math.PI/2) || (Math.PI <= this.angle && this.angle <= Math.PI*3/2)) { + tx = -Math.cos(this.angle) * this.width; + ty = -Math.sin(this.angle) * this.width - Math.cos(this.angle) * this.height; + } + // 3rd quadrant + else if ((-Math.PI*3/2 < this.angle && this.angle < Math.PI) || (Math.PI/2 < this.angle && this.angle < Math.PI)) { + tx = Math.sin(this.angle) * this.height - Math.cos(this.angle)*this.width; + ty = -Math.cos(this.angle) * this.height; + } + + ctx.strokeStyle = this.fillStyle; + ctx.fillStyle = this.fillStyle; + ctx.translate(tx, ty); + ctx.rotate(this.angle); + ctx.lineCap = "round"; + // multiplier was 2.0 + var fact = (this.normalizedFontSize > 30) ? 2.0 : 2 + (30 - this.normalizedFontSize)/20; + ctx.lineWidth = fact * mag * this.fontWeight2Float(this.fontWeight); + + for ( var i = 0; i < len; i++) { + var c = this.letter( str.charAt(i)); + if ( !c) { + continue; + } + + ctx.beginPath(); + + var penUp = 1; + var needStroke = 0; + for ( var j = 0; j < c.points.length; j++) { + var a = c.points[j]; + if ( a[0] == -1 && a[1] == -1) { + penUp = 1; + continue; + } + if ( penUp) { + ctx.moveTo( x + a[0]*mag*this.fontStretch, y - a[1]*mag); + penUp = false; + } else { + ctx.lineTo( x + a[0]*mag*this.fontStretch, y - a[1]*mag); + } + } + ctx.stroke(); + x += c.width*mag*this.fontStretch; + } + ctx.restore(); + return total; + }; + + $.jqplot.CanvasTextRenderer.prototype.letters = { + ' ': { width: 16, points: [] }, + '!': { width: 10, points: [[5,21],[5,7],[-1,-1],[5,2],[4,1],[5,0],[6,1],[5,2]] }, + '"': { width: 16, points: [[4,21],[4,14],[-1,-1],[12,21],[12,14]] }, + '#': { width: 21, points: [[11,25],[4,-7],[-1,-1],[17,25],[10,-7],[-1,-1],[4,12],[18,12],[-1,-1],[3,6],[17,6]] }, + '$': { width: 20, points: [[8,25],[8,-4],[-1,-1],[12,25],[12,-4],[-1,-1],[17,18],[15,20],[12,21],[8,21],[5,20],[3,18],[3,16],[4,14],[5,13],[7,12],[13,10],[15,9],[16,8],[17,6],[17,3],[15,1],[12,0],[8,0],[5,1],[3,3]] }, + '%': { width: 24, points: [[21,21],[3,0],[-1,-1],[8,21],[10,19],[10,17],[9,15],[7,14],[5,14],[3,16],[3,18],[4,20],[6,21],[8,21],[10,20],[13,19],[16,19],[19,20],[21,21],[-1,-1],[17,7],[15,6],[14,4],[14,2],[16,0],[18,0],[20,1],[21,3],[21,5],[19,7],[17,7]] }, + '&': { width: 26, points: [[23,12],[23,13],[22,14],[21,14],[20,13],[19,11],[17,6],[15,3],[13,1],[11,0],[7,0],[5,1],[4,2],[3,4],[3,6],[4,8],[5,9],[12,13],[13,14],[14,16],[14,18],[13,20],[11,21],[9,20],[8,18],[8,16],[9,13],[11,10],[16,3],[18,1],[20,0],[22,0],[23,1],[23,2]] }, + '\'': { width: 10, points: [[5,19],[4,20],[5,21],[6,20],[6,18],[5,16],[4,15]] }, + '(': { width: 14, points: [[11,25],[9,23],[7,20],[5,16],[4,11],[4,7],[5,2],[7,-2],[9,-5],[11,-7]] }, + ')': { width: 14, points: [[3,25],[5,23],[7,20],[9,16],[10,11],[10,7],[9,2],[7,-2],[5,-5],[3,-7]] }, + '*': { width: 16, points: [[8,21],[8,9],[-1,-1],[3,18],[13,12],[-1,-1],[13,18],[3,12]] }, + '+': { width: 26, points: [[13,18],[13,0],[-1,-1],[4,9],[22,9]] }, + ',': { width: 10, points: [[6,1],[5,0],[4,1],[5,2],[6,1],[6,-1],[5,-3],[4,-4]] }, + '-': { width: 18, points: [[6,9],[12,9]] }, + '.': { width: 10, points: [[5,2],[4,1],[5,0],[6,1],[5,2]] }, + '/': { width: 22, points: [[20,25],[2,-7]] }, + '0': { width: 20, points: [[9,21],[6,20],[4,17],[3,12],[3,9],[4,4],[6,1],[9,0],[11,0],[14,1],[16,4],[17,9],[17,12],[16,17],[14,20],[11,21],[9,21]] }, + '1': { width: 20, points: [[6,17],[8,18],[11,21],[11,0]] }, + '2': { width: 20, points: [[4,16],[4,17],[5,19],[6,20],[8,21],[12,21],[14,20],[15,19],[16,17],[16,15],[15,13],[13,10],[3,0],[17,0]] }, + '3': { width: 20, points: [[5,21],[16,21],[10,13],[13,13],[15,12],[16,11],[17,8],[17,6],[16,3],[14,1],[11,0],[8,0],[5,1],[4,2],[3,4]] }, + '4': { width: 20, points: [[13,21],[3,7],[18,7],[-1,-1],[13,21],[13,0]] }, + '5': { width: 20, points: [[15,21],[5,21],[4,12],[5,13],[8,14],[11,14],[14,13],[16,11],[17,8],[17,6],[16,3],[14,1],[11,0],[8,0],[5,1],[4,2],[3,4]] }, + '6': { width: 20, points: [[16,18],[15,20],[12,21],[10,21],[7,20],[5,17],[4,12],[4,7],[5,3],[7,1],[10,0],[11,0],[14,1],[16,3],[17,6],[17,7],[16,10],[14,12],[11,13],[10,13],[7,12],[5,10],[4,7]] }, + '7': { width: 20, points: [[17,21],[7,0],[-1,-1],[3,21],[17,21]] }, + '8': { width: 20, points: [[8,21],[5,20],[4,18],[4,16],[5,14],[7,13],[11,12],[14,11],[16,9],[17,7],[17,4],[16,2],[15,1],[12,0],[8,0],[5,1],[4,2],[3,4],[3,7],[4,9],[6,11],[9,12],[13,13],[15,14],[16,16],[16,18],[15,20],[12,21],[8,21]] }, + '9': { width: 20, points: [[16,14],[15,11],[13,9],[10,8],[9,8],[6,9],[4,11],[3,14],[3,15],[4,18],[6,20],[9,21],[10,21],[13,20],[15,18],[16,14],[16,9],[15,4],[13,1],[10,0],[8,0],[5,1],[4,3]] }, + ':': { width: 10, points: [[5,14],[4,13],[5,12],[6,13],[5,14],[-1,-1],[5,2],[4,1],[5,0],[6,1],[5,2]] }, + ';': { width: 10, points: [[5,14],[4,13],[5,12],[6,13],[5,14],[-1,-1],[6,1],[5,0],[4,1],[5,2],[6,1],[6,-1],[5,-3],[4,-4]] }, + '<': { width: 24, points: [[20,18],[4,9],[20,0]] }, + '=': { width: 26, points: [[4,12],[22,12],[-1,-1],[4,6],[22,6]] }, + '>': { width: 24, points: [[4,18],[20,9],[4,0]] }, + '?': { width: 18, points: [[3,16],[3,17],[4,19],[5,20],[7,21],[11,21],[13,20],[14,19],[15,17],[15,15],[14,13],[13,12],[9,10],[9,7],[-1,-1],[9,2],[8,1],[9,0],[10,1],[9,2]] }, + '@': { width: 27, points: [[18,13],[17,15],[15,16],[12,16],[10,15],[9,14],[8,11],[8,8],[9,6],[11,5],[14,5],[16,6],[17,8],[-1,-1],[12,16],[10,14],[9,11],[9,8],[10,6],[11,5],[-1,-1],[18,16],[17,8],[17,6],[19,5],[21,5],[23,7],[24,10],[24,12],[23,15],[22,17],[20,19],[18,20],[15,21],[12,21],[9,20],[7,19],[5,17],[4,15],[3,12],[3,9],[4,6],[5,4],[7,2],[9,1],[12,0],[15,0],[18,1],[20,2],[21,3],[-1,-1],[19,16],[18,8],[18,6],[19,5]] }, + 'A': { width: 18, points: [[9,21],[1,0],[-1,-1],[9,21],[17,0],[-1,-1],[4,7],[14,7]] }, + 'B': { width: 21, points: [[4,21],[4,0],[-1,-1],[4,21],[13,21],[16,20],[17,19],[18,17],[18,15],[17,13],[16,12],[13,11],[-1,-1],[4,11],[13,11],[16,10],[17,9],[18,7],[18,4],[17,2],[16,1],[13,0],[4,0]] }, + 'C': { width: 21, points: [[18,16],[17,18],[15,20],[13,21],[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5]] }, + 'D': { width: 21, points: [[4,21],[4,0],[-1,-1],[4,21],[11,21],[14,20],[16,18],[17,16],[18,13],[18,8],[17,5],[16,3],[14,1],[11,0],[4,0]] }, + 'E': { width: 19, points: [[4,21],[4,0],[-1,-1],[4,21],[17,21],[-1,-1],[4,11],[12,11],[-1,-1],[4,0],[17,0]] }, + 'F': { width: 18, points: [[4,21],[4,0],[-1,-1],[4,21],[17,21],[-1,-1],[4,11],[12,11]] }, + 'G': { width: 21, points: [[18,16],[17,18],[15,20],[13,21],[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[18,8],[-1,-1],[13,8],[18,8]] }, + 'H': { width: 22, points: [[4,21],[4,0],[-1,-1],[18,21],[18,0],[-1,-1],[4,11],[18,11]] }, + 'I': { width: 8, points: [[4,21],[4,0]] }, + 'J': { width: 16, points: [[12,21],[12,5],[11,2],[10,1],[8,0],[6,0],[4,1],[3,2],[2,5],[2,7]] }, + 'K': { width: 21, points: [[4,21],[4,0],[-1,-1],[18,21],[4,7],[-1,-1],[9,12],[18,0]] }, + 'L': { width: 17, points: [[4,21],[4,0],[-1,-1],[4,0],[16,0]] }, + 'M': { width: 24, points: [[4,21],[4,0],[-1,-1],[4,21],[12,0],[-1,-1],[20,21],[12,0],[-1,-1],[20,21],[20,0]] }, + 'N': { width: 22, points: [[4,21],[4,0],[-1,-1],[4,21],[18,0],[-1,-1],[18,21],[18,0]] }, + 'O': { width: 22, points: [[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[19,8],[19,13],[18,16],[17,18],[15,20],[13,21],[9,21]] }, + 'P': { width: 21, points: [[4,21],[4,0],[-1,-1],[4,21],[13,21],[16,20],[17,19],[18,17],[18,14],[17,12],[16,11],[13,10],[4,10]] }, + 'Q': { width: 22, points: [[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[19,8],[19,13],[18,16],[17,18],[15,20],[13,21],[9,21],[-1,-1],[12,4],[18,-2]] }, + 'R': { width: 21, points: [[4,21],[4,0],[-1,-1],[4,21],[13,21],[16,20],[17,19],[18,17],[18,15],[17,13],[16,12],[13,11],[4,11],[-1,-1],[11,11],[18,0]] }, + 'S': { width: 20, points: [[17,18],[15,20],[12,21],[8,21],[5,20],[3,18],[3,16],[4,14],[5,13],[7,12],[13,10],[15,9],[16,8],[17,6],[17,3],[15,1],[12,0],[8,0],[5,1],[3,3]] }, + 'T': { width: 16, points: [[8,21],[8,0],[-1,-1],[1,21],[15,21]] }, + 'U': { width: 22, points: [[4,21],[4,6],[5,3],[7,1],[10,0],[12,0],[15,1],[17,3],[18,6],[18,21]] }, + 'V': { width: 18, points: [[1,21],[9,0],[-1,-1],[17,21],[9,0]] }, + 'W': { width: 24, points: [[2,21],[7,0],[-1,-1],[12,21],[7,0],[-1,-1],[12,21],[17,0],[-1,-1],[22,21],[17,0]] }, + 'X': { width: 20, points: [[3,21],[17,0],[-1,-1],[17,21],[3,0]] }, + 'Y': { width: 18, points: [[1,21],[9,11],[9,0],[-1,-1],[17,21],[9,11]] }, + 'Z': { width: 20, points: [[17,21],[3,0],[-1,-1],[3,21],[17,21],[-1,-1],[3,0],[17,0]] }, + '[': { width: 14, points: [[4,25],[4,-7],[-1,-1],[5,25],[5,-7],[-1,-1],[4,25],[11,25],[-1,-1],[4,-7],[11,-7]] }, + '\\': { width: 14, points: [[0,21],[14,-3]] }, + ']': { width: 14, points: [[9,25],[9,-7],[-1,-1],[10,25],[10,-7],[-1,-1],[3,25],[10,25],[-1,-1],[3,-7],[10,-7]] }, + '^': { width: 16, points: [[6,15],[8,18],[10,15],[-1,-1],[3,12],[8,17],[13,12],[-1,-1],[8,17],[8,0]] }, + '_': { width: 16, points: [[0,-2],[16,-2]] }, + '`': { width: 10, points: [[6,21],[5,20],[4,18],[4,16],[5,15],[6,16],[5,17]] }, + 'a': { width: 19, points: [[15,14],[15,0],[-1,-1],[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] }, + 'b': { width: 19, points: [[4,21],[4,0],[-1,-1],[4,11],[6,13],[8,14],[11,14],[13,13],[15,11],[16,8],[16,6],[15,3],[13,1],[11,0],[8,0],[6,1],[4,3]] }, + 'c': { width: 18, points: [[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] }, + 'd': { width: 19, points: [[15,21],[15,0],[-1,-1],[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] }, + 'e': { width: 18, points: [[3,8],[15,8],[15,10],[14,12],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] }, + 'f': { width: 12, points: [[10,21],[8,21],[6,20],[5,17],[5,0],[-1,-1],[2,14],[9,14]] }, + 'g': { width: 19, points: [[15,14],[15,-2],[14,-5],[13,-6],[11,-7],[8,-7],[6,-6],[-1,-1],[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] }, + 'h': { width: 19, points: [[4,21],[4,0],[-1,-1],[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0]] }, + 'i': { width: 8, points: [[3,21],[4,20],[5,21],[4,22],[3,21],[-1,-1],[4,14],[4,0]] }, + 'j': { width: 10, points: [[5,21],[6,20],[7,21],[6,22],[5,21],[-1,-1],[6,14],[6,-3],[5,-6],[3,-7],[1,-7]] }, + 'k': { width: 17, points: [[4,21],[4,0],[-1,-1],[14,14],[4,4],[-1,-1],[8,8],[15,0]] }, + 'l': { width: 8, points: [[4,21],[4,0]] }, + 'm': { width: 30, points: [[4,14],[4,0],[-1,-1],[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0],[-1,-1],[15,10],[18,13],[20,14],[23,14],[25,13],[26,10],[26,0]] }, + 'n': { width: 19, points: [[4,14],[4,0],[-1,-1],[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0]] }, + 'o': { width: 19, points: [[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3],[16,6],[16,8],[15,11],[13,13],[11,14],[8,14]] }, + 'p': { width: 19, points: [[4,14],[4,-7],[-1,-1],[4,11],[6,13],[8,14],[11,14],[13,13],[15,11],[16,8],[16,6],[15,3],[13,1],[11,0],[8,0],[6,1],[4,3]] }, + 'q': { width: 19, points: [[15,14],[15,-7],[-1,-1],[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] }, + 'r': { width: 13, points: [[4,14],[4,0],[-1,-1],[4,8],[5,11],[7,13],[9,14],[12,14]] }, + 's': { width: 17, points: [[14,11],[13,13],[10,14],[7,14],[4,13],[3,11],[4,9],[6,8],[11,7],[13,6],[14,4],[14,3],[13,1],[10,0],[7,0],[4,1],[3,3]] }, + 't': { width: 12, points: [[5,21],[5,4],[6,1],[8,0],[10,0],[-1,-1],[2,14],[9,14]] }, + 'u': { width: 19, points: [[4,14],[4,4],[5,1],[7,0],[10,0],[12,1],[15,4],[-1,-1],[15,14],[15,0]] }, + 'v': { width: 16, points: [[2,14],[8,0],[-1,-1],[14,14],[8,0]] }, + 'w': { width: 22, points: [[3,14],[7,0],[-1,-1],[11,14],[7,0],[-1,-1],[11,14],[15,0],[-1,-1],[19,14],[15,0]] }, + 'x': { width: 17, points: [[3,14],[14,0],[-1,-1],[14,14],[3,0]] }, + 'y': { width: 16, points: [[2,14],[8,0],[-1,-1],[14,14],[8,0],[6,-4],[4,-6],[2,-7],[1,-7]] }, + 'z': { width: 17, points: [[14,14],[3,0],[-1,-1],[3,14],[14,14],[-1,-1],[3,0],[14,0]] }, + '{': { width: 14, points: [[9,25],[7,24],[6,23],[5,21],[5,19],[6,17],[7,16],[8,14],[8,12],[6,10],[-1,-1],[7,24],[6,22],[6,20],[7,18],[8,17],[9,15],[9,13],[8,11],[4,9],[8,7],[9,5],[9,3],[8,1],[7,0],[6,-2],[6,-4],[7,-6],[-1,-1],[6,8],[8,6],[8,4],[7,2],[6,1],[5,-1],[5,-3],[6,-5],[7,-6],[9,-7]] }, + '|': { width: 8, points: [[4,25],[4,-7]] }, + '}': { width: 14, points: [[5,25],[7,24],[8,23],[9,21],[9,19],[8,17],[7,16],[6,14],[6,12],[8,10],[-1,-1],[7,24],[8,22],[8,20],[7,18],[6,17],[5,15],[5,13],[6,11],[10,9],[6,7],[5,5],[5,3],[6,1],[7,0],[8,-2],[8,-4],[7,-6],[-1,-1],[8,8],[6,6],[6,4],[7,2],[8,1],[9,-1],[9,-3],[8,-5],[7,-6],[5,-7]] }, + '~': { width: 24, points: [[3,6],[3,8],[4,11],[6,12],[8,12],[10,11],[14,8],[16,7],[18,7],[20,8],[21,10],[-1,-1],[3,8],[4,10],[6,11],[8,11],[10,10],[14,7],[16,6],[18,6],[20,7],[21,10],[21,12]] } + }; + + $.jqplot.CanvasFontRenderer = function(options) { + options = options || {}; + if (!options.pt2px) { + options.pt2px = 1.5; + } + $.jqplot.CanvasTextRenderer.call(this, options); + }; + + $.jqplot.CanvasFontRenderer.prototype = new $.jqplot.CanvasTextRenderer({}); + $.jqplot.CanvasFontRenderer.prototype.constructor = $.jqplot.CanvasFontRenderer; + + $.jqplot.CanvasFontRenderer.prototype.measure = function(ctx, str) + { + // var fstyle = this.fontStyle+' '+this.fontVariant+' '+this.fontWeight+' '+this.fontSize+' '+this.fontFamily; + var fstyle = this.fontSize+' '+this.fontFamily; + ctx.save(); + ctx.font = fstyle; + var w = ctx.measureText(str).width; + ctx.restore(); + return w; + }; + + $.jqplot.CanvasFontRenderer.prototype.draw = function(ctx, str) + { + var x = 0; + // leave room at bottom for descenders. + var y = this.height*0.72; + //var y = 12; + + ctx.save(); + var tx, ty; + + // 1st quadrant + if ((-Math.PI/2 <= this.angle && this.angle <= 0) || (Math.PI*3/2 <= this.angle && this.angle <= Math.PI*2)) { + tx = 0; + ty = -Math.sin(this.angle) * this.width; + } + // 4th quadrant + else if ((0 < this.angle && this.angle <= Math.PI/2) || (-Math.PI*2 <= this.angle && this.angle <= -Math.PI*3/2)) { + tx = Math.sin(this.angle) * this.height; + ty = 0; + } + // 2nd quadrant + else if ((-Math.PI < this.angle && this.angle < -Math.PI/2) || (Math.PI <= this.angle && this.angle <= Math.PI*3/2)) { + tx = -Math.cos(this.angle) * this.width; + ty = -Math.sin(this.angle) * this.width - Math.cos(this.angle) * this.height; + } + // 3rd quadrant + else if ((-Math.PI*3/2 < this.angle && this.angle < Math.PI) || (Math.PI/2 < this.angle && this.angle < Math.PI)) { + tx = Math.sin(this.angle) * this.height - Math.cos(this.angle)*this.width; + ty = -Math.cos(this.angle) * this.height; + } + ctx.strokeStyle = this.fillStyle; + ctx.fillStyle = this.fillStyle; + // var fstyle = this.fontStyle+' '+this.fontVariant+' '+this.fontWeight+' '+this.fontSize+' '+this.fontFamily; + var fstyle = this.fontSize+' '+this.fontFamily; + ctx.font = fstyle; + ctx.translate(tx, ty); + ctx.rotate(this.angle); + ctx.fillText(str, x, y); + // ctx.strokeText(str, x, y); + + ctx.restore(); + }; + +})(jQuery); \ No newline at end of file diff --git a/www/protected/extensions/jqplot/plugins/jqplot.canvasTextRenderer.min.js b/www/protected/extensions/jqplot/plugins/jqplot.canvasTextRenderer.min.js new file mode 100644 index 0000000..a1ee0fd --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.canvasTextRenderer.min.js @@ -0,0 +1,57 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + * included jsDate library by Chris Leonello: + * + * Copyright (c) 2010-2011 Chris Leonello + * + * jsDate is currently available for use in all personal or commercial projects + * under both the MIT and GPL version 2.0 licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * jsDate borrows many concepts and ideas from the Date Instance + * Methods by Ken Snyder along with some parts of Ken's actual code. + * + * Ken's origianl Date Instance Methods and copyright notice: + * + * Ken Snyder (ken d snyder at gmail dot com) + * 2008-09-10 + * version 2.0.2 (http://kendsnyder.com/sandbox/date/) + * Creative Commons Attribution License 3.0 (http://creativecommons.org/licenses/by/3.0/) + * + * jqplotToImage function based on Larry Siden's export-jqplot-to-png.js. + * Larry has generously given permission to adapt his code for inclusion + * into jqPlot. + * + * Larry's original code can be found here: + * + * https://github.com/lsiden/export-jqplot-to-png + * + * + */ +(function(a){a.jqplot.CanvasTextRenderer=function(b){this.fontStyle="normal";this.fontVariant="normal";this.fontWeight="normal";this.fontSize="10px";this.fontFamily="sans-serif";this.fontStretch=1;this.fillStyle="#666666";this.angle=0;this.textAlign="start";this.textBaseline="alphabetic";this.text;this.width;this.height;this.pt2px=1.28;a.extend(true,this,b);this.normalizedFontSize=this.normalizeFontSize(this.fontSize);this.setHeight()};a.jqplot.CanvasTextRenderer.prototype.init=function(b){a.extend(true,this,b);this.normalizedFontSize=this.normalizeFontSize(this.fontSize);this.setHeight()};a.jqplot.CanvasTextRenderer.prototype.normalizeFontSize=function(b){b=String(b);var c=parseFloat(b);if(b.indexOf("px")>-1){return c/this.pt2px}else{if(b.indexOf("pt")>-1){return c}else{if(b.indexOf("em")>-1){return c*12}else{if(b.indexOf("%")>-1){return c*12/100}else{return c/this.pt2px}}}}};a.jqplot.CanvasTextRenderer.prototype.fontWeight2Float=function(b){if(Number(b)){return b/400}else{switch(b){case"normal":return 1;break;case"bold":return 1.75;break;case"bolder":return 2.25;break;case"lighter":return 0.75;break;default:return 1;break}}};a.jqplot.CanvasTextRenderer.prototype.getText=function(){return this.text};a.jqplot.CanvasTextRenderer.prototype.setText=function(c,b){this.text=c;this.setWidth(b);return this};a.jqplot.CanvasTextRenderer.prototype.getWidth=function(b){return this.width};a.jqplot.CanvasTextRenderer.prototype.setWidth=function(c,b){if(!b){this.width=this.measure(c,this.text)}else{this.width=b}return this};a.jqplot.CanvasTextRenderer.prototype.getHeight=function(b){return this.height};a.jqplot.CanvasTextRenderer.prototype.setHeight=function(b){if(!b){this.height=this.normalizedFontSize*this.pt2px}else{this.height=b}return this};a.jqplot.CanvasTextRenderer.prototype.letter=function(b){return this.letters[b]};a.jqplot.CanvasTextRenderer.prototype.ascent=function(){return this.normalizedFontSize};a.jqplot.CanvasTextRenderer.prototype.descent=function(){return 7*this.normalizedFontSize/25};a.jqplot.CanvasTextRenderer.prototype.measure=function(d,g){var f=0;var b=g.length;for(var e=0;e<b;e++){var h=this.letter(g.charAt(e));if(h){f+=h.width*this.normalizedFontSize/25*this.fontStretch}}return f};a.jqplot.CanvasTextRenderer.prototype.draw=function(s,n){var r=0;var o=this.height*0.72;var p=0;var l=n.length;var k=this.normalizedFontSize/25;s.save();var h,f;if((-Math.PI/2<=this.angle&&this.angle<=0)||(Math.PI*3/2<=this.angle&&this.angle<=Math.PI*2)){h=0;f=-Math.sin(this.angle)*this.width}else{if((0<this.angle&&this.angle<=Math.PI/2)||(-Math.PI*2<=this.angle&&this.angle<=-Math.PI*3/2)){h=Math.sin(this.angle)*this.height;f=0}else{if((-Math.PI<this.angle&&this.angle<-Math.PI/2)||(Math.PI<=this.angle&&this.angle<=Math.PI*3/2)){h=-Math.cos(this.angle)*this.width;f=-Math.sin(this.angle)*this.width-Math.cos(this.angle)*this.height}else{if((-Math.PI*3/2<this.angle&&this.angle<Math.PI)||(Math.PI/2<this.angle&&this.angle<Math.PI)){h=Math.sin(this.angle)*this.height-Math.cos(this.angle)*this.width;f=-Math.cos(this.angle)*this.height}}}}s.strokeStyle=this.fillStyle;s.fillStyle=this.fillStyle;s.translate(h,f);s.rotate(this.angle);s.lineCap="round";var t=(this.normalizedFontSize>30)?2:2+(30-this.normalizedFontSize)/20;s.lineWidth=t*k*this.fontWeight2Float(this.fontWeight);for(var g=0;g<l;g++){var m=this.letter(n.charAt(g));if(!m){continue}s.beginPath();var e=1;var b=0;for(var d=0;d<m.points.length;d++){var q=m.points[d];if(q[0]==-1&&q[1]==-1){e=1;continue}if(e){s.moveTo(r+q[0]*k*this.fontStretch,o-q[1]*k);e=false}else{s.lineTo(r+q[0]*k*this.fontStretch,o-q[1]*k)}}s.stroke();r+=m.width*k*this.fontStretch}s.restore();return p};a.jqplot.CanvasTextRenderer.prototype.letters={" ":{width:16,points:[]},"!":{width:10,points:[[5,21],[5,7],[-1,-1],[5,2],[4,1],[5,0],[6,1],[5,2]]},'"':{width:16,points:[[4,21],[4,14],[-1,-1],[12,21],[12,14]]},"#":{width:21,points:[[11,25],[4,-7],[-1,-1],[17,25],[10,-7],[-1,-1],[4,12],[18,12],[-1,-1],[3,6],[17,6]]},"$":{width:20,points:[[8,25],[8,-4],[-1,-1],[12,25],[12,-4],[-1,-1],[17,18],[15,20],[12,21],[8,21],[5,20],[3,18],[3,16],[4,14],[5,13],[7,12],[13,10],[15,9],[16,8],[17,6],[17,3],[15,1],[12,0],[8,0],[5,1],[3,3]]},"%":{width:24,points:[[21,21],[3,0],[-1,-1],[8,21],[10,19],[10,17],[9,15],[7,14],[5,14],[3,16],[3,18],[4,20],[6,21],[8,21],[10,20],[13,19],[16,19],[19,20],[21,21],[-1,-1],[17,7],[15,6],[14,4],[14,2],[16,0],[18,0],[20,1],[21,3],[21,5],[19,7],[17,7]]},"&":{width:26,points:[[23,12],[23,13],[22,14],[21,14],[20,13],[19,11],[17,6],[15,3],[13,1],[11,0],[7,0],[5,1],[4,2],[3,4],[3,6],[4,8],[5,9],[12,13],[13,14],[14,16],[14,18],[13,20],[11,21],[9,20],[8,18],[8,16],[9,13],[11,10],[16,3],[18,1],[20,0],[22,0],[23,1],[23,2]]},"'":{width:10,points:[[5,19],[4,20],[5,21],[6,20],[6,18],[5,16],[4,15]]},"(":{width:14,points:[[11,25],[9,23],[7,20],[5,16],[4,11],[4,7],[5,2],[7,-2],[9,-5],[11,-7]]},")":{width:14,points:[[3,25],[5,23],[7,20],[9,16],[10,11],[10,7],[9,2],[7,-2],[5,-5],[3,-7]]},"*":{width:16,points:[[8,21],[8,9],[-1,-1],[3,18],[13,12],[-1,-1],[13,18],[3,12]]},"+":{width:26,points:[[13,18],[13,0],[-1,-1],[4,9],[22,9]]},",":{width:10,points:[[6,1],[5,0],[4,1],[5,2],[6,1],[6,-1],[5,-3],[4,-4]]},"-":{width:18,points:[[6,9],[12,9]]},".":{width:10,points:[[5,2],[4,1],[5,0],[6,1],[5,2]]},"/":{width:22,points:[[20,25],[2,-7]]},"0":{width:20,points:[[9,21],[6,20],[4,17],[3,12],[3,9],[4,4],[6,1],[9,0],[11,0],[14,1],[16,4],[17,9],[17,12],[16,17],[14,20],[11,21],[9,21]]},"1":{width:20,points:[[6,17],[8,18],[11,21],[11,0]]},"2":{width:20,points:[[4,16],[4,17],[5,19],[6,20],[8,21],[12,21],[14,20],[15,19],[16,17],[16,15],[15,13],[13,10],[3,0],[17,0]]},"3":{width:20,points:[[5,21],[16,21],[10,13],[13,13],[15,12],[16,11],[17,8],[17,6],[16,3],[14,1],[11,0],[8,0],[5,1],[4,2],[3,4]]},"4":{width:20,points:[[13,21],[3,7],[18,7],[-1,-1],[13,21],[13,0]]},"5":{width:20,points:[[15,21],[5,21],[4,12],[5,13],[8,14],[11,14],[14,13],[16,11],[17,8],[17,6],[16,3],[14,1],[11,0],[8,0],[5,1],[4,2],[3,4]]},"6":{width:20,points:[[16,18],[15,20],[12,21],[10,21],[7,20],[5,17],[4,12],[4,7],[5,3],[7,1],[10,0],[11,0],[14,1],[16,3],[17,6],[17,7],[16,10],[14,12],[11,13],[10,13],[7,12],[5,10],[4,7]]},"7":{width:20,points:[[17,21],[7,0],[-1,-1],[3,21],[17,21]]},"8":{width:20,points:[[8,21],[5,20],[4,18],[4,16],[5,14],[7,13],[11,12],[14,11],[16,9],[17,7],[17,4],[16,2],[15,1],[12,0],[8,0],[5,1],[4,2],[3,4],[3,7],[4,9],[6,11],[9,12],[13,13],[15,14],[16,16],[16,18],[15,20],[12,21],[8,21]]},"9":{width:20,points:[[16,14],[15,11],[13,9],[10,8],[9,8],[6,9],[4,11],[3,14],[3,15],[4,18],[6,20],[9,21],[10,21],[13,20],[15,18],[16,14],[16,9],[15,4],[13,1],[10,0],[8,0],[5,1],[4,3]]},":":{width:10,points:[[5,14],[4,13],[5,12],[6,13],[5,14],[-1,-1],[5,2],[4,1],[5,0],[6,1],[5,2]]},";":{width:10,points:[[5,14],[4,13],[5,12],[6,13],[5,14],[-1,-1],[6,1],[5,0],[4,1],[5,2],[6,1],[6,-1],[5,-3],[4,-4]]},"<":{width:24,points:[[20,18],[4,9],[20,0]]},"=":{width:26,points:[[4,12],[22,12],[-1,-1],[4,6],[22,6]]},">":{width:24,points:[[4,18],[20,9],[4,0]]},"?":{width:18,points:[[3,16],[3,17],[4,19],[5,20],[7,21],[11,21],[13,20],[14,19],[15,17],[15,15],[14,13],[13,12],[9,10],[9,7],[-1,-1],[9,2],[8,1],[9,0],[10,1],[9,2]]},"@":{width:27,points:[[18,13],[17,15],[15,16],[12,16],[10,15],[9,14],[8,11],[8,8],[9,6],[11,5],[14,5],[16,6],[17,8],[-1,-1],[12,16],[10,14],[9,11],[9,8],[10,6],[11,5],[-1,-1],[18,16],[17,8],[17,6],[19,5],[21,5],[23,7],[24,10],[24,12],[23,15],[22,17],[20,19],[18,20],[15,21],[12,21],[9,20],[7,19],[5,17],[4,15],[3,12],[3,9],[4,6],[5,4],[7,2],[9,1],[12,0],[15,0],[18,1],[20,2],[21,3],[-1,-1],[19,16],[18,8],[18,6],[19,5]]},A:{width:18,points:[[9,21],[1,0],[-1,-1],[9,21],[17,0],[-1,-1],[4,7],[14,7]]},B:{width:21,points:[[4,21],[4,0],[-1,-1],[4,21],[13,21],[16,20],[17,19],[18,17],[18,15],[17,13],[16,12],[13,11],[-1,-1],[4,11],[13,11],[16,10],[17,9],[18,7],[18,4],[17,2],[16,1],[13,0],[4,0]]},C:{width:21,points:[[18,16],[17,18],[15,20],[13,21],[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5]]},D:{width:21,points:[[4,21],[4,0],[-1,-1],[4,21],[11,21],[14,20],[16,18],[17,16],[18,13],[18,8],[17,5],[16,3],[14,1],[11,0],[4,0]]},E:{width:19,points:[[4,21],[4,0],[-1,-1],[4,21],[17,21],[-1,-1],[4,11],[12,11],[-1,-1],[4,0],[17,0]]},F:{width:18,points:[[4,21],[4,0],[-1,-1],[4,21],[17,21],[-1,-1],[4,11],[12,11]]},G:{width:21,points:[[18,16],[17,18],[15,20],[13,21],[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[18,8],[-1,-1],[13,8],[18,8]]},H:{width:22,points:[[4,21],[4,0],[-1,-1],[18,21],[18,0],[-1,-1],[4,11],[18,11]]},I:{width:8,points:[[4,21],[4,0]]},J:{width:16,points:[[12,21],[12,5],[11,2],[10,1],[8,0],[6,0],[4,1],[3,2],[2,5],[2,7]]},K:{width:21,points:[[4,21],[4,0],[-1,-1],[18,21],[4,7],[-1,-1],[9,12],[18,0]]},L:{width:17,points:[[4,21],[4,0],[-1,-1],[4,0],[16,0]]},M:{width:24,points:[[4,21],[4,0],[-1,-1],[4,21],[12,0],[-1,-1],[20,21],[12,0],[-1,-1],[20,21],[20,0]]},N:{width:22,points:[[4,21],[4,0],[-1,-1],[4,21],[18,0],[-1,-1],[18,21],[18,0]]},O:{width:22,points:[[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[19,8],[19,13],[18,16],[17,18],[15,20],[13,21],[9,21]]},P:{width:21,points:[[4,21],[4,0],[-1,-1],[4,21],[13,21],[16,20],[17,19],[18,17],[18,14],[17,12],[16,11],[13,10],[4,10]]},Q:{width:22,points:[[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[19,8],[19,13],[18,16],[17,18],[15,20],[13,21],[9,21],[-1,-1],[12,4],[18,-2]]},R:{width:21,points:[[4,21],[4,0],[-1,-1],[4,21],[13,21],[16,20],[17,19],[18,17],[18,15],[17,13],[16,12],[13,11],[4,11],[-1,-1],[11,11],[18,0]]},S:{width:20,points:[[17,18],[15,20],[12,21],[8,21],[5,20],[3,18],[3,16],[4,14],[5,13],[7,12],[13,10],[15,9],[16,8],[17,6],[17,3],[15,1],[12,0],[8,0],[5,1],[3,3]]},T:{width:16,points:[[8,21],[8,0],[-1,-1],[1,21],[15,21]]},U:{width:22,points:[[4,21],[4,6],[5,3],[7,1],[10,0],[12,0],[15,1],[17,3],[18,6],[18,21]]},V:{width:18,points:[[1,21],[9,0],[-1,-1],[17,21],[9,0]]},W:{width:24,points:[[2,21],[7,0],[-1,-1],[12,21],[7,0],[-1,-1],[12,21],[17,0],[-1,-1],[22,21],[17,0]]},X:{width:20,points:[[3,21],[17,0],[-1,-1],[17,21],[3,0]]},Y:{width:18,points:[[1,21],[9,11],[9,0],[-1,-1],[17,21],[9,11]]},Z:{width:20,points:[[17,21],[3,0],[-1,-1],[3,21],[17,21],[-1,-1],[3,0],[17,0]]},"[":{width:14,points:[[4,25],[4,-7],[-1,-1],[5,25],[5,-7],[-1,-1],[4,25],[11,25],[-1,-1],[4,-7],[11,-7]]},"\\":{width:14,points:[[0,21],[14,-3]]},"]":{width:14,points:[[9,25],[9,-7],[-1,-1],[10,25],[10,-7],[-1,-1],[3,25],[10,25],[-1,-1],[3,-7],[10,-7]]},"^":{width:16,points:[[6,15],[8,18],[10,15],[-1,-1],[3,12],[8,17],[13,12],[-1,-1],[8,17],[8,0]]},_:{width:16,points:[[0,-2],[16,-2]]},"`":{width:10,points:[[6,21],[5,20],[4,18],[4,16],[5,15],[6,16],[5,17]]},a:{width:19,points:[[15,14],[15,0],[-1,-1],[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]]},b:{width:19,points:[[4,21],[4,0],[-1,-1],[4,11],[6,13],[8,14],[11,14],[13,13],[15,11],[16,8],[16,6],[15,3],[13,1],[11,0],[8,0],[6,1],[4,3]]},c:{width:18,points:[[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]]},d:{width:19,points:[[15,21],[15,0],[-1,-1],[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]]},e:{width:18,points:[[3,8],[15,8],[15,10],[14,12],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]]},f:{width:12,points:[[10,21],[8,21],[6,20],[5,17],[5,0],[-1,-1],[2,14],[9,14]]},g:{width:19,points:[[15,14],[15,-2],[14,-5],[13,-6],[11,-7],[8,-7],[6,-6],[-1,-1],[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]]},h:{width:19,points:[[4,21],[4,0],[-1,-1],[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0]]},i:{width:8,points:[[3,21],[4,20],[5,21],[4,22],[3,21],[-1,-1],[4,14],[4,0]]},j:{width:10,points:[[5,21],[6,20],[7,21],[6,22],[5,21],[-1,-1],[6,14],[6,-3],[5,-6],[3,-7],[1,-7]]},k:{width:17,points:[[4,21],[4,0],[-1,-1],[14,14],[4,4],[-1,-1],[8,8],[15,0]]},l:{width:8,points:[[4,21],[4,0]]},m:{width:30,points:[[4,14],[4,0],[-1,-1],[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0],[-1,-1],[15,10],[18,13],[20,14],[23,14],[25,13],[26,10],[26,0]]},n:{width:19,points:[[4,14],[4,0],[-1,-1],[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0]]},o:{width:19,points:[[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3],[16,6],[16,8],[15,11],[13,13],[11,14],[8,14]]},p:{width:19,points:[[4,14],[4,-7],[-1,-1],[4,11],[6,13],[8,14],[11,14],[13,13],[15,11],[16,8],[16,6],[15,3],[13,1],[11,0],[8,0],[6,1],[4,3]]},q:{width:19,points:[[15,14],[15,-7],[-1,-1],[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]]},r:{width:13,points:[[4,14],[4,0],[-1,-1],[4,8],[5,11],[7,13],[9,14],[12,14]]},s:{width:17,points:[[14,11],[13,13],[10,14],[7,14],[4,13],[3,11],[4,9],[6,8],[11,7],[13,6],[14,4],[14,3],[13,1],[10,0],[7,0],[4,1],[3,3]]},t:{width:12,points:[[5,21],[5,4],[6,1],[8,0],[10,0],[-1,-1],[2,14],[9,14]]},u:{width:19,points:[[4,14],[4,4],[5,1],[7,0],[10,0],[12,1],[15,4],[-1,-1],[15,14],[15,0]]},v:{width:16,points:[[2,14],[8,0],[-1,-1],[14,14],[8,0]]},w:{width:22,points:[[3,14],[7,0],[-1,-1],[11,14],[7,0],[-1,-1],[11,14],[15,0],[-1,-1],[19,14],[15,0]]},x:{width:17,points:[[3,14],[14,0],[-1,-1],[14,14],[3,0]]},y:{width:16,points:[[2,14],[8,0],[-1,-1],[14,14],[8,0],[6,-4],[4,-6],[2,-7],[1,-7]]},z:{width:17,points:[[14,14],[3,0],[-1,-1],[3,14],[14,14],[-1,-1],[3,0],[14,0]]},"{":{width:14,points:[[9,25],[7,24],[6,23],[5,21],[5,19],[6,17],[7,16],[8,14],[8,12],[6,10],[-1,-1],[7,24],[6,22],[6,20],[7,18],[8,17],[9,15],[9,13],[8,11],[4,9],[8,7],[9,5],[9,3],[8,1],[7,0],[6,-2],[6,-4],[7,-6],[-1,-1],[6,8],[8,6],[8,4],[7,2],[6,1],[5,-1],[5,-3],[6,-5],[7,-6],[9,-7]]},"|":{width:8,points:[[4,25],[4,-7]]},"}":{width:14,points:[[5,25],[7,24],[8,23],[9,21],[9,19],[8,17],[7,16],[6,14],[6,12],[8,10],[-1,-1],[7,24],[8,22],[8,20],[7,18],[6,17],[5,15],[5,13],[6,11],[10,9],[6,7],[5,5],[5,3],[6,1],[7,0],[8,-2],[8,-4],[7,-6],[-1,-1],[8,8],[6,6],[6,4],[7,2],[8,1],[9,-1],[9,-3],[8,-5],[7,-6],[5,-7]]},"~":{width:24,points:[[3,6],[3,8],[4,11],[6,12],[8,12],[10,11],[14,8],[16,7],[18,7],[20,8],[21,10],[-1,-1],[3,8],[4,10],[6,11],[8,11],[10,10],[14,7],[16,6],[18,6],[20,7],[21,10],[21,12]]}};a.jqplot.CanvasFontRenderer=function(b){b=b||{};if(!b.pt2px){b.pt2px=1.5}a.jqplot.CanvasTextRenderer.call(this,b)};a.jqplot.CanvasFontRenderer.prototype=new a.jqplot.CanvasTextRenderer({});a.jqplot.CanvasFontRenderer.prototype.constructor=a.jqplot.CanvasFontRenderer;a.jqplot.CanvasFontRenderer.prototype.measure=function(c,e){var d=this.fontSize+" "+this.fontFamily;c.save();c.font=d;var b=c.measureText(e).width;c.restore();return b};a.jqplot.CanvasFontRenderer.prototype.draw=function(e,g){var c=0;var h=this.height*0.72;e.save();var d,b;if((-Math.PI/2<=this.angle&&this.angle<=0)||(Math.PI*3/2<=this.angle&&this.angle<=Math.PI*2)){d=0;b=-Math.sin(this.angle)*this.width}else{if((0<this.angle&&this.angle<=Math.PI/2)||(-Math.PI*2<=this.angle&&this.angle<=-Math.PI*3/2)){d=Math.sin(this.angle)*this.height;b=0}else{if((-Math.PI<this.angle&&this.angle<-Math.PI/2)||(Math.PI<=this.angle&&this.angle<=Math.PI*3/2)){d=-Math.cos(this.angle)*this.width;b=-Math.sin(this.angle)*this.width-Math.cos(this.angle)*this.height}else{if((-Math.PI*3/2<this.angle&&this.angle<Math.PI)||(Math.PI/2<this.angle&&this.angle<Math.PI)){d=Math.sin(this.angle)*this.height-Math.cos(this.angle)*this.width;b=-Math.cos(this.angle)*this.height}}}}e.strokeStyle=this.fillStyle;e.fillStyle=this.fillStyle;var f=this.fontSize+" "+this.fontFamily;e.font=f;e.translate(d,b);e.rotate(this.angle);e.fillText(g,c,h);e.restore()}})(jQuery); \ No newline at end of file diff --git a/www/protected/extensions/jqplot/plugins/jqplot.categoryAxisRenderer.js b/www/protected/extensions/jqplot/plugins/jqplot.categoryAxisRenderer.js new file mode 100644 index 0000000..742096c --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.categoryAxisRenderer.js @@ -0,0 +1,636 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + */ +(function($) { + /** + * class: $.jqplot.CategoryAxisRenderer + * A plugin for jqPlot to render a category style axis, with equal pixel spacing between y data values of a series. + * + * To use this renderer, include the plugin in your source + * > <script type="text/javascript" language="javascript" src="plugins/jqplot.categoryAxisRenderer.js"></script> + * + * and supply the appropriate options to your plot + * + * > {axes:{xaxis:{renderer:$.jqplot.CategoryAxisRenderer}}} + **/ + $.jqplot.CategoryAxisRenderer = function(options) { + $.jqplot.LinearAxisRenderer.call(this); + // prop: sortMergedLabels + // True to sort tick labels when labels are created by merging + // x axis values from multiple series. That is, say you have + // two series like: + // > line1 = [[2006, 4], [2008, 9], [2009, 16]]; + // > line2 = [[2006, 3], [2007, 7], [2008, 6]]; + // If no label array is specified, tick labels will be collected + // from the x values of the series. With sortMergedLabels + // set to true, tick labels will be: + // > [2006, 2007, 2008, 2009] + // With sortMergedLabels set to false, tick labels will be: + // > [2006, 2008, 2009, 2007] + // + // Note, this property is specified on the renderOptions for the + // axes when creating a plot: + // > axes:{xaxis:{renderer:$.jqplot.CategoryAxisRenderer, rendererOptions:{sortMergedLabels:true}}} + this.sortMergedLabels = false; + }; + + $.jqplot.CategoryAxisRenderer.prototype = new $.jqplot.LinearAxisRenderer(); + $.jqplot.CategoryAxisRenderer.prototype.constructor = $.jqplot.CategoryAxisRenderer; + + $.jqplot.CategoryAxisRenderer.prototype.init = function(options){ + this.groups = 1; + this.groupLabels = []; + this._groupLabels = []; + this._grouped = false; + this._barsPerGroup = null; + // prop: tickRenderer + // A class of a rendering engine for creating the ticks labels displayed on the plot, + // See <$.jqplot.AxisTickRenderer>. + // this.tickRenderer = $.jqplot.AxisTickRenderer; + // this.labelRenderer = $.jqplot.AxisLabelRenderer; + $.extend(true, this, {tickOptions:{formatString:'%d'}}, options); + var db = this._dataBounds; + // Go through all the series attached to this axis and find + // the min/max bounds for this axis. + for (var i=0; i<this._series.length; i++) { + var s = this._series[i]; + if (s.groups) { + this.groups = s.groups; + } + var d = s.data; + + for (var j=0; j<d.length; j++) { + if (this.name == 'xaxis' || this.name == 'x2axis') { + if (d[j][0] < db.min || db.min == null) { + db.min = d[j][0]; + } + if (d[j][0] > db.max || db.max == null) { + db.max = d[j][0]; + } + } + else { + if (d[j][1] < db.min || db.min == null) { + db.min = d[j][1]; + } + if (d[j][1] > db.max || db.max == null) { + db.max = d[j][1]; + } + } + } + } + + if (this.groupLabels.length) { + this.groups = this.groupLabels.length; + } + }; + + + $.jqplot.CategoryAxisRenderer.prototype.createTicks = function() { + // we're are operating on an axis here + var ticks = this._ticks; + var userTicks = this.ticks; + var name = this.name; + // databounds were set on axis initialization. + var db = this._dataBounds; + var dim, interval; + var min, max; + var pos1, pos2; + var tt, i; + + // if we already have ticks, use them. + if (userTicks.length) { + // adjust with blanks if we have groups + if (this.groups > 1 && !this._grouped) { + var l = userTicks.length; + var skip = parseInt(l/this.groups, 10); + var count = 0; + for (var i=skip; i<l; i+=skip) { + userTicks.splice(i+count, 0, ' '); + count++; + } + this._grouped = true; + } + this.min = 0.5; + this.max = userTicks.length + 0.5; + var range = this.max - this.min; + this.numberTicks = 2*userTicks.length + 1; + for (i=0; i<userTicks.length; i++){ + tt = this.min + 2 * i * range / (this.numberTicks-1); + // need a marker before and after the tick + var t = new this.tickRenderer(this.tickOptions); + t.showLabel = false; + // t.showMark = true; + t.setTick(tt, this.name); + this._ticks.push(t); + var t = new this.tickRenderer(this.tickOptions); + t.label = userTicks[i]; + // t.showLabel = true; + t.showMark = false; + t.showGridline = false; + t.setTick(tt+0.5, this.name); + this._ticks.push(t); + } + // now add the last tick at the end + var t = new this.tickRenderer(this.tickOptions); + t.showLabel = false; + // t.showMark = true; + t.setTick(tt+1, this.name); + this._ticks.push(t); + } + + // we don't have any ticks yet, let's make some! + else { + if (name == 'xaxis' || name == 'x2axis') { + dim = this._plotDimensions.width; + } + else { + dim = this._plotDimensions.height; + } + + // if min, max and number of ticks specified, user can't specify interval. + if (this.min != null && this.max != null && this.numberTicks != null) { + this.tickInterval = null; + } + + // if max, min, and interval specified and interval won't fit, ignore interval. + if (this.min != null && this.max != null && this.tickInterval != null) { + if (parseInt((this.max-this.min)/this.tickInterval, 10) != (this.max-this.min)/this.tickInterval) { + this.tickInterval = null; + } + } + + // find out how many categories are in the lines and collect labels + var labels = []; + var numcats = 0; + var min = 0.5; + var max, val; + var isMerged = false; + for (var i=0; i<this._series.length; i++) { + var s = this._series[i]; + for (var j=0; j<s.data.length; j++) { + if (this.name == 'xaxis' || this.name == 'x2axis') { + val = s.data[j][0]; + } + else { + val = s.data[j][1]; + } + if ($.inArray(val, labels) == -1) { + isMerged = true; + numcats += 1; + labels.push(val); + } + } + } + + if (isMerged && this.sortMergedLabels) { + labels.sort(function(a,b) { return a - b; }); + } + + // keep a reference to these tick labels to use for redrawing plot (see bug #57) + this.ticks = labels; + + // now bin the data values to the right lables. + for (var i=0; i<this._series.length; i++) { + var s = this._series[i]; + for (var j=0; j<s.data.length; j++) { + if (this.name == 'xaxis' || this.name == 'x2axis') { + val = s.data[j][0]; + } + else { + val = s.data[j][1]; + } + // for category axis, force the values into category bins. + // we should have the value in the label array now. + var idx = $.inArray(val, labels)+1; + if (this.name == 'xaxis' || this.name == 'x2axis') { + s.data[j][0] = idx; + } + else { + s.data[j][1] = idx; + } + } + } + + // adjust with blanks if we have groups + if (this.groups > 1 && !this._grouped) { + var l = labels.length; + var skip = parseInt(l/this.groups, 10); + var count = 0; + for (var i=skip; i<l; i+=skip+1) { + labels[i] = ' '; + } + this._grouped = true; + } + + max = numcats + 0.5; + if (this.numberTicks == null) { + this.numberTicks = 2*numcats + 1; + } + + var range = max - min; + this.min = min; + this.max = max; + var track = 0; + + // todo: adjust this so more ticks displayed. + var maxVisibleTicks = parseInt(3+dim/10, 10); + var skip = parseInt(numcats/maxVisibleTicks, 10); + + if (this.tickInterval == null) { + + this.tickInterval = range / (this.numberTicks-1); + + } + // if tickInterval is specified, we will ignore any computed maximum. + for (var i=0; i<this.numberTicks; i++){ + tt = this.min + i * this.tickInterval; + var t = new this.tickRenderer(this.tickOptions); + // if even tick, it isn't a category, it's a divider + if (i/2 == parseInt(i/2, 10)) { + t.showLabel = false; + t.showMark = true; + } + else { + if (skip>0 && track<skip) { + t.showLabel = false; + track += 1; + } + else { + t.showLabel = true; + track = 0; + } + t.label = t.formatter(t.formatString, labels[(i-1)/2]); + t.showMark = false; + t.showGridline = false; + } + t.setTick(tt, this.name); + this._ticks.push(t); + } + } + + }; + + // called with scope of axis + $.jqplot.CategoryAxisRenderer.prototype.draw = function(ctx, plot) { + if (this.show) { + // populate the axis label and value properties. + // createTicks is a method on the renderer, but + // call it within the scope of the axis. + this.renderer.createTicks.call(this); + // fill a div with axes labels in the right direction. + // Need to pregenerate each axis to get it's bounds and + // position it and the labels correctly on the plot. + var dim=0; + var temp; + // Added for theming. + if (this._elem) { + // this._elem.empty(); + // Memory Leaks patch + this._elem.emptyForce(); + } + + this._elem = this._elem || $('<div class="jqplot-axis jqplot-'+this.name+'" style="position:absolute;"></div>'); + + if (this.name == 'xaxis' || this.name == 'x2axis') { + this._elem.width(this._plotDimensions.width); + } + else { + this._elem.height(this._plotDimensions.height); + } + + // create a _label object. + this.labelOptions.axis = this.name; + this._label = new this.labelRenderer(this.labelOptions); + if (this._label.show) { + var elem = this._label.draw(ctx, plot); + elem.appendTo(this._elem); + } + + var t = this._ticks; + for (var i=0; i<t.length; i++) { + var tick = t[i]; + if (tick.showLabel && (!tick.isMinorTick || this.showMinorTicks)) { + var elem = tick.draw(ctx, plot); + elem.appendTo(this._elem); + } + } + + this._groupLabels = []; + // now make group labels + for (var i=0; i<this.groupLabels.length; i++) + { + var elem = $('<div style="position:absolute;" class="jqplot-'+this.name+'-groupLabel"></div>'); + elem.html(this.groupLabels[i]); + this._groupLabels.push(elem); + elem.appendTo(this._elem); + } + } + return this._elem; + }; + + // called with scope of axis + $.jqplot.CategoryAxisRenderer.prototype.set = function() { + var dim = 0; + var temp; + var w = 0; + var h = 0; + var lshow = (this._label == null) ? false : this._label.show; + if (this.show) { + var t = this._ticks; + for (var i=0; i<t.length; i++) { + var tick = t[i]; + if (tick.showLabel && (!tick.isMinorTick || this.showMinorTicks)) { + if (this.name == 'xaxis' || this.name == 'x2axis') { + temp = tick._elem.outerHeight(true); + } + else { + temp = tick._elem.outerWidth(true); + } + if (temp > dim) { + dim = temp; + } + } + } + + var dim2 = 0; + for (var i=0; i<this._groupLabels.length; i++) { + var l = this._groupLabels[i]; + if (this.name == 'xaxis' || this.name == 'x2axis') { + temp = l.outerHeight(true); + } + else { + temp = l.outerWidth(true); + } + if (temp > dim2) { + dim2 = temp; + } + } + + if (lshow) { + w = this._label._elem.outerWidth(true); + h = this._label._elem.outerHeight(true); + } + if (this.name == 'xaxis') { + dim += dim2 + h; + this._elem.css({'height':dim+'px', left:'0px', bottom:'0px'}); + } + else if (this.name == 'x2axis') { + dim += dim2 + h; + this._elem.css({'height':dim+'px', left:'0px', top:'0px'}); + } + else if (this.name == 'yaxis') { + dim += dim2 + w; + this._elem.css({'width':dim+'px', left:'0px', top:'0px'}); + if (lshow && this._label.constructor == $.jqplot.AxisLabelRenderer) { + this._label._elem.css('width', w+'px'); + } + } + else { + dim += dim2 + w; + this._elem.css({'width':dim+'px', right:'0px', top:'0px'}); + if (lshow && this._label.constructor == $.jqplot.AxisLabelRenderer) { + this._label._elem.css('width', w+'px'); + } + } + } + }; + + // called with scope of axis + $.jqplot.CategoryAxisRenderer.prototype.pack = function(pos, offsets) { + var ticks = this._ticks; + var max = this.max; + var min = this.min; + var offmax = offsets.max; + var offmin = offsets.min; + var lshow = (this._label == null) ? false : this._label.show; + var i; + + for (var p in pos) { + this._elem.css(p, pos[p]); + } + + this._offsets = offsets; + // pixellength will be + for x axes and - for y axes becasue pixels always measured from top left. + var pixellength = offmax - offmin; + var unitlength = max - min; + + // point to unit and unit to point conversions references to Plot DOM element top left corner. + this.p2u = function(p){ + return (p - offmin) * unitlength / pixellength + min; + }; + + this.u2p = function(u){ + return (u - min) * pixellength / unitlength + offmin; + }; + + if (this.name == 'xaxis' || this.name == 'x2axis'){ + this.series_u2p = function(u){ + return (u - min) * pixellength / unitlength; + }; + this.series_p2u = function(p){ + return p * unitlength / pixellength + min; + }; + } + + else { + this.series_u2p = function(u){ + return (u - max) * pixellength / unitlength; + }; + this.series_p2u = function(p){ + return p * unitlength / pixellength + max; + }; + } + + if (this.show) { + if (this.name == 'xaxis' || this.name == 'x2axis') { + for (i=0; i<ticks.length; i++) { + var t = ticks[i]; + if (t.show && t.showLabel) { + var shim; + + if (t.constructor == $.jqplot.CanvasAxisTickRenderer && t.angle) { + // will need to adjust auto positioning based on which axis this is. + var temp = (this.name == 'xaxis') ? 1 : -1; + switch (t.labelPosition) { + case 'auto': + // position at end + if (temp * t.angle < 0) { + shim = -t.getWidth() + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2; + } + // position at start + else { + shim = -t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2; + } + break; + case 'end': + shim = -t.getWidth() + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2; + break; + case 'start': + shim = -t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2; + break; + case 'middle': + shim = -t.getWidth()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2; + break; + default: + shim = -t.getWidth()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2; + break; + } + } + else { + shim = -t.getWidth()/2; + } + var val = this.u2p(t.value) + shim + 'px'; + t._elem.css('left', val); + t.pack(); + } + } + + var labeledge=['bottom', 0]; + if (lshow) { + var w = this._label._elem.outerWidth(true); + this._label._elem.css('left', offmin + pixellength/2 - w/2 + 'px'); + if (this.name == 'xaxis') { + this._label._elem.css('bottom', '0px'); + labeledge = ['bottom', this._label._elem.outerHeight(true)]; + } + else { + this._label._elem.css('top', '0px'); + labeledge = ['top', this._label._elem.outerHeight(true)]; + } + this._label.pack(); + } + + // draw the group labels + var step = parseInt(this._ticks.length/this.groups, 10); + for (i=0; i<this._groupLabels.length; i++) { + var mid = 0; + var count = 0; + for (var j=i*step; j<=(i+1)*step; j++) { + if (this._ticks[j]._elem && this._ticks[j].label != " ") { + var t = this._ticks[j]._elem; + var p = t.position(); + mid += p.left + t.outerWidth(true)/2; + count++; + } + } + mid = mid/count; + this._groupLabels[i].css({'left':(mid - this._groupLabels[i].outerWidth(true)/2)}); + this._groupLabels[i].css(labeledge[0], labeledge[1]); + } + } + else { + for (i=0; i<ticks.length; i++) { + var t = ticks[i]; + if (t.show && t.showLabel) { + var shim; + if (t.constructor == $.jqplot.CanvasAxisTickRenderer && t.angle) { + // will need to adjust auto positioning based on which axis this is. + var temp = (this.name == 'yaxis') ? 1 : -1; + switch (t.labelPosition) { + case 'auto': + // position at end + case 'end': + if (temp * t.angle < 0) { + shim = -t._textRenderer.height * Math.cos(-t._textRenderer.angle) / 2; + } + else { + shim = -t.getHeight() + t._textRenderer.height * Math.cos(t._textRenderer.angle) / 2; + } + break; + case 'start': + if (t.angle > 0) { + shim = -t._textRenderer.height * Math.cos(-t._textRenderer.angle) / 2; + } + else { + shim = -t.getHeight() + t._textRenderer.height * Math.cos(t._textRenderer.angle) / 2; + } + break; + case 'middle': + // if (t.angle > 0) { + // shim = -t.getHeight()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2; + // } + // else { + // shim = -t.getHeight()/2 - t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2; + // } + shim = -t.getHeight()/2; + break; + default: + shim = -t.getHeight()/2; + break; + } + } + else { + shim = -t.getHeight()/2; + } + + var val = this.u2p(t.value) + shim + 'px'; + t._elem.css('top', val); + t.pack(); + } + } + + var labeledge=['left', 0]; + if (lshow) { + var h = this._label._elem.outerHeight(true); + this._label._elem.css('top', offmax - pixellength/2 - h/2 + 'px'); + if (this.name == 'yaxis') { + this._label._elem.css('left', '0px'); + labeledge = ['left', this._label._elem.outerWidth(true)]; + } + else { + this._label._elem.css('right', '0px'); + labeledge = ['right', this._label._elem.outerWidth(true)]; + } + this._label.pack(); + } + + // draw the group labels, position top here, do left after label position. + var step = parseInt(this._ticks.length/this.groups, 10); + for (i=0; i<this._groupLabels.length; i++) { + var mid = 0; + var count = 0; + for (var j=i*step; j<=(i+1)*step; j++) { + if (this._ticks[j]._elem && this._ticks[j].label != " ") { + var t = this._ticks[j]._elem; + var p = t.position(); + mid += p.top + t.outerHeight()/2; + count++; + } + } + mid = mid/count; + this._groupLabels[i].css({'top':mid - this._groupLabels[i].outerHeight()/2}); + this._groupLabels[i].css(labeledge[0], labeledge[1]); + + } + } + } + }; + + +})(jQuery); \ No newline at end of file diff --git a/www/protected/extensions/jqplot/plugins/jqplot.categoryAxisRenderer.min.js b/www/protected/extensions/jqplot/plugins/jqplot.categoryAxisRenderer.min.js new file mode 100644 index 0000000..e822bfe --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.categoryAxisRenderer.min.js @@ -0,0 +1,57 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + * included jsDate library by Chris Leonello: + * + * Copyright (c) 2010-2011 Chris Leonello + * + * jsDate is currently available for use in all personal or commercial projects + * under both the MIT and GPL version 2.0 licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * jsDate borrows many concepts and ideas from the Date Instance + * Methods by Ken Snyder along with some parts of Ken's actual code. + * + * Ken's origianl Date Instance Methods and copyright notice: + * + * Ken Snyder (ken d snyder at gmail dot com) + * 2008-09-10 + * version 2.0.2 (http://kendsnyder.com/sandbox/date/) + * Creative Commons Attribution License 3.0 (http://creativecommons.org/licenses/by/3.0/) + * + * jqplotToImage function based on Larry Siden's export-jqplot-to-png.js. + * Larry has generously given permission to adapt his code for inclusion + * into jqPlot. + * + * Larry's original code can be found here: + * + * https://github.com/lsiden/export-jqplot-to-png + * + * + */ +(function(a){a.jqplot.CategoryAxisRenderer=function(b){a.jqplot.LinearAxisRenderer.call(this);this.sortMergedLabels=false};a.jqplot.CategoryAxisRenderer.prototype=new a.jqplot.LinearAxisRenderer();a.jqplot.CategoryAxisRenderer.prototype.constructor=a.jqplot.CategoryAxisRenderer;a.jqplot.CategoryAxisRenderer.prototype.init=function(e){this.groups=1;this.groupLabels=[];this._groupLabels=[];this._grouped=false;this._barsPerGroup=null;a.extend(true,this,{tickOptions:{formatString:"%d"}},e);var b=this._dataBounds;for(var f=0;f<this._series.length;f++){var g=this._series[f];if(g.groups){this.groups=g.groups}var h=g.data;for(var c=0;c<h.length;c++){if(this.name=="xaxis"||this.name=="x2axis"){if(h[c][0]<b.min||b.min==null){b.min=h[c][0]}if(h[c][0]>b.max||b.max==null){b.max=h[c][0]}}else{if(h[c][1]<b.min||b.min==null){b.min=h[c][1]}if(h[c][1]>b.max||b.max==null){b.max=h[c][1]}}}}if(this.groupLabels.length){this.groups=this.groupLabels.length}};a.jqplot.CategoryAxisRenderer.prototype.createTicks=function(){var D=this._ticks;var z=this.ticks;var F=this.name;var C=this._dataBounds;var v,A;var q,w;var d,c;var b,x;if(z.length){if(this.groups>1&&!this._grouped){var r=z.length;var p=parseInt(r/this.groups,10);var e=0;for(var x=p;x<r;x+=p){z.splice(x+e,0," ");e++}this._grouped=true}this.min=0.5;this.max=z.length+0.5;var m=this.max-this.min;this.numberTicks=2*z.length+1;for(x=0;x<z.length;x++){b=this.min+2*x*m/(this.numberTicks-1);var h=new this.tickRenderer(this.tickOptions);h.showLabel=false;h.setTick(b,this.name);this._ticks.push(h);var h=new this.tickRenderer(this.tickOptions);h.label=z[x];h.showMark=false;h.showGridline=false;h.setTick(b+0.5,this.name);this._ticks.push(h)}var h=new this.tickRenderer(this.tickOptions);h.showLabel=false;h.setTick(b+1,this.name);this._ticks.push(h)}else{if(F=="xaxis"||F=="x2axis"){v=this._plotDimensions.width}else{v=this._plotDimensions.height}if(this.min!=null&&this.max!=null&&this.numberTicks!=null){this.tickInterval=null}if(this.min!=null&&this.max!=null&&this.tickInterval!=null){if(parseInt((this.max-this.min)/this.tickInterval,10)!=(this.max-this.min)/this.tickInterval){this.tickInterval=null}}var y=[];var B=0;var q=0.5;var w,E;var f=false;for(var x=0;x<this._series.length;x++){var k=this._series[x];for(var u=0;u<k.data.length;u++){if(this.name=="xaxis"||this.name=="x2axis"){E=k.data[u][0]}else{E=k.data[u][1]}if(a.inArray(E,y)==-1){f=true;B+=1;y.push(E)}}}if(f&&this.sortMergedLabels){y.sort(function(j,i){return j-i})}this.ticks=y;for(var x=0;x<this._series.length;x++){var k=this._series[x];for(var u=0;u<k.data.length;u++){if(this.name=="xaxis"||this.name=="x2axis"){E=k.data[u][0]}else{E=k.data[u][1]}var n=a.inArray(E,y)+1;if(this.name=="xaxis"||this.name=="x2axis"){k.data[u][0]=n}else{k.data[u][1]=n}}}if(this.groups>1&&!this._grouped){var r=y.length;var p=parseInt(r/this.groups,10);var e=0;for(var x=p;x<r;x+=p+1){y[x]=" "}this._grouped=true}w=B+0.5;if(this.numberTicks==null){this.numberTicks=2*B+1}var m=w-q;this.min=q;this.max=w;var o=0;var g=parseInt(3+v/10,10);var p=parseInt(B/g,10);if(this.tickInterval==null){this.tickInterval=m/(this.numberTicks-1)}for(var x=0;x<this.numberTicks;x++){b=this.min+x*this.tickInterval;var h=new this.tickRenderer(this.tickOptions);if(x/2==parseInt(x/2,10)){h.showLabel=false;h.showMark=true}else{if(p>0&&o<p){h.showLabel=false;o+=1}else{h.showLabel=true;o=0}h.label=h.formatter(h.formatString,y[(x-1)/2]);h.showMark=false;h.showGridline=false}h.setTick(b,this.name);this._ticks.push(h)}}};a.jqplot.CategoryAxisRenderer.prototype.draw=function(b,j){if(this.show){this.renderer.createTicks.call(this);var h=0;var c;if(this._elem){this._elem.emptyForce()}this._elem=this._elem||a('<div class="jqplot-axis jqplot-'+this.name+'" style="position:absolute;"></div>');if(this.name=="xaxis"||this.name=="x2axis"){this._elem.width(this._plotDimensions.width)}else{this._elem.height(this._plotDimensions.height)}this.labelOptions.axis=this.name;this._label=new this.labelRenderer(this.labelOptions);if(this._label.show){var g=this._label.draw(b,j);g.appendTo(this._elem)}var f=this._ticks;for(var e=0;e<f.length;e++){var d=f[e];if(d.showLabel&&(!d.isMinorTick||this.showMinorTicks)){var g=d.draw(b,j);g.appendTo(this._elem)}}this._groupLabels=[];for(var e=0;e<this.groupLabels.length;e++){var g=a('<div style="position:absolute;" class="jqplot-'+this.name+'-groupLabel"></div>');g.html(this.groupLabels[e]);this._groupLabels.push(g);g.appendTo(this._elem)}}return this._elem};a.jqplot.CategoryAxisRenderer.prototype.set=function(){var e=0;var m;var k=0;var f=0;var d=(this._label==null)?false:this._label.show;if(this.show){var n=this._ticks;for(var c=0;c<n.length;c++){var g=n[c];if(g.showLabel&&(!g.isMinorTick||this.showMinorTicks)){if(this.name=="xaxis"||this.name=="x2axis"){m=g._elem.outerHeight(true)}else{m=g._elem.outerWidth(true)}if(m>e){e=m}}}var j=0;for(var c=0;c<this._groupLabels.length;c++){var b=this._groupLabels[c];if(this.name=="xaxis"||this.name=="x2axis"){m=b.outerHeight(true)}else{m=b.outerWidth(true)}if(m>j){j=m}}if(d){k=this._label._elem.outerWidth(true);f=this._label._elem.outerHeight(true)}if(this.name=="xaxis"){e+=j+f;this._elem.css({height:e+"px",left:"0px",bottom:"0px"})}else{if(this.name=="x2axis"){e+=j+f;this._elem.css({height:e+"px",left:"0px",top:"0px"})}else{if(this.name=="yaxis"){e+=j+k;this._elem.css({width:e+"px",left:"0px",top:"0px"});if(d&&this._label.constructor==a.jqplot.AxisLabelRenderer){this._label._elem.css("width",k+"px")}}else{e+=j+k;this._elem.css({width:e+"px",right:"0px",top:"0px"});if(d&&this._label.constructor==a.jqplot.AxisLabelRenderer){this._label._elem.css("width",k+"px")}}}}}};a.jqplot.CategoryAxisRenderer.prototype.pack=function(e,c){var C=this._ticks;var v=this.max;var s=this.min;var n=c.max;var l=c.min;var q=(this._label==null)?false:this._label.show;var x;for(var r in e){this._elem.css(r,e[r])}this._offsets=c;var g=n-l;var k=v-s;this.p2u=function(h){return(h-l)*k/g+s};this.u2p=function(h){return(h-s)*g/k+l};if(this.name=="xaxis"||this.name=="x2axis"){this.series_u2p=function(h){return(h-s)*g/k};this.series_p2u=function(h){return h*k/g+s}}else{this.series_u2p=function(h){return(h-v)*g/k};this.series_p2u=function(h){return h*k/g+v}}if(this.show){if(this.name=="xaxis"||this.name=="x2axis"){for(x=0;x<C.length;x++){var o=C[x];if(o.show&&o.showLabel){var b;if(o.constructor==a.jqplot.CanvasAxisTickRenderer&&o.angle){var A=(this.name=="xaxis")?1:-1;switch(o.labelPosition){case"auto":if(A*o.angle<0){b=-o.getWidth()+o._textRenderer.height*Math.sin(-o._textRenderer.angle)/2}else{b=-o._textRenderer.height*Math.sin(o._textRenderer.angle)/2}break;case"end":b=-o.getWidth()+o._textRenderer.height*Math.sin(-o._textRenderer.angle)/2;break;case"start":b=-o._textRenderer.height*Math.sin(o._textRenderer.angle)/2;break;case"middle":b=-o.getWidth()/2+o._textRenderer.height*Math.sin(-o._textRenderer.angle)/2;break;default:b=-o.getWidth()/2+o._textRenderer.height*Math.sin(-o._textRenderer.angle)/2;break}}else{b=-o.getWidth()/2}var D=this.u2p(o.value)+b+"px";o._elem.css("left",D);o.pack()}}var z=["bottom",0];if(q){var m=this._label._elem.outerWidth(true);this._label._elem.css("left",l+g/2-m/2+"px");if(this.name=="xaxis"){this._label._elem.css("bottom","0px");z=["bottom",this._label._elem.outerHeight(true)]}else{this._label._elem.css("top","0px");z=["top",this._label._elem.outerHeight(true)]}this._label.pack()}var d=parseInt(this._ticks.length/this.groups,10);for(x=0;x<this._groupLabels.length;x++){var B=0;var f=0;for(var u=x*d;u<=(x+1)*d;u++){if(this._ticks[u]._elem&&this._ticks[u].label!=" "){var o=this._ticks[u]._elem;var r=o.position();B+=r.left+o.outerWidth(true)/2;f++}}B=B/f;this._groupLabels[x].css({left:(B-this._groupLabels[x].outerWidth(true)/2)});this._groupLabels[x].css(z[0],z[1])}}else{for(x=0;x<C.length;x++){var o=C[x];if(o.show&&o.showLabel){var b;if(o.constructor==a.jqplot.CanvasAxisTickRenderer&&o.angle){var A=(this.name=="yaxis")?1:-1;switch(o.labelPosition){case"auto":case"end":if(A*o.angle<0){b=-o._textRenderer.height*Math.cos(-o._textRenderer.angle)/2}else{b=-o.getHeight()+o._textRenderer.height*Math.cos(o._textRenderer.angle)/2}break;case"start":if(o.angle>0){b=-o._textRenderer.height*Math.cos(-o._textRenderer.angle)/2}else{b=-o.getHeight()+o._textRenderer.height*Math.cos(o._textRenderer.angle)/2}break;case"middle":b=-o.getHeight()/2;break;default:b=-o.getHeight()/2;break}}else{b=-o.getHeight()/2}var D=this.u2p(o.value)+b+"px";o._elem.css("top",D);o.pack()}}var z=["left",0];if(q){var y=this._label._elem.outerHeight(true);this._label._elem.css("top",n-g/2-y/2+"px");if(this.name=="yaxis"){this._label._elem.css("left","0px");z=["left",this._label._elem.outerWidth(true)]}else{this._label._elem.css("right","0px");z=["right",this._label._elem.outerWidth(true)]}this._label.pack()}var d=parseInt(this._ticks.length/this.groups,10);for(x=0;x<this._groupLabels.length;x++){var B=0;var f=0;for(var u=x*d;u<=(x+1)*d;u++){if(this._ticks[u]._elem&&this._ticks[u].label!=" "){var o=this._ticks[u]._elem;var r=o.position();B+=r.top+o.outerHeight()/2;f++}}B=B/f;this._groupLabels[x].css({top:B-this._groupLabels[x].outerHeight()/2});this._groupLabels[x].css(z[0],z[1])}}}}})(jQuery); \ No newline at end of file diff --git a/www/protected/extensions/jqplot/plugins/jqplot.json2.js b/www/protected/extensions/jqplot/plugins/jqplot.json2.js new file mode 100644 index 0000000..46fb942 --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.json2.js @@ -0,0 +1,475 @@ +/* + 2010-11-01 Chris Leonello + + Slightly modified version of the original json2.js to put JSON + functions under the $.jqplot namespace. + + licensing and orignal comments follow: + + http://www.JSON.org/json2.js + 2010-08-25 + + Public Domain. + + NO WARRANTY EXPRESSED OR IMPLIED. USE AT YOUR OWN RISK. + + See http://www.JSON.org/js.html + + + This code should be minified before deployment. + See http://javascript.crockford.com/jsmin.html + + USE YOUR OWN COPY. IT IS EXTREMELY UNWISE TO LOAD CODE FROM SERVERS YOU DO + NOT CONTROL. + + + This file creates a global JSON object containing two methods: stringify + and parse. + + $.jqplot.JSON.stringify(value, replacer, space) + value any JavaScript value, usually an object or array. + + replacer an optional parameter that determines how object + values are stringified for objects. It can be a + function or an array of strings. + + space an optional parameter that specifies the indentation + of nested structures. If it is omitted, the text will + be packed without extra whitespace. If it is a number, + it will specify the number of spaces to indent at each + level. If it is a string (such as '\t' or ' '), + it contains the characters used to indent at each level. + + This method produces a JSON text from a JavaScript value. + + When an object value is found, if the object contains a toJSON + method, its toJSON method will be called and the result will be + stringified. A toJSON method does not serialize: it returns the + value represented by the name/value pair that should be serialized, + or undefined if nothing should be serialized. The toJSON method + will be passed the key associated with the value, and this will be + bound to the value + + For example, this would serialize Dates as ISO strings. + + Date.prototype.toJSON = function (key) { + function f(n) { + // Format integers to have at least two digits. + return n < 10 ? '0' + n : n; + } + + return this.getUTCFullYear() + '-' + + f(this.getUTCMonth() + 1) + '-' + + f(this.getUTCDate()) + 'T' + + f(this.getUTCHours()) + ':' + + f(this.getUTCMinutes()) + ':' + + f(this.getUTCSeconds()) + 'Z'; + }; + + You can provide an optional replacer method. It will be passed the + key and value of each member, with this bound to the containing + object. The value that is returned from your method will be + serialized. If your method returns undefined, then the member will + be excluded from the serialization. + + If the replacer parameter is an array of strings, then it will be + used to select the members to be serialized. It filters the results + such that only members with keys listed in the replacer array are + stringified. + + Values that do not have JSON representations, such as undefined or + functions, will not be serialized. Such values in objects will be + dropped; in arrays they will be replaced with null. You can use + a replacer function to replace those with JSON values. + $.jqplot.JSON.stringify(undefined) returns undefined. + + The optional space parameter produces a stringification of the + value that is filled with line breaks and indentation to make it + easier to read. + + If the space parameter is a non-empty string, then that string will + be used for indentation. If the space parameter is a number, then + the indentation will be that many spaces. + + Example: + + text = $.jqplot.JSON.stringify(['e', {pluribus: 'unum'}]); + // text is '["e",{"pluribus":"unum"}]' + + + text = $.jqplot.JSON.stringify(['e', {pluribus: 'unum'}], null, '\t'); + // text is '[\n\t"e",\n\t{\n\t\t"pluribus": "unum"\n\t}\n]' + + text = $.jqplot.JSON.stringify([new Date()], function (key, value) { + return this[key] instanceof Date ? + 'Date(' + this[key] + ')' : value; + }); + // text is '["Date(---current time---)"]' + + + $.jqplot.JSON.parse(text, reviver) + This method parses a JSON text to produce an object or array. + It can throw a SyntaxError exception. + + The optional reviver parameter is a function that can filter and + transform the results. It receives each of the keys and values, + and its return value is used instead of the original value. + If it returns what it received, then the structure is not modified. + If it returns undefined then the member is deleted. + + Example: + + // Parse the text. Values that look like ISO date strings will + // be converted to Date objects. + + myData = $.jqplot.JSON.parse(text, function (key, value) { + var a; + if (typeof value === 'string') { + a = +/^(\d{4})-(\d{2})-(\d{2})T(\d{2}):(\d{2}):(\d{2}(?:\.\d*)?)Z$/.exec(value); + if (a) { + return new Date(Date.UTC(+a[1], +a[2] - 1, +a[3], +a[4], + +a[5], +a[6])); + } + } + return value; + }); + + myData = $.jqplot.JSON.parse('["Date(09/09/2001)"]', function (key, value) { + var d; + if (typeof value === 'string' && + value.slice(0, 5) === 'Date(' && + value.slice(-1) === ')') { + d = new Date(value.slice(5, -1)); + if (d) { + return d; + } + } + return value; + }); + + + This is a reference implementation. You are free to copy, modify, or + redistribute. +*/ + +(function($) { + + $.jqplot.JSON = window.JSON; + + if (!window.JSON) { + $.jqplot.JSON = {}; + } + + function f(n) { + // Format integers to have at least two digits. + return n < 10 ? '0' + n : n; + } + + if (typeof Date.prototype.toJSON !== 'function') { + + Date.prototype.toJSON = function (key) { + + return isFinite(this.valueOf()) ? + this.getUTCFullYear() + '-' + + f(this.getUTCMonth() + 1) + '-' + + f(this.getUTCDate()) + 'T' + + f(this.getUTCHours()) + ':' + + f(this.getUTCMinutes()) + ':' + + f(this.getUTCSeconds()) + 'Z' : null; + }; + + String.prototype.toJSON = + Number.prototype.toJSON = + Boolean.prototype.toJSON = function (key) { + return this.valueOf(); + }; + } + + var cx = /[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g, + escapable = /[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g, + gap, + indent, + meta = { // table of character substitutions + '\b': '\\b', + '\t': '\\t', + '\n': '\\n', + '\f': '\\f', + '\r': '\\r', + '"' : '\\"', + '\\': '\\\\' + }, + rep; + + + function quote(string) { + +// If the string contains no control characters, no quote characters, and no +// backslash characters, then we can safely slap some quotes around it. +// Otherwise we must also replace the offending characters with safe escape +// sequences. + + escapable.lastIndex = 0; + return escapable.test(string) ? + '"' + string.replace(escapable, function (a) { + var c = meta[a]; + return typeof c === 'string' ? c : + '\\u' + ('0000' + a.charCodeAt(0).toString(16)).slice(-4); + }) + '"' : + '"' + string + '"'; + } + + + function str(key, holder) { + +// Produce a string from holder[key]. + + var i, // The loop counter. + k, // The member key. + v, // The member value. + length, + mind = gap, + partial, + value = holder[key]; + +// If the value has a toJSON method, call it to obtain a replacement value. + + if (value && typeof value === 'object' && + typeof value.toJSON === 'function') { + value = value.toJSON(key); + } + +// If we were called with a replacer function, then call the replacer to +// obtain a replacement value. + + if (typeof rep === 'function') { + value = rep.call(holder, key, value); + } + +// What happens next depends on the value's type. + + switch (typeof value) { + case 'string': + return quote(value); + + case 'number': + +// JSON numbers must be finite. Encode non-finite numbers as null. + + return isFinite(value) ? String(value) : 'null'; + + case 'boolean': + case 'null': + +// If the value is a boolean or null, convert it to a string. Note: +// typeof null does not produce 'null'. The case is included here in +// the remote chance that this gets fixed someday. + + return String(value); + +// If the type is 'object', we might be dealing with an object or an array or +// null. + + case 'object': + +// Due to a specification blunder in ECMAScript, typeof null is 'object', +// so watch out for that case. + + if (!value) { + return 'null'; + } + +// Make an array to hold the partial results of stringifying this object value. + + gap += indent; + partial = []; + +// Is the value an array? + + if (Object.prototype.toString.apply(value) === '[object Array]') { + +// The value is an array. Stringify every element. Use null as a placeholder +// for non-JSON values. + + length = value.length; + for (i = 0; i < length; i += 1) { + partial[i] = str(i, value) || 'null'; + } + +// Join all of the elements together, separated with commas, and wrap them in +// brackets. + + v = partial.length === 0 ? '[]' : + gap ? '[\n' + gap + + partial.join(',\n' + gap) + '\n' + + mind + ']' : + '[' + partial.join(',') + ']'; + gap = mind; + return v; + } + +// If the replacer is an array, use it to select the members to be stringified. + + if (rep && typeof rep === 'object') { + length = rep.length; + for (i = 0; i < length; i += 1) { + k = rep[i]; + if (typeof k === 'string') { + v = str(k, value); + if (v) { + partial.push(quote(k) + (gap ? ': ' : ':') + v); + } + } + } + } else { + +// Otherwise, iterate through all of the keys in the object. + + for (k in value) { + if (Object.hasOwnProperty.call(value, k)) { + v = str(k, value); + if (v) { + partial.push(quote(k) + (gap ? ': ' : ':') + v); + } + } + } + } + +// Join all of the member texts together, separated with commas, +// and wrap them in braces. + + v = partial.length === 0 ? '{}' : + gap ? '{\n' + gap + partial.join(',\n' + gap) + '\n' + + mind + '}' : '{' + partial.join(',') + '}'; + gap = mind; + return v; + } + } + +// If the JSON object does not yet have a stringify method, give it one. + + if (typeof $.jqplot.JSON.stringify !== 'function') { + $.jqplot.JSON.stringify = function (value, replacer, space) { + +// The stringify method takes a value and an optional replacer, and an optional +// space parameter, and returns a JSON text. The replacer can be a function +// that can replace values, or an array of strings that will select the keys. +// A default replacer method can be provided. Use of the space parameter can +// produce text that is more easily readable. + + var i; + gap = ''; + indent = ''; + +// If the space parameter is a number, make an indent string containing that +// many spaces. + + if (typeof space === 'number') { + for (i = 0; i < space; i += 1) { + indent += ' '; + } + +// If the space parameter is a string, it will be used as the indent string. + + } else if (typeof space === 'string') { + indent = space; + } + +// If there is a replacer, it must be a function or an array. +// Otherwise, throw an error. + + rep = replacer; + if (replacer && typeof replacer !== 'function' && + (typeof replacer !== 'object' || + typeof replacer.length !== 'number')) { + throw new Error('$.jqplot.JSON.stringify'); + } + +// Make a fake root object containing our value under the key of ''. +// Return the result of stringifying the value. + + return str('', {'': value}); + }; + } + + +// If the JSON object does not yet have a parse method, give it one. + + if (typeof $.jqplot.JSON.parse !== 'function') { + $.jqplot.JSON.parse = function (text, reviver) { + +// The parse method takes a text and an optional reviver function, and returns +// a JavaScript value if the text is a valid JSON text. + + var j; + + function walk(holder, key) { + +// The walk method is used to recursively walk the resulting structure so +// that modifications can be made. + + var k, v, value = holder[key]; + if (value && typeof value === 'object') { + for (k in value) { + if (Object.hasOwnProperty.call(value, k)) { + v = walk(value, k); + if (v !== undefined) { + value[k] = v; + } else { + delete value[k]; + } + } + } + } + return reviver.call(holder, key, value); + } + + +// Parsing happens in four stages. In the first stage, we replace certain +// Unicode characters with escape sequences. JavaScript handles many characters +// incorrectly, either silently deleting them, or treating them as line endings. + + text = String(text); + cx.lastIndex = 0; + if (cx.test(text)) { + text = text.replace(cx, function (a) { + return '\\u' + + ('0000' + a.charCodeAt(0).toString(16)).slice(-4); + }); + } + +// In the second stage, we run the text against regular expressions that look +// for non-JSON patterns. We are especially concerned with '()' and 'new' +// because they can cause invocation, and '=' because it can cause mutation. +// But just to be safe, we want to reject all unexpected forms. + +// We split the second stage into 4 regexp operations in order to work around +// crippling inefficiencies in IE's and Safari's regexp engines. First we +// replace the JSON backslash pairs with '@' (a non-JSON character). Second, we +// replace all simple value tokens with ']' characters. Third, we delete all +// open brackets that follow a colon or comma or that begin the text. Finally, +// we look to see that the remaining characters are only whitespace or ']' or +// ',' or ':' or '{' or '}'. If that is so, then the text is safe for eval. + + if (/^[\],:{}\s]*$/.test(text.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, '@').replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, ']').replace(/(?:^|:|,)(?:\s*\[)+/g, ''))) { + +// In the third stage we use the eval function to compile the text into a +// JavaScript structure. The '{' operator is subject to a syntactic ambiguity +// in JavaScript: it can begin a block or an object literal. We wrap the text +// in parens to eliminate the ambiguity. + + j = eval('(' + text + ')'); + +// In the optional fourth stage, we recursively walk the new structure, passing +// each name/value pair to a reviver function for possible transformation. + + return typeof reviver === 'function' ? + walk({'': j}, '') : j; + } + +// If the text is not JSON parseable, then a SyntaxError is thrown. + + throw new SyntaxError('$.jqplot.JSON.parse'); + }; + } +})(jQuery); diff --git a/www/protected/extensions/jqplot/plugins/jqplot.json2.min.js b/www/protected/extensions/jqplot/plugins/jqplot.json2.min.js new file mode 100644 index 0000000..83a74ad --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.json2.min.js @@ -0,0 +1,57 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + * included jsDate library by Chris Leonello: + * + * Copyright (c) 2010-2011 Chris Leonello + * + * jsDate is currently available for use in all personal or commercial projects + * under both the MIT and GPL version 2.0 licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * jsDate borrows many concepts and ideas from the Date Instance + * Methods by Ken Snyder along with some parts of Ken's actual code. + * + * Ken's origianl Date Instance Methods and copyright notice: + * + * Ken Snyder (ken d snyder at gmail dot com) + * 2008-09-10 + * version 2.0.2 (http://kendsnyder.com/sandbox/date/) + * Creative Commons Attribution License 3.0 (http://creativecommons.org/licenses/by/3.0/) + * + * jqplotToImage function based on Larry Siden's export-jqplot-to-png.js. + * Larry has generously given permission to adapt his code for inclusion + * into jqPlot. + * + * Larry's original code can be found here: + * + * https://github.com/lsiden/export-jqplot-to-png + * + * + */ +(function($){$.jqplot.JSON=window.JSON;if(!window.JSON){$.jqplot.JSON={}}function f(n){return n<10?"0"+n:n}if(typeof Date.prototype.toJSON!=="function"){Date.prototype.toJSON=function(key){return isFinite(this.valueOf())?this.getUTCFullYear()+"-"+f(this.getUTCMonth()+1)+"-"+f(this.getUTCDate())+"T"+f(this.getUTCHours())+":"+f(this.getUTCMinutes())+":"+f(this.getUTCSeconds())+"Z":null};String.prototype.toJSON=Number.prototype.toJSON=Boolean.prototype.toJSON=function(key){return this.valueOf()}}var cx=/[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,escapable=/[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,gap,indent,meta={"\b":"\\b","\t":"\\t","\n":"\\n","\f":"\\f","\r":"\\r",'"':'\\"',"\\":"\\\\"},rep;function quote(string){escapable.lastIndex=0;return escapable.test(string)?'"'+string.replace(escapable,function(a){var c=meta[a];return typeof c==="string"?c:"\\u"+("0000"+a.charCodeAt(0).toString(16)).slice(-4)})+'"':'"'+string+'"'}function str(key,holder){var i,k,v,length,mind=gap,partial,value=holder[key];if(value&&typeof value==="object"&&typeof value.toJSON==="function"){value=value.toJSON(key)}if(typeof rep==="function"){value=rep.call(holder,key,value)}switch(typeof value){case"string":return quote(value);case"number":return isFinite(value)?String(value):"null";case"boolean":case"null":return String(value);case"object":if(!value){return"null"}gap+=indent;partial=[];if(Object.prototype.toString.apply(value)==="[object Array]"){length=value.length;for(i=0;i<length;i+=1){partial[i]=str(i,value)||"null"}v=partial.length===0?"[]":gap?"[\n"+gap+partial.join(",\n"+gap)+"\n"+mind+"]":"["+partial.join(",")+"]";gap=mind;return v}if(rep&&typeof rep==="object"){length=rep.length;for(i=0;i<length;i+=1){k=rep[i];if(typeof k==="string"){v=str(k,value);if(v){partial.push(quote(k)+(gap?": ":":")+v)}}}}else{for(k in value){if(Object.hasOwnProperty.call(value,k)){v=str(k,value);if(v){partial.push(quote(k)+(gap?": ":":")+v)}}}}v=partial.length===0?"{}":gap?"{\n"+gap+partial.join(",\n"+gap)+"\n"+mind+"}":"{"+partial.join(",")+"}";gap=mind;return v}}if(typeof $.jqplot.JSON.stringify!=="function"){$.jqplot.JSON.stringify=function(value,replacer,space){var i;gap="";indent="";if(typeof space==="number"){for(i=0;i<space;i+=1){indent+=" "}}else{if(typeof space==="string"){indent=space}}rep=replacer;if(replacer&&typeof replacer!=="function"&&(typeof replacer!=="object"||typeof replacer.length!=="number")){throw new Error("$.jqplot.JSON.stringify")}return str("",{"":value})}}if(typeof $.jqplot.JSON.parse!=="function"){$.jqplot.JSON.parse=function(text,reviver){var j;function walk(holder,key){var k,v,value=holder[key];if(value&&typeof value==="object"){for(k in value){if(Object.hasOwnProperty.call(value,k)){v=walk(value,k);if(v!==undefined){value[k]=v}else{delete value[k]}}}}return reviver.call(holder,key,value)}text=String(text);cx.lastIndex=0;if(cx.test(text)){text=text.replace(cx,function(a){return"\\u"+("0000"+a.charCodeAt(0).toString(16)).slice(-4)})}if(/^[\],:{}\s]*$/.test(text.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,"@").replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,"]").replace(/(?:^|:|,)(?:\s*\[)+/g,""))){j=eval("("+text+")");return typeof reviver==="function"?walk({"":j},""):j}throw new SyntaxError("$.jqplot.JSON.parse")}}})(jQuery); \ No newline at end of file diff --git a/www/protected/extensions/jqplot/plugins/jqplot.logAxisRenderer.js b/www/protected/extensions/jqplot/plugins/jqplot.logAxisRenderer.js new file mode 100644 index 0000000..1effb05 --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.logAxisRenderer.js @@ -0,0 +1,528 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + */ +(function($) { + /** + * class: $.jqplot.LogAxisRenderer + * A plugin for a jqPlot to render a logarithmic axis. + * + * To use this renderer, include the plugin in your source + * > <script type="text/javascript" language="javascript" src="plugins/jqplot.logAxisRenderer.js"></script> + * + * and supply the appropriate options to your plot + * + * > {axes:{xaxis:{renderer:$.jqplot.LogAxisRenderer}}} + **/ + $.jqplot.LogAxisRenderer = function() { + $.jqplot.LinearAxisRenderer.call(this); + // prop: axisDefaults + // Default properties which will be applied directly to the series. + // + // Group: Properties + // + // Properties + // + // base - the logarithmic base, commonly 2, 10 or Math.E + // tickDistribution - Deprecated. "power" distribution of ticks + // always used. Option has no effect. + this.axisDefaults = { + base : 10, + tickDistribution :'power' + }; + }; + + $.jqplot.LogAxisRenderer.prototype = new $.jqplot.LinearAxisRenderer(); + $.jqplot.LogAxisRenderer.prototype.constructor = $.jqplot.LogAxisRenderer; + + $.jqplot.LogAxisRenderer.prototype.init = function(options) { + // prop: drawBaseline + // True to draw the axis baseline. + this.drawBaseline = true; + // prop: minorTicks + // Number of ticks to add between "major" ticks. + // Major ticks are ticks supplied by user or auto computed. + // Minor ticks cannot be created by user. + this.minorTicks = 'auto'; + this._scalefact = 1.0; + + $.extend(true, this, options); + + this._autoFormatString = '%d'; + this._overrideFormatString = false; + + for (var d in this.renderer.axisDefaults) { + if (this[d] == null) { + this[d] = this.renderer.axisDefaults[d]; + } + } + + this.resetDataBounds(); + }; + + $.jqplot.LogAxisRenderer.prototype.createTicks = function(plot) { + // we're are operating on an axis here + var ticks = this._ticks; + var userTicks = this.ticks; + var name = this.name; + var db = this._dataBounds; + var dim = (this.name.charAt(0) === 'x') ? this._plotDimensions.width : this._plotDimensions.height; + var interval; + var min, max; + var pos1, pos2; + var tt, i; + + var threshold = 30; + // For some reason scalefactor is screwing up ticks. + this._scalefact = (Math.max(dim, threshold+1) - threshold)/300; + + // if we already have ticks, use them. + // ticks must be in order of increasing value. + if (userTicks.length) { + // ticks could be 1D or 2D array of [val, val, ,,,] or [[val, label], [val, label], ...] or mixed + for (i=0; i<userTicks.length; i++){ + var ut = userTicks[i]; + var t = new this.tickRenderer(this.tickOptions); + if (ut.constructor == Array) { + t.value = ut[0]; + t.label = ut[1]; + if (!this.showTicks) { + t.showLabel = false; + t.showMark = false; + } + else if (!this.showTickMarks) { + t.showMark = false; + } + t.setTick(ut[0], this.name); + this._ticks.push(t); + } + + else if ($.isPlainObject(ut)) { + $.extend(true, t, ut); + t.axis = this.name; + this._ticks.push(t); + } + + else { + t.value = ut; + if (!this.showTicks) { + t.showLabel = false; + t.showMark = false; + } + else if (!this.showTickMarks) { + t.showMark = false; + } + t.setTick(ut, this.name); + this._ticks.push(t); + } + } + this.numberTicks = userTicks.length; + this.min = this._ticks[0].value; + this.max = this._ticks[this.numberTicks-1].value; + } + + // we don't have any ticks yet, let's make some! + else if (this.min == null && this.max == null) { + min = db.min * (2 - this.padMin); + max = db.max * this.padMax; + + // if min and max are same, space them out a bit + if (min == max) { + var adj = 0.05; + min = min*(1-adj); + max = max*(1+adj); + } + + // perform some checks + if (this.min != null && this.min <= 0) { + throw('log axis minimum must be greater than 0'); + } + if (this.max != null && this.max <= 0) { + throw('log axis maximum must be greater than 0'); + } + + function findCeil (val) { + var order = Math.pow(10, Math.floor(Math.log(val)/Math.LN10)); + return Math.ceil(val/order) * order; + } + + function findFloor(val) { + var order = Math.pow(10, Math.floor(Math.log(val)/Math.LN10)); + return Math.floor(val/order) * order; + } + + // var range = max - min; + var rmin, rmax; + + // for power distribution, open up range to get a nice power of axis.renderer.base. + // power distribution won't respect the user's min/max settings. + rmin = Math.pow(this.base, Math.floor(Math.log(min)/Math.log(this.base))); + rmax = Math.pow(this.base, Math.ceil(Math.log(max)/Math.log(this.base))); + + // // if min and max are same, space them out a bit + // if (rmin === rmax) { + // var adj = 0.05; + // rmin = rmin*(1-adj); + // rmax = rmax*(1+adj); + // } + + var order = Math.round(Math.log(rmin)/Math.LN10); + + if (this.tickOptions == null || !this.tickOptions.formatString) { + this._overrideFormatString = true; + } + + this.min = rmin; + this.max = rmax; + var range = this.max - this.min; + + var minorTicks = (this.minorTicks === 'auto') ? 0 : this.minorTicks; + var numberTicks; + if (this.numberTicks == null){ + if (dim > 140) { + numberTicks = Math.round(Math.log(this.max/this.min)/Math.log(this.base) + 1); + if (numberTicks < 2) { + numberTicks = 2; + } + if (minorTicks === 0) { + var temp = dim/(numberTicks - 1); + if (temp < 100) { + minorTicks = 0; + } + else if (temp < 190) { + minorTicks = 1; + } + else if (temp < 250) { + minorTicks = 3; + } + else if (temp < 600) { + minorTicks = 4; + } + else { + minorTicks = 9; + } + } + } + else { + numberTicks = 2; + if (minorTicks === 0) { + minorTicks = 1; + } + minorTicks = 0; + } + } + else { + numberTicks = this.numberTicks; + } + + if (order >= 0 && minorTicks !== 3) { + this._autoFormatString = '%d'; + } + // Adjust format string for case with 3 ticks where we'll have like 1, 2.5, 5, 7.5, 10 + else if (order <= 0 && minorTicks === 3) { + var temp = -(order - 1); + this._autoFormatString = '%.'+ Math.abs(order-1) + 'f'; + } + + // Adjust format string for values less than 1. + else if (order < 0) { + var temp = -order; + this._autoFormatString = '%.'+ Math.abs(order) + 'f'; + } + + else { + this._autoFormatString = '%d'; + } + + var to, t, val, tt1, spread, interval; + for (var i=0; i<numberTicks; i++){ + tt = Math.pow(this.base, i - numberTicks + 1) * this.max; + + t = new this.tickRenderer(this.tickOptions); + + if (this._overrideFormatString) { + t.formatString = this._autoFormatString; + } + + if (!this.showTicks) { + t.showLabel = false; + t.showMark = false; + } + else if (!this.showTickMarks) { + t.showMark = false; + } + t.setTick(tt, this.name); + this._ticks.push(t); + + if (minorTicks && i<numberTicks-1) { + tt1 = Math.pow(this.base, i - numberTicks + 2) * this.max; + spread = tt1 - tt; + interval = tt1 / (minorTicks+1); + for (var j=minorTicks-1; j>=0; j--) { + val = tt1-interval*(j+1); + t = new this.tickRenderer(this.tickOptions); + + if (this._overrideFormatString && this._autoFormatString != '') { + t.formatString = this._autoFormatString; + } + if (!this.showTicks) { + t.showLabel = false; + t.showMark = false; + } + else if (!this.showTickMarks) { + t.showMark = false; + } + t.setTick(val, this.name); + this._ticks.push(t); + } + } + } + } + + // min and max are set as would be the case with zooming + else if (this.min != null && this.max != null) { + var opts = $.extend(true, {}, this.tickOptions, {name: this.name, value: null}); + var nt, ti; + // don't have an interval yet, pick one that gives the most + // "round" ticks we can get. + if (this.numberTicks == null && this.tickInterval == null) { + // var threshold = 30; + var tdim = Math.max(dim, threshold+1); + var nttarget = Math.ceil((tdim-threshold)/35 + 1); + + var ret = $.jqplot.LinearTickGenerator.bestConstrainedInterval(this.min, this.max, nttarget); + + this._autoFormatString = ret[3]; + nt = ret[2]; + ti = ret[4]; + + for (var i=0; i<nt; i++) { + opts.value = this.min + i * ti; + t = new this.tickRenderer(opts); + + if (this._overrideFormatString && this._autoFormatString != '') { + t.formatString = this._autoFormatString; + } + if (!this.showTicks) { + t.showLabel = false; + t.showMark = false; + } + else if (!this.showTickMarks) { + t.showMark = false; + } + this._ticks.push(t); + } + } + + // for loose zoom, number ticks and interval are also set. + else if (this.numberTicks != null && this.tickInterval != null) { + nt = this.numberTicks; + for (var i=0; i<nt; i++) { + opts.value = this.min + i * this.tickInterval; + t = new this.tickRenderer(opts); + + if (this._overrideFormatString && this._autoFormatString != '') { + t.formatString = this._autoFormatString; + } + if (!this.showTicks) { + t.showLabel = false; + t.showMark = false; + } + else if (!this.showTickMarks) { + t.showMark = false; + } + this._ticks.push(t); + } + } + } + }; + + $.jqplot.LogAxisRenderer.prototype.pack = function(pos, offsets) { + var lb = parseInt(this.base, 10); + var ticks = this._ticks; + var trans = function (v) { return Math.log(v)/Math.log(lb); }; + var invtrans = function (v) { return Math.pow(Math.E, (Math.log(lb)*v)); }; + var max = trans(this.max); + var min = trans(this.min); + var offmax = offsets.max; + var offmin = offsets.min; + var lshow = (this._label == null) ? false : this._label.show; + + for (var p in pos) { + this._elem.css(p, pos[p]); + } + + this._offsets = offsets; + // pixellength will be + for x axes and - for y axes becasue pixels always measured from top left. + var pixellength = offmax - offmin; + var unitlength = max - min; + + // point to unit and unit to point conversions references to Plot DOM element top left corner. + this.p2u = function(p){ + return invtrans((p - offmin) * unitlength / pixellength + min); + }; + + this.u2p = function(u){ + return (trans(u) - min) * pixellength / unitlength + offmin; + }; + + if (this.name == 'xaxis' || this.name == 'x2axis'){ + this.series_u2p = function(u){ + return (trans(u) - min) * pixellength / unitlength; + }; + this.series_p2u = function(p){ + return invtrans(p * unitlength / pixellength + min); + }; + } + // yaxis is max at top of canvas. + else { + this.series_u2p = function(u){ + return (trans(u) - max) * pixellength / unitlength; + }; + this.series_p2u = function(p){ + return invtrans(p * unitlength / pixellength + max); + }; + } + + if (this.show) { + if (this.name == 'xaxis' || this.name == 'x2axis') { + for (var i=0; i<ticks.length; i++) { + var t = ticks[i]; + if (t.show && t.showLabel) { + var shim; + + if (t.constructor == $.jqplot.CanvasAxisTickRenderer && t.angle) { + switch (t.labelPosition) { + case 'auto': + // position at end + if (t.angle < 0) { + shim = -t.getWidth() + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2; + } + // position at start + else { + shim = -t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2; + } + break; + case 'end': + shim = -t.getWidth() + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2; + break; + case 'start': + shim = -t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2; + break; + case 'middle': + shim = -t.getWidth()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2; + break; + default: + shim = -t.getWidth()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2; + break; + } + } + else { + shim = -t.getWidth()/2; + } + // var shim = t.getWidth()/2; + var val = this.u2p(t.value) + shim + 'px'; + t._elem.css('left', val); + t.pack(); + } + } + if (lshow) { + var w = this._label._elem.outerWidth(true); + this._label._elem.css('left', offmin + pixellength/2 - w/2 + 'px'); + if (this.name == 'xaxis') { + this._label._elem.css('bottom', '0px'); + } + else { + this._label._elem.css('top', '0px'); + } + this._label.pack(); + } + } + else { + for (var i=0; i<ticks.length; i++) { + var t = ticks[i]; + if (t.show && t.showLabel) { + var shim; + if (t.constructor == $.jqplot.CanvasAxisTickRenderer && t.angle) { + switch (t.labelPosition) { + case 'auto': + // position at end + case 'end': + if (t.angle < 0) { + shim = -t._textRenderer.height * Math.cos(-t._textRenderer.angle) / 2; + } + else { + shim = -t.getHeight() + t._textRenderer.height * Math.cos(t._textRenderer.angle) / 2; + } + break; + case 'start': + if (t.angle > 0) { + shim = -t._textRenderer.height * Math.cos(-t._textRenderer.angle) / 2; + } + else { + shim = -t.getHeight() + t._textRenderer.height * Math.cos(t._textRenderer.angle) / 2; + } + break; + case 'middle': + // if (t.angle > 0) { + // shim = -t.getHeight()/2 + t._textRenderer.height * Math.sin(-t._textRenderer.angle) / 2; + // } + // else { + // shim = -t.getHeight()/2 - t._textRenderer.height * Math.sin(t._textRenderer.angle) / 2; + // } + shim = -t.getHeight()/2; + break; + default: + shim = -t.getHeight()/2; + break; + } + } + else { + shim = -t.getHeight()/2; + } + + var val = this.u2p(t.value) + shim + 'px'; + t._elem.css('top', val); + t.pack(); + } + } + if (lshow) { + var h = this._label._elem.outerHeight(true); + this._label._elem.css('top', offmax - pixellength/2 - h/2 + 'px'); + if (this.name == 'yaxis') { + this._label._elem.css('left', '0px'); + } + else { + this._label._elem.css('right', '0px'); + } + this._label.pack(); + } + } + } + }; +})(jQuery); \ No newline at end of file diff --git a/www/protected/extensions/jqplot/plugins/jqplot.logAxisRenderer.min.js b/www/protected/extensions/jqplot/plugins/jqplot.logAxisRenderer.min.js new file mode 100644 index 0000000..0f254da --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.logAxisRenderer.min.js @@ -0,0 +1,57 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + * included jsDate library by Chris Leonello: + * + * Copyright (c) 2010-2011 Chris Leonello + * + * jsDate is currently available for use in all personal or commercial projects + * under both the MIT and GPL version 2.0 licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * jsDate borrows many concepts and ideas from the Date Instance + * Methods by Ken Snyder along with some parts of Ken's actual code. + * + * Ken's origianl Date Instance Methods and copyright notice: + * + * Ken Snyder (ken d snyder at gmail dot com) + * 2008-09-10 + * version 2.0.2 (http://kendsnyder.com/sandbox/date/) + * Creative Commons Attribution License 3.0 (http://creativecommons.org/licenses/by/3.0/) + * + * jqplotToImage function based on Larry Siden's export-jqplot-to-png.js. + * Larry has generously given permission to adapt his code for inclusion + * into jqPlot. + * + * Larry's original code can be found here: + * + * https://github.com/lsiden/export-jqplot-to-png + * + * + */ +(function(a){a.jqplot.LogAxisRenderer=function(){a.jqplot.LinearAxisRenderer.call(this);this.axisDefaults={base:10,tickDistribution:"power"}};a.jqplot.LogAxisRenderer.prototype=new a.jqplot.LinearAxisRenderer();a.jqplot.LogAxisRenderer.prototype.constructor=a.jqplot.LogAxisRenderer;a.jqplot.LogAxisRenderer.prototype.init=function(b){this.drawBaseline=true;this.minorTicks="auto";this._scalefact=1;a.extend(true,this,b);this._autoFormatString="%d";this._overrideFormatString=false;for(var c in this.renderer.axisDefaults){if(this[c]==null){this[c]=this.renderer.axisDefaults[c]}}this.resetDataBounds()};a.jqplot.LogAxisRenderer.prototype.createTicks=function(d){var G=this._ticks;var w=this.ticks;var s=this.name;var u=this._dataBounds;var b=(this.name.charAt(0)==="x")?this._plotDimensions.width:this._plotDimensions.height;var k;var N,v;var m,l;var M,K;var g=30;this._scalefact=(Math.max(b,g+1)-g)/300;if(w.length){for(K=0;K<w.length;K++){var A=w[K];var H=new this.tickRenderer(this.tickOptions);if(A.constructor==Array){H.value=A[0];H.label=A[1];if(!this.showTicks){H.showLabel=false;H.showMark=false}else{if(!this.showTickMarks){H.showMark=false}}H.setTick(A[0],this.name);this._ticks.push(H)}else{if(a.isPlainObject(A)){a.extend(true,H,A);H.axis=this.name;this._ticks.push(H)}else{H.value=A;if(!this.showTicks){H.showLabel=false;H.showMark=false}else{if(!this.showTickMarks){H.showMark=false}}H.setTick(A,this.name);this._ticks.push(H)}}}this.numberTicks=w.length;this.min=this._ticks[0].value;this.max=this._ticks[this.numberTicks-1].value}else{if(this.min==null&&this.max==null){N=u.min*(2-this.padMin);v=u.max*this.padMax;if(N==v){var c=0.05;N=N*(1-c);v=v*(1+c)}if(this.min!=null&&this.min<=0){throw ("log axis minimum must be greater than 0")}if(this.max!=null&&this.max<=0){throw ("log axis maximum must be greater than 0")}function f(j){var i=Math.pow(10,Math.floor(Math.log(j)/Math.LN10));return Math.ceil(j/i)*i}function x(j){var i=Math.pow(10,Math.floor(Math.log(j)/Math.LN10));return Math.floor(j/i)*i}var F,r;F=Math.pow(this.base,Math.floor(Math.log(N)/Math.log(this.base)));r=Math.pow(this.base,Math.ceil(Math.log(v)/Math.log(this.base)));var E=Math.round(Math.log(F)/Math.LN10);if(this.tickOptions==null||!this.tickOptions.formatString){this._overrideFormatString=true}this.min=F;this.max=r;var q=this.max-this.min;var C=(this.minorTicks==="auto")?0:this.minorTicks;var h;if(this.numberTicks==null){if(b>140){h=Math.round(Math.log(this.max/this.min)/Math.log(this.base)+1);if(h<2){h=2}if(C===0){var o=b/(h-1);if(o<100){C=0}else{if(o<190){C=1}else{if(o<250){C=3}else{if(o<600){C=4}else{C=9}}}}}}else{h=2;if(C===0){C=1}C=0}}else{h=this.numberTicks}if(E>=0&&C!==3){this._autoFormatString="%d"}else{if(E<=0&&C===3){var o=-(E-1);this._autoFormatString="%."+Math.abs(E-1)+"f"}else{if(E<0){var o=-E;this._autoFormatString="%."+Math.abs(E)+"f"}else{this._autoFormatString="%d"}}}var O,H,z,p,n,k;for(var K=0;K<h;K++){M=Math.pow(this.base,K-h+1)*this.max;H=new this.tickRenderer(this.tickOptions);if(this._overrideFormatString){H.formatString=this._autoFormatString}if(!this.showTicks){H.showLabel=false;H.showMark=false}else{if(!this.showTickMarks){H.showMark=false}}H.setTick(M,this.name);this._ticks.push(H);if(C&&K<h-1){p=Math.pow(this.base,K-h+2)*this.max;n=p-M;k=p/(C+1);for(var J=C-1;J>=0;J--){z=p-k*(J+1);H=new this.tickRenderer(this.tickOptions);if(this._overrideFormatString&&this._autoFormatString!=""){H.formatString=this._autoFormatString}if(!this.showTicks){H.showLabel=false;H.showMark=false}else{if(!this.showTickMarks){H.showMark=false}}H.setTick(z,this.name);this._ticks.push(H)}}}}else{if(this.min!=null&&this.max!=null){var y=a.extend(true,{},this.tickOptions,{name:this.name,value:null});var I,e;if(this.numberTicks==null&&this.tickInterval==null){var D=Math.max(b,g+1);var L=Math.ceil((D-g)/35+1);var B=a.jqplot.LinearTickGenerator.bestConstrainedInterval(this.min,this.max,L);this._autoFormatString=B[3];I=B[2];e=B[4];for(var K=0;K<I;K++){y.value=this.min+K*e;H=new this.tickRenderer(y);if(this._overrideFormatString&&this._autoFormatString!=""){H.formatString=this._autoFormatString}if(!this.showTicks){H.showLabel=false;H.showMark=false}else{if(!this.showTickMarks){H.showMark=false}}this._ticks.push(H)}}else{if(this.numberTicks!=null&&this.tickInterval!=null){I=this.numberTicks;for(var K=0;K<I;K++){y.value=this.min+K*this.tickInterval;H=new this.tickRenderer(y);if(this._overrideFormatString&&this._autoFormatString!=""){H.formatString=this._autoFormatString}if(!this.showTicks){H.showLabel=false;H.showMark=false}else{if(!this.showTickMarks){H.showMark=false}}this._ticks.push(H)}}}}}}};a.jqplot.LogAxisRenderer.prototype.pack=function(f,e){var r=parseInt(this.base,10);var y=this._ticks;var d=function(h){return Math.log(h)/Math.log(r)};var b=function(h){return Math.pow(Math.E,(Math.log(r)*h))};var u=d(this.max);var s=d(this.min);var m=e.max;var k=e.min;var o=(this._label==null)?false:this._label.show;for(var q in f){this._elem.css(q,f[q])}this._offsets=e;var g=m-k;var j=u-s;this.p2u=function(h){return b((h-k)*j/g+s)};this.u2p=function(h){return(d(h)-s)*g/j+k};if(this.name=="xaxis"||this.name=="x2axis"){this.series_u2p=function(h){return(d(h)-s)*g/j};this.series_p2u=function(h){return b(h*j/g+s)}}else{this.series_u2p=function(h){return(d(h)-u)*g/j};this.series_p2u=function(h){return b(h*j/g+u)}}if(this.show){if(this.name=="xaxis"||this.name=="x2axis"){for(var v=0;v<y.length;v++){var n=y[v];if(n.show&&n.showLabel){var c;if(n.constructor==a.jqplot.CanvasAxisTickRenderer&&n.angle){switch(n.labelPosition){case"auto":if(n.angle<0){c=-n.getWidth()+n._textRenderer.height*Math.sin(-n._textRenderer.angle)/2}else{c=-n._textRenderer.height*Math.sin(n._textRenderer.angle)/2}break;case"end":c=-n.getWidth()+n._textRenderer.height*Math.sin(-n._textRenderer.angle)/2;break;case"start":c=-n._textRenderer.height*Math.sin(n._textRenderer.angle)/2;break;case"middle":c=-n.getWidth()/2+n._textRenderer.height*Math.sin(-n._textRenderer.angle)/2;break;default:c=-n.getWidth()/2+n._textRenderer.height*Math.sin(-n._textRenderer.angle)/2;break}}else{c=-n.getWidth()/2}var z=this.u2p(n.value)+c+"px";n._elem.css("left",z);n.pack()}}if(o){var l=this._label._elem.outerWidth(true);this._label._elem.css("left",k+g/2-l/2+"px");if(this.name=="xaxis"){this._label._elem.css("bottom","0px")}else{this._label._elem.css("top","0px")}this._label.pack()}}else{for(var v=0;v<y.length;v++){var n=y[v];if(n.show&&n.showLabel){var c;if(n.constructor==a.jqplot.CanvasAxisTickRenderer&&n.angle){switch(n.labelPosition){case"auto":case"end":if(n.angle<0){c=-n._textRenderer.height*Math.cos(-n._textRenderer.angle)/2}else{c=-n.getHeight()+n._textRenderer.height*Math.cos(n._textRenderer.angle)/2}break;case"start":if(n.angle>0){c=-n._textRenderer.height*Math.cos(-n._textRenderer.angle)/2}else{c=-n.getHeight()+n._textRenderer.height*Math.cos(n._textRenderer.angle)/2}break;case"middle":c=-n.getHeight()/2;break;default:c=-n.getHeight()/2;break}}else{c=-n.getHeight()/2}var z=this.u2p(n.value)+c+"px";n._elem.css("top",z);n.pack()}}if(o){var x=this._label._elem.outerHeight(true);this._label._elem.css("top",m-g/2-x/2+"px");if(this.name=="yaxis"){this._label._elem.css("left","0px")}else{this._label._elem.css("right","0px")}this._label.pack()}}}}})(jQuery); \ No newline at end of file diff --git a/www/protected/extensions/jqplot/plugins/jqplot.meterGaugeRenderer.js b/www/protected/extensions/jqplot/plugins/jqplot.meterGaugeRenderer.js new file mode 100644 index 0000000..1836cee --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.meterGaugeRenderer.js @@ -0,0 +1,1029 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + */ +(function($) { + /** + * Class: $.jqplot.MeterGaugeRenderer + * Plugin renderer to draw a meter gauge chart. + * + * Data consists of a single series with 1 data point to position the gauge needle. + * + * To use this renderer, you need to include the + * meter gauge renderer plugin, for example: + * + * > <script type="text/javascript" src="plugins/jqplot.meterGaugeRenderer.js"></script> + * + * Properties described here are passed into the $.jqplot function + * as options on the series renderer. For example: + * + * > plot0 = $.jqplot('chart0',[[18]],{ + * > title: 'Network Speed', + * > seriesDefaults: { + * > renderer: $.jqplot.MeterGaugeRenderer, + * > rendererOptions: { + * > label: 'MB/s' + * > } + * > } + * > }); + * + * A meterGauge plot does not support events. + */ + $.jqplot.MeterGaugeRenderer = function(){ + $.jqplot.LineRenderer.call(this); + }; + + $.jqplot.MeterGaugeRenderer.prototype = new $.jqplot.LineRenderer(); + $.jqplot.MeterGaugeRenderer.prototype.constructor = $.jqplot.MeterGaugeRenderer; + + // called with scope of a series + $.jqplot.MeterGaugeRenderer.prototype.init = function(options) { + // Group: Properties + // + // prop: diameter + // Outer diameter of the meterGauge, auto computed by default + this.diameter = null; + // prop: padding + // padding between the meterGauge and plot edges, auto + // calculated by default. + this.padding = null; + // prop: shadowOffset + // offset of the shadow from the gauge ring and offset of + // each succesive stroke of the shadow from the last. + this.shadowOffset = 2; + // prop: shadowAlpha + // transparency of the shadow (0 = transparent, 1 = opaque) + this.shadowAlpha = 0.07; + // prop: shadowDepth + // number of strokes to apply to the shadow, + // each stroke offset shadowOffset from the last. + this.shadowDepth = 4; + // prop: background + // background color of the inside of the gauge. + this.background = "#efefef"; + // prop: ringColor + // color of the outer ring, hub, and needle of the gauge. + this.ringColor = "#BBC6D0"; + // needle color not implemented yet. + this.needleColor = "#C3D3E5"; + // prop: tickColor + // color of the tick marks around the gauge. + this.tickColor = "989898"; + // prop: ringWidth + // width of the ring around the gauge. Auto computed by default. + this.ringWidth = null; + // prop: min + // Minimum value on the gauge. Auto computed by default + this.min; + // prop: max + // Maximum value on the gauge. Auto computed by default + this.max; + // prop: ticks + // Array of tick values. Auto computed by default. + this.ticks = []; + // prop: showTicks + // true to show ticks around gauge. + this.showTicks = true; + // prop: showTickLabels + // true to show tick labels next to ticks. + this.showTickLabels = true; + // prop: label + // A gauge label like 'kph' or 'Volts' + this.label = null; + // prop: labelHeightAdjust + // Number of Pixels to offset the label up (-) or down (+) from its default position. + this.labelHeightAdjust = 0; + // prop: labelPosition + // Where to position the label, either 'inside' or 'bottom'. + this.labelPosition = 'inside'; + // prop: intervals + // Array of ranges to be drawn around the gauge. + // Array of form: + // > [value1, value2, ...] + // indicating the values for the first, second, ... intervals. + this.intervals = []; + // prop: intervalColors + // Array of colors to use for the intervals. + this.intervalColors = [ "#4bb2c5", "#EAA228", "#c5b47f", "#579575", "#839557", "#958c12", "#953579", "#4b5de4", "#d8b83f", "#ff5800", "#0085cc", "#c747a3", "#cddf54", "#FBD178", "#26B4E3", "#bd70c7"]; + // prop: intervalInnerRadius + // Radius of the inner circle of the interval ring. + this.intervalInnerRadius = null; + // prop: intervalOuterRadius + // Radius of the outer circle of the interval ring. + this.intervalOuterRadius = null; + this.tickRenderer = $.jqplot.MeterGaugeTickRenderer; + // ticks spaced every 1, 2, 2.5, 5, 10, 20, .1, .2, .25, .5, etc. + this.tickPositions = [1, 2, 2.5, 5, 10]; + // prop: tickSpacing + // Degrees between ticks. This is a target number, if + // incompatible span and ticks are supplied, a suitable + // spacing close to this value will be computed. + this.tickSpacing = 30; + this.numberMinorTicks = null; + // prop: hubRadius + // Radius of the hub at the bottom center of gauge which the needle attaches to. + // Auto computed by default + this.hubRadius = null; + // prop: tickPadding + // padding of the tick marks to the outer ring and the tick labels to marks. + // Auto computed by default. + this.tickPadding = null; + // prop: needleThickness + // Maximum thickness the needle. Auto computed by default. + this.needleThickness = null; + // prop: needlePad + // Padding between needle and inner edge of the ring when the needle is at the min or max gauge value. + this.needlePad = 6; + // prop: pegNeedle + // True will stop needle just below/above the min/max values if data is below/above min/max, + // as if the meter is "pegged". + this.pegNeedle = true; + this._type = 'meterGauge'; + + $.extend(true, this, options); + this.type = null; + this.numberTicks = null; + this.tickInterval = null; + // span, the sweep (in degrees) from min to max. This gauge is + // a semi-circle. + this.span = 180; + // get rid of this nonsense + // this.innerSpan = this.span; + if (this.type == 'circular') { + this.semiCircular = false; + } + else if (this.type != 'circular') { + this.semiCircular = true; + } + else { + this.semiCircular = (this.span <= 180) ? true : false; + } + this._tickPoints = []; + // reference to label element. + this._labelElem = null; + + // start the gauge at the beginning of the span + this.startAngle = (90 + (360 - this.span)/2) * Math.PI/180; + this.endAngle = (90 - (360 - this.span)/2) * Math.PI/180; + + this.setmin = !!(this.min == null); + this.setmax = !!(this.max == null); + + // if given intervals and is an array of values, create labels and colors. + if (this.intervals.length) { + if (this.intervals[0].length == null || this.intervals.length == 1) { + for (var i=0; i<this.intervals.length; i++) { + this.intervals[i] = [this.intervals[i], this.intervals[i], this.intervalColors[i]]; + } + } + else if (this.intervals[0].length == 2) { + for (i=0; i<this.intervals.length; i++) { + this.intervals[i] = [this.intervals[i][0], this.intervals[i][1], this.intervalColors[i]]; + } + } + } + + // compute min, max and ticks if not supplied: + if (this.ticks.length) { + if (this.ticks[0].length == null || this.ticks[0].length == 1) { + for (var i=0; i<this.ticks.length; i++) { + this.ticks[i] = [this.ticks[i], this.ticks[i]]; + } + } + this.min = (this.min == null) ? this.ticks[0][0] : this.min; + this.max = (this.max == null) ? this.ticks[this.ticks.length-1][0] : this.max; + this.setmin = false; + this.setmax = false; + this.numberTicks = this.ticks.length; + this.tickInterval = this.ticks[1][0] - this.ticks[0][0]; + this.tickFactor = Math.floor(parseFloat((Math.log(this.tickInterval)/Math.log(10)).toFixed(11))); + // use the first interal to calculate minor ticks; + this.numberMinorTicks = getnmt(this.tickPositions, this.tickInterval, this.tickFactor); + if (!this.numberMinorTicks) { + this.numberMinorTicks = getnmt(this.tickPositions, this.tickInterval, this.tickFactor-1); + } + if (!this.numberMinorTicks) { + this.numberMinorTicks = 1; + } + } + + else if (this.intervals.length) { + this.min = (this.min == null) ? 0 : this.min; + this.setmin = false; + if (this.max == null) { + if (this.intervals[this.intervals.length-1][0] >= this.data[0][1]) { + this.max = this.intervals[this.intervals.length-1][0]; + this.setmax = false; + } + } + else { + this.setmax = false; + } + } + + else { + // no ticks and no intervals supplied, put needle in middle + this.min = (this.min == null) ? 0 : this.min; + this.setmin = false; + if (this.max == null) { + this.max = this.data[0][1] * 1.25; + this.setmax = true; + } + else { + this.setmax = false; + } + } + }; + + $.jqplot.MeterGaugeRenderer.prototype.setGridData = function(plot) { + // set gridData property. This will hold angle in radians of each data point. + var stack = []; + var td = []; + var sa = this.startAngle; + for (var i=0; i<this.data.length; i++){ + stack.push(this.data[i][1]); + td.push([this.data[i][0]]); + if (i>0) { + stack[i] += stack[i-1]; + } + } + var fact = Math.PI*2/stack[stack.length - 1]; + + for (var i=0; i<stack.length; i++) { + td[i][1] = stack[i] * fact; + } + this.gridData = td; + }; + + $.jqplot.MeterGaugeRenderer.prototype.makeGridData = function(data, plot) { + var stack = []; + var td = []; + var sa = this.startAngle; + for (var i=0; i<data.length; i++){ + stack.push(data[i][1]); + td.push([data[i][0]]); + if (i>0) { + stack[i] += stack[i-1]; + } + } + var fact = Math.PI*2/stack[stack.length - 1]; + + for (var i=0; i<stack.length; i++) { + td[i][1] = stack[i] * fact; + } + return td; + }; + + + function getnmt(pos, interval, fact) { + var temp; + for (var i=pos.length-1; i>=0; i--) { + temp = interval/(pos[i] * Math.pow(10, fact)); + if (temp == 4 || temp == 5) { + return temp - 1; + } + } + return null; + } + + // called with scope of series + $.jqplot.MeterGaugeRenderer.prototype.draw = function (ctx, gd, options) { + var i; + var opts = (options != undefined) ? options : {}; + // offset and direction of offset due to legend placement + var offx = 0; + var offy = 0; + var trans = 1; + if (options.legendInfo && options.legendInfo.placement == 'inside') { + var li = options.legendInfo; + switch (li.location) { + case 'nw': + offx = li.width + li.xoffset; + break; + case 'w': + offx = li.width + li.xoffset; + break; + case 'sw': + offx = li.width + li.xoffset; + break; + case 'ne': + offx = li.width + li.xoffset; + trans = -1; + break; + case 'e': + offx = li.width + li.xoffset; + trans = -1; + break; + case 'se': + offx = li.width + li.xoffset; + trans = -1; + break; + case 'n': + offy = li.height + li.yoffset; + break; + case 's': + offy = li.height + li.yoffset; + trans = -1; + break; + default: + break; + } + } + + + + // pre-draw so can get it's dimensions. + if (this.label) { + this._labelElem = $('<div class="jqplot-meterGauge-label" style="position:absolute;">'+this.label+'</div>'); + this.canvas._elem.after(this._labelElem); + } + + var shadow = (opts.shadow != undefined) ? opts.shadow : this.shadow; + var showLine = (opts.showLine != undefined) ? opts.showLine : this.showLine; + var fill = (opts.fill != undefined) ? opts.fill : this.fill; + var cw = ctx.canvas.width; + var ch = ctx.canvas.height; + if (this.padding == null) { + this.padding = Math.round(Math.min(cw, ch)/30); + } + var w = cw - offx - 2 * this.padding; + var h = ch - offy - 2 * this.padding; + if (this.labelPosition == 'bottom' && this.label) { + h -= this._labelElem.outerHeight(true); + } + var mindim = Math.min(w,h); + var d = mindim; + + if (!this.diameter) { + if (this.semiCircular) { + if ( w >= 2*h) { + if (!this.ringWidth) { + this.ringWidth = 2*h/35; + } + this.needleThickness = this.needleThickness || 2+Math.pow(this.ringWidth, 0.8); + this.innerPad = this.ringWidth/2 + this.needleThickness/2 + this.needlePad; + this.diameter = 2 * (h - 2*this.innerPad); + } + else { + if (!this.ringWidth) { + this.ringWidth = w/35; + } + this.needleThickness = this.needleThickness || 2+Math.pow(this.ringWidth, 0.8); + this.innerPad = this.ringWidth/2 + this.needleThickness/2 + this.needlePad; + this.diameter = w - 2*this.innerPad - this.ringWidth - this.padding; + } + // center taking into account legend and over draw for gauge bottom below hub. + // this will be center of hub. + this._center = [(cw - trans * offx)/2 + trans * offx, (ch + trans*offy - this.padding - this.ringWidth - this.innerPad)]; + } + else { + if (!this.ringWidth) { + this.ringWidth = d/35; + } + this.needleThickness = this.needleThickness || 2+Math.pow(this.ringWidth, 0.8); + this.innerPad = 0; + this.diameter = d - this.ringWidth; + // center in middle of canvas taking into account legend. + // will be center of hub. + this._center = [(cw-trans*offx)/2 + trans * offx, (ch-trans*offy)/2 + trans * offy]; + } + } + + + if (this._labelElem && this.labelPosition == 'bottom') { + this._center[1] -= this._labelElem.outerHeight(true); + } + + this._radius = this.diameter/2; + + this.tickSpacing = 6000/this.diameter; + + if (!this.hubRadius) { + this.hubRadius = this.diameter/18; + } + + this.shadowOffset = 0.5 + this.ringWidth/9; + this.shadowWidth = this.ringWidth*1; + + this.tickPadding = 3 + Math.pow(this.diameter/20, 0.7); + this.tickOuterRadius = this._radius - this.ringWidth/2 - this.tickPadding; + this.tickLength = (this.showTicks) ? this._radius/13 : 0; + + if (this.ticks.length == 0) { + // no ticks, lets make some. + var max = this.max, + min = this.min, + setmax = this.setmax, + setmin = this.setmin, + ti = (max - min) * this.tickSpacing / this.span; + var tf = Math.floor(parseFloat((Math.log(ti)/Math.log(10)).toFixed(11))); + var tp = (ti/Math.pow(10, tf)); + (tp > 2 && tp <= 2.5) ? tp = 2.5 : tp = Math.ceil(tp); + var t = this.tickPositions; + var tpindex, nt; + + for (i=0; i<t.length; i++) { + if (tp == t[i] || i && t[i-1] < tp && tp < t[i]) { + ti = t[i]*Math.pow(10, tf); + tpindex = i; + } + } + + for (i=0; i<t.length; i++) { + if (tp == t[i] || i && t[i-1] < tp && tp < t[i]) { + ti = t[i]*Math.pow(10, tf); + nt = Math.ceil((max - min) / ti); + } + } + + // both max and min are free + if (setmax && setmin) { + var tmin = (min > 0) ? min - min % ti : min - min % ti - ti; + if (!this.forceZero) { + var diff = Math.min(min - tmin, 0.8*ti); + var ntp = Math.floor(diff/t[tpindex]); + if (ntp > 1) { + tmin = tmin + t[tpindex] * (ntp-1); + if (parseInt(tmin, 10) != tmin && parseInt(tmin-t[tpindex], 10) == tmin-t[tpindex]) { + tmin = tmin - t[tpindex]; + } + } + } + if (min == tmin) { + min -= ti; + } + else { + // tmin should always be lower than dataMin + if (min - tmin > 0.23*ti) { + min = tmin; + } + else { + min = tmin -ti; + nt += 1; + } + } + nt += 1; + var tmax = min + (nt - 1) * ti; + if (max >= tmax) { + tmax += ti; + nt += 1; + } + // now tmax should always be mroe than dataMax + if (tmax - max < 0.23*ti) { + tmax += ti; + nt += 1; + } + this.max = max = tmax; + this.min = min; + + this.tickInterval = ti; + this.numberTicks = nt; + var it; + for (i=0; i<nt; i++) { + it = parseFloat((min+i*ti).toFixed(11)); + this.ticks.push([it, it]); + } + this.max = this.ticks[nt-1][1]; + + this.tickFactor = tf; + // determine number of minor ticks + + this.numberMinorTicks = getnmt(this.tickPositions, this.tickInterval, this.tickFactor); + + if (!this.numberMinorTicks) { + this.numberMinorTicks = getnmt(this.tickPositions, this.tickInterval, this.tickFactor-1); + } + } + // max is free, min is fixed + else if (setmax) { + var tmax = min + (nt - 1) * ti; + if (max >= tmax) { + max = tmax + ti; + nt += 1; + } + else { + max = tmax; + } + + this.tickInterval = this.tickInterval || ti; + this.numberTicks = this.numberTicks || nt; + var it; + for (i=0; i<this.numberTicks; i++) { + it = parseFloat((min+i*this.tickInterval).toFixed(11)); + this.ticks.push([it, it]); + } + this.max = this.ticks[this.numberTicks-1][1]; + + this.tickFactor = tf; + // determine number of minor ticks + this.numberMinorTicks = getnmt(this.tickPositions, this.tickInterval, this.tickFactor); + + if (!this.numberMinorTicks) { + this.numberMinorTicks = getnmt(this.tickPositions, this.tickInterval, this.tickFactor-1); + } + } + + // not setting max or min + if (!setmax && !setmin) { + var range = this.max - this.min; + tf = Math.floor(parseFloat((Math.log(range)/Math.log(10)).toFixed(11))) - 1; + var nticks = [5,6,4,7,3,8,9,10,2], res, numticks, nonSigDigits=0, sigRange; + // check to see how many zeros are at the end of the range + if (range > 1) { + var rstr = String(range); + if (rstr.search(/\./) == -1) { + var pos = rstr.search(/0+$/); + nonSigDigits = (pos > 0) ? rstr.length - pos - 1 : 0; + } + } + sigRange = range/Math.pow(10, nonSigDigits); + for (i=0; i<nticks.length; i++) { + res = sigRange/(nticks[i]-1); + if (res == parseInt(res, 10)) { + this.numberTicks = nticks[i]; + this.tickInterval = range/(this.numberTicks-1); + this.tickFactor = tf+1; + break; + } + } + var it; + for (i=0; i<this.numberTicks; i++) { + it = parseFloat((this.min+i*this.tickInterval).toFixed(11)); + this.ticks.push([it, it]); + } + // determine number of minor ticks + this.numberMinorTicks = getnmt(this.tickPositions, this.tickInterval, this.tickFactor); + + if (!this.numberMinorTicks) { + this.numberMinorTicks = getnmt(this.tickPositions, this.tickInterval, this.tickFactor-1); + } + + if (!this.numberMinorTicks) { + this.numberMinorTicks = 1; + var nums = [4, 5, 3, 6, 2]; + for (i=0; i<5; i++) { + var temp = this.tickInterval/nums[i]; + if (temp == parseInt(temp, 10)) { + this.numberMinorTicks = nums[i]-1; + break; + } + } + } + } + } + + + var r = this._radius, + sa = this.startAngle, + ea = this.endAngle, + pi = Math.PI, + hpi = Math.PI/2; + + if (this.semiCircular) { + var overAngle = Math.atan(this.innerPad/r), + outersa = this.outerStartAngle = sa - overAngle, + outerea = this.outerEndAngle = ea + overAngle, + hubsa = this.hubStartAngle = sa - Math.atan(this.innerPad/this.hubRadius*2), + hubea = this.hubEndAngle = ea + Math.atan(this.innerPad/this.hubRadius*2); + + ctx.save(); + + ctx.translate(this._center[0], this._center[1]); + ctx.lineJoin = "round"; + ctx.lineCap = "round"; + + // draw the innerbackground + ctx.save(); + ctx.beginPath(); + ctx.fillStyle = this.background; + ctx.arc(0, 0, r, outersa, outerea, false); + ctx.closePath(); + ctx.fill(); + ctx.restore(); + + // draw the shadow + // the outer ring. + var shadowColor = 'rgba(0,0,0,'+this.shadowAlpha+')'; + ctx.save(); + for (var i=0; i<this.shadowDepth; i++) { + ctx.translate(this.shadowOffset*Math.cos(this.shadowAngle/180*Math.PI), this.shadowOffset*Math.sin(this.shadowAngle/180*Math.PI)); + ctx.beginPath(); + ctx.strokeStyle = shadowColor; + ctx.lineWidth = this.shadowWidth; + ctx.arc(0 ,0, r, outersa, outerea, false); + ctx.closePath(); + ctx.stroke(); + } + ctx.restore(); + + // the inner hub. + ctx.save(); + var tempd = parseInt((this.shadowDepth+1)/2, 10); + for (var i=0; i<tempd; i++) { + ctx.translate(this.shadowOffset*Math.cos(this.shadowAngle/180*Math.PI), this.shadowOffset*Math.sin(this.shadowAngle/180*Math.PI)); + ctx.beginPath(); + ctx.fillStyle = shadowColor; + ctx.arc(0 ,0, this.hubRadius, hubsa, hubea, false); + ctx.closePath(); + ctx.fill(); + } + ctx.restore(); + + // draw the outer ring. + ctx.save(); + ctx.beginPath(); + ctx.strokeStyle = this.ringColor; + ctx.lineWidth = this.ringWidth; + ctx.arc(0 ,0, r, outersa, outerea, false); + ctx.closePath(); + ctx.stroke(); + ctx.restore(); + + // draw the hub + + ctx.save(); + ctx.beginPath(); + ctx.fillStyle = this.ringColor; + ctx.arc(0 ,0, this.hubRadius,hubsa, hubea, false); + ctx.closePath(); + ctx.fill(); + ctx.restore(); + + // draw the ticks + if (this.showTicks) { + ctx.save(); + var orad = this.tickOuterRadius, + tl = this.tickLength, + mtl = tl/2, + nmt = this.numberMinorTicks, + ts = this.span * Math.PI / 180 / (this.ticks.length-1), + mts = ts/(nmt + 1); + + for (i = 0; i<this.ticks.length; i++) { + ctx.beginPath(); + ctx.lineWidth = 1.5 + this.diameter/360; + ctx.strokeStyle = this.ringColor; + var wps = ts*i+sa; + ctx.moveTo(-orad * Math.cos(ts*i+sa), orad * Math.sin(ts*i+sa)); + ctx.lineTo(-(orad-tl) * Math.cos(ts*i+sa), (orad - tl) * Math.sin(ts*i+sa)); + this._tickPoints.push([(orad-tl) * Math.cos(ts*i+sa) + this._center[0] + this.canvas._offsets.left, (orad - tl) * Math.sin(ts*i+sa) + this._center[1] + this.canvas._offsets.top, ts*i+sa]); + ctx.stroke(); + ctx.lineWidth = 1.0 + this.diameter/440; + if (i<this.ticks.length-1) { + for (var j=1; j<=nmt; j++) { + ctx.beginPath(); + ctx.moveTo(-orad * Math.cos(ts*i+mts*j+sa), orad * Math.sin(ts*i+mts*j+sa)); + ctx.lineTo(-(orad-mtl) * Math.cos(ts*i+mts*j+sa), (orad-mtl) * Math.sin(ts*i+mts*j+sa)); + ctx.stroke(); + } + } + } + ctx.restore(); + } + + // draw the tick labels + if (this.showTickLabels) { + var elem, l, t, ew, eh, dim, maxdim=0; + var tp = this.tickPadding * (1 - 1/(this.diameter/80+1)); + for (i=0; i<this.ticks.length; i++) { + elem = $('<div class="jqplot-meterGauge-tick" style="position:absolute;">'+this.ticks[i][1]+'</div>'); + this.canvas._elem.after(elem); + ew = elem.outerWidth(true); + eh = elem.outerHeight(true); + l = this._tickPoints[i][0] - ew * (this._tickPoints[i][2]-Math.PI)/Math.PI - tp * Math.cos(this._tickPoints[i][2]); + t = this._tickPoints[i][1] - eh/2 + eh/2 * Math.pow(Math.abs((Math.sin(this._tickPoints[i][2]))), 0.5) + tp/3 * Math.pow(Math.abs((Math.sin(this._tickPoints[i][2]))), 0.5) ; + // t = this._tickPoints[i][1] - eh/2 - eh/2 * Math.sin(this._tickPoints[i][2]) - tp/2 * Math.sin(this._tickPoints[i][2]); + elem.css({left:l, top:t}); + dim = ew*Math.cos(this._tickPoints[i][2]) + eh*Math.sin(Math.PI/2+this._tickPoints[i][2]/2); + maxdim = (dim > maxdim) ? dim : maxdim; + } + } + + // draw the gauge label + if (this.label && this.labelPosition == 'inside') { + var l = this._center[0] + this.canvas._offsets.left; + var tp = this.tickPadding * (1 - 1/(this.diameter/80+1)); + var t = 0.5*(this._center[1] + this.canvas._offsets.top - this.hubRadius) + 0.5*(this._center[1] + this.canvas._offsets.top - this.tickOuterRadius + this.tickLength + tp) + this.labelHeightAdjust; + // this._labelElem = $('<div class="jqplot-meterGauge-label" style="position:absolute;">'+this.label+'</div>'); + // this.canvas._elem.after(this._labelElem); + l -= this._labelElem.outerWidth(true)/2; + t -= this._labelElem.outerHeight(true)/2; + this._labelElem.css({left:l, top:t}); + } + + else if (this.label && this.labelPosition == 'bottom') { + var l = this._center[0] + this.canvas._offsets.left - this._labelElem.outerWidth(true)/2; + var t = this._center[1] + this.canvas._offsets.top + this.innerPad + + this.ringWidth + this.padding + this.labelHeightAdjust; + this._labelElem.css({left:l, top:t}); + + } + + // draw the intervals + + ctx.save(); + var inner = this.intervalInnerRadius || this.hubRadius * 1.5; + if (this.intervalOuterRadius == null) { + if (this.showTickLabels) { + var outer = (this.tickOuterRadius - this.tickLength - this.tickPadding - this.diameter/8); + } + else { + var outer = (this.tickOuterRadius - this.tickLength - this.diameter/16); + } + } + else { + var outer = this.intervalOuterRadius; + } + var range = this.max - this.min; + var intrange = this.intervals[this.intervals.length-1] - this.min; + var start, end, span = this.span*Math.PI/180; + for (i=0; i<this.intervals.length; i++) { + start = (i == 0) ? sa : sa + (this.intervals[i-1][0] - this.min)*span/range; + if (start < 0) { + start = 0; + } + end = sa + (this.intervals[i][0] - this.min)*span/range; + if (end < 0) { + end = 0; + } + ctx.beginPath(); + ctx.fillStyle = this.intervals[i][2]; + ctx.arc(0, 0, inner, start, end, false); + ctx.lineTo(outer*Math.cos(end), outer*Math.sin(end)); + ctx.arc(0, 0, outer, end, start, true); + ctx.lineTo(inner*Math.cos(start), inner*Math.sin(start)); + ctx.closePath(); + ctx.fill(); + } + ctx.restore(); + + // draw the needle + var datapoint = this.data[0][1]; + var dataspan = this.max - this.min; + if (this.pegNeedle) { + if (this.data[0][1] > this.max + dataspan*3/this.span) { + datapoint = this.max + dataspan*3/this.span; + } + if (this.data[0][1] < this.min - dataspan*3/this.span) { + datapoint = this.min - dataspan*3/this.span; + } + } + var dataang = (datapoint - this.min)/dataspan * this.span * Math.PI/180 + this.startAngle; + + + ctx.save(); + ctx.beginPath(); + ctx.fillStyle = this.ringColor; + ctx.strokeStyle = this.ringColor; + this.needleLength = (this.tickOuterRadius - this.tickLength) * 0.85; + this.needleThickness = (this.needleThickness < 2) ? 2 : this.needleThickness; + var endwidth = this.needleThickness * 0.4; + + + var dl = this.needleLength/10; + var dt = (this.needleThickness - endwidth)/10; + var templ; + for (var i=0; i<10; i++) { + templ = this.needleThickness - i*dt; + ctx.moveTo(dl*i*Math.cos(dataang), dl*i*Math.sin(dataang)); + ctx.lineWidth = templ; + ctx.lineTo(dl*(i+1)*Math.cos(dataang), dl*(i+1)*Math.sin(dataang)); + ctx.stroke(); + } + + ctx.restore(); + } + else { + this._center = [(cw - trans * offx)/2 + trans * offx, (ch - trans*offy)/2 + trans * offy]; + } + }; + + $.jqplot.MeterGaugeAxisRenderer = function() { + $.jqplot.LinearAxisRenderer.call(this); + }; + + $.jqplot.MeterGaugeAxisRenderer.prototype = new $.jqplot.LinearAxisRenderer(); + $.jqplot.MeterGaugeAxisRenderer.prototype.constructor = $.jqplot.MeterGaugeAxisRenderer; + + + // There are no traditional axes on a gauge chart. We just need to provide + // dummy objects with properties so the plot will render. + // called with scope of axis object. + $.jqplot.MeterGaugeAxisRenderer.prototype.init = function(options){ + // + this.tickRenderer = $.jqplot.MeterGaugeTickRenderer; + $.extend(true, this, options); + // I don't think I'm going to need _dataBounds here. + // have to go Axis scaling in a way to fit chart onto plot area + // and provide u2p and p2u functionality for mouse cursor, etc. + // for convienence set _dataBounds to 0 and 100 and + // set min/max to 0 and 100. + this._dataBounds = {min:0, max:100}; + this.min = 0; + this.max = 100; + this.showTicks = false; + this.ticks = []; + this.showMark = false; + this.show = false; + }; + + $.jqplot.MeterGaugeLegendRenderer = function(){ + $.jqplot.TableLegendRenderer.call(this); + }; + + $.jqplot.MeterGaugeLegendRenderer.prototype = new $.jqplot.TableLegendRenderer(); + $.jqplot.MeterGaugeLegendRenderer.prototype.constructor = $.jqplot.MeterGaugeLegendRenderer; + + /** + * Class: $.jqplot.MeterGaugeLegendRenderer + *Meter gauges don't typically have a legend, this overrides the default legend renderer. + */ + $.jqplot.MeterGaugeLegendRenderer.prototype.init = function(options) { + // Maximum number of rows in the legend. 0 or null for unlimited. + this.numberRows = null; + // Maximum number of columns in the legend. 0 or null for unlimited. + this.numberColumns = null; + $.extend(true, this, options); + }; + + // called with context of legend + $.jqplot.MeterGaugeLegendRenderer.prototype.draw = function() { + if (this.show) { + var series = this._series; + var ss = 'position:absolute;'; + ss += (this.background) ? 'background:'+this.background+';' : ''; + ss += (this.border) ? 'border:'+this.border+';' : ''; + ss += (this.fontSize) ? 'font-size:'+this.fontSize+';' : ''; + ss += (this.fontFamily) ? 'font-family:'+this.fontFamily+';' : ''; + ss += (this.textColor) ? 'color:'+this.textColor+';' : ''; + ss += (this.marginTop != null) ? 'margin-top:'+this.marginTop+';' : ''; + ss += (this.marginBottom != null) ? 'margin-bottom:'+this.marginBottom+';' : ''; + ss += (this.marginLeft != null) ? 'margin-left:'+this.marginLeft+';' : ''; + ss += (this.marginRight != null) ? 'margin-right:'+this.marginRight+';' : ''; + this._elem = $('<table class="jqplot-table-legend" style="'+ss+'"></table>'); + // MeterGauge charts legends don't go by number of series, but by number of data points + // in the series. Refactor things here for that. + + var pad = false, + reverse = false, + nr, nc; + var s = series[0]; + + if (s.show) { + var pd = s.data; + if (this.numberRows) { + nr = this.numberRows; + if (!this.numberColumns){ + nc = Math.ceil(pd.length/nr); + } + else{ + nc = this.numberColumns; + } + } + else if (this.numberColumns) { + nc = this.numberColumns; + nr = Math.ceil(pd.length/this.numberColumns); + } + else { + nr = pd.length; + nc = 1; + } + + var i, j, tr, td1, td2, lt, rs, color; + var idx = 0; + + for (i=0; i<nr; i++) { + if (reverse){ + tr = $('<tr class="jqplot-table-legend"></tr>').prependTo(this._elem); + } + else{ + tr = $('<tr class="jqplot-table-legend"></tr>').appendTo(this._elem); + } + for (j=0; j<nc; j++) { + if (idx < pd.length){ + // debugger + lt = this.labels[idx] || pd[idx][0].toString(); + color = s.color; + if (!reverse){ + if (i>0){ + pad = true; + } + else{ + pad = false; + } + } + else{ + if (i == nr -1){ + pad = false; + } + else{ + pad = true; + } + } + rs = (pad) ? this.rowSpacing : '0'; + + td1 = $('<td class="jqplot-table-legend" style="text-align:center;padding-top:'+rs+';">'+ + '<div><div class="jqplot-table-legend-swatch" style="border-color:'+color+';"></div>'+ + '</div></td>'); + td2 = $('<td class="jqplot-table-legend" style="padding-top:'+rs+';"></td>'); + if (this.escapeHtml){ + td2.text(lt); + } + else { + td2.html(lt); + } + if (reverse) { + td2.prependTo(tr); + td1.prependTo(tr); + } + else { + td1.appendTo(tr); + td2.appendTo(tr); + } + pad = true; + } + idx++; + } + } + } + } + return this._elem; + }; + + + // setup default renderers for axes and legend so user doesn't have to + // called with scope of plot + function preInit(target, data, options) { + // debugger + options = options || {}; + options.axesDefaults = options.axesDefaults || {}; + options.legend = options.legend || {}; + options.seriesDefaults = options.seriesDefaults || {}; + options.grid = options.grid || {}; + + // only set these if there is a gauge series + var setopts = false; + if (options.seriesDefaults.renderer == $.jqplot.MeterGaugeRenderer) { + setopts = true; + } + else if (options.series) { + for (var i=0; i < options.series.length; i++) { + if (options.series[i].renderer == $.jqplot.MeterGaugeRenderer) { + setopts = true; + } + } + } + + if (setopts) { + options.axesDefaults.renderer = $.jqplot.MeterGaugeAxisRenderer; + options.legend.renderer = $.jqplot.MeterGaugeLegendRenderer; + options.legend.preDraw = true; + options.grid.background = options.grid.background || 'white'; + options.grid.drawGridlines = false; + options.grid.borderWidth = (options.grid.borderWidth != null) ? options.grid.borderWidth : 0; + options.grid.shadow = (options.grid.shadow != null) ? options.grid.shadow : false; + } + } + + // called with scope of plot + function postParseOptions(options) { + // + } + + $.jqplot.preInitHooks.push(preInit); + $.jqplot.postParseOptionsHooks.push(postParseOptions); + + $.jqplot.MeterGaugeTickRenderer = function() { + $.jqplot.AxisTickRenderer.call(this); + }; + + $.jqplot.MeterGaugeTickRenderer.prototype = new $.jqplot.AxisTickRenderer(); + $.jqplot.MeterGaugeTickRenderer.prototype.constructor = $.jqplot.MeterGaugeTickRenderer; + +})(jQuery); + + \ No newline at end of file diff --git a/www/protected/extensions/jqplot/plugins/jqplot.meterGaugeRenderer.min.js b/www/protected/extensions/jqplot/plugins/jqplot.meterGaugeRenderer.min.js new file mode 100644 index 0000000..52f7bdc --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.meterGaugeRenderer.min.js @@ -0,0 +1,57 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + * included jsDate library by Chris Leonello: + * + * Copyright (c) 2010-2011 Chris Leonello + * + * jsDate is currently available for use in all personal or commercial projects + * under both the MIT and GPL version 2.0 licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * jsDate borrows many concepts and ideas from the Date Instance + * Methods by Ken Snyder along with some parts of Ken's actual code. + * + * Ken's origianl Date Instance Methods and copyright notice: + * + * Ken Snyder (ken d snyder at gmail dot com) + * 2008-09-10 + * version 2.0.2 (http://kendsnyder.com/sandbox/date/) + * Creative Commons Attribution License 3.0 (http://creativecommons.org/licenses/by/3.0/) + * + * jqplotToImage function based on Larry Siden's export-jqplot-to-png.js. + * Larry has generously given permission to adapt his code for inclusion + * into jqPlot. + * + * Larry's original code can be found here: + * + * https://github.com/lsiden/export-jqplot-to-png + * + * + */ +(function(c){c.jqplot.MeterGaugeRenderer=function(){c.jqplot.LineRenderer.call(this)};c.jqplot.MeterGaugeRenderer.prototype=new c.jqplot.LineRenderer();c.jqplot.MeterGaugeRenderer.prototype.constructor=c.jqplot.MeterGaugeRenderer;c.jqplot.MeterGaugeRenderer.prototype.init=function(e){this.diameter=null;this.padding=null;this.shadowOffset=2;this.shadowAlpha=0.07;this.shadowDepth=4;this.background="#efefef";this.ringColor="#BBC6D0";this.needleColor="#C3D3E5";this.tickColor="989898";this.ringWidth=null;this.min;this.max;this.ticks=[];this.showTicks=true;this.showTickLabels=true;this.label=null;this.labelHeightAdjust=0;this.labelPosition="inside";this.intervals=[];this.intervalColors=["#4bb2c5","#EAA228","#c5b47f","#579575","#839557","#958c12","#953579","#4b5de4","#d8b83f","#ff5800","#0085cc","#c747a3","#cddf54","#FBD178","#26B4E3","#bd70c7"];this.intervalInnerRadius=null;this.intervalOuterRadius=null;this.tickRenderer=c.jqplot.MeterGaugeTickRenderer;this.tickPositions=[1,2,2.5,5,10];this.tickSpacing=30;this.numberMinorTicks=null;this.hubRadius=null;this.tickPadding=null;this.needleThickness=null;this.needlePad=6;this.pegNeedle=true;this._type="meterGauge";c.extend(true,this,e);this.type=null;this.numberTicks=null;this.tickInterval=null;this.span=180;if(this.type=="circular"){this.semiCircular=false}else{if(this.type!="circular"){this.semiCircular=true}else{this.semiCircular=(this.span<=180)?true:false}}this._tickPoints=[];this._labelElem=null;this.startAngle=(90+(360-this.span)/2)*Math.PI/180;this.endAngle=(90-(360-this.span)/2)*Math.PI/180;this.setmin=!!(this.min==null);this.setmax=!!(this.max==null);if(this.intervals.length){if(this.intervals[0].length==null||this.intervals.length==1){for(var f=0;f<this.intervals.length;f++){this.intervals[f]=[this.intervals[f],this.intervals[f],this.intervalColors[f]]}}else{if(this.intervals[0].length==2){for(f=0;f<this.intervals.length;f++){this.intervals[f]=[this.intervals[f][0],this.intervals[f][1],this.intervalColors[f]]}}}}if(this.ticks.length){if(this.ticks[0].length==null||this.ticks[0].length==1){for(var f=0;f<this.ticks.length;f++){this.ticks[f]=[this.ticks[f],this.ticks[f]]}}this.min=(this.min==null)?this.ticks[0][0]:this.min;this.max=(this.max==null)?this.ticks[this.ticks.length-1][0]:this.max;this.setmin=false;this.setmax=false;this.numberTicks=this.ticks.length;this.tickInterval=this.ticks[1][0]-this.ticks[0][0];this.tickFactor=Math.floor(parseFloat((Math.log(this.tickInterval)/Math.log(10)).toFixed(11)));this.numberMinorTicks=b(this.tickPositions,this.tickInterval,this.tickFactor);if(!this.numberMinorTicks){this.numberMinorTicks=b(this.tickPositions,this.tickInterval,this.tickFactor-1)}if(!this.numberMinorTicks){this.numberMinorTicks=1}}else{if(this.intervals.length){this.min=(this.min==null)?0:this.min;this.setmin=false;if(this.max==null){if(this.intervals[this.intervals.length-1][0]>=this.data[0][1]){this.max=this.intervals[this.intervals.length-1][0];this.setmax=false}}else{this.setmax=false}}else{this.min=(this.min==null)?0:this.min;this.setmin=false;if(this.max==null){this.max=this.data[0][1]*1.25;this.setmax=true}else{this.setmax=false}}}};c.jqplot.MeterGaugeRenderer.prototype.setGridData=function(j){var f=[];var k=[];var e=this.startAngle;for(var h=0;h<this.data.length;h++){f.push(this.data[h][1]);k.push([this.data[h][0]]);if(h>0){f[h]+=f[h-1]}}var g=Math.PI*2/f[f.length-1];for(var h=0;h<f.length;h++){k[h][1]=f[h]*g}this.gridData=k};c.jqplot.MeterGaugeRenderer.prototype.makeGridData=function(j,k){var f=[];var l=[];var e=this.startAngle;for(var h=0;h<j.length;h++){f.push(j[h][1]);l.push([j[h][0]]);if(h>0){f[h]+=f[h-1]}}var g=Math.PI*2/f[f.length-1];for(var h=0;h<f.length;h++){l[h][1]=f[h]*g}return l};function b(j,f,g){var e;for(var h=j.length-1;h>=0;h--){e=f/(j[h]*Math.pow(10,g));if(e==4||e==5){return e-1}}return null}c.jqplot.MeterGaugeRenderer.prototype.draw=function(X,aC,ap){var aa;var aM=(ap!=undefined)?ap:{};var ai=0;var ah=0;var at=1;if(ap.legendInfo&&ap.legendInfo.placement=="inside"){var aI=ap.legendInfo;switch(aI.location){case"nw":ai=aI.width+aI.xoffset;break;case"w":ai=aI.width+aI.xoffset;break;case"sw":ai=aI.width+aI.xoffset;break;case"ne":ai=aI.width+aI.xoffset;at=-1;break;case"e":ai=aI.width+aI.xoffset;at=-1;break;case"se":ai=aI.width+aI.xoffset;at=-1;break;case"n":ah=aI.height+aI.yoffset;break;case"s":ah=aI.height+aI.yoffset;at=-1;break;default:break}}if(this.label){this._labelElem=c('<div class="jqplot-meterGauge-label" style="position:absolute;">'+this.label+"</div>");this.canvas._elem.after(this._labelElem)}var m=(aM.shadow!=undefined)?aM.shadow:this.shadow;var N=(aM.showLine!=undefined)?aM.showLine:this.showLine;var I=(aM.fill!=undefined)?aM.fill:this.fill;var K=X.canvas.width;var S=X.canvas.height;if(this.padding==null){this.padding=Math.round(Math.min(K,S)/30)}var Q=K-ai-2*this.padding;var ab=S-ah-2*this.padding;if(this.labelPosition=="bottom"&&this.label){ab-=this._labelElem.outerHeight(true)}var L=Math.min(Q,ab);var ad=L;if(!this.diameter){if(this.semiCircular){if(Q>=2*ab){if(!this.ringWidth){this.ringWidth=2*ab/35}this.needleThickness=this.needleThickness||2+Math.pow(this.ringWidth,0.8);this.innerPad=this.ringWidth/2+this.needleThickness/2+this.needlePad;this.diameter=2*(ab-2*this.innerPad)}else{if(!this.ringWidth){this.ringWidth=Q/35}this.needleThickness=this.needleThickness||2+Math.pow(this.ringWidth,0.8);this.innerPad=this.ringWidth/2+this.needleThickness/2+this.needlePad;this.diameter=Q-2*this.innerPad-this.ringWidth-this.padding}this._center=[(K-at*ai)/2+at*ai,(S+at*ah-this.padding-this.ringWidth-this.innerPad)]}else{if(!this.ringWidth){this.ringWidth=ad/35}this.needleThickness=this.needleThickness||2+Math.pow(this.ringWidth,0.8);this.innerPad=0;this.diameter=ad-this.ringWidth;this._center=[(K-at*ai)/2+at*ai,(S-at*ah)/2+at*ah]}}if(this._labelElem&&this.labelPosition=="bottom"){this._center[1]-=this._labelElem.outerHeight(true)}this._radius=this.diameter/2;this.tickSpacing=6000/this.diameter;if(!this.hubRadius){this.hubRadius=this.diameter/18}this.shadowOffset=0.5+this.ringWidth/9;this.shadowWidth=this.ringWidth*1;this.tickPadding=3+Math.pow(this.diameter/20,0.7);this.tickOuterRadius=this._radius-this.ringWidth/2-this.tickPadding;this.tickLength=(this.showTicks)?this._radius/13:0;if(this.ticks.length==0){var A=this.max,aL=this.min,q=this.setmax,aG=this.setmin,au=(A-aL)*this.tickSpacing/this.span;var aw=Math.floor(parseFloat((Math.log(au)/Math.log(10)).toFixed(11)));var an=(au/Math.pow(10,aw));(an>2&&an<=2.5)?an=2.5:an=Math.ceil(an);var T=this.tickPositions;var aA,ak;for(aa=0;aa<T.length;aa++){if(an==T[aa]||aa&&T[aa-1]<an&&an<T[aa]){au=T[aa]*Math.pow(10,aw);aA=aa}}for(aa=0;aa<T.length;aa++){if(an==T[aa]||aa&&T[aa-1]<an&&an<T[aa]){au=T[aa]*Math.pow(10,aw);ak=Math.ceil((A-aL)/au)}}if(q&&aG){var aP=(aL>0)?aL-aL%au:aL-aL%au-au;if(!this.forceZero){var D=Math.min(aL-aP,0.8*au);var o=Math.floor(D/T[aA]);if(o>1){aP=aP+T[aA]*(o-1);if(parseInt(aP,10)!=aP&&parseInt(aP-T[aA],10)==aP-T[aA]){aP=aP-T[aA]}}}if(aL==aP){aL-=au}else{if(aL-aP>0.23*au){aL=aP}else{aL=aP-au;ak+=1}}ak+=1;var E=aL+(ak-1)*au;if(A>=E){E+=au;ak+=1}if(E-A<0.23*au){E+=au;ak+=1}this.max=A=E;this.min=aL;this.tickInterval=au;this.numberTicks=ak;var O;for(aa=0;aa<ak;aa++){O=parseFloat((aL+aa*au).toFixed(11));this.ticks.push([O,O])}this.max=this.ticks[ak-1][1];this.tickFactor=aw;this.numberMinorTicks=b(this.tickPositions,this.tickInterval,this.tickFactor);if(!this.numberMinorTicks){this.numberMinorTicks=b(this.tickPositions,this.tickInterval,this.tickFactor-1)}}else{if(q){var E=aL+(ak-1)*au;if(A>=E){A=E+au;ak+=1}else{A=E}this.tickInterval=this.tickInterval||au;this.numberTicks=this.numberTicks||ak;var O;for(aa=0;aa<this.numberTicks;aa++){O=parseFloat((aL+aa*this.tickInterval).toFixed(11));this.ticks.push([O,O])}this.max=this.ticks[this.numberTicks-1][1];this.tickFactor=aw;this.numberMinorTicks=b(this.tickPositions,this.tickInterval,this.tickFactor);if(!this.numberMinorTicks){this.numberMinorTicks=b(this.tickPositions,this.tickInterval,this.tickFactor-1)}}}if(!q&&!aG){var P=this.max-this.min;aw=Math.floor(parseFloat((Math.log(P)/Math.log(10)).toFixed(11)))-1;var aN=[5,6,4,7,3,8,9,10,2],V,C,av=0,M;if(P>1){var aJ=String(P);if(aJ.search(/\./)==-1){var aF=aJ.search(/0+$/);av=(aF>0)?aJ.length-aF-1:0}}M=P/Math.pow(10,av);for(aa=0;aa<aN.length;aa++){V=M/(aN[aa]-1);if(V==parseInt(V,10)){this.numberTicks=aN[aa];this.tickInterval=P/(this.numberTicks-1);this.tickFactor=aw+1;break}}var O;for(aa=0;aa<this.numberTicks;aa++){O=parseFloat((this.min+aa*this.tickInterval).toFixed(11));this.ticks.push([O,O])}this.numberMinorTicks=b(this.tickPositions,this.tickInterval,this.tickFactor);if(!this.numberMinorTicks){this.numberMinorTicks=b(this.tickPositions,this.tickInterval,this.tickFactor-1)}if(!this.numberMinorTicks){this.numberMinorTicks=1;var aH=[4,5,3,6,2];for(aa=0;aa<5;aa++){var ao=this.tickInterval/aH[aa];if(ao==parseInt(ao,10)){this.numberMinorTicks=aH[aa]-1;break}}}}}var U=this._radius,aE=this.startAngle,k=this.endAngle,H=Math.PI,e=Math.PI/2;if(this.semiCircular){var z=Math.atan(this.innerPad/U),ac=this.outerStartAngle=aE-z,aB=this.outerEndAngle=k+z,B=this.hubStartAngle=aE-Math.atan(this.innerPad/this.hubRadius*2),af=this.hubEndAngle=k+Math.atan(this.innerPad/this.hubRadius*2);X.save();X.translate(this._center[0],this._center[1]);X.lineJoin="round";X.lineCap="round";X.save();X.beginPath();X.fillStyle=this.background;X.arc(0,0,U,ac,aB,false);X.closePath();X.fill();X.restore();var aj="rgba(0,0,0,"+this.shadowAlpha+")";X.save();for(var aa=0;aa<this.shadowDepth;aa++){X.translate(this.shadowOffset*Math.cos(this.shadowAngle/180*Math.PI),this.shadowOffset*Math.sin(this.shadowAngle/180*Math.PI));X.beginPath();X.strokeStyle=aj;X.lineWidth=this.shadowWidth;X.arc(0,0,U,ac,aB,false);X.closePath();X.stroke()}X.restore();X.save();var az=parseInt((this.shadowDepth+1)/2,10);for(var aa=0;aa<az;aa++){X.translate(this.shadowOffset*Math.cos(this.shadowAngle/180*Math.PI),this.shadowOffset*Math.sin(this.shadowAngle/180*Math.PI));X.beginPath();X.fillStyle=aj;X.arc(0,0,this.hubRadius,B,af,false);X.closePath();X.fill()}X.restore();X.save();X.beginPath();X.strokeStyle=this.ringColor;X.lineWidth=this.ringWidth;X.arc(0,0,U,ac,aB,false);X.closePath();X.stroke();X.restore();X.save();X.beginPath();X.fillStyle=this.ringColor;X.arc(0,0,this.hubRadius,B,af,false);X.closePath();X.fill();X.restore();if(this.showTicks){X.save();var f=this.tickOuterRadius,aq=this.tickLength,v=aq/2,F=this.numberMinorTicks,am=this.span*Math.PI/180/(this.ticks.length-1),p=am/(F+1);for(aa=0;aa<this.ticks.length;aa++){X.beginPath();X.lineWidth=1.5+this.diameter/360;X.strokeStyle=this.ringColor;var ae=am*aa+aE;X.moveTo(-f*Math.cos(am*aa+aE),f*Math.sin(am*aa+aE));X.lineTo(-(f-aq)*Math.cos(am*aa+aE),(f-aq)*Math.sin(am*aa+aE));this._tickPoints.push([(f-aq)*Math.cos(am*aa+aE)+this._center[0]+this.canvas._offsets.left,(f-aq)*Math.sin(am*aa+aE)+this._center[1]+this.canvas._offsets.top,am*aa+aE]);X.stroke();X.lineWidth=1+this.diameter/440;if(aa<this.ticks.length-1){for(var Y=1;Y<=F;Y++){X.beginPath();X.moveTo(-f*Math.cos(am*aa+p*Y+aE),f*Math.sin(am*aa+p*Y+aE));X.lineTo(-(f-v)*Math.cos(am*aa+p*Y+aE),(f-v)*Math.sin(am*aa+p*Y+aE));X.stroke()}}}X.restore()}if(this.showTickLabels){var J,W,T,aO,g,G,n=0;var an=this.tickPadding*(1-1/(this.diameter/80+1));for(aa=0;aa<this.ticks.length;aa++){J=c('<div class="jqplot-meterGauge-tick" style="position:absolute;">'+this.ticks[aa][1]+"</div>");this.canvas._elem.after(J);aO=J.outerWidth(true);g=J.outerHeight(true);W=this._tickPoints[aa][0]-aO*(this._tickPoints[aa][2]-Math.PI)/Math.PI-an*Math.cos(this._tickPoints[aa][2]);T=this._tickPoints[aa][1]-g/2+g/2*Math.pow(Math.abs((Math.sin(this._tickPoints[aa][2]))),0.5)+an/3*Math.pow(Math.abs((Math.sin(this._tickPoints[aa][2]))),0.5);J.css({left:W,top:T});G=aO*Math.cos(this._tickPoints[aa][2])+g*Math.sin(Math.PI/2+this._tickPoints[aa][2]/2);n=(G>n)?G:n}}if(this.label&&this.labelPosition=="inside"){var W=this._center[0]+this.canvas._offsets.left;var an=this.tickPadding*(1-1/(this.diameter/80+1));var T=0.5*(this._center[1]+this.canvas._offsets.top-this.hubRadius)+0.5*(this._center[1]+this.canvas._offsets.top-this.tickOuterRadius+this.tickLength+an)+this.labelHeightAdjust;W-=this._labelElem.outerWidth(true)/2;T-=this._labelElem.outerHeight(true)/2;this._labelElem.css({left:W,top:T})}else{if(this.label&&this.labelPosition=="bottom"){var W=this._center[0]+this.canvas._offsets.left-this._labelElem.outerWidth(true)/2;var T=this._center[1]+this.canvas._offsets.top+this.innerPad+ +this.ringWidth+this.padding+this.labelHeightAdjust;this._labelElem.css({left:W,top:T})}}X.save();var ax=this.intervalInnerRadius||this.hubRadius*1.5;if(this.intervalOuterRadius==null){if(this.showTickLabels){var ag=(this.tickOuterRadius-this.tickLength-this.tickPadding-this.diameter/8)}else{var ag=(this.tickOuterRadius-this.tickLength-this.diameter/16)}}else{var ag=this.intervalOuterRadius}var P=this.max-this.min;var aD=this.intervals[this.intervals.length-1]-this.min;var y,Z,u=this.span*Math.PI/180;for(aa=0;aa<this.intervals.length;aa++){y=(aa==0)?aE:aE+(this.intervals[aa-1][0]-this.min)*u/P;if(y<0){y=0}Z=aE+(this.intervals[aa][0]-this.min)*u/P;if(Z<0){Z=0}X.beginPath();X.fillStyle=this.intervals[aa][2];X.arc(0,0,ax,y,Z,false);X.lineTo(ag*Math.cos(Z),ag*Math.sin(Z));X.arc(0,0,ag,Z,y,true);X.lineTo(ax*Math.cos(y),ax*Math.sin(y));X.closePath();X.fill()}X.restore();var ay=this.data[0][1];var R=this.max-this.min;if(this.pegNeedle){if(this.data[0][1]>this.max+R*3/this.span){ay=this.max+R*3/this.span}if(this.data[0][1]<this.min-R*3/this.span){ay=this.min-R*3/this.span}}var al=(ay-this.min)/R*this.span*Math.PI/180+this.startAngle;X.save();X.beginPath();X.fillStyle=this.ringColor;X.strokeStyle=this.ringColor;this.needleLength=(this.tickOuterRadius-this.tickLength)*0.85;this.needleThickness=(this.needleThickness<2)?2:this.needleThickness;var aK=this.needleThickness*0.4;var x=this.needleLength/10;var s=(this.needleThickness-aK)/10;var ar;for(var aa=0;aa<10;aa++){ar=this.needleThickness-aa*s;X.moveTo(x*aa*Math.cos(al),x*aa*Math.sin(al));X.lineWidth=ar;X.lineTo(x*(aa+1)*Math.cos(al),x*(aa+1)*Math.sin(al));X.stroke()}X.restore()}else{this._center=[(K-at*ai)/2+at*ai,(S-at*ah)/2+at*ah]}};c.jqplot.MeterGaugeAxisRenderer=function(){c.jqplot.LinearAxisRenderer.call(this)};c.jqplot.MeterGaugeAxisRenderer.prototype=new c.jqplot.LinearAxisRenderer();c.jqplot.MeterGaugeAxisRenderer.prototype.constructor=c.jqplot.MeterGaugeAxisRenderer;c.jqplot.MeterGaugeAxisRenderer.prototype.init=function(e){this.tickRenderer=c.jqplot.MeterGaugeTickRenderer;c.extend(true,this,e);this._dataBounds={min:0,max:100};this.min=0;this.max=100;this.showTicks=false;this.ticks=[];this.showMark=false;this.show=false};c.jqplot.MeterGaugeLegendRenderer=function(){c.jqplot.TableLegendRenderer.call(this)};c.jqplot.MeterGaugeLegendRenderer.prototype=new c.jqplot.TableLegendRenderer();c.jqplot.MeterGaugeLegendRenderer.prototype.constructor=c.jqplot.MeterGaugeLegendRenderer;c.jqplot.MeterGaugeLegendRenderer.prototype.init=function(e){this.numberRows=null;this.numberColumns=null;c.extend(true,this,e)};c.jqplot.MeterGaugeLegendRenderer.prototype.draw=function(){if(this.show){var p=this._series;var x="position:absolute;";x+=(this.background)?"background:"+this.background+";":"";x+=(this.border)?"border:"+this.border+";":"";x+=(this.fontSize)?"font-size:"+this.fontSize+";":"";x+=(this.fontFamily)?"font-family:"+this.fontFamily+";":"";x+=(this.textColor)?"color:"+this.textColor+";":"";x+=(this.marginTop!=null)?"margin-top:"+this.marginTop+";":"";x+=(this.marginBottom!=null)?"margin-bottom:"+this.marginBottom+";":"";x+=(this.marginLeft!=null)?"margin-left:"+this.marginLeft+";":"";x+=(this.marginRight!=null)?"margin-right:"+this.marginRight+";":"";this._elem=c('<table class="jqplot-table-legend" style="'+x+'"></table>');var f=false,q=false,u,o;var w=p[0];if(w.show){var t=w.data;if(this.numberRows){u=this.numberRows;if(!this.numberColumns){o=Math.ceil(t.length/u)}else{o=this.numberColumns}}else{if(this.numberColumns){o=this.numberColumns;u=Math.ceil(t.length/this.numberColumns)}else{u=t.length;o=1}}var n,m,r,g,e,l,k,h;var v=0;for(n=0;n<u;n++){if(q){r=c('<tr class="jqplot-table-legend"></tr>').prependTo(this._elem)}else{r=c('<tr class="jqplot-table-legend"></tr>').appendTo(this._elem)}for(m=0;m<o;m++){if(v<t.length){l=this.labels[v]||t[v][0].toString();h=w.color;if(!q){if(n>0){f=true}else{f=false}}else{if(n==u-1){f=false}else{f=true}}k=(f)?this.rowSpacing:"0";g=c('<td class="jqplot-table-legend" style="text-align:center;padding-top:'+k+';"><div><div class="jqplot-table-legend-swatch" style="border-color:'+h+';"></div></div></td>');e=c('<td class="jqplot-table-legend" style="padding-top:'+k+';"></td>');if(this.escapeHtml){e.text(l)}else{e.html(l)}if(q){e.prependTo(r);g.prependTo(r)}else{g.appendTo(r);e.appendTo(r)}f=true}v++}}}}return this._elem};function a(j,h,f){f=f||{};f.axesDefaults=f.axesDefaults||{};f.legend=f.legend||{};f.seriesDefaults=f.seriesDefaults||{};f.grid=f.grid||{};var e=false;if(f.seriesDefaults.renderer==c.jqplot.MeterGaugeRenderer){e=true}else{if(f.series){for(var g=0;g<f.series.length;g++){if(f.series[g].renderer==c.jqplot.MeterGaugeRenderer){e=true}}}}if(e){f.axesDefaults.renderer=c.jqplot.MeterGaugeAxisRenderer;f.legend.renderer=c.jqplot.MeterGaugeLegendRenderer;f.legend.preDraw=true;f.grid.background=f.grid.background||"white";f.grid.drawGridlines=false;f.grid.borderWidth=(f.grid.borderWidth!=null)?f.grid.borderWidth:0;f.grid.shadow=(f.grid.shadow!=null)?f.grid.shadow:false}}function d(e){}c.jqplot.preInitHooks.push(a);c.jqplot.postParseOptionsHooks.push(d);c.jqplot.MeterGaugeTickRenderer=function(){c.jqplot.AxisTickRenderer.call(this)};c.jqplot.MeterGaugeTickRenderer.prototype=new c.jqplot.AxisTickRenderer();c.jqplot.MeterGaugeTickRenderer.prototype.constructor=c.jqplot.MeterGaugeTickRenderer})(jQuery); \ No newline at end of file diff --git a/www/protected/extensions/jqplot/plugins/jqplot.pointLabels.js b/www/protected/extensions/jqplot/plugins/jqplot.pointLabels.js new file mode 100644 index 0000000..15f7293 --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.pointLabels.js @@ -0,0 +1,362 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + */ +(function($) { + + /** + * Class: $.jqplot.PointLabels + * Plugin for putting labels at the data points. + * + * To use this plugin, include the js + * file in your source: + * + * > <script type="text/javascript" src="plugins/jqplot.pointLabels.js"></script> + * + * By default, the last value in the data ponit array in the data series is used + * for the label. For most series renderers, extra data can be added to the + * data point arrays and the last value will be used as the label. + * + * For instance, + * this series: + * + * > [[1,4], [3,5], [7,2]] + * + * Would, by default, use the y values in the labels. + * Extra data can be added to the series like so: + * + * > [[1,4,'mid'], [3 5,'hi'], [7,2,'low']] + * + * And now the point labels would be 'mid', 'low', and 'hi'. + * + * Options to the point labels and a custom labels array can be passed into the + * "pointLabels" option on the series option like so: + * + * > series:[{pointLabels:{ + * > labels:['mid', 'hi', 'low'], + * > location:'se', + * > ypadding: 12 + * > } + * > }] + * + * A custom labels array in the options takes precendence over any labels + * in the series data. If you have a custom labels array in the options, + * but still want to use values from the series array as labels, set the + * "labelsFromSeries" option to true. + * + * By default, html entities (<, >, etc.) are escaped in point labels. + * If you want to include actual html markup in the labels, + * set the "escapeHTML" option to false. + * + */ + $.jqplot.PointLabels = function(options) { + // Group: Properties + // + // prop: show + // show the labels or not. + this.show = $.jqplot.config.enablePlugins; + // prop: location + // compass location where to position the label around the point. + // 'n', 'ne', 'e', 'se', 's', 'sw', 'w', 'nw' + this.location = 'n'; + // prop: labelsFromSeries + // true to use labels within data point arrays. + this.labelsFromSeries = false; + // prop: seriesLabelIndex + // array index for location of labels within data point arrays. + // if null, will use the last element of the data point array. + this.seriesLabelIndex = null; + // prop: labels + // array of arrays of labels, one array for each series. + this.labels = []; + // actual labels that will get displayed. + // needed to preserve user specified labels in labels array. + this._labels = []; + // prop: stackedValue + // true to display value as stacked in a stacked plot. + // no effect if labels is specified. + this.stackedValue = false; + // prop: ypadding + // vertical padding in pixels between point and label + this.ypadding = 6; + // prop: xpadding + // horizontal padding in pixels between point and label + this.xpadding = 6; + // prop: escapeHTML + // true to escape html entities in the labels. + // If you want to include markup in the labels, set to false. + this.escapeHTML = true; + // prop: edgeTolerance + // Number of pixels that the label must be away from an axis + // boundary in order to be drawn. Negative values will allow overlap + // with the grid boundaries. + this.edgeTolerance = -5; + // prop: formatter + // A class of a formatter for the tick text. sprintf by default. + this.formatter = $.jqplot.DefaultTickFormatter; + // prop: formatString + // string passed to the formatter. + this.formatString = ''; + // prop: hideZeros + // true to not show a label for a value which is 0. + this.hideZeros = false; + this._elems = []; + + $.extend(true, this, options); + }; + + var locations = ['nw', 'n', 'ne', 'e', 'se', 's', 'sw', 'w']; + var locationIndicies = {'nw':0, 'n':1, 'ne':2, 'e':3, 'se':4, 's':5, 'sw':6, 'w':7}; + var oppositeLocations = ['se', 's', 'sw', 'w', 'nw', 'n', 'ne', 'e']; + + // called with scope of a series + $.jqplot.PointLabels.init = function (target, data, seriesDefaults, opts, plot){ + var options = $.extend(true, {}, seriesDefaults, opts); + options.pointLabels = options.pointLabels || {}; + if (this.renderer.constructor === $.jqplot.BarRenderer && this.barDirection === 'horizontal' && !options.pointLabels.location) { + options.pointLabels.location = 'e'; + } + // add a pointLabels attribute to the series plugins + this.plugins.pointLabels = new $.jqplot.PointLabels(options.pointLabels); + this.plugins.pointLabels.setLabels.call(this); + }; + + // called with scope of series + $.jqplot.PointLabels.prototype.setLabels = function() { + var p = this.plugins.pointLabels; + var labelIdx; + if (p.seriesLabelIndex != null) { + labelIdx = p.seriesLabelIndex; + } + else if (this.renderer.constructor === $.jqplot.BarRenderer && this.barDirection === 'horizontal') { + labelIdx = 0; + } + else { + labelIdx = (this._plotData.length === 0) ? 0 : this._plotData[0].length -1; + } + p._labels = []; + if (p.labels.length === 0 || p.labelsFromSeries) { + if (p.stackedValue) { + if (this._plotData.length && this._plotData[0].length){ + // var idx = p.seriesLabelIndex || this._plotData[0].length -1; + for (var i=0; i<this._plotData.length; i++) { + p._labels.push(this._plotData[i][labelIdx]); + } + } + } + else { + var d = this._plotData; + if (this.renderer.constructor === $.jqplot.BarRenderer && this.waterfall) { + d = this._data; + } + if (d.length && d[0].length) { + // var idx = p.seriesLabelIndex || d[0].length -1; + for (var i=0; i<d.length; i++) { + p._labels.push(d[i][labelIdx]); + } + } + d = null; + } + } + else if (p.labels.length){ + p._labels = p.labels; + } + }; + + $.jqplot.PointLabels.prototype.xOffset = function(elem, location, padding) { + location = location || this.location; + padding = padding || this.xpadding; + var offset; + + switch (location) { + case 'nw': + offset = -elem.outerWidth(true) - this.xpadding; + break; + case 'n': + offset = -elem.outerWidth(true)/2; + break; + case 'ne': + offset = this.xpadding; + break; + case 'e': + offset = this.xpadding; + break; + case 'se': + offset = this.xpadding; + break; + case 's': + offset = -elem.outerWidth(true)/2; + break; + case 'sw': + offset = -elem.outerWidth(true) - this.xpadding; + break; + case 'w': + offset = -elem.outerWidth(true) - this.xpadding; + break; + default: // same as 'nw' + offset = -elem.outerWidth(true) - this.xpadding; + break; + } + return offset; + }; + + $.jqplot.PointLabels.prototype.yOffset = function(elem, location, padding) { + location = location || this.location; + padding = padding || this.xpadding; + var offset; + + switch (location) { + case 'nw': + offset = -elem.outerHeight(true) - this.ypadding; + break; + case 'n': + offset = -elem.outerHeight(true) - this.ypadding; + break; + case 'ne': + offset = -elem.outerHeight(true) - this.ypadding; + break; + case 'e': + offset = -elem.outerHeight(true)/2; + break; + case 'se': + offset = this.ypadding; + break; + case 's': + offset = this.ypadding; + break; + case 'sw': + offset = this.ypadding; + break; + case 'w': + offset = -elem.outerHeight(true)/2; + break; + default: // same as 'nw' + offset = -elem.outerHeight(true) - this.ypadding; + break; + } + return offset; + }; + + // called with scope of series + $.jqplot.PointLabels.draw = function (sctx, options, plot) { + var p = this.plugins.pointLabels; + // set labels again in case they have changed. + p.setLabels.call(this); + // remove any previous labels + for (var i=0; i<p._elems.length; i++) { + // Memory Leaks patch + // p._elems[i].remove(); + p._elems[i].emptyForce(); + } + p._elems.splice(0, p._elems.length); + + if (p.show) { + var ax = '_'+this._stackAxis+'axis'; + + if (!p.formatString) { + p.formatString = this[ax]._ticks[0].formatString; + p.formatter = this[ax]._ticks[0].formatter; + } + + var pd = this._plotData; + var xax = this._xaxis; + var yax = this._yaxis; + var elem, helem; + + for (var i=0, l=p._labels.length; i < l; i++) { + var label = p._labels[i]; + + if (p.hideZeros && parseInt(p._labels[i], 10) == 0) { + label = ''; + } + + if (label != null) { + label = p.formatter(p.formatString, label); + } + + helem = document.createElement('div'); + p._elems[i] = $(helem); + + elem = p._elems[i]; + + + elem.addClass('jqplot-point-label jqplot-series-'+this.index+' jqplot-point-'+i); + elem.css('position', 'absolute'); + elem.insertAfter(sctx.canvas); + + if (p.escapeHTML) { + elem.text(label); + } + else { + elem.html(label); + } + var location = p.location; + if ((this.fillToZero && pd[i][1] < 0) || (this.fillToZero && this._type === 'bar' && this.barDirection === 'horizontal' && pd[i][0] < 0) || (this.waterfall && parseInt(label, 10)) < 0) { + location = oppositeLocations[locationIndicies[location]]; + } + var ell = xax.u2p(pd[i][0]) + p.xOffset(elem, location); + var elt = yax.u2p(pd[i][1]) + p.yOffset(elem, location); + if (this.renderer.constructor == $.jqplot.BarRenderer) { + if (this.barDirection == "vertical") { + ell += this._barNudge; + } + else { + elt -= this._barNudge; + } + } + elem.css('left', ell); + elem.css('top', elt); + var elr = ell + elem.width(); + var elb = elt + elem.height(); + var et = p.edgeTolerance; + var scl = $(sctx.canvas).position().left; + var sct = $(sctx.canvas).position().top; + var scr = sctx.canvas.width + scl; + var scb = sctx.canvas.height + sct; + // if label is outside of allowed area, remove it + if (ell - et < scl || elt - et < sct || elr + et > scr || elb + et > scb) { + elem.remove(); + } + + elem = null; + helem = null; + } + + // finally, animate them if the series is animated + // if (this.renderer.animation && this.renderer.animation._supported && this.renderer.animation.show && plot._drawCount < 2) { + // var sel = '.jqplot-point-label.jqplot-series-'+this.index; + // $(sel).hide(); + // $(sel).fadeIn(1000); + // } + + } + }; + + $.jqplot.postSeriesInitHooks.push($.jqplot.PointLabels.init); + $.jqplot.postDrawSeriesHooks.push($.jqplot.PointLabels.draw); +})(jQuery); \ No newline at end of file diff --git a/www/protected/extensions/jqplot/plugins/jqplot.pointLabels.min.js b/www/protected/extensions/jqplot/plugins/jqplot.pointLabels.min.js new file mode 100644 index 0000000..7cf02ea --- /dev/null +++ b/www/protected/extensions/jqplot/plugins/jqplot.pointLabels.min.js @@ -0,0 +1,57 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: 1.0.0b2_r1012 + * + * Copyright (c) 2009-2011 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + * included jsDate library by Chris Leonello: + * + * Copyright (c) 2010-2011 Chris Leonello + * + * jsDate is currently available for use in all personal or commercial projects + * under both the MIT and GPL version 2.0 licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * jsDate borrows many concepts and ideas from the Date Instance + * Methods by Ken Snyder along with some parts of Ken's actual code. + * + * Ken's origianl Date Instance Methods and copyright notice: + * + * Ken Snyder (ken d snyder at gmail dot com) + * 2008-09-10 + * version 2.0.2 (http://kendsnyder.com/sandbox/date/) + * Creative Commons Attribution License 3.0 (http://creativecommons.org/licenses/by/3.0/) + * + * jqplotToImage function based on Larry Siden's export-jqplot-to-png.js. + * Larry has generously given permission to adapt his code for inclusion + * into jqPlot. + * + * Larry's original code can be found here: + * + * https://github.com/lsiden/export-jqplot-to-png + * + * + */ +(function(c){c.jqplot.PointLabels=function(e){this.show=c.jqplot.config.enablePlugins;this.location="n";this.labelsFromSeries=false;this.seriesLabelIndex=null;this.labels=[];this._labels=[];this.stackedValue=false;this.ypadding=6;this.xpadding=6;this.escapeHTML=true;this.edgeTolerance=-5;this.formatter=c.jqplot.DefaultTickFormatter;this.formatString="";this.hideZeros=false;this._elems=[];c.extend(true,this,e)};var a=["nw","n","ne","e","se","s","sw","w"];var d={nw:0,n:1,ne:2,e:3,se:4,s:5,sw:6,w:7};var b=["se","s","sw","w","nw","n","ne","e"];c.jqplot.PointLabels.init=function(j,h,f,g,i){var e=c.extend(true,{},f,g);e.pointLabels=e.pointLabels||{};if(this.renderer.constructor===c.jqplot.BarRenderer&&this.barDirection==="horizontal"&&!e.pointLabels.location){e.pointLabels.location="e"}this.plugins.pointLabels=new c.jqplot.PointLabels(e.pointLabels);this.plugins.pointLabels.setLabels.call(this)};c.jqplot.PointLabels.prototype.setLabels=function(){var f=this.plugins.pointLabels;var h;if(f.seriesLabelIndex!=null){h=f.seriesLabelIndex}else{if(this.renderer.constructor===c.jqplot.BarRenderer&&this.barDirection==="horizontal"){h=0}else{h=(this._plotData.length===0)?0:this._plotData[0].length-1}}f._labels=[];if(f.labels.length===0||f.labelsFromSeries){if(f.stackedValue){if(this._plotData.length&&this._plotData[0].length){for(var e=0;e<this._plotData.length;e++){f._labels.push(this._plotData[e][h])}}}else{var g=this._plotData;if(this.renderer.constructor===c.jqplot.BarRenderer&&this.waterfall){g=this._data}if(g.length&&g[0].length){for(var e=0;e<g.length;e++){f._labels.push(g[e][h])}}g=null}}else{if(f.labels.length){f._labels=f.labels}}};c.jqplot.PointLabels.prototype.xOffset=function(f,e,g){e=e||this.location;g=g||this.xpadding;var h;switch(e){case"nw":h=-f.outerWidth(true)-this.xpadding;break;case"n":h=-f.outerWidth(true)/2;break;case"ne":h=this.xpadding;break;case"e":h=this.xpadding;break;case"se":h=this.xpadding;break;case"s":h=-f.outerWidth(true)/2;break;case"sw":h=-f.outerWidth(true)-this.xpadding;break;case"w":h=-f.outerWidth(true)-this.xpadding;break;default:h=-f.outerWidth(true)-this.xpadding;break}return h};c.jqplot.PointLabels.prototype.yOffset=function(f,e,g){e=e||this.location;g=g||this.xpadding;var h;switch(e){case"nw":h=-f.outerHeight(true)-this.ypadding;break;case"n":h=-f.outerHeight(true)-this.ypadding;break;case"ne":h=-f.outerHeight(true)-this.ypadding;break;case"e":h=-f.outerHeight(true)/2;break;case"se":h=this.ypadding;break;case"s":h=this.ypadding;break;case"sw":h=this.ypadding;break;case"w":h=-f.outerHeight(true)/2;break;default:h=-f.outerHeight(true)-this.ypadding;break}return h};c.jqplot.PointLabels.draw=function(x,j,v){var t=this.plugins.pointLabels;t.setLabels.call(this);for(var w=0;w<t._elems.length;w++){t._elems[w].emptyForce()}t._elems.splice(0,t._elems.length);if(t.show){var r="_"+this._stackAxis+"axis";if(!t.formatString){t.formatString=this[r]._ticks[0].formatString;t.formatter=this[r]._ticks[0].formatter}var D=this._plotData;var A=this._xaxis;var q=this._yaxis;var z,f;for(var w=0,u=t._labels.length;w<u;w++){var o=t._labels[w];if(t.hideZeros&&parseInt(t._labels[w],10)==0){o=""}if(o!=null){o=t.formatter(t.formatString,o)}f=document.createElement("div");t._elems[w]=c(f);z=t._elems[w];z.addClass("jqplot-point-label jqplot-series-"+this.index+" jqplot-point-"+w);z.css("position","absolute");z.insertAfter(x.canvas);if(t.escapeHTML){z.text(o)}else{z.html(o)}var g=t.location;if((this.fillToZero&&D[w][1]<0)||(this.fillToZero&&this._type==="bar"&&this.barDirection==="horizontal"&&D[w][0]<0)||(this.waterfall&&parseInt(o,10))<0){g=b[d[g]]}var n=A.u2p(D[w][0])+t.xOffset(z,g);var h=q.u2p(D[w][1])+t.yOffset(z,g);if(this.renderer.constructor==c.jqplot.BarRenderer){if(this.barDirection=="vertical"){n+=this._barNudge}else{h-=this._barNudge}}z.css("left",n);z.css("top",h);var k=n+z.width();var s=h+z.height();var C=t.edgeTolerance;var e=c(x.canvas).position().left;var y=c(x.canvas).position().top;var B=x.canvas.width+e;var m=x.canvas.height+y;if(n-C<e||h-C<y||k+C>B||s+C>m){z.remove()}z=null;f=null}}};c.jqplot.postSeriesInitHooks.push(c.jqplot.PointLabels.init);c.jqplot.postDrawSeriesHooks.push(c.jqplot.PointLabels.draw)})(jQuery); \ No newline at end of file diff --git a/www/protected/models/Candidato.php b/www/protected/models/Candidato.php index 9a9d7a8..80981d2 100644 --- a/www/protected/models/Candidato.php +++ b/www/protected/models/Candidato.php @@ -213,7 +213,7 @@ class Candidato extends CActiveRecord 'titulaciones' => array(self::HAS_MANY, 'CandidatoTitulacion', 'candidato_id'), 'titulacionesCount' => array(self::STAT, 'CandidatoTitulacion', 'candidato_id'), 'documentos' => array(self::HAS_MANY, 'CandidatoDocumento', 'candidato_id'), - 'documentosCount' => array(self::STAT, 'CandidatoDocumento', 'candidato_id'), + 'documentosCount' => array(self::STAT, 'CandidatoDocumento', 'candidato_id'), ); } @@ -271,27 +271,44 @@ class Candidato extends CActiveRecord $criteria->together = true; $criteria->compare('t.id',$this->id); - $criteria->compare('id_estado',$this->id_estado); - $criteria->compare('estado',$this->estado); - $criteria->compare('dni',$this->dni,true); - $criteria->compare('nombre',$this->nombre,true); - $criteria->compare('apellidos',$this->apellidos,true); - $criteria->compare('email',$this->email,true); - $criteria->compare('telefono_fijo',$this->telefono_fijo,true); - $criteria->compare('telefono_movil',$this->telefono_movil,true); + $criteria->compare('t.id_estado',$this->id_estado); + $criteria->compare('t.estado',$this->estado); + $criteria->compare('t.dni',$this->dni,true); + $criteria->compare('t.nombre',$this->nombre,true); + $criteria->compare('t.apellidos',$this->apellidos,true); + $criteria->compare('t.email',$this->email,true); + $criteria->compare('t.telefono_fijo',$this->telefono_fijo,true); + $criteria->compare('t.telefono_movil',$this->telefono_movil,true); $criteria->addSearchCondition('concat(nombre, " ", apellidos)', $this->nombreCompleto); $criteria->compare( 'capacidades.perfil_tecnico_id', $this->capacidad_tecnica_search, true ); - //$criteria->compare( 'capacidades.capacidadesFuncionales.perfil_funcional_id', $this->capacidad_funcional_search, true ); - $sort = new CSort; - $sort->defaultOrder = 'nombre, apellidos ASC'; + + $sort = new CSort(); + $sort->attributes = array( + 'defaultOrder' => '', + 'estado' => array( + 'asc' => 't.id_estado', + 'desc' => 't.id_estado desc', + ), + 'fecha_modificacion' => array( + 'asc' => 't.fecha_modificacion', + 'desc' => 't.fecha_modificacion desc', + ), + 'nombreCompleto' => array( + 'asc' => 'concat(t.nombre, " ", t.apellidos)', + 'desc' => 'concat(t.nombre, " ", t.apellidos) desc', + ), + 'capacidad_tecnica_search' => array( + 'asc' => 'capacidades.perfil_tecnico_id', + 'desc' => 'capacidades.perfil_tecnico_id desc', + ), + ); return new CActiveDataProvider($this, array( 'criteria' => $criteria, 'sort' => $sort, )); - } protected function beforeValidate() { diff --git a/www/protected/models/Tablero.php b/www/protected/models/Tablero.php new file mode 100644 index 0000000..c404a4f --- /dev/null +++ b/www/protected/models/Tablero.php @@ -0,0 +1,78 @@ +<?php + +/** + * Modelo para el tablero + * + */ +class Tablero extends CModel { + + private function getActividadPortlet() { + $model=new Candidato('search'); + + $portlet = array( + 'id' => 'actividad_candidatos', + 'header' => 'Resumen de actividad de candidatos (últimos 7 días)', + 'content' => array( + 'model' => $model + ) + ); + return $portlet; + } + + private function getSituacionCandidatosPortlet() { + $candidatos = new Candidato('search'); + + $total = $candidatos->count(); + + $portlet = array( + 'id' => 'situacion_candidatos', + 'header' => 'Situación actual', + 'content' => array( + 'total' => $total + ) + ); + return $portlet; + } + + + /** + * + * @return array lista de portlets del tablero + */ + public function getPortlets() { + $portlets = array(); + $portlets['actividad_candidatos'] = $this->getActividadPortlet(); + $portlets['situacion_candidatos'] = $this->getSituacionCandidatosPortlet(); + + return $portlets; + } + + /** + * Returns the list of attribute names. + * By default, this method returns all public properties of the class. + * You may override this method to change the default. + * @return array list of attribute names. Defaults to all public properties of the class. + */ + public function attributeNames() + { + $className=get_class($this); + if(!isset(self::$_names[$className])) + { + $class=new ReflectionClass(get_class($this)); + $names=array(); + foreach($class->getProperties() as $property) + { + $name=$property->getName(); + if($property->isPublic() && !$property->isStatic()) + $names[]=$name; + } + return self::$_names[$className]=$names; + } + else + return self::$_names[$className]; + } +} + + + +?> diff --git a/www/protected/views/candidato/index.php b/www/protected/views/candidato/index.php index c58ec49..e5c9d05 100644 --- a/www/protected/views/candidato/index.php +++ b/www/protected/views/candidato/index.php @@ -154,6 +154,9 @@ $this->endWidget('zii.widgets.jui.CJuiDialog'); 'name' => 'capacidad_tecnica_search', 'value'=> array($this, 'gridDataColumnCapacidadTecnica'), 'header' => 'Capacidad técnica', + 'headerHtmlOptions'=>array( + 'class' => 'head1 sorting', + ), // 'filter' => CHtml::listData(PerfilTecnico::model()->findAll(), 'id', 'descripcion'), 'cssClassExpression' => '"con0"', ), @@ -162,7 +165,7 @@ $this->endWidget('zii.widgets.jui.CJuiDialog'); 'type'=>'raw', 'name' => 'estado', 'headerHtmlOptions'=>array( - 'class' => 'head1 sorting', + 'class' => 'head0 sorting', ), 'cssClassExpression' => '"con0"', 'value'=> 'CHtml::ajaxLink( @@ -187,7 +190,7 @@ $this->endWidget('zii.widgets.jui.CJuiDialog'); 'name' => 'fecha_modificacion', 'value' => '($data->fecha_modificacion === NULL) ? CHtml::tag("span", array("class"=>"nodata"), "Nunca") : Time::timeAgoInWords($data->fecha_modificacion);', 'headerHtmlOptions'=>array( - 'class' => 'head0 sorting', + 'class' => 'head1 sorting', ), 'cssClassExpression' => '"con1"', ), diff --git a/www/protected/views/layouts/tablero.php b/www/protected/views/layouts/tablero.php index 018a826..e6f7507 100644 --- a/www/protected/views/layouts/tablero.php +++ b/www/protected/views/layouts/tablero.php @@ -1,10 +1,24 @@ +<?php + $baseUrl = Yii::app()->baseUrl; + $cs = Yii::app()->clientScript; + + $cs->coreScriptPosition=CClientScript::POS_HEAD; + $cs->scriptMap = array(); + + $cs->registerCoreScript('jquery'); + $cs->registerCoreScript('jquery.ui'); + $cs->registerScriptFile($baseUrl.'/js/custom/general.js'); + + $cs->registerCssFile($baseUrl.'/css/style.css'); + $cs->registerCssFile($baseUrl.'/css/plugins/jquery-ui.css'); +?> + <!doctype html> <html xmlns="http://www.w3.org/1999/xhtml" xml:lang="<?php echo Yii::app()->language; ?>" lang="<?php echo Yii::app()->language; ?>"> <head> <meta http-equiv="Content-Type" content="text/html; charset=utf-8" /> <meta name="language" content="<?php echo Yii::app()->language; ?>" /> - <link rel="stylesheet" media="screen" href="<?php echo Yii::app()->baseUrl; ?>/css/style.css" /> <!--[if IE 9]> <link rel="stylesheet" media="screen" href="<?php echo Yii::app()->baseUrl; ?>/css/ie9.css"/> <![endif]--> @@ -16,9 +30,6 @@ <!--[if IE 7]> <link rel="stylesheet" media="screen" href="<?php echo Yii::app()->baseUrl; ?>/css/ie7.css"/> <![endif]--> - <script type="text/javascript" src="<?php echo Yii::app()->baseUrl; ?>/js/plugins/jquery-1.7.min.js"></script> - <script type="text/javascript" src="<?php echo Yii::app()->baseUrl; ?>/js/plugins/jquery-ui-1.8.16.custom.min.js"></script> - <script type="text/javascript" src="<?php echo Yii::app()->baseUrl; ?>/js/custom/general.js"></script> <title><?php echo CHtml::encode($this->pageTitle); ?> diff --git a/www/protected/views/site/portlets/actividad_candidatos.php b/www/protected/views/site/portlets/actividad_candidatos.php new file mode 100644 index 0000000..4373854 --- /dev/null +++ b/www/protected/views/site/portlets/actividad_candidatos.php @@ -0,0 +1,15 @@ + + +

    6 candidatos: han pasado a estado (Borrador) en la última semana

    +

    3 candidatos: han pasado a estado (Sin capacidades) en la última semana

    +

    2 candidatos: han pasado a estado (Rechazados) en la última semana

    +

    1 candidatos: han pasado a estado (Si más adelante) en la última semana

    +

    15 candidatos: han pasado a estado (En proceso: disponible) en la última semana

    +

    7 candidatos: han pasado a estado (En proceso: disponible asignado) en la última semana

    +

    1 candidatos: han pasado a estado (Otras provincias) en la última semana

    + +
    +
    + diff --git a/www/protected/views/site/portlets/situacion_candidatos.php b/www/protected/views/site/portlets/situacion_candidatos.php new file mode 100644 index 0000000..988a073 --- /dev/null +++ b/www/protected/views/site/portlets/situacion_candidatos.php @@ -0,0 +1,21 @@ + + + +

    1#candidatos existentes', $total); ?>

    +
    + +
    +

    Borrador (19)

    +

    Sin capacidades (43)

    +

    En proceso: disponible (626)

    +

    En proceso: disponible asignado (218)

    +
    + +
    +

    Rechazados (35)

    +

    Si más adelante (67)

    +

    Otras provincias (70)

    +
    + diff --git a/www/protected/views/site/tablero.php b/www/protected/views/site/tablero.php index 94706f3..00dd1ae 100644 --- a/www/protected/views/site/tablero.php +++ b/www/protected/views/site/tablero.php @@ -1,41 +1,37 @@ clientScript->registerScriptFile(Yii::app()->baseUrl . '/js/plugins/jquery.flot.min.js'); +//Yii::app()->clientScript->registerScriptFile(Yii::app()->baseUrl . '/js/plugins/jquery.flot.min.js'); Yii::app()->clientScript->registerScriptFile(Yii::app()->baseUrl . '/js/custom/dashboard.js'); + ?> -
    -
    +widget('application.extensions.dashboard.dashboard', array( + 'divColumns' => array('dash-column1', 'dash-column2'),// Css class names of DIV columns + 'dashHeader' => array('show'=>true, 'title'=>'Dashboard')// Dashboard header options +)); + +// Adding portlets to each column +// These column1,column2,column3 css classes are defined in dasboard/assests/css/dasboard.css +// You can define your own columns and assign here also define them in above "divColumns" array as well +// EXAMPLE 1 +// ===================== + +$actividad_7dias = ' +

    6 candidatos: han pasado a estado (Borrador) en la última semana

    +

    3 candidatos: han pasado a estado (Sin capacidades) en la última semana

    +

    2 candidatos: han pasado a estado (Rechazados) en la última semana

    +

    1 candidatos: han pasado a estado (Si más adelante) en la última semana

    +

    15 candidatos: han pasado a estado (En proceso: disponible) en la última semana

    +

    7 candidatos: han pasado a estado (En proceso: disponible asignado) en la última semana

    +

    1 candidatos: han pasado a estado (Otras provincias) en la última semana

    -
    - - ¡¡¡¡ ESTE TABLERO ES UN EJEMPLO !!!! -
    +
    +
    +'; - -
    -

    RESUMEN DE ACTIVIDAD DE CANDIDATOS (últimos 7 días)

    -
    - -

    6 candidatos: han pasado a estado (Borrador) en la última semana

    -

    3 candidatos: han pasado a estado (Sin capacidades) en la última semana

    -

    2 candidatos: han pasado a estado (Rechazados) en la última semana

    -

    1 candidatos: han pasado a estado (Si más adelante) en la última semana

    -

    15 candidatos: han pasado a estado (En proceso: disponible) en la última semana

    -

    7 candidatos: han pasado a estado (En proceso: disponible asignado) en la última semana

    -

    1 candidatos: han pasado a estado (Otras provincias) en la última semana

    - -
    -
    - -
    -
    - -
    -

    RESUMEN DE ACTIVIDAD DE GERENTES (últimos 7 días)

    -
    - - -
    +$actividad_gerentes = ' +
    - +'; -
    -
    +$situacion_actual = ' +

    1.078 candidatos existentes

    +
    - - - -
    -
    +
    +

    Borrador (19)

    +

    Sin capacidades (43)

    +

    En proceso: disponible (626)

    +

    En proceso: disponible asignado (218)

    +
    -
    -
    - -
    -

    SITUACIÓN ACTUAL

    - -
    - -

    1.078 candidatos existentes

    -
    - -
    -

    Borrador (19)

    -

    Sin capacidades (43)

    -

    En proceso: disponible (626)

    -

    En proceso: disponible asignado (218)

    -
    - -
    -

    Rechazados (35)

    -

    Si más adelante (67)

    -

    Otras provincias (70)

    - -
    - - -
    -
    - -
    -

    Gráfica

    -
    +
    +

    Rechazados (35)

    +

    Si más adelante (67)

    +

    Otras provincias (70)

    +
    +'; +$grafica = '
    Borrador (2%)
    @@ -139,20 +111,58 @@ Yii::app()->clientScript->registerScriptFile(Yii::app()->baseUrl . '/js/custom/d Otras provincias (10%)
    +'; -
    -
    +$imagen_src = Yii::app()->baseURL . "/images/assets/image1.png"; +$imagen = + '

    Sed ut perspiciatis unde omnis iste natus error sit voluptatem accusantium doloremque laudantium, totam rem aperiam. Sed ut perspiciatis unde omnis iste natus error sit voluptatem accusantium.

    +'; +$portlets = $tablero->portlets; -
    -

    Widget Box 2

    -
    +?> -

    Sed ut perspiciatis unde omnis iste natus error sit voluptatem accusantium doloremque laudantium, totam rem aperiam. Sed ut perspiciatis unde omnis iste natus error sit voluptatem accusantium.

    -
    -
    +
    +
    +
    + + ¡¡¡¡ ESTE TABLERO ES UN EJEMPLO !!!! +
    -
    -
    + addPortlet( + $portlet['id'], + $portlet['header'], + $this->renderPartial('portlets/'.$portlet['id'], $portlet['content'], true) + ); + } + + ?> + addPortlet('actividad_gerentes', 'RESUMEN DE ACTIVIDAD DE GERENTES (últimos 7 días)', $actividad_gerentes);?> +
    +
    + +
    +
    + addPortlet( + $portlet['id'], + $portlet['header'], + $this->renderPartial('portlets/'.$portlet['id'], $portlet['content'], true) + ); + } + + ?> + addPortlet('grafica', 'Gráfica', $grafica);?> + addPortlet('imagen', 'Imagen', $imagen);?> +
    +
    + +end()?>
    \ No newline at end of file